diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..1c12731 --- /dev/null +++ b/.gitignore @@ -0,0 +1,34 @@ + +# OS generated files # +###################### +.DS_Store +.DS_Store? +._* +.Spotlight-V100 +.Trashes +ehthumbs.db +Thumbs.db + +# mousepad shit # +*.*~ + +#### JEKYLL +_site/ +.sass-cache/ +.jekyll-cache/ +.jekyll-metadata +_data/.~lock.*.csv + +## vcode +.vscode +.vscode/* + +## No cover artwork or Mp3 +*.mp3 +assets/albums/ + +# No Media Symbolic links +media + +# See if cloudcannon renders plugin +_data/pleroma.json \ No newline at end of file diff --git a/404.html b/404.html new file mode 100644 index 0000000..661a997 --- /dev/null +++ b/404.html @@ -0,0 +1,9 @@ +--- +layout: 404page +title: Error 404 This is not a page +description: The page you are looking for has moved to the darknet. +image: /images/pages/creds.jpg +video_path: /videos/37th--chamber.mp4 +permalink: /404/ +sitemap: false +--- diff --git a/Gemfile b/Gemfile new file mode 100644 index 0000000..8559860 --- /dev/null +++ b/Gemfile @@ -0,0 +1,13 @@ +source 'https://rubygems.org' + +gem 'jekyll', '4.1.1' + +group :jekyll_plugins do + gem 'jekyll-sitemap' + gem 'jekyll-last-modified-at' + gem 'jekyll-image-size' + gem "json" + gem "activesupport" +end + +gem "webrick", "~> 1.7" diff --git a/Gemfile.lock b/Gemfile.lock new file mode 100644 index 0000000..04667ce --- /dev/null +++ b/Gemfile.lock @@ -0,0 +1,93 @@ +GEM + remote: https://rubygems.org/ + specs: + activesupport (7.0.4) + concurrent-ruby (~> 1.0, >= 1.0.2) + i18n (>= 1.6, < 2) + minitest (>= 5.1) + tzinfo (~> 2.0) + addressable (2.8.1) + public_suffix (>= 2.0.2, < 6.0) + colorator (1.1.0) + concurrent-ruby (1.1.10) + em-websocket (0.5.3) + eventmachine (>= 0.12.9) + http_parser.rb (~> 0) + eventmachine (1.2.7) + fastimage (2.2.6) + ffi (1.15.5) + forwardable-extended (2.6.0) + http_parser.rb (0.8.0) + i18n (1.12.0) + concurrent-ruby (~> 1.0) + jekyll (4.1.1) + addressable (~> 2.4) + colorator (~> 1.0) + em-websocket (~> 0.5) + i18n (~> 1.0) + jekyll-sass-converter (~> 2.0) + jekyll-watch (~> 2.0) + kramdown (~> 2.1) + kramdown-parser-gfm (~> 1.0) + liquid (~> 4.0) + mercenary (~> 0.4.0) + pathutil (~> 0.9) + rouge (~> 3.0) + safe_yaml (~> 1.0) + terminal-table (~> 1.8) + jekyll-image-size (1.2.1) + fastimage (>= 1.8) + jekyll (>= 3.7) + jekyll-last-modified-at (1.3.0) + jekyll (>= 3.7, < 5.0) + posix-spawn (~> 0.3.9) + jekyll-sass-converter (2.2.0) + sassc (> 2.0.1, < 3.0) + jekyll-sitemap (1.4.0) + jekyll (>= 3.7, < 5.0) + jekyll-watch (2.2.1) + listen (~> 3.0) + json (2.6.2) + kramdown (2.4.0) + rexml + kramdown-parser-gfm (1.1.0) + kramdown (~> 2.0) + liquid (4.0.3) + listen (3.7.1) + rb-fsevent (~> 0.10, >= 0.10.3) + rb-inotify (~> 0.9, >= 0.9.10) + mercenary (0.4.0) + minitest (5.16.3) + pathutil (0.16.2) + forwardable-extended (~> 2.6) + posix-spawn (0.3.15) + public_suffix (5.0.0) + rb-fsevent (0.11.2) + rb-inotify (0.10.1) + ffi (~> 1.0) + rexml (3.2.5) + rouge (3.30.0) + safe_yaml (1.0.5) + sassc (2.4.0) + ffi (~> 1.9) + terminal-table (1.8.0) + unicode-display_width (~> 1.1, >= 1.1.1) + tzinfo (2.0.5) + concurrent-ruby (~> 1.0) + unicode-display_width (1.8.0) + webrick (1.7.0) + +PLATFORMS + x86_64-linux + +DEPENDENCIES + activesupport + jekyll (= 4.1.1) + jekyll-image-size + jekyll-last-modified-at + jekyll-sitemap + json + webrick (~> 1.7) + +BUNDLED WITH + 2.3.23 diff --git a/LICENSE b/LICENSE new file mode 100644 index 0000000..cfac67e --- /dev/null +++ b/LICENSE @@ -0,0 +1,28 @@ +This is free and unencumbered software released into the public domain applied to +the code written by Sakrecoer. Code present in this repository written by other +people will be subject to their own licensing-model respectfully, with credit +served where credits are due. + +Anyone is free to copy, modify, publish, use, compile, sell, or distribute the +software written by Sakrecoer, either in source code form or as a compiled binary, +for any purpose, commercial or non-commercial, and by any means. + +In jurisdictions that recognize copyright laws, the author or authors +of this software dedicate any and all copyright interest in the +software to the public domain. We make this dedication for the benefit +of the public at large and to the detriment of our heirs and +successors. We intend this dedication to be an overt act of +relinquishment in perpetuity of all present and future rights to this +software under copyright law. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +For more information, please refer to + + diff --git a/README.md b/README.md new file mode 100644 index 0000000..846fbcc --- /dev/null +++ b/README.md @@ -0,0 +1,2 @@ +# setto.basspistol.com +Webiste for To Setto Setto \ No newline at end of file diff --git a/_albums/cyber-grany.md b/_albums/cyber-grany.md new file mode 100644 index 0000000..fbf6e01 --- /dev/null +++ b/_albums/cyber-grany.md @@ -0,0 +1,228 @@ +--- +layout: album +slug: cyber-grany +name: Cyber Grany +artists: + - 徒 Setto セット + - 徒 setto セット +bitrate: 128000 +trackCount: 2 +cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg +date: 2019-1-1 +tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + audio: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + slug: cyber-grany/1-grandma-got-the-ssh-keys-insutrmental- + albumSlug: cyber-grany + trackSlug: 1-grandma-got-the-ssh-keys-insutrmental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8910720 + duration: 202.05714285714285 + native: + ID3v2.3: + - id: TIT2 + value: Grandma got the SSH keys (Insutrmental) + - id: TPE1 + value: 徒 Setto セット + - id: TRCK + value: 1/2 + - id: TALB + value: Cyber Grany + - id: TPE2 + value: To Setto Setto + - id: TCON + value: Acid Trap + - id: 'TXXX:CDDB DiscID' + value: 0200ca01 + - id: 'TXXX:discid' + value: 0200ca01 + - id: 'TXXX:MusicBrainz DiscID' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: 'TXXX:musicbrainz_discid' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: COMM + value: + language: xxx + description: WEBSITE + text: 'https://setto.basspistol.com' + - id: COMM + value: + language: xxx + description: Comment + text: Special track for Acid December 2019 + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: 2 + disk: + 'no': null + of: null + title: Grandma got the SSH keys (Insutrmental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Cyber Grany + albumartist: To Setto Setto + genre: + - Acid Trap + comment: + - 'https://setto.basspistol.com' + - Special track for Acid December 2019 + year: 2019 + transformed: + ID3v2.3: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' + all: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + audio: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + slug: cyber-grany/2-grand-ma-is-a-cyborg-now + albumSlug: cyber-grany + trackSlug: 2-grand-ma-is-a-cyborg-now + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + cover: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9568512 + duration: 199.344 + native: + ID3v2.3: + - id: TIT2 + value: Grand'ma Is A Cyborg Now + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Cyber Grany + - id: TRCK + value: 2/2 + - id: TCON + value: Acid Trap + - id: TPE2 + value: To Setto Setto + - id: USLT + value: &ref_0 + language: eng + description: '' + text: |- + Got a friend request from my grandma + But she spelled her name with an O + Felt like it came from Futurama + but I know my OP-sec yo! + + Background check just didn't add up + Family tree is kind of messy + So I called her up + She loled out loud and said: hey sweetie! + + Why is it that you never call me? + Good thing I went through the zuck + Although I think it's kind of shitty + I simply had to try my luck + + Do I know what it does to democracy? + How come we have to be registered? + How can this promote any liberty? + If all we do in it is monitored? + + So many questions and all valid, + She checked all my OP-sec control + 94 years old and vivid + Holding strong her grandma role. + + She said next time we go for a stroll + I'll get to see her augmentation: + A 2kg aluminum walker-roll + A marvelous invention! + - id: TYER + value: '2020' + quality: + warnings: [] + common: + track: + 'no': 2 + of: 2 + disk: + 'no': null + of: null + title: Grand'ma Is A Cyborg Now + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Cyber Grany + genre: + - Acid Trap + albumartist: To Setto Setto + year: 2020 + transformed: + ID3v2.3: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' + all: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' +--- diff --git a/_albums/darkweb.md b/_albums/darkweb.md new file mode 100644 index 0000000..0a6505b --- /dev/null +++ b/_albums/darkweb.md @@ -0,0 +1,614 @@ +--- +layout: album +slug: darkweb +name: Darkweb +artists: 徒 Setto セット +bitrate: 128000 +trackCount: 4 +cover: /assets/albums/darkweb/1-swipe.jpeg +date: 2019-1-1 +tracks: + - path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.mp3 + audio: /assets/albums/darkweb/1-swipe.mp3 + slug: darkweb/1-swipe + albumSlug: darkweb + trackSlug: 1-swipe + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.jpeg + cover: /assets/albums/darkweb/1-swipe.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12388608 + duration: 280.9208163265306 + native: + ID3v2.3: + - id: TIT2 + value: Swipe + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: Swipe + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + - path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.mp3 + audio: /assets/albums/darkweb/2-darkweb.mp3 + slug: darkweb/2-darkweb + albumSlug: darkweb + trackSlug: 2-darkweb + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.jpeg + cover: /assets/albums/darkweb/2-darkweb.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12566016 + duration: 284.94367346938776 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + - id: TCON + value: Cypher Rap + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Darkweb + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + all: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.mp3 + audio: /assets/albums/darkweb/3-swipe-instrumental-.mp3 + slug: darkweb/3-swipe-instrumental- + albumSlug: darkweb + trackSlug: 3-swipe-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.jpeg + cover: /assets/albums/darkweb/3-swipe-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12436992 + duration: 282.0179591836735 + native: + ID3v2.3: + - id: TIT2 + value: Swipe (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '3' + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: + - message: Illegal ID3v2 tag length + common: + track: + 'no': 3 + of: null + disk: + 'no': null + of: null + title: Swipe (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.mp3 + audio: /assets/albums/darkweb/4-darkweb-instrumental-.mp3 + slug: darkweb/4-darkweb-instrumental- + albumSlug: darkweb + trackSlug: 4-darkweb-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.jpeg + cover: /assets/albums/darkweb/4-darkweb-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12526848 + duration: 284.05551020408166 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: '' + - id: TALB + value: Darkweb + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cypher Rap + - id: TRCK + value: '4' + - id: COMM + value: + language: XXX + description: Comment + text: Cover art and music by To Setto Setto + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 4 + of: null + disk: + 'no': null + of: null + title: Darkweb (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - '' + - Cover art and music by To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' + all: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +--- diff --git a/_albums/little-bug-ep.md b/_albums/little-bug-ep.md new file mode 100644 index 0000000..0638f36 --- /dev/null +++ b/_albums/little-bug-ep.md @@ -0,0 +1,383 @@ +--- +layout: album +slug: little-bug-ep +name: Little Bug EP +artists: + - 徒 Setto セット + - Randulo +bitrate: 192000 +trackCount: 2 +cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg +date: 2021-1-1 +tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.mp3 + audio: /assets/albums/little-bug-ep/1-ding-ding-world.mp3 + slug: little-bug-ep/1-ding-ding-world + albumSlug: little-bug-ep + trackSlug: 1-ding-ding-world + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.jpeg + cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 9355392 + duration: 212.1404081632653 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Ding Ding World + - id: TRCK + value: '1' + - id: COMM + value: &ref_0 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: '' + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: bc760d71-a92d-44a4-8cae-907b26de8947 + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - '' + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Ding Ding World + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.mp3 + audio: /assets/albums/little-bug-ep/2-little-bug.mp3 + slug: little-bug-ep/2-little-bug + albumSlug: little-bug-ep + trackSlug: 2-little-bug + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.jpeg + cover: /assets/albums/little-bug-ep/2-little-bug.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 6884352 + duration: 156.1077551020408 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Little Bug + - id: TRCK + value: '2' + - id: COMM + value: &ref_1 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: Randulo + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: 7a4ff716-7305-47d2-81b5-2689f1846cdd + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: fbb7ab99-ab85-4dea-be4d-282692d0050d + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - Randulo + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Little Bug + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +--- diff --git a/_albums/live-with-hardware.md b/_albums/live-with-hardware.md new file mode 100644 index 0000000..7431eae --- /dev/null +++ b/_albums/live-with-hardware.md @@ -0,0 +1,89 @@ +--- +layout: album +slug: live-with-hardware +name: Live with hardware +artists: 徒 Setto セット +bitrate: 192000 +trackCount: 1 +cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg +date: 2020-4-20 +tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + audio: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + slug: live-with-hardware/1-ep-life-of-a-dudelini + albumSlug: live-with-hardware + trackSlug: 1-ep-life-of-a-dudelini + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + format: + tagTypes: + - ID3v2.4 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + tool: LAME3.100 + duration: 683.472 + native: + ID3v2.4: + - id: TIT2 + value: EP-Life of a Dudelini + - id: TPE1 + value: 徒 Setto セット + - id: TALB + value: Live with hardware + - id: COMM + value: &ref_0 + language: eng + description: '' + text: Live take + - id: TDRC + value: '2020-04-20' + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: EP-Life of a Dudelini + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Live with hardware + comment: + - Live take + year: 2020 + date: '2020-04-20' + genre: + - Cybersoul + transformed: + ID3v2.4: + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_0 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul + all: + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_0 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul +--- diff --git a/_albums/satoshi-mon-ami.md b/_albums/satoshi-mon-ami.md new file mode 100644 index 0000000..f176447 --- /dev/null +++ b/_albums/satoshi-mon-ami.md @@ -0,0 +1,191 @@ +--- +layout: album +slug: satoshi-mon-ami +name: Satoshi mon ami +artists: 徒 Setto セット +bitrate: 128000 +trackCount: 2 +cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg +date: 2018-1-1 +tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + audio: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + slug: satoshi-mon-ami/1-k-as-tu-fait-de-nous- + albumSlug: satoshi-mon-ami + trackSlug: 1-k-as-tu-fait-de-nous- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13433472 + duration: 304.6138775510204 + native: + ID3v2.3: + - id: TIT2 + value: K'as-tu fait de nous? + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: K'as-tu fait de nous? + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + audio: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + slug: satoshi-mon-ami/2-r-ve-de-toi + albumSlug: satoshi-mon-ami + trackSlug: 2-r-ve-de-toi + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + cover: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8195328 + duration: 185.83510204081634 + native: + ID3v2.3: + - id: TIT2 + value: Rêve de toi + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_1 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Rêve de toi + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' +--- diff --git a/_albums/unmet-dependencies.md b/_albums/unmet-dependencies.md new file mode 100644 index 0000000..801c26a --- /dev/null +++ b/_albums/unmet-dependencies.md @@ -0,0 +1,220 @@ +--- +layout: album +slug: unmet-dependencies +name: Unmet Dependencies +artists: 徒 setto セット +bitrate: 128000 +trackCount: 2 +cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg +date: 2020-1-1 +tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.mp3 + audio: /assets/albums/unmet-dependencies/1-dependency-error.mp3 + slug: unmet-dependencies/1-dependency-error + albumSlug: unmet-dependencies + trackSlug: 1-dependency-error + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.jpeg + cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13817088 + duration: 313.31265306122447 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Dependency Error + - id: USLT + value: &ref_0 + language: eng + description: '' + text: | + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + There is an error with my dependencies + Consultd 1.2 and emplyomentd 1.70 + I cannot pay my rent without their libraries + And to install I need to share my salary + Where do I fit in this society + The more I look and the less I see + They want no robots nor do they want me + Because work is a point in the agenda of the party + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + My liver isn't black market worthy + And my master degree from a street university + My ambitions are low and I am debt free + There is no room in the industry for robots like me + Don't get me wrong I would also like to be + Installed and running and compatible with society + But I am running a different library + Because my kernel is still libre and free + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Dependency Error + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.mp3 + audio: /assets/albums/unmet-dependencies/2-pingnu.mp3 + slug: unmet-dependencies/2-pingnu + albumSlug: unmet-dependencies + trackSlug: 2-pingnu + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.jpeg + cover: /assets/albums/unmet-dependencies/2-pingnu.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9795456 + duration: 222.1191836734694 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '2' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Pingnu + - id: USLT + value: &ref_1 + language: eng + description: '' + text: | + I’m a little Pingu, riding on a GNU. + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could take me in. + Your computer and i could change the world we’re in. + Your freedom is being diluted. + And your code is being polluted. + + I’m a big GNU with my little Pingu, + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could compute. + Your freedom is not to dilute, + Someone has taken your tool into dispute, + This is what together we should refute. + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Pingnu + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 +--- diff --git a/_authors/_defaults.md b/_authors/_defaults.md new file mode 100644 index 0000000..e31a8a0 --- /dev/null +++ b/_authors/_defaults.md @@ -0,0 +1,9 @@ +--- +name: +position: +image: +url_staff: +email: +gpg: +blurb_markup: +--- \ No newline at end of file diff --git a/_authors/setto.md b/_authors/setto.md new file mode 100644 index 0000000..9984242 --- /dev/null +++ b/_authors/setto.md @@ -0,0 +1,9 @@ +--- +name: 徒 setto セット +position: 'Information Musician' +image: /siteicon.png +url_staff: 'https://setto.basspistol.com' +email: 'setto@basspistol.com' +gpg: 'https://keyserver.ubuntu.com/pks/lookup?search=setto%40basspistol.com&fingerprint=on&op=index' +blurb_markup: 'Set, Party, Gang' +--- \ No newline at end of file diff --git a/_config.yml b/_config.yml new file mode 100644 index 0000000..d171956 --- /dev/null +++ b/_config.yml @@ -0,0 +1,190 @@ +title : 徒settoセット +description: 'Set, Party, Gang! #Cybersoul.' + +url: "https://setto.basspistol.com" # the base hostname & protocol for your site +permalink: /:categories/:title/ + +## jekyll excludes +exclude: + - changelog.md + - '*.*~' + - '*.xcf' + - '*.blend*' + - Gemfile + - Gemfile.lock + - README.md + - LICENCE +## SEO +geo: + timezone: "Europe/Switzerland" + lat: '46.203918' + long: '6.133011' + region: 'CH-GE' + town: 'Geneva' + country: 'Switzerland' + postalcode: '1201' +timezone: CET + +banner: /images/setto-logo.svg +banner-vert: /images/setto_logo.svg +icon: /images/setto-logoicon.svg +logo: /images/setto-logo.svg +logo-footer: /images/setto-logoicon-footer.svg +mediaurl: https://media.basspistol.com/setto.basspistol.com +#mediaurl: /media + +publisher: + name: Basspistol + domain: basspistol.com + mail: info@basspistol.com +social: + name: To Setto Setto + mail: setto@basspistol.com + links: + - https://twitter.com/ToSettoSetto + - https://instagram.com/ToSettoSetto + - https://s.basspistol.org/@setto + - https://www.facebook.com/徒-setto-セット-100627981795265 + usernames: + twitter: ToSettoSetto + telegram: tosettosetto + hashtag: basspistol + irc: + channel: '#tosettosetto' + guest-nick: anon + matrix: https://matrix.to/#/!YQcdVviFQNGYFMYrxD:matrix.org?via=matrix.org +## Matomo +matomo_site_id: '3' +matomo_container: 'fHO88MfH' +# defaults +categories: + - releases + - ramblings +tags: + - LP + - EP + - Single + +collections: + albums: + output: false + permalink: /albums/:name/ + _disable_add: true + tracks: + output: true + permalink: /:path/ + sort_by: common.year + _disable_add: true + authors: + output: false + +sass: + sass_dir: _sass + +defaults: + - scope: + path: "" + values: + lang: en + - scope: + path: "" + type: "tracks" + values: + layout: "track" + lang: en + seo: + type: "AudioObject" + _unlisted: true + - scope: + path: "" + type: "albums" + values: + layout: "album" + lang: en + seo: + type: "AudioObject" + _unlisted: true + - scope: + path: "" + type: "pages" + values: + layout: "default" + lang: en + _options: + image: + width: 1024 + height: 720 + resize_style: cover + uploads_dir: "/images/pages" + content: + width: 720 + height: 720 + resize_style: cover + uploads_dir: "/images/pages" + - scope: + path: "" + type: "posts" + values: + layout: "post" + lang: en + permalink: /:title/ + _options: + image: + width: 1024 + height: 720 + resize_style: cover + uploads_dir: "/images/posts" + content: + width: 720 + height: 720 + resize_style: cover + uploads_dir: "/images/posts" + video_path: + uploads_dir: "/videos" +# --------- +# Translate +lang: en + +### Cloud Cannon Settings + +_explore: + groups: + - heading: Content + collections: + - posts + - drafts + - pages + - heading: Other + collections: + - data + - authors + + + +plugins: +# - jekyll-pwa-plugin + - jekyll-image-size +plugins_dir: ./_plugins + +jekyll_xml: + - data: pleroma + source: https://t.basspistol.org/users/setto/feed.atom + cache: true + +# pwa: +# enabled: false # Optional +# sw_src_filepath: service-worker.js # Optional +# sw_dest_filename: service-worker.js # Optional +# dest_js_directory: assets/js # Required +# precache_recent_posts_num: 5 # Optional +# precache_glob_directory: / # Optional +# precache_glob_patterns: # Optional +# - "assets/{js,css,fonts}/**/*.{js,css,eot,svg,ttf,woff,png,jpg,jpeg}" +# - "videos/*{mp4,webm}" +# - "images/**/*.{svg}" +# - "images/posts/*.{jpg,jpeg,png}" +# - "images/pages/*.{jpg,jpeg,png}" +# - "assets/albums/**/*.{mp3,jpeg}" +# - index.html +# precache_glob_ignores: # Optional +# - sw-register.js diff --git a/_data/albums.yml b/_data/albums.yml new file mode 100644 index 0000000..017a497 --- /dev/null +++ b/_data/albums.yml @@ -0,0 +1,1751 @@ +- layout: album + slug: unmet-dependencies + name: Unmet Dependencies + artists: 徒 setto セット + bitrate: 128000 + trackCount: 2 + cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg + date: 2020-1-1 + tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.mp3 + audio: /assets/albums/unmet-dependencies/1-dependency-error.mp3 + slug: unmet-dependencies/1-dependency-error + albumSlug: unmet-dependencies + trackSlug: 1-dependency-error + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.jpeg + cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13817088 + duration: 313.31265306122447 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Dependency Error + - id: USLT + value: &ref_0 + language: eng + description: '' + text: | + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + There is an error with my dependencies + Consultd 1.2 and emplyomentd 1.70 + I cannot pay my rent without their libraries + And to install I need to share my salary + Where do I fit in this society + The more I look and the less I see + They want no robots nor do they want me + Because work is a point in the agenda of the party + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + My liver isn't black market worthy + And my master degree from a street university + My ambitions are low and I am debt free + There is no room in the industry for robots like me + Don't get me wrong I would also like to be + Installed and running and compatible with society + But I am running a different library + Because my kernel is still libre and free + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Dependency Error + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.mp3 + audio: /assets/albums/unmet-dependencies/2-pingnu.mp3 + slug: unmet-dependencies/2-pingnu + albumSlug: unmet-dependencies + trackSlug: 2-pingnu + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.jpeg + cover: /assets/albums/unmet-dependencies/2-pingnu.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9795456 + duration: 222.1191836734694 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '2' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Pingnu + - id: USLT + value: &ref_1 + language: eng + description: '' + text: | + I’m a little Pingu, riding on a GNU. + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could take me in. + Your computer and i could change the world we’re in. + Your freedom is being diluted. + And your code is being polluted. + + I’m a big GNU with my little Pingu, + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could compute. + Your freedom is not to dilute, + Someone has taken your tool into dispute, + This is what together we should refute. + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Pingnu + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 +- layout: album + slug: cyber-grany + name: Cyber Grany + artists: + - 徒 Setto セット + - 徒 setto セット + bitrate: 128000 + trackCount: 2 + cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + date: 2019-1-1 + tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + audio: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + slug: cyber-grany/1-grandma-got-the-ssh-keys-insutrmental- + albumSlug: cyber-grany + trackSlug: 1-grandma-got-the-ssh-keys-insutrmental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8910720 + duration: 202.05714285714285 + native: + ID3v2.3: + - id: TIT2 + value: Grandma got the SSH keys (Insutrmental) + - id: TPE1 + value: 徒 Setto セット + - id: TRCK + value: 1/2 + - id: TALB + value: Cyber Grany + - id: TPE2 + value: To Setto Setto + - id: TCON + value: Acid Trap + - id: 'TXXX:CDDB DiscID' + value: 0200ca01 + - id: 'TXXX:discid' + value: 0200ca01 + - id: 'TXXX:MusicBrainz DiscID' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: 'TXXX:musicbrainz_discid' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: COMM + value: + language: xxx + description: WEBSITE + text: 'https://setto.basspistol.com' + - id: COMM + value: + language: xxx + description: Comment + text: Special track for Acid December 2019 + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: 2 + disk: + 'no': null + of: null + title: Grandma got the SSH keys (Insutrmental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Cyber Grany + albumartist: To Setto Setto + genre: + - Acid Trap + comment: + - 'https://setto.basspistol.com' + - Special track for Acid December 2019 + year: 2019 + transformed: + ID3v2.3: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' + all: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + audio: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + slug: cyber-grany/2-grand-ma-is-a-cyborg-now + albumSlug: cyber-grany + trackSlug: 2-grand-ma-is-a-cyborg-now + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + cover: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9568512 + duration: 199.344 + native: + ID3v2.3: + - id: TIT2 + value: Grand'ma Is A Cyborg Now + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Cyber Grany + - id: TRCK + value: 2/2 + - id: TCON + value: Acid Trap + - id: TPE2 + value: To Setto Setto + - id: USLT + value: &ref_2 + language: eng + description: '' + text: |- + Got a friend request from my grandma + But she spelled her name with an O + Felt like it came from Futurama + but I know my OP-sec yo! + + Background check just didn't add up + Family tree is kind of messy + So I called her up + She loled out loud and said: hey sweetie! + + Why is it that you never call me? + Good thing I went through the zuck + Although I think it's kind of shitty + I simply had to try my luck + + Do I know what it does to democracy? + How come we have to be registered? + How can this promote any liberty? + If all we do in it is monitored? + + So many questions and all valid, + She checked all my OP-sec control + 94 years old and vivid + Holding strong her grandma role. + + She said next time we go for a stroll + I'll get to see her augmentation: + A 2kg aluminum walker-roll + A marvelous invention! + - id: TYER + value: '2020' + quality: + warnings: [] + common: + track: + 'no': 2 + of: 2 + disk: + 'no': null + of: null + title: Grand'ma Is A Cyborg Now + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Cyber Grany + genre: + - Acid Trap + albumartist: To Setto Setto + year: 2020 + transformed: + ID3v2.3: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_2 + TYER: '2020' + all: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_2 + TYER: '2020' +- layout: album + slug: darkweb + name: Darkweb + artists: 徒 Setto セット + bitrate: 128000 + trackCount: 4 + cover: /assets/albums/darkweb/1-swipe.jpeg + date: 2019-1-1 + tracks: + - path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.mp3 + audio: /assets/albums/darkweb/1-swipe.mp3 + slug: darkweb/1-swipe + albumSlug: darkweb + trackSlug: 1-swipe + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.jpeg + cover: /assets/albums/darkweb/1-swipe.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12388608 + duration: 280.9208163265306 + native: + ID3v2.3: + - id: TIT2 + value: Swipe + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: >- + Comme tous les après-midis, Assis dans le tram en face d'une + jolie vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: Swipe + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + - path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.mp3 + audio: /assets/albums/darkweb/2-darkweb.mp3 + slug: darkweb/2-darkweb + albumSlug: darkweb + trackSlug: 2-darkweb + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.jpeg + cover: /assets/albums/darkweb/2-darkweb.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12566016 + duration: 284.94367346938776 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + - id: TCON + value: Cypher Rap + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Darkweb + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + all: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.mp3 + audio: /assets/albums/darkweb/3-swipe-instrumental-.mp3 + slug: darkweb/3-swipe-instrumental- + albumSlug: darkweb + trackSlug: 3-swipe-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.jpeg + cover: /assets/albums/darkweb/3-swipe-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12436992 + duration: 282.0179591836735 + native: + ID3v2.3: + - id: TIT2 + value: Swipe (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '3' + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: + - message: Illegal ID3v2 tag length + common: + track: + 'no': 3 + of: null + disk: + 'no': null + of: null + title: Swipe (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.mp3 + audio: /assets/albums/darkweb/4-darkweb-instrumental-.mp3 + slug: darkweb/4-darkweb-instrumental- + albumSlug: darkweb + trackSlug: 4-darkweb-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.jpeg + cover: /assets/albums/darkweb/4-darkweb-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12526848 + duration: 284.05551020408166 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_3 + language: XXX + description: '' + text: '' + - id: TALB + value: Darkweb + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cypher Rap + - id: TRCK + value: '4' + - id: COMM + value: + language: XXX + description: Comment + text: Cover art and music by To Setto Setto + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 4 + of: null + disk: + 'no': null + of: null + title: Darkweb (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - '' + - Cover art and music by To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_3 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' + all: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_3 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +- layout: album + slug: little-bug-ep + name: Little Bug EP + artists: + - 徒 Setto セット + - Randulo + bitrate: 192000 + trackCount: 2 + cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg + date: 2021-1-1 + tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.mp3 + audio: /assets/albums/little-bug-ep/1-ding-ding-world.mp3 + slug: little-bug-ep/1-ding-ding-world + albumSlug: little-bug-ep + trackSlug: 1-ding-ding-world + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.jpeg + cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 9355392 + duration: 212.1404081632653 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Ding Ding World + - id: TRCK + value: '1' + - id: COMM + value: &ref_4 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: '' + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: bc760d71-a92d-44a4-8cae-907b26de8947 + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - '' + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Ding Ding World + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_4 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_4 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.mp3 + audio: /assets/albums/little-bug-ep/2-little-bug.mp3 + slug: little-bug-ep/2-little-bug + albumSlug: little-bug-ep + trackSlug: 2-little-bug + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.jpeg + cover: /assets/albums/little-bug-ep/2-little-bug.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 6884352 + duration: 156.1077551020408 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Little Bug + - id: TRCK + value: '2' + - id: COMM + value: &ref_5 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: Randulo + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: 7a4ff716-7305-47d2-81b5-2689f1846cdd + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: fbb7ab99-ab85-4dea-be4d-282692d0050d + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - Randulo + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Little Bug + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_5 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_5 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +- layout: album + slug: live-with-hardware + name: Live with hardware + artists: 徒 Setto セット + bitrate: 192000 + trackCount: 1 + cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + date: 2020-4-20 + tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + audio: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + slug: live-with-hardware/1-ep-life-of-a-dudelini + albumSlug: live-with-hardware + trackSlug: 1-ep-life-of-a-dudelini + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + format: + tagTypes: + - ID3v2.4 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + tool: LAME3.100 + duration: 683.472 + native: + ID3v2.4: + - id: TIT2 + value: EP-Life of a Dudelini + - id: TPE1 + value: 徒 Setto セット + - id: TALB + value: Live with hardware + - id: COMM + value: &ref_6 + language: eng + description: '' + text: Live take + - id: TDRC + value: '2020-04-20' + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: EP-Life of a Dudelini + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Live with hardware + comment: + - Live take + year: 2020 + date: '2020-04-20' + genre: + - Cybersoul + transformed: + ID3v2.4: + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_6 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul + all: + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_6 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul +- layout: album + slug: satoshi-mon-ami + name: Satoshi mon ami + artists: 徒 Setto セット + bitrate: 128000 + trackCount: 2 + cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + date: 2018-1-1 + tracks: + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + audio: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + slug: satoshi-mon-ami/1-k-as-tu-fait-de-nous- + albumSlug: satoshi-mon-ami + trackSlug: 1-k-as-tu-fait-de-nous- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13433472 + duration: 304.6138775510204 + native: + ID3v2.3: + - id: TIT2 + value: K'as-tu fait de nous? + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_7 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: K'as-tu fait de nous? + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_7 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_7 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' + - path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + audio: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + slug: satoshi-mon-ami/2-r-ve-de-toi + albumSlug: satoshi-mon-ami + trackSlug: 2-r-ve-de-toi + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + cover: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8195328 + duration: 185.83510204081634 + native: + ID3v2.3: + - id: TIT2 + value: Rêve de toi + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_8 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Rêve de toi + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_8 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_8 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' diff --git a/_data/colors.yml b/_data/colors.yml new file mode 100644 index 0000000..a3d2e8a --- /dev/null +++ b/_data/colors.yml @@ -0,0 +1,10 @@ +bg_rgba: 'rgb(60, 42, 82)' +bg-alt_rgba: 'rgba(60, 42, 82, 0.75)' +fg_rgba: 'rgb(235, 219, 248)' +fg-alt_rgba: 'rgba(235, 219, 248, 0.25)' +border_rgba: 'rgb(0, 0, 0)' +border-alt_rgba: 'rgba(0, 0, 0, 0.75)' +accent1_rgba: 'rgb(56, 255, 89)' +accent1-alt_rgba: 'rgba(56, 255, 89, 0.75)' +accent2_rgba: 'rgba(255, 145, 0, 1)' +accent2-alt_rgba: 'rgba(255, 145, 0, 0.75)' diff --git a/_data/links.yml b/_data/links.yml new file mode 100644 index 0000000..7cff1fe --- /dev/null +++ b/_data/links.yml @@ -0,0 +1,20 @@ +- title: Ritarn + url: http://ritarn.com + banner: + image: /images/links/ritarn.jpg +- title: Basspistol + url: https://basspistol.com + banner: + image: /images/links/basspistol.png +- title: Alsenet + url: http://www.alsenet.com/ + banner: + image: /images/links/cropped-logo_alsenet_pv-1-e1466347695561.png +- title: Linux Audio + url: https://www.linuxaudio.org/ + banner: + image: /images/links/Screenshot_20200908_202439.jpg +- title: Dyne + url: https://www.dyne.org/ + banner: + image: /images/links/Screenshot_20200908_202215.jpg \ No newline at end of file diff --git a/_data/navigation.yml b/_data/navigation.yml new file mode 100644 index 0000000..d5dec8a --- /dev/null +++ b/_data/navigation.yml @@ -0,0 +1,28 @@ +- icon: "\U0001F4BD" + url: '/discography' + name: Music + external_site: false +- icon: 🎬 + url: 'https://v.basspistol.org/accounts/setto/video-channels' + name: Video + external_site: true +- icon: "\U0001F4F0" + url: 'https://txt.basspistol.org/setto' + name: Blog + external_site: true +- icon: 📢 + url: 'https://s.basspistol.org/@setto' + name: Fedi + external_site: true +- icon: ㊙️ + url: /about/ + name: About + external_site: false +- name: Support + url: '#support' + icon: 🌮 + external: false +- icon: "\U0001F517" + url: /links/ + name: Links + external_site: false diff --git a/_data/social.yml b/_data/social.yml new file mode 100644 index 0000000..50960a7 --- /dev/null +++ b/_data/social.yml @@ -0,0 +1,31 @@ +--- +- name: Mastodon + url: 'https://s.basspistol.org/@setto' + icon: fa-mastodon + share_link: + we_have_account: true +- name: Telegram + url: 'https://t.me/tosettosetto' + icon: fa-telegram + share_link: >- + https://telegram.me/share/url?url={{ site.url }}{{ page.url }}&text={{ + page.description }}%20via%20@tosettosetto + we_have_account: true +- name: Reddit + url: 'https://www.reddit.com/r/basspistol' + icon: fa-reddit + share_link: >- + https://reddit.com/submit/?url={{ site.url }}{{ page.url }}&title={{ + page.title | xml_escape }} + we_have_account: true +- name: Peertube + url: 'https://v.basspistol.org/a/setto/' + icon: fa-youtube + share_link: + we_have_account: true +- name: Matrix + url: 'https://matrix.to/#/!YQcdVviFQNGYFMYrxD:matrix.org' + icon: fa-connectdevelop + share_link: + we_have_account: true +--- diff --git a/_data/stores.yml b/_data/stores.yml new file mode 100644 index 0000000..ba2b8cc --- /dev/null +++ b/_data/stores.yml @@ -0,0 +1,32 @@ +- name: Bandcamp + url: https://shop.basspistol.com + icon: fa-bandcamp + download: true +#- name: Spotify +# url: https://open.spotify.com/artist/0gus2IdSkfrvFDBPqeiksM/ +# icon: fa-spotify +# download: false +- name: Audius + url: https://audius.co/tosettosetto + icon: fa-creative-commons-sampling + download: false +#- name: Apple Music +# url: https://itunes.apple.com/us/artist/%E5%BE%92-setto-%E3%82%BB%E3%83%83%E3%83%88/1447055514 +# icon: fa-apple +# download: false +#- name: Google Play +# url: https://play.google.com/store/music/artist/%E5%BE%92_setto_%E3%82%BB%E3%83%83%E3%83%88?id=Ayi4avjpfyinbrepzebpsvpjc5a +# icon: fa-google-play +# download: false +#- name: Deezer +# url: https://www.deezer.com/fr/artist/56004012 +# icon: fa-deezer +# download: false +#- name: Napster +# url: https://us.napster.com/artist/-setto- +# icon: fa-napster +# download: false +- name: PeerTube + icon: fa-youtube + url: https://v.basspistol.org/accounts/setto/video-channels + download: false \ No newline at end of file diff --git a/_data/translations.yml b/_data/translations.yml new file mode 100644 index 0000000..7bb719c --- /dev/null +++ b/_data/translations.yml @@ -0,0 +1,52 @@ +en: + navigation: + - + read-post: 'Read post' + name: Name + lastname: Last name + email: E-mail + message: Message + privacy: 'I agree with the privacy policy.' + newsletter: I want the newsletter! + required: Required field + contact-us: Get in touch + contact: Contact + write-msg: Write your message... + send: Send Message + news: News + top: Back to top + cookies: >- +

I only use cookies if you consent to it. They don't contain any identifiable info: they just let me know if you enjoyed this enough to come back. +
Click here if you want this shit to go away without cookies. +
Read more about how me & basspistol use cookies +

+ cookie-agree: I'm in! + back: Take me back! + home: Home + post-nav: Read more posts + +sv: + navigation: + read-post: 'Läs post' + name: Namn + lastname: Efternamn + email: e-post + message: Meddelande + privacy: 'Jag godkänner sekretesspolicyn' + newsletter: Jag vill ha nyhetsutskick + required: Obligatoriskt fält + contact-us: Kontakta oss + contact: Kontakt + write-msg: Skriv ditt meddelande... + send: Skicka Meddelande + news: Nyheter + top: Tillbaka till toppen + cookies: >- +

Vi använder bara cookies om du går med på det. Hjälp oss förbättra våran marknadsföring! +
Klicka här om du inte vill hjälpa till +
Läs mer om hur vi använder cookies +

+ cookie-agree: Jag hjälper gärna! + back: Ta mig tillbaka! + home: Hem + post-nav: Läs fler inlägg \ No newline at end of file diff --git a/_drafts/2020-09-17-pushing-things-differently.md b/_drafts/2020-09-17-pushing-things-differently.md new file mode 100644 index 0000000..481215e --- /dev/null +++ b/_drafts/2020-09-17-pushing-things-differently.md @@ -0,0 +1,29 @@ +--- +title: Pushing things differently +author: setto +date: 2020-09-17 00:00:00 +description: >- + Embracing the mainstream networks and reaching out through sponsored content, + the underground is staging it's own isolation. +image: /images/posts/Screenshot_20200918_112312.jpg +video_path: /videos/37th--chamber.mp4 +category: ramblings +link: + url: + buttontext: +check_this_if_cannot_be_bought: true +album: +stores: + - name: + - url: + - icon: + - download: false +--- + +"I post what's on my mind, therefore I am".  The reflex is hard to avoid. The thumb swipes the screen by muscle-memory. A tiny but well oiled ritual. A digital routine. From the finger-tops we manipulate extensions that may not be attached to our bodies, yet at this point they are intrinsic part of ourselves. We want them, we need them and they keep needing replacement every each year or so. It's not so much the devices in themselves that suck us in, but the applications. What was meant to free us and facilitate our daily bullshit turned out to be alienating masters of complications. + +Love/hate relationship doesn't quite cut it as a descriptor though: most of us probably realize something isn't too right with these tools, but how many can explain what, how and why? Society is slowly becoming unavailable to the disconnected: socializing, dating, creating, communicating, paying, learning… everything goes through the wireless wires. In and out of the very real data-centers made of concrete and silicon, that we call "clouds". + +### But in the realm of the mind there is a choice: do i want to participate? + +  \ No newline at end of file diff --git a/_includes/_cookie-consent.html b/_includes/_cookie-consent.html new file mode 100644 index 0000000..062c424 --- /dev/null +++ b/_includes/_cookie-consent.html @@ -0,0 +1,60 @@ + + + + \ No newline at end of file diff --git a/_includes/analytics.js b/_includes/analytics.js new file mode 100644 index 0000000..3194c76 --- /dev/null +++ b/_includes/analytics.js @@ -0,0 +1,40 @@ +{% if page.url == '/404/' %} + +//* Matomo *// + +var _paq = window._paq = window._paq || []; +_paq.push(['setDocumentTitle', '404/URL = ' + encodeURIComponent(document.location.pathname+document.location.search) + '/From = ' + encodeURIComponent(document.referrer)]); +_paq.push(["setCookieDomain", "*.basspistol.com"]); +_paq.push(["setDomains", ["*.basspistol.org","*.basspistol.com","*.pauvrecoude.basspistol.com","*.paxnion.basspistol.com","*.radio.basspistol.com","*.sakrecoer.basspistol.com","*.sakrecoer.com","*.sethybowoy.basspistol.com","*.setto.basspistol.com","*.tfb.basspistol.com","*.v.basspistol.org"]]); +_paq.push(["enableCrossDomainLinking"]); +_paq.push(['trackPageView']); +_paq.push(['enableLinkTracking']); +(function() { + var u="https://terminalnetwork.matomo.cloud/"; + _paq.push(['setTrackerUrl', u+'matomo.php']); + _paq.push(['setSiteId', '{{ site.matomo_site_id }}']); + var d=document, g=d.createElement('script'), s=d.getElementsByTagName('script')[0]; + g.type='text/javascript'; g.async=true; g.src='https://cdn.matomo.cloud/terminalnetwork.matomo.cloud/matomo.js'; s.parentNode.insertBefore(g,s); +})(); +//* End Matomo *// + +{% else %} + + +var _paq = window._paq = window._paq || []; +_paq.push(["setDocumentTitle", document.domain + "/" + document.title]); +_paq.push(["setCookieDomain", "*.basspistol.com"]); +_paq.push(["setDomains", ["*.basspistol.org","*.basspistol.com","*.pauvrecoude.basspistol.com","*.paxnion.basspistol.com","*.radio.basspistol.com","*.sakrecoer.basspistol.com","*.sakrecoer.com","*.sethybowoy.basspistol.com","*.setto.basspistol.com","*.tfb.basspistol.com","*.v.basspistol.org"]]); +_paq.push(["enableCrossDomainLinking"]); +_paq.push(['trackPageView']); +_paq.push(['enableLinkTracking']); +(function() { + var u="https://terminalnetwork.matomo.cloud/"; + _paq.push(['setTrackerUrl', u+'matomo.php']); + _paq.push(['setSiteId', '{{ site.matomo_site_id }}']); + var d=document, g=d.createElement('script'), s=d.getElementsByTagName('script')[0]; + g.type='text/javascript'; g.async=true; g.src='https://cdn.matomo.cloud/terminalnetwork.matomo.cloud/matomo.js'; s.parentNode.insertBefore(g,s); +})(); + +{% endif %} + diff --git a/_includes/author.html b/_includes/author.html new file mode 100644 index 0000000..312ae08 --- /dev/null +++ b/_includes/author.html @@ -0,0 +1,34 @@ +{% assign author_id = page.author | prepend: "/authors/" | append: "/" %} +{% assign author = site.authors | where: "url", author_id | first %} +
+
+ + {% if page.collection == 'posts' %} +
+
+
+

{{ author.name }}

+

{{ author.position }}{% if author.gpg != nil %} | GPG{% endif %}

+

+ Published the + +

+ + {% endif %} +
+ + Share this page: +
+ +
+ {% unless page.url == '/radio/' %} +

🙏 Support

+ {% endunless %} +
+
\ No newline at end of file diff --git a/_includes/contact.html b/_includes/contact.html new file mode 100644 index 0000000..148db71 --- /dev/null +++ b/_includes/contact.html @@ -0,0 +1,47 @@ + +
+
+
+
+

Kontakta oss!

+
+ +
+
+ + + {% if page.url == '/fr-fretag/' %} + + + + + + + {% endif %} +
+
+
+ +
+
+
+ +
+
+
+ +
+
+
+ +
+
+
+
+ \ No newline at end of file diff --git a/_includes/dates.html b/_includes/dates.html new file mode 100644 index 0000000..c34c26c --- /dev/null +++ b/_includes/dates.html @@ -0,0 +1,21 @@ + + {% assign d = page.date | date: "%-d" %} + {% case d %} + {% when '1' or '21' or '31' %}{{ d }}:st + {% when '2' or '22' %}{{ d }}:nd + {% when '3' or '23' %}{{ d }}:rd + {% else %}{{ d }}:th + {% endcase %} of + {% assign m = page.date | date: "%-m" %} + {% case m %} + {% when '1' %}January + {% when '2' %}February + {% when '3' %}March + {% when '4' %}April + {% when '5' %}May + {% when '6' %}June + {% when '7' %}July + {% when '8' %}August + {% when '9' %}September {% when '10' %}October {% when '11' %}November {% when '12' %}December + {% endcase %} + {{ page.date | date: "%Y" }} diff --git a/_includes/footer.html b/_includes/footer.html new file mode 100644 index 0000000..b3f158c --- /dev/null +++ b/_includes/footer.html @@ -0,0 +1,35 @@ +{% include streamer.html %} + + diff --git a/_includes/forloop-dates.html b/_includes/forloop-dates.html new file mode 100644 index 0000000..34c84a7 --- /dev/null +++ b/_includes/forloop-dates.html @@ -0,0 +1,21 @@ + + {% assign d = post.date | date: "%-d" %} + {% case d %} + {% when '1' or '21' or '31' %}{{ d }}:st + {% when '2' or '22' %}{{ d }}:nd + {% when '3' or '23' %}{{ d }}:rd + {% else %}{{ d }}:th + {% endcase %} of + {% assign m = post.date | date: "%-m" %} + {% case m %} + {% when '1' %}January + {% when '2' %}February + {% when '3' %}March + {% when '4' %}April + {% when '5' %}May + {% when '6' %}June + {% when '7' %}July + {% when '8' %}August + {% when '9' %}September {% when '10' %}October {% when '11' %}November {% when '12' %}December + {% endcase %} + {{ post.date | date: "%Y" }} diff --git a/_includes/header.html b/_includes/header.html new file mode 100644 index 0000000..668e88d --- /dev/null +++ b/_includes/header.html @@ -0,0 +1,36 @@ +{% include relBase.html %} +
+
+

{{ page.title }}

+
+
+ +
+ +

{{ page.title }}

+

{{ page.description }}

+ {% if page.category == 'releases' %} +

🔊 Listen

+ {% elsif page.category == 'ramblings' %} +

👀 Read

+ {% elsif page.url == '/404/' %} +

🏡 Take me home

+ {% elsif page.url == '/about/' %} +

👽 Saywhat?

+ {% else %} +

🔥 Boom

+ {% endif %} +
+
+ + + + +
diff --git a/_includes/matomo.js b/_includes/matomo.js new file mode 100644 index 0000000..696067c --- /dev/null +++ b/_includes/matomo.js @@ -0,0 +1,45 @@ +{% if page.url == '/404/' %} + +//* Matomo *// + +var _paq = window._paq = window._paq || []; +/* tracker methods like "setCustomDimension" should be called before "trackPageView" */ +_paq.push(['setDocumentTitle', '404/URL = ' + encodeURIComponent(document.location.pathname+document.location.search) + '/From = ' + encodeURIComponent(document.referrer)]); +_paq.push(["setCookieDomain", "*.basspistol.com"]); +_paq.push(["setDomains", ["*.basspistol.org","*.basspistol.com","*.pauvrecoude.basspistol.com","*.paxnion.basspistol.com","*.radio.basspistol.com","*.sakrecoer.basspistol.com","*.sakrecoer.com","*.sethybowoy.basspistol.com","*.setto.basspistol.com","*.tfb.basspistol.com","*.v.basspistol.org"]]); +_paq.push(["enableCrossDomainLinking"]); +_paq.push(["disableCookies"]); +_paq.push(['trackPageView']); +_paq.push(['enableLinkTracking']); +(function() { + var u="https://terminalnetwork.matomo.cloud/"; + _paq.push(['setTrackerUrl', u+'matomo.php']); + _paq.push(['setSiteId', '{{ site.matomo_site_id }}']); + var d=document, g=d.createElement('script'), s=d.getElementsByTagName('script')[0]; + g.type='text/javascript'; g.async=true; g.src='https://cdn.matomo.cloud/terminalnetwork.matomo.cloud/matomo.js'; s.parentNode.insertBefore(g,s); +})(); +//* End Matomo *// + +{% else %} + +//* Matomo *// + +var _paq = window._paq = window._paq || []; +_paq.push(["setDocumentTitle", document.domain + "/" + document.title]); +_paq.push(["setCookieDomain", "*.basspistol.com"]); +_paq.push(["setDomains", ["*.basspistol.org","*.basspistol.com","*.pauvrecoude.basspistol.com","*.paxnion.basspistol.com","*.radio.basspistol.com","*.sakrecoer.basspistol.com","*.sakrecoer.com","*.sethybowoy.basspistol.com","*.setto.basspistol.com","*.tfb.basspistol.com","*.v.basspistol.org"]]); +_paq.push(["enableCrossDomainLinking"]); +_paq.push(["disableCookies"]); +_paq.push(['trackPageView']); +_paq.push(['enableLinkTracking']); +(function() { + var u="https://terminalnetwork.matomo.cloud/"; + _paq.push(['setTrackerUrl', u+'matomo.php']); + _paq.push(['setSiteId', '{{ site.matomo_site_id }}']); + var d=document, g=d.createElement('script'), s=d.getElementsByTagName('script')[0]; + g.type='text/javascript'; g.async=true; g.src='https://cdn.matomo.cloud/terminalnetwork.matomo.cloud/matomo.js'; s.parentNode.insertBefore(g,s); +})(); + +//* End Matomo *// + +{% endif %} \ No newline at end of file diff --git a/_includes/mautic-tracker.js b/_includes/mautic-tracker.js new file mode 100644 index 0000000..ab1aec1 --- /dev/null +++ b/_includes/mautic-tracker.js @@ -0,0 +1,8 @@ + + (function(w,d,t,u,n,a,m){w['MauticTrackingObject']=n; + w[n]=w[n]||function(){(w[n].q=w[n].q||[]).push(arguments)},a=d.createElement(t), + m=d.getElementsByTagName(t)[0];a.async=1;a.src=u;m.parentNode.insertBefore(a,m) + })(window,document,'script','https://pr.basspistol.com/mtc.js','mt'); + + mt('send', 'pageview'); + diff --git a/_includes/navigation.html b/_includes/navigation.html new file mode 100644 index 0000000..6db262c --- /dev/null +++ b/_includes/navigation.html @@ -0,0 +1,33 @@ + +
+ + + + +
+ + + + + \ No newline at end of file diff --git a/_includes/relBase.html b/_includes/relBase.html new file mode 100644 index 0000000..94ba93e --- /dev/null +++ b/_includes/relBase.html @@ -0,0 +1,12 @@ +{% assign relBase = '' %} +{% assign tempDepth = page.url | append: 'hackish-solution' | split: '/' | size | minus: 2 %} +{% for i in (1..tempDepth) %} + {% if forloop.last %} + {% assign relBase = relBase | append: ".." %} + {% else %} + {% assign relBase = relBase | append: "../" %} + {% endif %} +{% endfor %} +{% if relBase == '' %} + {% assign relBase = '.' %} +{% endif %} \ No newline at end of file diff --git a/_includes/scripts.html b/_includes/scripts.html new file mode 100644 index 0000000..a0055d9 --- /dev/null +++ b/_includes/scripts.html @@ -0,0 +1,3 @@ + +{% include relBase.html %} + diff --git a/_includes/seo.html b/_includes/seo.html new file mode 100644 index 0000000..ee5facc --- /dev/null +++ b/_includes/seo.html @@ -0,0 +1,292 @@ + + + +{% if page.collection == 'tracks' %} + + +Play {{ page.common.title | xml_escape }} by {{ page.common.artist | xml_escape }} | {{ site.title | xml_escape }} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +{% elsif page.collection == 'posts' %} +{% if page.category == 'releases' %} + +{% for album in site.albums %} +{% if album.slug == page.album %} + +{% capture namelist %}{% for art in album.artists %}{{ art }}{% unless forloop.last %}, {% endunless %}{% endfor %}{% endcapture %} +{% capture artist %}{{ namelist }}{% endcapture %} + +Play "{{ album.name | xml_escape }}" by {{ artist | xml_escape | uniq }} | {{ site.title | xml_escape }} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +{% for track in album.tracks %}{% endfor %} + + + + + + + + + +{% endif %}{% endfor %} +{% elsif page.category == 'ramblings' %} + + +{{ page.title }} | {{ site.title }} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +{% endif %} +{% else %} + + +{{ page.title }} | {{ site.title }} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +{% endif %} + + + \ No newline at end of file diff --git a/_includes/streamer.html b/_includes/streamer.html new file mode 100644 index 0000000..c1641f5 --- /dev/null +++ b/_includes/streamer.html @@ -0,0 +1,103 @@ + +{% if page.collection == 'posts' %} + {% if page.category == 'releases' %} + {% if page.check_this_if_cannot_be_bought == false %} +
+

Get this release

+
+ {% for shop in page.stores %} + + {{ shop.name }} + + {% endfor %} +
+
+ {% else %} +
+

This release can't be obtained

+

Stream, follow, like and subscribe!

+
+ {% for shop in site.data.stores %} + + {{ shop.name }} + + {% endfor %} +
+
+ {% endif %} + {% else %} + {% if page.check_this_if_cannot_be_bought == false %} +
+

Get this release

+
+ {% for shop in page.stores %} + + {{ shop.name }} + + {% endfor %} +
+
+ {% else %} +
+

Support {{ site.title }}

+

Stream, follow, like and subscribe!

+
+ {% for shop in site.data.stores %} + + {{ shop.name }} + + {% endfor %} +
+
+ {% endif %} + {% endif %} +{% elsif page.collection == 'tracks' %} +
+ + {% for post in site.posts %} + {% if post.album == page.albumSlug %} + {% if post.check_this_if_cannot_be_bought == false %} + +

Get this track

+
+ {% for shop in post.stores %} + + {{ shop.name }} + + {% endfor %} +
+ {% else %} + +

This track can't be obtained

+

Stream, follow, like and subscribe!

+
+ {% for shop in site.data.stores %} + + {{ shop.name }} + + {% endfor %} +
+ {% break %} + + {% endif %} + {% endif %} + {% endfor %} +
+ +{% else %} +
+

Support {{ site.title }}

+

Stream, follow, like and subscribe!

+
+ {% for shop in site.data.stores %} + + {{ shop.name }} + + {% endfor %} +
+
+{% endif %} +
+ + +
diff --git a/_includes/zafari.html b/_includes/zafari.html new file mode 100644 index 0000000..cafd2fc --- /dev/null +++ b/_includes/zafari.html @@ -0,0 +1,22 @@ +
+
+

Hey Safari User!

+

Amazing! You are surfing the web with one of the leading browsers to download another browser! Such luxury!
+To listen to {{ site.title }}'s music, these are your options: +

+
+If you like browsing the web this way and you really just want to see if this {{ site.title }} thing is for real:
+ + + +

+{% include streamer.html %} +
+
\ No newline at end of file diff --git a/_layouts/404page.html b/_layouts/404page.html new file mode 100644 index 0000000..669b51e --- /dev/null +++ b/_layouts/404page.html @@ -0,0 +1,133 @@ +--- +layout: nil +--- + + + + +{% include seo.html %} + + + + + + + + + + + + + + + + + + + +
+ + +
+
+

{{ page.title }}

+
+
+ +
+ +

{{ page.title }}

+

{{ page.description }}

+ {% if page.category == 'releases' %} +

🔊 Listen

+ {% elsif page.category == 'highlights' %} +

👀 Read

+ {% elsif page.url == '/404/' %} +

🏡 Take me home

+ {% elsif page.url == '/about/' %} +

👽 Saywhat?

+ {% else %} +

🔥 Boom

+ {% endif %} +
+
+ + + + +
+ +
+
+ {{ content }} +
+
+ + +{% unless page.collection == 'tracks' or page.url == '/radio/' %} + +
+
+
+

{{ site.title }}

+

{{ site.description }}

+ +
+ +
{{ site.title }} Logo
+ + +
+ {% for nw in site.data.social %} + {{ nw.name }} + {% endfor %} + Email +
+

©{{ site.time | date: '%Y' }} {{ site.publisher.name }} | Credits | + Cookies & Privacy +
This page was last updated on {{ page.last_modified_at | date: "%A, %b %d, %Y" }}

+
+
+
+{% endunless %} + + + + +
+ +{% unless page.collection == 'tracks' %} +{% include navigation.html %} +{% endunless %} + +{% include scripts.html %} +{% if page.video_path %} +
+ +
+{% endif %} + + + diff --git a/_layouts/album.html b/_layouts/album.html new file mode 100644 index 0000000..b5024df --- /dev/null +++ b/_layouts/album.html @@ -0,0 +1,3 @@ +--- +layout: nil +--- diff --git a/_layouts/default.html b/_layouts/default.html new file mode 100644 index 0000000..e44198d --- /dev/null +++ b/_layouts/default.html @@ -0,0 +1,69 @@ +--- +--- + + + + +{% include seo.html %} +{% include relBase.html %} + + + + + + + + + + + + + + + + + + +
+ +{{ content }} + +{% unless page.collection == 'tracks' or page.url == '/radio/' %} +{% include footer.html %} +{% endunless %} + + + + +
+ + +{% include navigation.html %} + + +{% include scripts.html %} +{% if page.video_path %} +
+ +
+{% endif %} + +{% if page.image %} + +{% endif %} + + + + diff --git a/_layouts/nil.html b/_layouts/nil.html new file mode 100644 index 0000000..7f63ffd --- /dev/null +++ b/_layouts/nil.html @@ -0,0 +1,3 @@ +--- +--- +{{ content }} \ No newline at end of file diff --git a/_layouts/page.html b/_layouts/page.html new file mode 100644 index 0000000..2e5608a --- /dev/null +++ b/_layouts/page.html @@ -0,0 +1,15 @@ +--- +layout: default +--- + +{% include header.html %} +
+
+
+ {{ content }} +
+
+
+{% if page.url == '/about/' %} + +{% endif %} \ No newline at end of file diff --git a/_layouts/post.html b/_layouts/post.html new file mode 100644 index 0000000..763f715 --- /dev/null +++ b/_layouts/post.html @@ -0,0 +1,412 @@ +--- +layout: default +--- +{% if page.category == 'releases' %} + + +{% include relBase.html %} + +
+
+

{{ page.title }}

+
+
+ + + +
+ + + + {% for album in site.albums %} + {% if page.album == album.slug %} + {% assign onetracker = album.tracks | size %} +
+

{{ page.title }}

+

{{ page.description }}

+
+

 

+

Track list

+
    + {% for track in album.tracks %} +
  • +
    +
    {{ track.common.track.no }}.
    +
    {{ track.common.title }}
    +
    + {% assign round_seconds = track.format.duration | round %}{% assign minutes = round_seconds | divided_by: 60 %}{% assign leftover_seconds = minutes | times: 60 %}{{ minutes }}:{% assign seconds_without_zero = round_seconds | minus: leftover_seconds %}{% if seconds_without_zero < 10 %}0{% endif %}{{ seconds_without_zero }} +
    +
    +
  • + {% endfor %} +
+
+
+
+
+
+
+ {% for track in album.tracks %} + +
+
{{ track.common.track.no }}.
+ +
+ {% assign round_seconds = track.format.duration | round %}{% assign minutes = round_seconds | divided_by: 60 %}{% assign leftover_seconds = minutes | times: 60 %}{{ minutes }}:{% assign seconds_without_zero = round_seconds | minus: leftover_seconds %}{% if seconds_without_zero < 10 %}0{% endif %}{{ seconds_without_zero }} +
+
+ {% endfor %} +
+ {% endif %}{% endfor %} +
+ {% for album in site.albums %} + {% if page.album == album.slug %} +
+
+
+
+ + {% assign author_id = page.author | prepend: "/authors/" | append: "/" %} + {% assign author = site.authors | where: "url", author_id | first %} +
+
+

+ Published the + +

+ {% if page.download_form_id %}{% endif %} +
+ Share this release: +
+ +
+
+
+{% endif %}{% endfor %} +
+
+ + + + + + + +{% for album in site.albums %} +{% if page.album == album.slug %} + +
+
+ {{ content }} + {% if page.link.url %} +

+ + {% if page.link.buttontext %}{{ page.link.buttontext }}{% else %}👀 check it out{% endif %} + +

+ {% endif %} +
+
+
+
+ +
+ +
+ +
+
+ + {% if onetracker > 1 %} +
+ + +
+ {% endif %} +

+ +

+
+
+ +
+ +{% if onetracker > 1 %} + +{% for track in album.tracks %} + +
+
+
+
+

{{ track.common.title }}

+

+ {% assign round_seconds = track.format.duration | round %}{% assign minutes = round_seconds | divided_by: 60 %}{% assign leftover_seconds = minutes | times: 60 %}{{ minutes }}:{% assign seconds_without_zero = round_seconds | minus: leftover_seconds %}{% if seconds_without_zero < 10 %}0{% endif %}{{ seconds_without_zero }} + | {{ track.common.genre }}

+

{{ track.common.year }}

+

🔊 Play

+ {% if track.all.UNSYNCEDLYRICS and track.all.USLT %} + +

+ {{ track.all.USLT.text | newline_to_br }} +

+ + {% elsif track.all.USLT and track.all.UNSYNCEDLYRICS == nil %} + +

+ {{ track.all.USLT.text | newline_to_br }} +

+ + {% elsif track.all.UNSYNCEDLYRICS and track.all.USLT == nil %} + +

+ {{ track.all.UNSYNCEDLYRICS | newline_to_br }} +

+ + {% elsif track.all.lyrics %} + +

+ {{ track.all.lyrics | newline_to_br }} +

+ + {% endif %} +
+
+ +{% endfor %} + + +{% endif %} + + {% break %} {% endif %} {% endfor %} + + + +
+ {% if page.previous.url or page.next.url %} +
+
+ {% if page.previous.url %} +

+

{{ page.previous.title }}

+

{{ page.previous.description }}

+ {% endif %} +
+
+ {% if page.next.url%} +

+

{{ page.next.title }}

+

{{ page.next.description }}

+ {% endif %} +
+
+ {% endif %} +
+ + + + + + +{% else %} + {% include header.html %} + +
+ +
+
+ {{ content }} +
+ {% if page.link.url %} +

+ {% if page.link.buttontext %}{{ page.link.buttontext }}{% else %}👀 check it out{% endif %} +

+ {% endif %} + {% include author.html %} +
+
+ + + + +
+ {% if page.previous.url or page.next.url %} +
+
+ {% if page.previous.url %} +

+

{{ page.previous.title }}

+

{{ page.previous.description }}

+ {% endif %} +
+
+ {% if page.next.url%} +

+

{{ page.next.title }}

+

{{ page.next.description }}

+ {% endif %} +
+
+{% endif %} +
+{% endif %} \ No newline at end of file diff --git a/_layouts/track.html b/_layouts/track.html new file mode 100644 index 0000000..7f6a07a --- /dev/null +++ b/_layouts/track.html @@ -0,0 +1,217 @@ +--- +layout: default +--- + +{% include relBase.html %} + +{% for album in site.albums %} +{% if album.slug == page.albumSlug %} +{% assign onetracker = album.tracks | size %} +{% endif %} +{% endfor %} + + +
+
+
+
+
+ + +
+
+ +
+ +
+

{{ page.common.title }}

+

{% for style in page.common.genre %}{{ style }}{% endfor %} by {{ page.common.artist }}

+ {% for post in site.posts %} + {% if post.album == page.albumSlug %} +

From the {{ page.common.year }} {% if onetracker > 1 %}release{% else %}single{% endif %} "{{ page.common.album }}"

+ {% endif %} + {% endfor %} + +

{% assign round_seconds = page.format.duration | round %}{% assign minutes = round_seconds | divided_by: 60 %}{% assign leftover_seconds = minutes | times: 60 %}{{ minutes }}:{% assign seconds_without_zero = round_seconds | minus: leftover_seconds %}{% if seconds_without_zero < 10 %}0{% endif %}{{ seconds_without_zero }}

+ + + {% include author.html %} + + + + +

Play!

+ + + + + + {% if page.all.UNSYNCEDLYRICS and page.all.USLT %} +
+

+ {{ page.all.USLT.text | newline_to_br }} +

+
+ {% elsif page.all.USLT and page.all.UNSYNCEDLYRICS == nil %} +
+

+ {{ page.all.USLT.text | newline_to_br }} +

+
+ {% elsif page.all.UNSYNCEDLYRICS and page.all.USLT == nil %} +
+

+ {{ page.all.UNSYNCEDLYRICS | newline_to_br }} +

+
+ {% endif %} +

+ {{ page.all.Comment }} +

+ +
+ + +
+ {% if page.previous.url or page.next.url %} +
+ {% if page.previous.url %} +

+

{{ page.previous.common.title }}

+

{{ page.previous.description }}

+ {% endif %} +
+
+ {% if page.next.url%} +

+

{{ page.next.common.title }}

+

{{ page.next.description }}

+ {% endif %} +
+{% endif %} +
+{% include footer.html %} + +
+ + + + + +
+
+ +
+ +
+ +
+
+ + +
+ {% if page.previous.url %} + + {% endif %} + + {% if page.next.url %} + + {% endif %} + +
+ +

{{ page.common.title }}

+
+ + +
+
+ + + +
+
\ No newline at end of file diff --git a/_manifest.json b/_manifest.json new file mode 100644 index 0000000..bd1d7af --- /dev/null +++ b/_manifest.json @@ -0,0 +1,85 @@ +{ + "short_name": "徒 setto セット", + "name": "徒 setto セット Music PWA", + "lang": "en", + "description": "Music of 徒 setto セット in your phone", + "start_url": "/", + "background_color": "#3c2a52", + "theme_color": "#3c2a52", + "dir": "ltr", + "display": "standalone", + "orientation": "portrait", + "icons": [ + { + "src": "/setto-webapp.png", + "type": "image/png", + "sizes": "512x512" + }, + { + "src": "/android-icon-192x192-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "192x192" + }, + { + "src": "/apple-icon-180x180-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "180x180" + }, + { + "src": "/apple-icon-152x152-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "152x152" + }, + { + "src": "/apple-icon-144x144-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "144x144" + }, + { + "src": "/apple-icon-120x120-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "120x120" + }, + { + "src": "/apple-icon-114x114-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "114x114" + }, + { + "src": "/favicon-96x96-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "96x96" + }, + { + "src": "/apple-icon-76x76-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "76x76" + }, + { + "src": "/apple-icon-72x72-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "72x72" + }, + { + "src": "/apple-icon-60x60-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "60x60" + }, + { + "src": "/apple-icon-57x57-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "57x57" + }, + { + "src": "/favicon-32x32-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "32x32" + }, + { + "src": "/favicon-16x16-dunplab-manifest-9805.png", + "type": "image/png", + "sizes": "16x16" + } + ], + "prefer_related_applications": "false" +} diff --git a/_old.cookies.md b/_old.cookies.md new file mode 100644 index 0000000..e2662b3 --- /dev/null +++ b/_old.cookies.md @@ -0,0 +1,157 @@ +--- +title: Cookies & Privacy policy +image: /images/pages/arget-zvhhkivur9m-unsplash.jpg +description: 'Privacy is important, therefor 徒 setto セット respects it!' +sitemap: false +layout: page +--- + +To improve our marketing efforts, we at {{ site.publisher.name }} sometimes place small data files called cookies on your device. This site will work perfectly without them. We do however use anonymized analytics of the site-usage regardless of cookies (see bellow if you want to opt out of this too) This usage-data contain no identifiable information. + +#### If you were not prompted to consent to cookies when you entered this site, it means you either expressed consent for cookies or dismissed cookies on one of {{ site.publisher.name }}'s subdomain-websites. + +## What are cookies? + +A cookie is a small text file that a website stores on your computer or mobile device when you visit the site. + +* **First party cookies** are cookies set by the website you are visiting. Only that website can read them. In addition, a website might potentially use external services, which also set their own cookies, known as **third-party cookies**. +* **Persistent cookies** are cookies saved on your computer and that are not deleted automatically when you quit your browser, **unlike a session cookie**, which is deleted when you quit your browser. + +Every time you visit the websites managed by the {{ site.publisher.name }}, you will be prompted to **accept or refuse cookies**.
The purpose is to enable the site to remember your preferences for a certain period of time.
That way, **you do not have to re-enter them** when browsing around the site during the same visit.
Cookies can also be used to establish anonymized statistics about the browsing experience on our sites. However, if you do not dismiss the cookie-banner, no cookies will be placed in your browser but we will still be able to see your anonymized actions on this website. + +## How do we use cookies? + +The websites managed by the {{ site.publisher.name }} mostly use **first-party cookies**. These are cookies set and controlled by the {{ site.publisher.name }}, not by any external organization.
However, to view some of our pages, you will have to accept cookies from external organizations. + +The **2 types of first-party cookie** we use are to: + +* store visitor preferences +* gather analytics data (about user behaviour). + +### 1\. Visitor preferences + +This one is set by us. It is only placed if you dismiss the cookie-banner by either chosing to help or declining to help. They remember: + +* if you have agreed to (or refused) this site’s cookie policy +* if you have already replied to our survey pop-up (about how helpful the site content was) – so you will not be asked again. + +**Visitor preferences cookies** are: + +**Name**\: cookie-notice-dissmissed
**Services**\: Cookie consent kit
**Purpose**\: Stores your cookie preferences (so you will not be asked again) This cookie is only placed if you accept or decline to help improve our marketing via the cookie-banner buttons.
**Cookie type and duration:** First-party session cookie deleted after 12 months. + +### 2\. Analytics cookies + +We use these purely for internal research on how we can improve the service we provide for all our users.
The cookies simply assess how you interact with our website – as an anonymous user (they **data gathered does not identify you personally**).
Also, this data is **not shared with any third parties** or used for any other purpose. The anonymized statistics could be shared with contractors working on communication projects under contractual agreement with the {{ site.publisher.name }}.
However, you are **free to refuse** these types of cookies –simply let the cookie banner you see in the foot of all pages be displayed + +**Analytics cookies** are: + +**Name**\: \_pk\_id\#
**Services**\: Corporate web analytics service, (Matomo open source software)
**Purpose**\: Recognises website visitors (**anonymously** – no personal information is collected on the user)
**Cookie type and duration**\: First-party persistent cookie, 13 months + +**Name**\: \_pk\_ses\#
**Services**\: Corporate web analytics service, (Matomo open source software**)
Purpose**\: Identifies the pages viewed by the same user during the same visit. (**anonymously** – no personal information is collected on the user)
**Cookie type and duration**\: First-party persistent cookie, 30 minutes + +## Third-party cookies + +Some of our pages display content from external providers, e.g. YouTube, Facebook and Twitter.
To view this third-party content, you first have to accept their specific terms and conditions. This includes their cookie policies, which we have no control over.
But if you do not view this content, no third-party cookies are installed on your device. + +### Third-party providers that may found on this website + +* [YouTube](https://www.youtube.com/t/terms){: target="_blank"} +* [Internet Archive](https://archive.org/about/terms.php){: target="_blank"} +* [ScribbleLive](https://www.scribblelive.com/legal/terms-of-use/){: target="_blank"} +* [Google Maps](https://www.google.com/intl/en_be/help/terms_maps/) +* [Twitter](https://twitter.com/en/tos?wcmmode=disabled#intlTerms){: target="_blank"} +* [TV1](https://www.tv1.eu/en/datenschutz/){: target="_blank"} +* [Vimeo](https://vimeo.com/terms){: target="_blank"} +* [Microsoft](https://www.microsoft.com/en/servicesagreement/){: target="_blank"} +* [Facebook](https://www.facebook.com/legal/terms){: target="_blank"} +* [Google](https://policies.google.com/terms?hl=en&gl=be){: target="_blank"} +* [LinkedIn](https://www.linkedin.com/legal/user-agreement){: target="_blank"} +* [Livestream](https://livestream.com/legal/terms){: target="_blank"} +* [SoundCloud](https://soundcloud.com/pages/privacy){: target="_blank"} +* [European Parliament](http://www.europarl.europa.eu/portal/en/legal-notice){: target="_blank"} + +These third-party services are outside of the control of the {{ site.publisher.name }}. Providers may, at any time, change their terms of service, purpose and use of cookies, etc. + +## How can you manage cookies? + +You can **manage/delete** cookies as you wish - for details, see [aboutcookies.org](https://www.aboutcookies.org/){: target="_blank"} + +### Removing cookies from your device + +You can delete all cookies that are already on your device by clearing the browsing history of your browser. This will remove all cookies from all websites you have visited.
Be aware though that you may also lose some saved information (e.g. saved login details, site preferences). + +### Managing site-specific cookies + +For more detailed control over site-specific cookies, check the privacy and cookie settings in your preferred browser. + +### Blocking cookies + +You can set most modern browsers to prevent any cookies being placed on your device, but you may then have to manually adjust some preferences every time you visit a site/page. And some services and functionalities may not work properly at all (e.g. profile logging-in). + +### Opting out of all of log-analytics + +(if you can't see a dialogue box here, you are already opted out by your browser and/or any of it's add-ons)
  + + + +## Personal data protection + +{{ site.publisher.name }} is committed to user privacy. + +The policy on protection of individuals with regard to the processing of personal data by {{ site.publisher.name }} is based on [Regulation (EU) 2018/1725](https://eur-lex.europa.eu/legal-content/EN/TXT/?uri=CELEX:32018R1725) of the European Parliament and Council of 23 October 2018 on the protection of natural persons with regard to the processing of personal data by {{ site.publisher.name }} and on the free movement of such data, and repealing Regulation (EC) No 45/2001 and Decision No 1247/2002/EC. + +This general policy covers the {{ site.publisher.name }}'s family of websites, within the {{ site.publisher.domain }} domain. Although you can browse through most of these websites without giving any personal information, in some cases information is required in order to provide the e-services you request. Websites that require such information treat it in full compliance with the regulation mentioned above and provide information about the use of your data in their specific privacy policy statements. + +In this respect: + +* for each e-service, a controller determines the purposes and means of personal data processing and ensures conformity with the privacy policy +* within each website/e-service, a Data Protection Officer ensures that the provisions of the regulation are applied and advises controllers on fulfilling their obligations + +The {{ site.publisher.name }}'s family of websites, within the {{ site.publisher.domain }} domain, provides links to third party sites. In order to use third party content on our websites, you may need to accept their specific terms and conditions, including their cookie policies, over which we have no control. + +## e-service + +An e-service on {{ site.publisher.domain }} is a service or resource made available on the Internet in order to improve the communication between people, customers, employees and businesses on the one hand and the {{ site.publisher.name }} on the other hand. + +3 types of e-services are, or will be, offered by {{ site.publisher.name }} : + +* information services that provide people, media, businesses, administrations and others with access to information +* interactive communication services that allow better contact with people, businesses, civil society, customers and public bodies, in order to facilitate consultations and feedback +* services that allow access to all basic forms of transactions with {{ site.publisher.name }}, such as  recruitment, event enrolment, and acquisition of documents + +### Information contained in a specific privacy statement + +A specific privacy policy statement will contain the following information about the use of your data + +* what information is collected, for what purpose and the technical means by which {{ site.publisher.name }} collects personal information in order to fulfill a specific purpose +* to whom your information is disclosed +* how you can access your information, verify its accuracy and, if necessary, correct it +* how long your data is kept +* what security measures are taken to safeguard your information against possible misuse or unauthorised access +* whom to contact if you have queries or complaints + +### {{ site.publisher.name }} Analytics + +{{ site.publisher.name }} is the corporation that measures the effectiveness and efficiency of the {{ site.publisher.domain }} site managed by the {{ site.publisher.name }}. + +You are free to refuse the use of this service – either by letting the cookie banner that appears at the bottom of all pages you visit be, and using the settings provided above on this page. + +{{ site.publisher.name }} manages its own web pages This is the page where you can manage your options. + +### Contacting {{ site.publisher.name }} + +Many web pages on {{ site.publisher.domain }} have a contact button, which either sends an email on your behalf of activates your e-mail software and invites you to send your comments to a specific mailbox. + +When you send such a message, your personal data is collected only to the extent necessary to reply. If the management team of the mailbox is unable to answer your question, it will forward your e-mail to another service. You will be informed, via e-mail, about which service your question has been forwarded to. + +If you have any questions about the processing of your e-mail and related personal data, do not hesitate to include them in your message. + +## Safeguarding information + +Collected personal data is stored and encrypted on a computer of the external subcontractor acting as processor, who must guarantee the data protection and confidentiality required by Regulation (EU) 2018/1725. + +## Verifying, modifying or deleting information + +If you want to verify, modify or delete your personal data stored by the responsible controllers for the {{ site.publisher.name }} website and its sub-sites, you can email the data controller for the {{ site.publisher.name }} website at the address below. In your email, clearly state your request and include the URL of the website/webpages your request refers to. + +Email: [{{ site.publisher.mail }}](mailto:{{ site.publisher.mail }}) \ No newline at end of file diff --git a/_plugins/jekyll_xml_source.rb b/_plugins/jekyll_xml_source.rb new file mode 100644 index 0000000..e1631d0 --- /dev/null +++ b/_plugins/jekyll_xml_source.rb @@ -0,0 +1,66 @@ +## +# Download XML data from external sources +# Convert data to JSON and optionally save it to cache +# +# @author Derek Smart +# @copyright 2018 +# @license MIT + +require 'json' +require 'net/http' +require 'active_support/core_ext/hash' + +module Jekyll_Xml_Source + class Generator < Jekyll::Generator + safe true + priority :highest + + def saveToCache(data_source, name, content) + path = "#{data_source}/#{name}.json" + File.open(path,"w") do |file| + file.write(content) + end + end + + def loadFromCache(data_source, name) + path = "#{data_source}/#{name}.json" + if not File.exist?(path) + return + end + File.open(path,"r") do |file| + return JSON.load(file.read()) + end + end + + def generate(site) + config = site.config['jekyll_xml'] + data_source = (site.config['data_source'] || '_data') + + if !config + return + end + + config.each do |data| + if data['cache'] + site.data[data['data']] = loadFromCache(data_source, data['data']) + end + + if site.data[data['data']].nil? + begin + result = Net::HTTP.get_response(URI.parse(data['source'])).body + site.data[data['data']] = JSON.load(Hash.from_xml(result).to_json) + rescue + next + end + + if data['cache'] + saveToCache(data_source, data['data'], Hash.from_xml(result).to_json) + end + end + + end + + end + + end +end diff --git a/_posts/2018-12-17-satoshi-mon-ami.md b/_posts/2018-12-17-satoshi-mon-ami.md new file mode 100644 index 0000000..17292c9 --- /dev/null +++ b/_posts/2018-12-17-satoshi-mon-ami.md @@ -0,0 +1,41 @@ +--- +title: Satoshi Mon Ami +author: setto +date: 2018-12-17 19:00:00 +description: >- + The 2 tracks of laid back cloud rap are tales of daily digital life-struggles. + When day-to-day communication blurs the line between the virtual and real. +image: /images/posts/1-k-as-tu-fait-de-nous-.jpeg +video_path: /videos/satoshi.webm +category: releases +tags: + - EP +link: + url: + buttontext: +check_this_if_cannot_be_bought: false +album: satoshi-mon-ami +stores: + - name: Bandcamp + url: 'https://shop.basspistol.com/album/satoshi-mon-ami' + icon: fa-bandcamp + download: true + - name: Audius + url: 'https://audius.co/tosettosetto/playlist/satoshi-mon-ami-11205' + icon: fa-creative-commons-sampling + - name: Peertube + url: >- + https://v.basspistol.org/videos/watch/playlist/262e54c5-6f15-402a-972d-474a898129df + icon: fa-youtube + download: false +--- + +The 2 tracks of laid back cloud rap are tales of daily digital life-struggles. When day-to-day communication blurs the line between the virtual and real. + +Being close to someone, without them knowing, anonymously and obsessively through a device. Decrypting interconnected sub-stories from every node in the graph and losing your mind on it.What's the latest story? FOMO to the max, The Fear Of Missing Out\! + +Put your derpy VR-goggles on and check out the 360 video bellow\! + + + +The video is delivered from YouTube, but is explicitly set not to push any cookies to your browser\! [Click here for a direct link](https://www.youtube.com/watch?v=mOPubF0xhG8){: target="_blank"} \ No newline at end of file diff --git a/_posts/2019-02-07-darkweb.md b/_posts/2019-02-07-darkweb.md new file mode 100644 index 0000000..7e97ed6 --- /dev/null +++ b/_posts/2019-02-07-darkweb.md @@ -0,0 +1,39 @@ +--- +title: Darkweb +author: setto +date: 2019-02-07 19:07:00 +description: >- + As dystopian as the present might seem on-line, there is always room for the + strange in the cypher... +image: /images/darkweb.jpg +video_path: /videos/darkweb.webm +category: releases +tags: + - EP +link: + url: + buttontext: +check_this_if_cannot_be_bought: false +album: darkweb +download_form_id: 6 +stores: + - name: Bandcamp + url: 'https://shop.basspistol.com/album/darkweb' + icon: fa-bandcamp + download: true + - name: Audius + url: 'https://audius.co/tosettosetto/playlist/darkweb-11204' + icon: fa-creative-commons-sampling + download: false + - name: PeerTube + url: >- + https://v.basspistol.org/videos/watch/playlist/a6d80b4d-5e6e-4546-b90e-2be5b4d8a960 + icon: fa-youtube + download: false +--- + +As dystopian as the present might seem on-line, there is always room for the strange in the cypher. + +At the end of the tunnel through the flashy but controlled cyberspace we call the "Internet", there is a light of hope for the underground. + +Cover-art by [Mattias “Ritarn” Lindström](https://ritarn.com/){: target="_blank"} \ No newline at end of file diff --git a/_posts/2019-12-12-granny-is-a-cyborg-now.md b/_posts/2019-12-12-granny-is-a-cyborg-now.md new file mode 100644 index 0000000..bb10ac8 --- /dev/null +++ b/_posts/2019-12-12-granny-is-a-cyborg-now.md @@ -0,0 +1,31 @@ +--- +title: Granny is a cyborg now +author: setto +date: 2019-12-12 04:03:00 +0100 +description: Jazzy Cybersoul with a hint of 303 baselines. +image: /images/posts/1-grandma-got-the-ssh-keys.jpeg +video_path: /videos/37th--chamber.mp4 +category: releases +tags: + - EP +link: + url: + buttontext: +check_this_if_cannot_be_bought: false +album: cyber-grany +stores: + - name: Audius + url: 'https://audius.co/tosettosetto/grandma-is-a-cyborg-now-92454' + icon: fa-creative-commons-sampling + download: false +--- + +My grandmother, 93,  added me on social media yesterday. So I called her. Long-chat good talk. TL;DR Damn what a woman\! She told me she had a roll-walker. I said "we're in the future now Grandma, you're a cyborg, half machine\!" + +She laughed and acknowledge it was a marvellous invention\! + +Now with vocals on Audius\! + + + +  \ No newline at end of file diff --git a/_posts/2020-04-19-live-with-hardware.md b/_posts/2020-04-19-live-with-hardware.md new file mode 100644 index 0000000..5774dbf --- /dev/null +++ b/_posts/2020-04-19-live-with-hardware.md @@ -0,0 +1,34 @@ +--- +title: Live with hardware +author: setto +date: 2020-04-19 09:07:00 +0200 +description: >- + There is a weird meta-core to anything social exchange on internet that I + can't get my finger on. Assumptions and projections that I think partially + stem from the lack in body language +image: /images/posts/1-ep-life-of-a-dudelini.jpeg +video_path: +category: releases +tags: + - Mixtape +link: + url: + buttontext: +album: live-with-hardware +check_this_if_cannot_be_bought: true +stores: + - name: + url: + icon: + download: false +--- + +There is a weird meta-core to anything social exchange on internet that I can't get my finger on. Assumptions and projections that I think partially stem from the lack in body language and the fact that we tend to be alone with our devices when we exchange. Even when we do so while our physical self is in a room full of friends. One of it's symptoms is the *endorsement paradox,* for lack of better words. At some point it was common to see Twitter bios with the line *"retweets \!= Endorsement".* It might have a better name, but that "endorsement paradox" is something I feel heavily used as a propaganda strategy. The thing is, there is always someone in anyone's acquaintances that will resonate to shared info and critique in unexpected ways. For example some unspeakable parties triggered everyone to a point where everyone got so obsessed that everyone kept talking about those parties non stop. Basically taking said unspeakable parties out of the void they were in, and promoting them into a mass that had to be accounted for. I'm not saying unspeakable party propaganda should be ignored, but I think some information is better dissected away from public spaces where there is no control over the dimension of time since the discussion can keep on forever, even when everyone involved at first have moved on. Like that which happened to 4chan. + +It takes at least 2 to have a dialogue. And to achieve that plurality in cyberspace seems to require a lot of effort. Probably due to that aforementioned conflict between solitude and time-traversing company. "Company" as in being accompanied and time-traversing because what we record today can be used in the future, and in the future we might use recordings from the past. + +Either way, there is always something that escapes me when I try to thinker about exchange of information that pertain to the power limbo between humans. Hence the idea of a meta core: like a Russian doll. After all information is vehicular to energy. Be it human or robot information exchange: an impulse that turns a turbine on, a poem that make your heart beat faster… + +Audio extracted from the 360 video of [this jam](/hw-jam/) recorded a while back. + + \ No newline at end of file diff --git a/_posts/2020-08-02-unmet-dependencies.md b/_posts/2020-08-02-unmet-dependencies.md new file mode 100644 index 0000000..68b8f7e --- /dev/null +++ b/_posts/2020-08-02-unmet-dependencies.md @@ -0,0 +1,48 @@ +--- +title: Unmet Dependencies +author: setto +date: 2020-08-02 07:00:00 +description: >- + Proprietary tools, consultancies, remote labor... The reality in the digital + industry is as hard to cope with as it is building software in Haskell. + Freedom is luxury, but also a burden. + + + Open your mind, open the source! +image: /images/posts/final-pingnucover1220x1200.jpg +video_path: /videos/pingu.mp4 +category: releases +tags: + - EP +link: + url: + buttontext: +check_this_if_cannot_be_bought: false +album: unmet-dependencies +stores: + - name: Bandcamp + url: 'https://shop.basspistol.com/album/unmet-dependencies' + icon: fa-bandcamp + download: true + - name: Audius + url: 'https://audius.co/tosettosetto/playlist/unmet-dependencies-11206' + icon: fa-creative-commons-sampling + download: false + - name: PeerTube + url: >- + https://v.basspistol.org/videos/watch/playlist/e2e57ea1-5ed1-41a2-afd9-f8f9a0b7d1c6 + icon: fa-youtube + download: false +--- + +## Oldies, but goldies + +It is through these 2 tracks that i found the To Setto Setto in me. Before that i used to do some (Excellent, but) sort of lamo Electro-pop. Originally released under Sethybwoy, around 2016, they got some traction in Cyperpunk and geek circles, but never quite made it further… + +I don't really expect them to go so much longer this time, the odds are about the same as winning the EU-Jackpot Lottery. But i decided they belonged to To Setto Setto now and i can do as I please with them. + +Hope you like them\! + +Here is a video that was made for the track Pingnu. It's cute AF… but ok, that's how it was made\! + + \ No newline at end of file diff --git a/_posts/2020-08-03-333mix.md b/_posts/2020-08-03-333mix.md new file mode 100644 index 0000000..6ba34fb --- /dev/null +++ b/_posts/2020-08-03-333mix.md @@ -0,0 +1,31 @@ +--- +title: 333mix +author: setto +date: 2020-08-03 00:00:00 +0200 +description: Pignu got Chopped & Screwed by KodTreatment +image: /images/posts/333mix.jpg +video_path: +category: ramblings +tags: +link: + url: 'https://kodtreatment.bandcamp.com/' + buttontext: Visit KodTreatment +check_this_if_cannot_be_bought: true +album: +stores: + - name: + url: + icon: + download: false +--- +## I'm super stoked about this! + +Internet is wonderful: you put something in it and it gets a life, mutates, grows some muscles, finds a passion, duplicates itself, pops out and then back in on repeat! + +Merci Rskp!\ +👑\ +🐧 + + + +Check out the enitre project's bandcamp on the link below! \ No newline at end of file diff --git a/_posts/2020-11-13-make-a-bold-move-or-die-trying.md b/_posts/2020-11-13-make-a-bold-move-or-die-trying.md new file mode 100644 index 0000000..ed430f3 --- /dev/null +++ b/_posts/2020-11-13-make-a-bold-move-or-die-trying.md @@ -0,0 +1,34 @@ +--- +title: Make a bold move or die trying +author: setto +date: 2020-11-13 17:20:00 +0100 +description: >- + Being Underground is a dirty job, but someone has to do it! Tell your idols + they need to find some courage! Fuck the Haters (yeah you D.Ek!) +image: /images/posts/fuckit.jpg +video_path: +category: ramblings +tags: +link: + url: + buttontext: +check_this_if_cannot_be_bought: true +album: +stores: + - name: + url: + icon: + download: false +--- + +I've spent ~$90 to be available on streaming services for 2 years and made exactly $9.85 (before taxes) during that time. That's 152 times less then i did by spending 0 on Audius. I don't know if Audius is savior, but i know for sure the mainstreaming platforms are not. Of course i could up my promotion game, send all my listeners into their network of [stalker-bots and trackers.](https://thebaffler.com/downstream/big-mood-machine-pelly){: target="_blank"} Or like the haters say: "mAyBE jUst mAKe bETter muSIC". But instead I'm going to make a bold move. + +> A move that is allowed to me because I'm small and truly independent: **I'm deleting that shit\!** 🖕 + +Effective soon (whatever time it takes for my aggregator to act upon my request), you'll find me everywhere, but i won't promote any other places then: + +### This website and [My Peertube Channel](https://v.basspistol.org/accounts/setto/video-channels) + +Being Underground is a dirty job, but someone has to do it\! Tell your idols they need to find some courage\! + +PS. Fuck the Haters (yeah you D.Ek\!) \ No newline at end of file diff --git a/_posts/2020-11-17-social-media-distancing.md b/_posts/2020-11-17-social-media-distancing.md new file mode 100644 index 0000000..4c7e072 --- /dev/null +++ b/_posts/2020-11-17-social-media-distancing.md @@ -0,0 +1,37 @@ +--- +title: Social Media Distancing +author: setto +date: 2020-11-17 16:20:00 +0100 +description: 'We see each other less, but when we do it''s on the same screen we work on.' +image: /images/posts/digital-detox.jpg +video_path: +category: ramblings +tags: +link: + url: 'https://v.basspistol.org/accounts/setto/video-channels' + buttontext: "Subscribe to my PeerTube \U0001F4FA" +check_this_if_cannot_be_bought: true +album: +stores: + - name: + url: + icon: + download: false +--- + +The mainstream networks have gone void of actual content. Everybody is either mimicking something or avoiding any sort of relevance because "it just creates conflicts". And maybe that makes sense in these dark times? Remote work has got us so stuck to our screens that we'd rather not stick around on there. The escapism escaped from those places when the corporation jumped in. + +I really do my best to social-media distance myself from the usual suspects. And there are plenty of alternatives: + +* [Pixelfed](https://pixfed.com/tosettosetto){: target="_blank"} replaces Insta +* [Mastodon](https://kolektiva.social/@setto){: target="_blank"} replaces Twitter +* [Matrix](https://matrix.to/#/!YQcdVviFQNGYFMYrxD:matrix.org?via=matrix.org){: target="_blank"} replaces Whatsapp +* [PeerTube](https://v.basspistol.org) replace YouTube + +The fediverse is a diverse and federate network. Here you can start afresh. Be that GeoCities person you used to be? Or simply a lurker\! It becomes what we make it… The cool thing about Fediverse is that once you have an identity on one of those systems, say mastodon, you can interact with content from all systems\! Be it pixelfed, peertube, disapora… + +Try it out\! I suggest you start by looking for a [community node that fits your vibe.](https://joinmastodon.org/communities){: target="_blank"} + +> Mastodon isn’t a single website like Twitter or Facebook, it's a network of thousands of communities operated by different organizations and individuals that provide a seamless social media experience. + +Get your self an identity on there and once logged in, search for "@setto@v.basspistol.org" That is my PeerTube identity. Wonder how? Ask [me on matrix!](/chat/#read) :) \ No newline at end of file diff --git a/_posts/2021-03-08-little-bug-ep.md b/_posts/2021-03-08-little-bug-ep.md new file mode 100644 index 0000000..cc96bd4 --- /dev/null +++ b/_posts/2021-03-08-little-bug-ep.md @@ -0,0 +1,33 @@ +--- +title: Little Bug EP +author: setto +date: 2021-03-08 19:07:00 +0100 +description: Lofi Hiphop from planet Foss. +image: /images/posts/littlebug1400x1400.png +video_path: +category: releases +tags: + - EP +link: + url: + buttontext: +check_this_if_cannot_be_bought: false +album: little-bug-ep +download_form_id: 11 +stores: + - name: Bandcamp + url: 'https://shop.basspistol.com/album/little-bug-ep' + icon: fa-bandcamp + download: true + - name: Audius + url: 'https://audius.co/tosettosetto/playlist/little-bug-ep-31143' + icon: fa-creative-commons-sampling + download: false +--- +A smol EP for human kind. A giant leap for me. This is my first release that is entirely produced using Cooperative software (AKA FLOSS). As in: no hardware\!\! Yes\! it is also my first release in over a decade where all the synths and drum machines are software modules. It features flute and sax from the talented [Randulo](https://indieweb.social/@randulo){: target="_blank" rel="noopener noreferrer"}, and I am happy to share it with you. + + + +Let me know what you think\! You can talk to me [here](/chat/#read) + +  diff --git a/_posts/_defaults.md b/_posts/_defaults.md new file mode 100644 index 0000000..2c18df4 --- /dev/null +++ b/_posts/_defaults.md @@ -0,0 +1,20 @@ +--- +title: +author: +date: +description: +image: +video_path: +category: +tags: +link: + url: + buttontext: +check_this_if_cannot_be_bought: true +album: +stores: + - name: + url: + icon: + download: false +--- \ No newline at end of file diff --git a/_sass/_cookies.scss b/_sass/_cookies.scss new file mode 100644 index 0000000..cb0254b --- /dev/null +++ b/_sass/_cookies.scss @@ -0,0 +1,66 @@ +/* cookies */ + +#cookie-notice { + + display: none; + text-align: right; + position: fixed; + bottom: 0; + width: 100%; + background-color: var(--bg); + flex-wrap: wrap; + justify-content: space-evenly; + align-content: center; + align-items: center; + z-index: 10000000; + -webkit-box-shadow: 0px -12px 32px -25px var(--border-alt); + -moz-box-shadow: 0px -12px 32px -25px var(--border-alt); + box-shadow: 0px -12px 32px -25px var(--border-alt); + p { + flex: 1 0 250px; + margin: 40px 20px 40px 40px; + font-size: 0.8em; + font-family: _font(family); + font-weight: 300; + } + @media only screen and (max-width: 651px) { + p { + text-align: center; + margin: 40px 40px 20px 40px; + } + .yes, .no { + margin: 20px 40px 0px 40px; + } + + } + button { + border: none; + font-size: inherit; + font-family: inherit; + } +} + +.yes, .no { + flex: 0 0 100px; + -moz-transition: all var(--anim-speed) ease-in-out; + -webkit-transition: all var(--anim-speed) ease-in-out; + -ms-transition: all var(--anim-speed) ease-in-out; + transition: all var(--anim-speed) ease-in-out; + text-align: center; + margin: 40px 40px 40px 10px; +} +.yes { + background-image: unset; + background-color: var(--accent1) !important; +} +.no { + background-image: unset; + background-color: #f00 !important; +} +.yes:hover { + // color: #000 !important; + -moz-transition: all var(--anim-speed) ease-in-out; + -webkit-transition: all var(--anim-speed) ease-in-out; + -ms-transition: all var(--anim-speed) ease-in-out; + transition: all var(--anim-speed) ease-in-out; +} diff --git a/_sass/_elements.scss b/_sass/_elements.scss new file mode 100644 index 0000000..96e03bc --- /dev/null +++ b/_sass/_elements.scss @@ -0,0 +1,373 @@ + +// Basic Elements + +h1, h2, h3, h4, h5, h6 { + font-family: _font(title); + font-weight: 700; + +} +h1 { + font-size: 2.5em; +} +h2 { + font-size: 1.75em; +} +h3 { + font-size: 1.5em; +} +strong { + font-weight: 500; +} +a { + text-decoration-style: wavy; + text-decoration-color: transparent; + color: var(--accent1); + -moz-transition: all var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + -webkit-transition: all var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + -ms-transition: all var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + transition: all var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; +} +a:hover { + color: var(--accent2); + text-decoration-style: wavy; + text-decoration-color: unset; +} +.center { + text-align: center; +} + +// Buttons + +.button, .mauticform-button { + font-family: _font(title); + background-color: var(--accent2); + padding: 1em; + margin-bottom: 20px; + display: inline-block; + border-radius: var(--border-radius); + text-align: center; + text-decoration: none; + text-transform: uppercase; + font-weight: 500; + color: var(--bg); + -webkit-box-shadow: 0px 0px 0px -3px var(--border-alt); + -moz-box-shadow: 0px 0px 0px -3px var(--border-alt); + box-shadow: 0px 0px 0px -3px var(--border-alt); + -webkit-transition: all var(--anim-speed) ease-in-out; + -moz-transition: all var(--anim-speed) ease-in-out; + -ms-transition: all var(--anim-speed) ease-in-out; + transition: all var(--anim-speed) ease-in-out; + background-image: linear-gradient(228deg, var(--accent1-alt), var(--accent2-alt)); + background-size: 400% 400%; + -webkit-animation: backgroundBlink 2s ease infinite; + -moz-animation: backgroundBlink 2s ease infinite; + animation: backgroundBlink 2s ease infinite; + + +} +.button:hover .mauticform-button:hover { + background-color: var(--accent1); + color: var(--bg); + -webkit-box-shadow: 0px 11px 10px -3px var(--border-alt); + -moz-box-shadow: 0px 11px 10px -3px var(--border-alt); + box-shadow: 0px 11px 10px -3px var(--border-alt); + -webkit-transition: all var(--anim-speed) ease-in-out; + -moz-transition: all var(--anim-speed) ease-in-out; + -ms-transition: all var(--anim-speed) ease-in-out; + transition: all var(--anim-speed) ease-in-out; +} +.button:active, .mauticform-button:active { + -webkit-box-shadow: 0px 0px 0px -3px var(--border-alt); + -moz-box-shadow: 0px 0px 0px -3px var(--border-alt); + box-shadow: 0px 0px 0px -3px var(--border-alt); +} +@media only screen and (max-width: 480px) { + .button, .mauticform-button{ + font-size: 0.75em; + padding: 0.75em; + } +} + +.normal-section { + display:flex; + flex-wrap: wrap; + justify-content: space-around; + padding: 20px; + -webkit-box-shadow: unset; + -moz-box-shadow: unset; + box-shadow: unset; + h2 { + flex: 0 0 100%; + margin: 20px; + } + + p { + margin-top: 20px; + } + ul{ + width: 100%; + + } + + .icon { + flex: 0 0 100px; + margin: 0 0 20px 0; + display: inline-block; + width: 100px; + height: 100px; + border-radius: 200px; + font-size: 40px; + + line-height: 100px; + text-align: center; + + } + + + + img { + width:100%; + height: 100%; + object-fit: cover; + border-radius: var(--border-radius); + } +} + +// icon + +.label { + display: none; +} +.icon { + flex: 0 0 45px; + margin:20px; + font-size: 45px; + border-radius: 100px; + width: 100px; + height: 100px; + line-height: 100px; + border: 1px solid var(--accent1); + color: var(--accent1); + text-align: center; + text-decoration: none; + -moz-transition: border var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + -webkit-transition: border var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + -ms-transition: border var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + transition: border var(--anim-speed) ease-in-out, color var(--anim-speed) ease-in-out; + +} +.icon:hover { + border: 1px solid var(--accent2); + color: var(--accent2); + +} +.small { + border-radius: 80px; + width: 70px; + height: 70px; + line-height: 70px; + font-size: 45px; + margin-left: 0; +} +.smaller { + border-radius: 30px; + width: 30px; + height: 30px; + line-height: 30px; + font-size: 18px; + margin: 10px 10px 10px 0; +} + +// Content Author +#author { + flex: 0 0 280px; + margin: 0; + .date { + font-size:.85em; + } + .author-image { + margin-right: 10px; + background-repeat: no-repeat; + background-size:cover; + border-radius:150px; + width:150px; + height:150px; + } +} + +.info{ + padding: 40px; + + margin: auto; + .info-pages { + padding-top: 40px; + max-width: var(--max-width); + margin: auto; + .container { + img { + margin-left: auto; + margin-right: auto; + width: 100%; + max-width: 600px; + height: auto; + display: block; + } + h6 { + font-size: 0.8em; + text-align: center; + } + blockquote { + font-weight: 700; + border-left: 3px dotted var(--fg); + padding-left: 40px; + } + ul { + list-style-type:circle; + padding-left:40px; + } + } + } + + p { + margin: 20px 0; + } + h2, h3, h4, h5, h6 { + text-align: left; + } +} + +.news, .links { + margin-top: 40px; + padding: 0; + display: flex; + flex-wrap: wrap; + h2 { + flex: 0 0 100%; + margin-bottom: 20px; + } + > div { + background-size: cover; + background-repeat: no; + background-position: center center; + flex: 1 1 512px; + min-height: 80vh; + + padding: 40px; + box-sizing: border-box; + text-align: left; + + } + .description { + h2, p, a { + text-align: center; + } + p { + margin-top: 20px; + } + p:last-child { + margin-bottom: 40px; + } + min-height: unset; + } +} +.news:nth-child(even), .links:nth-child(even) { + flex-direction: row-reverse; + +} +.links { + > div { + min-height: unset; + } + +} +.linksbg { + background-size: 100%; + background: var(--bg); + background: linear-gradient(180deg, var(--bg) 26%, var(--accent2-alt) 100%); + +} + + +.front-section { + flex-direction: row-reverse; + -webkit-box-shadow: unset; + -moz-box-shadow: unset; + box-shadow: unset; + padding: 0; + display: flex; + flex-wrap: wrap; + p, h1, h2, h3, h4 { + text-align: left; + margin-top: 20px; + max-width: 570px; + } + p:last-child { + margin-bottom: 40px; + } + + > div { + background-size: cover; + background-repeat: no; + background-position: center center; + flex: 1 1 380px; + min-height: 50vh; + + padding: 20px; + box-sizing: border-box; + text-align: left; + + } + .description { + min-height: unset; + } + .container { + max-width: 460px; + margin: 0 20px 0 auto; + } + @media only screen and (max-width: 1080px) { + + .container { + margin: 0 20px 0 20px; + } + } +} +.front-section:nth-child(even) { + flex-direction: row; + .container { + + margin: 0 auto 0 20px; + } + @media only screen and (max-width: 1000px) { + .container { + + margin: 0 20px 0 20px; + } + } + +} + + + + +#contact { + padding: 20px; + + > div { + max-width: var(--max-width); + margin: auto; + padding: 40px 20px; + } + h2 { + padding-top: 20px; + } +} + +.normal-section { + display:flex; + flex-wrap: wrap; + justify-content: space-around; + padding: 20px; + -webkit-box-shadow: unset; + -moz-box-shadow: unset; + box-shadow: unset; +} \ No newline at end of file diff --git a/_sass/_forms.scss b/_sass/_forms.scss new file mode 100644 index 0000000..449203c --- /dev/null +++ b/_sass/_forms.scss @@ -0,0 +1,125 @@ +.textspace { + height: 100px; + +} + +input, textarea, select { + width: 100%; + padding: 12px 20px; + margin: 8px 0; + display: inline-block; + border: 1px solid #ccc; + border-radius: var(--border-radius); + box-sizing: border-box; + font-family: _font(family); + font-size: 1em; +} + + +input[type=submit] { + width: 200px; + background-image: linear-gradient(223deg, var(--accent1), var(--accent2)); + background-size: 800% 800%; + -webkit-animation: backgroundBlink 2s ease infinite; + -moz-animation: backgroundBlink 2s ease infinite; + animation: backgroundBlink 2s ease infinite; + + + color: var(--bg); + padding: 14px 20px; + margin: 8px 0; + border: none; + border-radius: var(--border-radius); + cursor: pointer; +} + +input[type=submit]:hover { + background-image: linear-gradient(223deg, var(--accent2),var(--accent1)); + background-size: 800% 800%; + -webkit-animation: backgroundBlink 2s ease infinite; + -moz-animation: backgroundBlink 2s ease infinite; + animation: backgroundBlink 2s ease infinite; + +} + +.contact-info { + display: flex; + flex-wrap: wrap; + justify-content: space-between; + label { + display: none; + + } + input { + flex: 1 1 330px; + min-width: 240px; + + } +} + +/*specific classes related to Checkbox skins*/ +/* CSS Created by CSS CHECKBOX */ +/**********************************/ +/**** www.CSScheckbox.com *********/ + +/*general styles for all CSS Checkboxes*/ +label { + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + display: none; + } + + input[type=checkbox].css-checkbox { + position: absolute; + overflow: hidden; + clip: rect(0 0 0 0); + height:1px; + width:1px; + margin:-1px; + padding:0; + border:0; + } + + input[type=checkbox].css-checkbox + label.css-label { + padding-left:20px; + height:15px; + display:inline-block; + background-repeat:no-repeat; + background-position: 0 0; + font-size:1em; + vertical-align:middle; + cursor:pointer; + } + + input[type=checkbox].css-checkbox:checked + label.css-label { + background-position: 0 -15px; + } + + .css-label{ + background-image:url(/assets/img/check.png); + } + + + + + input[type=checkbox].css-checkbox.lrg + label.css-label.lrg { + padding-left:22px; + height:20px; + display:inline-block; + line-height:20px; + background-repeat:no-repeat; + background-position: 0 0; + font-size:1em; + vertical-align:middle; + cursor:pointer; + } + + input[type=checkbox].css-checkbox.lrg:checked + label.css-label.lrg{ + + background-position: 0 -20px; + } + diff --git a/_sass/_layout.scss b/_sass/_layout.scss new file mode 100644 index 0000000..089793b --- /dev/null +++ b/_sass/_layout.scss @@ -0,0 +1,471 @@ +html, +body { + margin: 0; + padding: 0; + background-color: var(--bg); +} +body { + height: 100vh; + width: 100%; + font-family: _font(family); + font-weight: 300; + font-size: 1em; + color: var(--fg); + letter-spacing: _font(kerning); + background-color: var(--bg); +} +#main-wrapper { + display: flex; + flex-wrap: wrap; + width: 100%; + -webkit-transition: filter var(--anim-speed) ease-in; + -moz-transition: filter var(--anim-speed) ease-in; + -ms-transition: filter var(--anim-speed) ease-in-out; + transition: filter var(--anim-speed) ease-in; + z-index: 1; +} +.content-wrapper { + max-width: var(--max-width); + margin: auto; +} +.wrapper { + margin: 20px 40px; +} + +.hero { + display: flex; + flex-wrap: wrap; + flex-direction: row; + align-content: center; + background-color: transparent; + justify-content: center; + background-size: cover; + background-position: center; + background-repeat: no-repeat; + padding: 0; + position: relative; + min-height: 100vh; + width: 100vw; + + .textcontainer { + background: var(--bg-alt); + background: linear-gradient(33deg, transparent 0%, var(--bg) 90%, transparent 90%); + border-radius: var(--border-radius); + max-width: var(--max-width); + padding: 0px 40px 40px 40px; + + } + + div { + z-index: 10; + h1, + p { + flex: 1 0 100%; + + z-index: 10; + color: var(--fg); + max-width: var(--max-width); + margin-top: 40px; + } + + h1 { + font-size: 1.8em; + } + } + .imagecontainer { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + background-image: url("../img/vignette.svg"); + background-size: 960px; + background-repeat: repeat-x; + background-position: bottom; + z-index: 1; + h4 { + width: 90vw; + /* height: auto; */ + /* min-height: 100px; */ + line-height: 1.011em; + letter-spacing: -0em; + color: var(--bg); + font-size: 15vw; + display: inline; + opacity: 1; + border-radius: var(--border-radius); + position: absolute; + bottom: 0; + transform: rotate(-3deg); + overflow: hidden; + background: -webkit-linear-gradient(90deg, var(--bg) 25%,transparent 100%); + -webkit-background-clip: text; + -webkit-text-fill-color: transparent; + filter: blur(2px); + } + } + .splash { + background-color: transparent; + display: flex; + flex-wrap: wrap; + padding: 40px; + align-items: flex-start; + max-width: var(--max-width); + margin: auto; + .description { + display: flex; + flex-wrap: wrap; + border-radius: var(--border-radius); + background: var(--bg-alt); + box-shadow: 15px 15px 28px 24px var(--bg-alt); + -webkit-box-shadow: 15px 15px 28px 24px var(--bg-alt); + -moz-box-shadow: 15px 15px 28px 24px var(--bg-alt); + > * { + margin: 40px !important; + } + > ul { + display: flex; + justify-content: space-between; + flex-wrap: wrap; + + .button { + background-image: linear-gradient(228deg, var(--accent1-alt), var(--accent2-alt)); + background-size: 400% 400%; + -webkit-animation: backgroundBlink 7s ease infinite; + -moz-animation: backgroundBlink 7s ease infinite; + animation: backgroundBlink 7s ease infinite; + width: 100px; + height: 100px; + line-height: 100px; + margin: 0 0 10px 0; + padding:0; + font-size: 65px; + } + } + .mauticform_wrapper { + width: 200px; + .button { + border: 0; + } + } + } + h1, h2 { + font-size: 2em; + } + p, h1, h2, h3, h4 { + text-align: left; + margin-top: 20px; + + } + h1:first-child { + margin-top: 0; + } + div { + max-width: unset; + margin: 0; + flex: 1 1 300px; + + + } + .splash-logo { + padding: 0; + margin: 0; + } + @media only screen and (max-width: 759px) { + text-align: center; + div { + + padding: 20px 0; + } + .splash-logo { + padding: 20px 0; + } + + } + @media only screen and (max-width: 480px) { + + .description { + h1 { + font-size: 1.1em + } + > ul { + .button { + width: 75px; + height: 75px; + line-height: 75px; + + font-size: 55px; + } + } + } + } + } +} + +section { + .container { + max-width: var(--max-width); + margin: 0 auto; + } + flex: 1 1 100%; + background-color: var(--bg); + + z-index: 2; + h2 { + text-align: center; + padding: 40px 0; + } +} +section:first-of-type { + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + margin-top: 0; + padding-top: 40px; +} +.section-title { + padding: 80px; +} +footer { + width: 100%; + padding: 160px 20px 200px 20px; + background-color: var(--border-alt); + color: var(--fg); + background-image: url("../img/vignette-footer.svg"); + background-size: 500px; + background-repeat: repeat-x; + background-position: top; + box-sizing: border-box; + z-index: 2; + a { + color: var(--fg); + } + .icon { + color: var(--fg); + border: 1px solid var(--fg-alt); + } + .icon:hover { + border: 1px solid var(--accent2); + color: var(--accent2); + + } + .footframe { + display: flex; + flex-wrap: wrap; + justify-content: space-between; + max-width: var(--max-width); + margin: auto; + padding: 20px; + + div { + flex: 0 1 300px; + margin-bottom: 80px; + img { + margin: auto; + display: block; + width: 100%; + } + li { + + line-height: 2; + font-size: 1.5em; + a { + font-weight: 700; + text-decoration: none; + color: var(--fg); + } + a:hover { + color: var(--accent2); + } + + } + } + + small { + flex: 0 0 100%; + box-sizing: border-box; + margin: 0; + text-align: center; + font-size: 0.8em; + .label { + display: none; + } + } + } + @media only screen and (max-width: 679px) { + .footframe { + justify-content: center; + div { + flex-grow: 1; + } + } + } +} + +.post-navigation { + margin: 0; + .container { + display: flex; + flex-wrap: wrap; + justify-content: space-between; + padding: 40px; + align-items: flex-start; + max-width: var(--max-width); + margin: 0 auto; + h2 { + flex: 0 0 100%; + margin-top: 40px; + text-align: center; + } + .post-nav, + .post-nav-next { + flex: 1 0 200px; + + h4 { + font-size: 2em; + justify-self: right; + } + } + .post-nav { + margin: 0 40px 0 0; + text-align: left; + } + .post-nav-next { + margin: 0 0 0 40px; + text-align: right; + } + } +} +// album index +.releases { + padding: 80px 0; + + .container { + max-width: var(--max-width); + margin: 0 auto; + padding: 40px; + display: flex; + flex-wrap: wrap; + justify-content: space-between; + h2 { + flex: 0 0 100%; + margin: 20px; + } + article { + flex: 0 1 280px; + max-width: 480px; + margin: 20px 0; + } + @media only screen and (max-width: 640px) { + + article { + max-width: unset; + min-width: 100%; + flex-grow: 1; + margin: 20px 0; + } + } + img { + width: 100%; + height: 100%; + object-fit: cover; + border-radius: 5px; + } + } +} + +// Streambox +.streambox { + text-align: center; + line-height: 1em; + padding: 0; + padding-top: 80px; +} +.streamer { + max-width: var(--max-width); + margin: 80px auto; + padding: 0 40px; + text-align: center; + display: flex; + flex-wrap: wrap; + justify-content: space-around; + p { + text-align: center !important; + } + .icon { + flex: 0 0 100px; + margin: 0; + justify-self: center; + } +} + + +#pleroma { + padding: 60px 0; + .container { + display: flex; + flex-wrap: wrap; + + border-radius: var(--border-radius); + justify-content: space-between; + div { + flex: 1 1 280px; + padding: 20px; + margin: 20px; + overflow: hidden; + text-overflow: ellipsis; + background-color: var(--bg-alt); + box-shadow: 15px 15px 28px 24px var(--border-alt); + border-radius: var(--border-radius); + img { + max-width: 100%; + height: auto; + } + .date { + font-size: 0.6em; + margin-top: 10px; + img { + border-radius: 40px; + width: 40px; + height: 40px; + } + } + h2 { + padding-top: 0; + margin-bottom: 0px; + + } + hr { + + border: 1px solid var(--fg-alt); + } + } + } + @media only screen and (max-width: 720px) { + + .container { + width: 100vw; + justify-content: center; + div { + + flex: 1 1 280px; + } + } + } +} +.bio { + flex-wrap: wrap; + .mauticform_wrapper, .mauticform-input { + width: calc(100% - 80px); + max-width: 480px; + margin: 10px auto; + .button { + border: 0; + } + } +} +.mautic-focus { + font-family: 'Lucida Console', Monaco, monospace; + color: #3c2a52; + background-color: #3c2a52; +} \ No newline at end of file diff --git a/_sass/_navigation.scss b/_sass/_navigation.scss new file mode 100644 index 0000000..dcb7239 --- /dev/null +++ b/_sass/_navigation.scss @@ -0,0 +1,164 @@ +/* NAVIGATION */ + +#navbar { + z-index: 10000; + display: block; +} +.logo { + filter: blur(20px); + opacity: 0; + text-decoration: none; + position: fixed; + top:0; + width: 100%; + height: 60px; + z-index: 100; + -webkit-transition: all var(--anim-speed) ease-in; + -moz-transition: all var(--anim-speed) ease-in; + -ms-transition: all var(--anim-speed) ease-in; + transition: all var(--anim-speed) ease-in; + background-color: transparent; + background-repeat: no-repeat; + background-position: center center; + background-size: 95% 95%; + -webkit-box-shadow: 0px 12px 32px -25px var(--border-alt); + -moz-box-shadow: 0px 12px 32px -25px var(--border-alt); + box-shadow: 0px 12px 32px -25px var(--border-alt); + display: flex; + flex-wrap: wrap; + justify-content: flex-end; + align-items: center; + > a { + height: 40px; + + } + +} +.logo:hover { + filter: blur(0px); + opacity: 1; + -webkit-transition: all var(--anim-speed) ease-in; + -moz-transition: all var(--anim-speed) ease-in; + -ms-transition: all var(--anim-speed) ease-in; + transition: all var(--anim-speed) ease-in; + background-color: var(--bg); + +} +.sticky { + filter: blur(0px); + opacity: 1; + background-color: var(--bg); + -webkit-transition: all var(--anim-speed) ease-in; + -moz-transition: all var(--anim-speed) ease-in; + -ms-transition: all var(--anim-speed) ease-in; + transition: all var(--anim-speed) ease-in; + + } +.navmenu { + margin: 0 40px 0 20px; + font-size: 34px; + color:var(--accent1); +} + + +nav { + position: absolute; + width: 300px; + max-height: 90vh; + max-width: 90vw; + top: 50%; + left: 50%; + transform: translate(-50%, -50%); + background-color: var(--bg); + border-radius: var(--border-radius); + display: flex; + flex-wrap: wrap; + ul { + padding: 20px; + width: 100% + } + li { + list-style-type: none; + margin: 20px; + padding: 0; + a { + display: block; + font-size: 14px + } + .button { + display: block; + } + } + } + //.blurredout { + // filter: blur(5px); + // -webkit-transition: filter var(--anim-speed) ease-in; + // -moz-transition: filter var(--anim-speed) ease-in; + // transition: filter var(--anim-speed) ease-in; + // } + +.modalDialog { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + background: var(--bg-alt); + z-index: 10; + opacity:0; + -webkit-transition: opacity var(--anim-speed) ease-in; + -moz-transition: opacity var(--anim-speed) ease-in; + -ms-transition: opacity var(--anim-speed) ease-in; + transition: opacity var(--anim-speed) ease-in; + pointer-events: none; + +} + +.modalDialog:target { + opacity:1; + pointer-events: auto; +} + +.modalDialog > div { + + display: flex; + align-items: center; + position: relative; + margin: 100px auto; + padding: 20px; + border-radius: var(--border-radius); + +} + +.close-button { + background-color: var(--accent2); + color: var(--accent1); + margin: 0 auto; + line-height: 48px; + position: absolute; + right: -12px; + text-align: center; + top: -10px; + width: 48px; + height: 48px; + text-decoration: none; + font-weight: bold; + border-radius: 48px; + -webkit-transition: all var(--anim-speed) ease-in; + -moz-transition: all var(--anim-speed) ease-in; + -ms-transition: all var(--anim-speed) ease-in; + transition: all var(--anim-speed) ease-in; +} + +.close-button:hover { + background-color: var(--accent1); + color: var(--accent2); + +} + +#closearea { + position: fixed; + width: 100%; + height: 100%; + +} diff --git a/_sass/_noscripts.scss b/_sass/_noscripts.scss new file mode 100644 index 0000000..91b52b9 --- /dev/null +++ b/_sass/_noscripts.scss @@ -0,0 +1,39 @@ +// NAvigation + +.logo, #sticky { + filter: blur(0px); + opacity: 1; + background-color: var(--bg); + } + +.blurredout { + filter: blur(0px); + opacity: 1; + background-color: var(--bg); + -webkit-transition: all var(--anim-speed) ease-in; + -moz-transition: all var(--anim-speed) ease-in; + -ms-transition: all var(--anim-speed) ease-in; + transition: all var(--anim-speed) ease-in; + } + +.hero { + padding-top: 120px; +} + +// Player link +.player-wrap { + display: none; +} +.noJSalbum { + display: unset; + flex: 0 1 400px; + border-radius: var(--border-radius); + width: 100%; +} +#fixed-player { + display: unset; + height: unset; +} +.hideWhenNoJS { + display: none; +} \ No newline at end of file diff --git a/_sass/_player.scss b/_sass/_player.scss new file mode 100644 index 0000000..1141378 --- /dev/null +++ b/_sass/_player.scss @@ -0,0 +1,344 @@ +/* Audio Player Styles +================================================== */ + +/* Default / Desktop / Firefox */ +.album-player { + display: flex; + flex-wrap: wrap; + flex-direction: column-reverse; + padding: 0px 40px; + justify-content: space-around; + flex-direction: row-reverse; + align-items: center; + max-width: var(--max-width); + margin: auto; + flex: 1 1 auto; + > div { + margin: 20px 0; + flex: 1 0 300px; + } + .description { + + } +} + +audio { + margin: 0; + width: 100%; +} + +.player-wrap { + flex: 1 1 400px; + max-width: 700px; + border-radius: 5px; + width: 100%; + .shadow { + text-shadow: 0px 0px 15px var(--bg),0px 0px 15px var(--bg),0px 0px 30px var(--bg),0px 0px 45px var(--bg); + } +} +#plwrap { + + ul { + list-style: none; + padding: 0; + li { + border-top: solid 1px var(--bg); + + } + li:first-child { + border-radius: 5px 5px 0 0 ; + } + li:last-child { + border-radius: 0 0 5px 5px; + border-bottom: solid 1px var(--bg); + } + } +} + +#audiowrap { + background-color: var(--bg); + margin: 0 auto 0 auto; +} + +#plwrap { + margin: 0 auto; +} + +#tracks { + flex: 1 0 200px; + min-height: 65px; + position: relative; + text-align: center; + text-decoration: none; + padding-top: 20px; +} + + +#nowPlay { + display: flex; + width: 100%; + height: 80px; + flex-wrap: unset; + justify-content: flex-start; + align-items: center; + background-color: var(--bg); + +} + +#npTitle { + flex: 1 1 100%; + margin: 0; + padding: 21px; + +} + +#npAction { + display: none; + margin: 0; + padding: 21px; + font-size: 12px; +} + +#plList { + margin: 0; +} + +#plList li { + background-color: var(--bg-alt); + cursor: pointer; + margin: 0; + padding: 21px 0; + border-left: 1px solid var(--bg); + border-right: 1px solid var(--bg); + border-top: 0; + transition: all 400ms ease-in-out; +} + +#plList li:hover { + background-color: var(--accent2-alt); + color: var(--bg); + transition: all 400ms ease-in-out; +} + +.plItem { + position: relative; +} + +.plTitle { + left: 40px; + overflow: hidden; + position: absolute; + right: 65px; + text-overflow: ellipsis; + top: 0; + white-space: nowrap; + font-weight: bold; + padding-right: 10px; +} + +.plNum { + padding-left: 20px; + width: 20px; +} + +.plLength { + padding-left: 21px; + position: absolute; + right: 21px; + top: 0; +} + +.plSel { + background-color: var(--accent1-alt)!important; + cursor: pointer!important; + color: var(--bg); +} +.plSel:hover { + background-color: var(--accent2-alt)!important; +} + + +a[id^="btn"] { + font-size: 1.5em; + color: var(--fg); + cursor: pointer; + margin: 0; + padding: 0 27px 0 21px; + text-decoration: none; +} + + +a[id^="btn"]::-moz-focus-inner { + border: 0; + padding: 0; +} +.coverart { + flex: 1 1 400px; + justify-content: center; + display: flex; + flex-wrap: wrap; + max-width: 700px; + #author { + margin: 40px 0 0 0; + flex: 1 1 auto; + text-align: center; + } +} +.coverartwrapper { + + width: 70%; + padding-top: 70%; /* 1:1 Aspect Ratio */ + position: relative; /* If you want text inside of it */ +} + .coverartwrapped { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + border-radius: 100%; + padding-bottom: 0; + background-size: cover; + +} +.spinnit { + + -webkit-animation: infiniteRotate 2s linear infinite; /* Safari */ + -moz-animation: infiniteRotate 2s linear infinite; + animation: infiniteRotate 2s linear infinite; +} + +.paused { + animation-play-state: paused; +} + +.track-picker { + display: flex; + flex-wrap: wrap; + margin:0; + padding:0; + background-color: var(--accent1); + margin: 0; + padding: 0; + min-height: 50vh; + text-align: left; + .button { + background-color: var(--accent1); + color: var(--bg); + } + .button:hover { + background-color: var(--accent2); + + } + > div { + flex: 1 1 auto; + width: 50%; + min-width: 280px; + margin: 0; + padding: 0; + background-color: var(--bg); + -webkit-box-shadow: inset 0px 23px 25px -25px var(--border-alt); + -moz-box-shadow: inset 0px 23px 25px -25px var(--border-alt); + box-shadow: inset 0px 23px 25px -25px var(--border-alt); + + > h2, p { + text-align: left; + margin: 20px 40px; + } + p:last-child { + margin-bottom: 40px; + } + } + + .full-image { + width: 50%; + min-width: 280px; + min-height: 50vh; + background-color: transparent; + background-size: cover; + background-position: center; + } + +} + +.track-picker:nth-child(even) { + flex-direction: row-reverse; + background-color: var(--accent2); + text-align: right; + .button { + background-color: var(--accent2); + + } + .button:hover{ + background-color: var(--accent1); + + } + > div { + > h2, a, p { + text-align: right; + + } + } +} + +#fixedPlayer { + background-color: var(--bg); + margin: 0; + padding:0; + position: fixed; + bottom: 0; + left: 0; + width: 100%; + z-index: 100000; + -webkit-box-shadow: 0px 3px 35px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 3px 35px 2px rgba(0,0,0,0.3); + box-shadow: 0px 3px 35px 2px rgba(0,0,0,0.3); + -webkit-transition: all 400ms ease-in; + -moz-transition: all 400ms ease-in; + transition: all 400ms ease-in; +} +.showplayer { + height: 120px; + +} +.hideplayer { + height: 0; +} +@media only screen and (max-width: 559px) { + .track-picker { + background-size: 100%; + .full-image { + min-height: 100vw; + } + + } + #nowPlay { + + align-items: baseline; + padding-bottom: 20px; + } + #tracks { + flex: 1 0 100px; + width: 100px; + position: relative; + text-align: center; + text-decoration: none; + + } + a[id^="btn"] { + font-size: 1em; + color: var(--fg); + cursor: pointer; + margin: 0; + padding: 0 0 0 20px; + text-decoration: none; + } + #npTitle{ + + font-size: 0.8em; + + text-decoration: none; + margin: 0; + padding: 0 0 0 20px; + } +} \ No newline at end of file diff --git a/_sass/_set.scss b/_sass/_set.scss new file mode 100644 index 0000000..b9230f6 --- /dev/null +++ b/_sass/_set.scss @@ -0,0 +1,34 @@ +//* Cloudcannon *// + +.editor-link { + display: none; + margin-top: 0; + padding-top: 30px; + .btn { + border: 0; + border-radius: var(--border-radius); + width: 100%; + max-width: 500px; + box-sizing: border-box; + text-decoration: none; + padding: 10px 15px; + margin: 0; + font-size: 18px; + cursor: pointer; + background-color: #f7e064; + color: #333; + box-shadow: 1px 1px 5px 0 rgba(0, 0, 0, 0.2); + &:hover { + background-color: #f4d525; + color: #333; + } + } +} + +.cms-editor-active .editor-link { + display: block; +} + +.noJSalbum { + display: none; +} \ No newline at end of file diff --git a/_sass/_videos.scss b/_sass/_videos.scss new file mode 100644 index 0000000..6095656 --- /dev/null +++ b/_sass/_videos.scss @@ -0,0 +1,33 @@ +/* Background Video */ +.fullscreen-bg { + position: absolute; + height: 100%; + width: 100%; + overflow: hidden; + z-index: 0; + background: var(--bg); + top: 0; + left: 0; + right: 0; + z-index: 0; + +} + +.fullscreen-bg__video { + object-fit: cover; + width: 100vw; + height: 100vh; + position: absolute; + top: 0; + left: 0; + + +} +#myVideo { + position: absolute; + right: 0; + bottom: 0; + min-width: 100%; + min-height: 100%; + +} \ No newline at end of file diff --git a/_sass/libs/_animations.scss b/_sass/libs/_animations.scss new file mode 100644 index 0000000..73b7aa6 --- /dev/null +++ b/_sass/libs/_animations.scss @@ -0,0 +1,46 @@ +// Animation +@-webkit-keyframes infiniteRotate { + 0% { -webkit-transform: rotate(0deg); } + 100% { -webkit-transform: rotate(360deg); } +} +@-moz-keyframes infiniteRotate { + 0% { -webkit-transform: rotate(0deg); } + 100% { -webkit-transform: rotate(360deg); } +} +@keyframes infiniteRotate { + 0% { -webkit-transform: rotate(0deg); } + 100% { -webkit-transform: rotate(360deg); } +} + + +@-webkit-keyframes backgroundBlink { + 0%{background-position:73% 0%} + 50%{background-position:28% 100%} + 100%{background-position:73% 0%} +} +@-moz-keyframes backgroundBlink { + 0%{background-position:73% 0%} + 50%{background-position:28% 100%} + 100%{background-position:73% 0%} +} +@keyframes backgroundBlink { + 0%{background-position:73% 0%} + 50%{background-position:28% 100%} + 100%{background-position:73% 0%} +} + +@-webkit-keyframes backgroundSize { + 0%{background-size:100% 150%} + 50%{background-size:150% 100%} + 100%{background-size:100% 150%} +} +@-moz-keyframes backgroundSize { + 0%{background-size:100% 150%} + 50%{background-size:150% 100%} + 100%{background-size:100% 150%} +} +@keyframes backgroundSize { + 0%{background-size:100% 150%} + 50%{background-size:150% 100%} + 100%{background-size:100% 150%} +} \ No newline at end of file diff --git a/_sass/libs/_reset.scss b/_sass/libs/_reset.scss new file mode 100644 index 0000000..7a56930 --- /dev/null +++ b/_sass/libs/_reset.scss @@ -0,0 +1,78 @@ +/// +/// Story by HTML5 UP +/// html5up.net | @ajlkn +/// Free for personal and commercial use under the CCA 3.0 license (html5up.net/license) +/// + +// Reset. +// Based on meyerweb.com/eric/tools/css/reset (v2.0 | 20110126 | License: public domain) + +html, body, div, span, applet, object, +iframe, h1, h2, h3, h4, h5, h6, p, blockquote, +pre, a, abbr, acronym, address, big, cite, +code, del, dfn, em, img, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, b, +u, i, center, dl, dt, dd, ol, ul, li, fieldset, +form, label, legend, table, caption, tbody, +tfoot, thead, tr, th, td, article, aside, +canvas, details, embed, figure, figcaption, +footer, header, hgroup, menu, nav, output, ruby, +section, summary, time, mark, audio, video { + margin: 0; + padding: 0; + border: 0; + font-size: 100%; + font: inherit; + vertical-align: baseline; +} + +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} +html { + scroll-behavior: smooth; +} +body { + line-height: 1.75; +} + +ol, ul { + list-style:none; +} + +blockquote, q { + quotes: none; + + &:before, + &:after { + content: ''; + content: none; + } +} + +table { + border-collapse: collapse; + border-spacing: 0; +} + +body { + -webkit-text-size-adjust: none; +} + +mark { + background-color: transparent; + color: inherit; +} + +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +input, select, textarea { + -moz-appearance: none; + -webkit-appearance: none; + -ms-appearance: none; + appearance: none; +} diff --git a/_sass/libs/_vars.scss b/_sass/libs/_vars.scss new file mode 100644 index 0000000..2614347 --- /dev/null +++ b/_sass/libs/_vars.scss @@ -0,0 +1,117 @@ +/// Removes a specific item from a list. +/// @author Hugo Giraudel +/// @param {list} $list List. +/// @param {integer} $index Index. +/// @return {list} Updated list. +@function remove-nth($list, $index) { + + $result: null; + + @if type-of($index) != number { + @warn "$index: #{quote($index)} is not a number for `remove-nth`."; + } + @else if $index == 0 { + @warn "List index 0 must be a non-zero integer for `remove-nth`."; + } + @else if abs($index) > length($list) { + @warn "List index is #{$index} but list is only #{length($list)} item long for `remove-nth`."; + } + @else { + + $result: (); + $index: if($index < 0, length($list) + $index + 1, $index); + + @for $i from 1 through length($list) { + + @if $i != $index { + $result: append($result, nth($list, $i)); + } + + } + + } + + @return $result; + +} + +/// Gets a value from a map. +/// @author Hugo Giraudel +/// @param {map} $map Map. +/// @param {string} $keys Key(s). +/// @return {string} Value. +@function val($map, $keys...) { + + @if nth($keys, 1) == null { + $keys: remove-nth($keys, 1); + } + + @each $key in $keys { + $map: map-get($map, $key); + } + + @return $map; + +} + +/// Gets a font value. +/// @param {string} $keys Key(s). +/// @return {string} Value. +@function _font($keys...) { + @return val($font, $keys...); +} + +// /// Gets a palette value. +// /// @param {string} $keys Key(s). +// /// @return {string} Value. +// @function _palette($keys...) { +// @return val($palette, $keys...); +// } + + + +@font-face { + font-family: 'Terminus'; + font-style: normal; + font-weight: 400; + src: local('Terminus Regular'), local('Terminus-Regular'), url(/assets/fonts/terminus/TerminusTTF.ttf) format('truetype'); + } + +@font-face { + font-family: 'Terminus'; + font-style: normal; + font-weight: 700; + src: local('Terminus Bold'), local('Terminus-Vold'), url(/assets/fonts/terminus/TerminusTTF-Bold.ttf) format('truetype'); + } + +$font: ( + title: ('Terminus', 'Lucida Console', Monaco, monospace), + family: ('Terminus', 'Poppins', 'Arial', 'Helvetica', sans-serif), + family-fixed: ('Terminus', 'Lucida Console', Monaco, monospace), + weight: 400, + weight-bold: 700, + kerning: 0em, + kerning-alt: 0.125em +); +:root { + --border-radius: 3px; + --max-width: 1000px; + --anim-speed: 200ms; + +} + +// // Palette. +// $palette: ( + +// bg: #0C0F0A, +// bg-alt: rgba(12, 15, 10, 0.5), +// fg: #FFFFFF, +// fg-alt: rgba(255, 255, 255, 0.5), +// border: #000000, +// border-alt: rgba(0, 0, 0, 0.75), +// accent1: #41EAD4, +// accent1-alt:rgba(65, 234, 212, 0.75), +// accent2: #FF206E, +// accent2-alt:rgba(255, 32, 110, 0.75), + +// ); \ No newline at end of file diff --git a/_sass/staff.scss b/_sass/staff.scss new file mode 100644 index 0000000..e51615b --- /dev/null +++ b/_sass/staff.scss @@ -0,0 +1,48 @@ +.staff { + max-width: var(--max-width); + padding: 0; + margin: auto; + list-style: none; + + display: flex; + flex-wrap: wrap; + li { + flex: 1 1 300px; + display: flex; + flex-direction: column; + padding: 30px 20px; + box-sizing: border-box; + width: 100%; + text-align: center; + + .square-image { + background-size: cover; + background-position: center; + width: 100px; + height: 100px; + border-radius: 200px; + margin: 0 auto; + + } + } + + .name { + margin-top: 20px; + font-weight: 700; + } + + .position { + color: var(--fg); + font-size: 1em; + } + @media only screen and (max-width: 769px) { + li { + .square-image { + width: 70px; + height: 70px; + + + } + } + } +} diff --git a/_sass/svg.scss b/_sass/svg.scss new file mode 100644 index 0000000..c48d394 --- /dev/null +++ b/_sass/svg.scss @@ -0,0 +1,9 @@ +#linearGradient2060 { + stop { + stop-color: var(--accent2); + } + stop:nth-child(even){ + stop-color: var(--fg); + } + +} \ No newline at end of file diff --git a/_sass/trackplayer.scss b/_sass/trackplayer.scss new file mode 100644 index 0000000..9de100e --- /dev/null +++ b/_sass/trackplayer.scss @@ -0,0 +1,116 @@ + +#trackArt { + z-index: 5; + overflow-x: hidden; + flex: 1 1 50%; + min-width: 512px; + height: 100vh; + padding: 0; + margin: 0; + background-size: 100%; + background: var(--bg-alt); + background: linear-gradient(180deg, var(--bg-alt) 0%, var(--accent1-alt) 180%); + + > section { + position: absolute; + height: 100vh; + width: 50%; + background: transparent; + padding: 0; + margin: 0; + text-align: center; + > * { + margin: 40px; + } + + } + .coverartwrapper { + + margin-top: 120px; + margin-left: 50%; + transform: translateX(-50%); + + width: 50%; + padding-top: 50%; /* 1:1 Aspect Ratio */ + position: relative; /* If you want text inside of it */ + } + .coverartwrapped { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + border-radius: 100%; + padding-bottom: 0; + background-size: cover; + } + .playbutton { + cursor: pointer; + justify-self: center; + } + + } + #trackInfo { + flex: 1 1 50%; + z-index: 5; + height:100vh; + overflow-y: scroll; + overflow-x: hidden; + margin: 0; + padding: 0; + section { + padding: 20px; + background-color: var(--bg); + > * { + margin: 20px; + } + .info { + margin: 20px; + padding: 0; + } + p:first-child { + margin-top:80px; + } + } + + .post-nav-next { + text-align: right; + } + .post-nav { + text-align: left; + } + + } + .playerlogo { + + } + +@media only screen and (max-width: 1023px) { + #trackArt { + z-index: 5; + min-width: 100%; + section { + position: absolute; + top: 0; + margin: 0; + width: 100%; + height: 80vh; + } + } + #trackInfo { + z-index: 5; + height: unset; + overflow-y: unset; + section { + p:first-child { + margin-top:20px; + } + } + } +} + +.bouncer { + -webkit-animation: backgroundSize 10s ease infinite; + -moz-animation: backgroundSize 10s ease infinite; + animation: backgroundSize 10s ease infinite; +} \ No newline at end of file diff --git a/_sass/zafari.scss b/_sass/zafari.scss new file mode 100644 index 0000000..2d7474c --- /dev/null +++ b/_sass/zafari.scss @@ -0,0 +1,30 @@ +.zafariClass { + opacity:1; + pointer-events: auto; + background-color: var(--bg); + text-align: center; + z-index: 10000; + overflow-y: scroll; + > div { + flex-direction: column; + align-items: center; + justify-content: center; + max-width: 700px; + h2 { + font-family: _font(family); + } + ul { + padding: 20px; + width: 100% + } + li { + list-style-type: none; + margin: 20px; + padding: 0; + a { + display: block; + font-size: 14px + } + } + } +} diff --git a/_tracks/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.md b/_tracks/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.md new file mode 100644 index 0000000..96eb1b9 --- /dev/null +++ b/_tracks/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.md @@ -0,0 +1,220 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 +audio: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 +slug: cyber-grany/1-grandma-got-the-ssh-keys-insutrmental- +albumSlug: cyber-grany +trackSlug: 1-grandma-got-the-ssh-keys-insutrmental- +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg +cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8910720 + duration: 202.05714285714285 +native: + ID3v2.3: + - id: TIT2 + value: Grandma got the SSH keys (Insutrmental) + - id: TPE1 + value: 徒 Setto セット + - id: TRCK + value: 1/2 + - id: TALB + value: Cyber Grany + - id: TPE2 + value: To Setto Setto + - id: TCON + value: Acid Trap + - id: 'TXXX:CDDB DiscID' + value: 0200ca01 + - id: 'TXXX:discid' + value: 0200ca01 + - id: 'TXXX:MusicBrainz DiscID' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: 'TXXX:musicbrainz_discid' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: COMM + value: + language: xxx + description: WEBSITE + text: 'https://setto.basspistol.com' + - id: COMM + value: + language: xxx + description: Comment + text: Special track for Acid December 2019 + - id: TYER + value: '2019' +quality: + warnings: [] +common: + track: + 'no': 1 + of: 2 + disk: + 'no': null + of: null + title: Grandma got the SSH keys (Insutrmental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Cyber Grany + albumartist: To Setto Setto + genre: + - Acid Trap + comment: + - 'https://setto.basspistol.com' + - Special track for Acid December 2019 + year: 2019 +transformed: + ID3v2.3: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' +all: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' +nextTrack: &ref_1 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + audio: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 + slug: cyber-grany/2-grand-ma-is-a-cyborg-now + albumSlug: cyber-grany + trackSlug: 2-grand-ma-is-a-cyborg-now + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + cover: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9568512 + duration: 199.344 + native: + ID3v2.3: + - id: TIT2 + value: Grand'ma Is A Cyborg Now + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Cyber Grany + - id: TRCK + value: 2/2 + - id: TCON + value: Acid Trap + - id: TPE2 + value: To Setto Setto + - id: USLT + value: &ref_0 + language: eng + description: '' + text: |- + Got a friend request from my grandma + But she spelled her name with an O + Felt like it came from Futurama + but I know my OP-sec yo! + + Background check just didn't add up + Family tree is kind of messy + So I called her up + She loled out loud and said: hey sweetie! + + Why is it that you never call me? + Good thing I went through the zuck + Although I think it's kind of shitty + I simply had to try my luck + + Do I know what it does to democracy? + How come we have to be registered? + How can this promote any liberty? + If all we do in it is monitored? + + So many questions and all valid, + She checked all my OP-sec control + 94 years old and vivid + Holding strong her grandma role. + + She said next time we go for a stroll + I'll get to see her augmentation: + A 2kg aluminum walker-roll + A marvelous invention! + - id: TYER + value: '2020' + quality: + warnings: [] + common: + track: + 'no': 2 + of: 2 + disk: + 'no': null + of: null + title: Grand'ma Is A Cyborg Now + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Cyber Grany + genre: + - Acid Trap + albumartist: To Setto Setto + year: 2020 + transformed: + ID3v2.3: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' + all: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' +previousTrack: *ref_1 +--- diff --git a/_tracks/cyber-grany/2-grand-ma-is-a-cyborg-now.md b/_tracks/cyber-grany/2-grand-ma-is-a-cyborg-now.md new file mode 100644 index 0000000..1812220 --- /dev/null +++ b/_tracks/cyber-grany/2-grand-ma-is-a-cyborg-now.md @@ -0,0 +1,220 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 +audio: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.mp3 +slug: cyber-grany/2-grand-ma-is-a-cyborg-now +albumSlug: cyber-grany +trackSlug: 2-grand-ma-is-a-cyborg-now +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg +cover: /assets/albums/cyber-grany/2-grand-ma-is-a-cyborg-now.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9568512 + duration: 199.344 +native: + ID3v2.3: + - id: TIT2 + value: Grand'ma Is A Cyborg Now + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Cyber Grany + - id: TRCK + value: 2/2 + - id: TCON + value: Acid Trap + - id: TPE2 + value: To Setto Setto + - id: USLT + value: &ref_0 + language: eng + description: '' + text: |- + Got a friend request from my grandma + But she spelled her name with an O + Felt like it came from Futurama + but I know my OP-sec yo! + + Background check just didn't add up + Family tree is kind of messy + So I called her up + She loled out loud and said: hey sweetie! + + Why is it that you never call me? + Good thing I went through the zuck + Although I think it's kind of shitty + I simply had to try my luck + + Do I know what it does to democracy? + How come we have to be registered? + How can this promote any liberty? + If all we do in it is monitored? + + So many questions and all valid, + She checked all my OP-sec control + 94 years old and vivid + Holding strong her grandma role. + + She said next time we go for a stroll + I'll get to see her augmentation: + A 2kg aluminum walker-roll + A marvelous invention! + - id: TYER + value: '2020' +quality: + warnings: [] +common: + track: + 'no': 2 + of: 2 + disk: + 'no': null + of: null + title: Grand'ma Is A Cyborg Now + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Cyber Grany + genre: + - Acid Trap + albumartist: To Setto Setto + year: 2020 +transformed: + ID3v2.3: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' +all: + TIT2: Grand'ma Is A Cyborg Now + TPE1: 徒 setto セット + TALB: Cyber Grany + TRCK: 2/2 + TCON: Acid Trap + TPE2: To Setto Setto + USLT: *ref_0 + TYER: '2020' +nextTrack: &ref_1 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + audio: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.mp3 + slug: cyber-grany/1-grandma-got-the-ssh-keys-insutrmental- + albumSlug: cyber-grany + trackSlug: 1-grandma-got-the-ssh-keys-insutrmental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + cover: /assets/albums/cyber-grany/1-grandma-got-the-ssh-keys-insutrmental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8910720 + duration: 202.05714285714285 + native: + ID3v2.3: + - id: TIT2 + value: Grandma got the SSH keys (Insutrmental) + - id: TPE1 + value: 徒 Setto セット + - id: TRCK + value: 1/2 + - id: TALB + value: Cyber Grany + - id: TPE2 + value: To Setto Setto + - id: TCON + value: Acid Trap + - id: 'TXXX:CDDB DiscID' + value: 0200ca01 + - id: 'TXXX:discid' + value: 0200ca01 + - id: 'TXXX:MusicBrainz DiscID' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: 'TXXX:musicbrainz_discid' + value: bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + - id: COMM + value: + language: xxx + description: WEBSITE + text: 'https://setto.basspistol.com' + - id: COMM + value: + language: xxx + description: Comment + text: Special track for Acid December 2019 + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: 2 + disk: + 'no': null + of: null + title: Grandma got the SSH keys (Insutrmental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Cyber Grany + albumartist: To Setto Setto + genre: + - Acid Trap + comment: + - 'https://setto.basspistol.com' + - Special track for Acid December 2019 + year: 2019 + transformed: + ID3v2.3: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' + all: + TIT2: Grandma got the SSH keys (Insutrmental) + TPE1: 徒 Setto セット + TRCK: 1/2 + TALB: Cyber Grany + TPE2: To Setto Setto + TCON: Acid Trap + 'TXXX:CDDB DiscID': 0200ca01 + 'TXXX:discid': 0200ca01 + 'TXXX:MusicBrainz DiscID': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + 'TXXX:musicbrainz_discid': bhKd3SFqkr6x1L9X2JkIZ6UIaRA- + WEBSITE: 'https://setto.basspistol.com' + Comment: Special track for Acid December 2019 + TYER: '2019' +previousTrack: *ref_1 +--- diff --git a/_tracks/darkweb/1-swipe.md b/_tracks/darkweb/1-swipe.md new file mode 100644 index 0000000..e73d100 --- /dev/null +++ b/_tracks/darkweb/1-swipe.md @@ -0,0 +1,447 @@ +--- +layout: track +path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.mp3 +audio: /assets/albums/darkweb/1-swipe.mp3 +slug: darkweb/1-swipe +albumSlug: darkweb +trackSlug: 1-swipe +coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.jpeg +cover: /assets/albums/darkweb/1-swipe.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12388608 + duration: 280.9208163265306 +native: + ID3v2.3: + - id: TIT2 + value: Swipe + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' +quality: + warnings: [] +common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: Swipe + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 +transformed: + ID3v2.3: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' +all: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' +nextTrack: + path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.mp3 + audio: /assets/albums/darkweb/2-darkweb.mp3 + slug: darkweb/2-darkweb + albumSlug: darkweb + trackSlug: 2-darkweb + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.jpeg + cover: /assets/albums/darkweb/2-darkweb.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12566016 + duration: 284.94367346938776 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + - id: TCON + value: Cypher Rap + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Darkweb + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + all: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' +previousTrack: + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.mp3 + audio: /assets/albums/darkweb/4-darkweb-instrumental-.mp3 + slug: darkweb/4-darkweb-instrumental- + albumSlug: darkweb + trackSlug: 4-darkweb-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.jpeg + cover: /assets/albums/darkweb/4-darkweb-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12526848 + duration: 284.05551020408166 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: '' + - id: TALB + value: Darkweb + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cypher Rap + - id: TRCK + value: '4' + - id: COMM + value: + language: XXX + description: Comment + text: Cover art and music by To Setto Setto + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 4 + of: null + disk: + 'no': null + of: null + title: Darkweb (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - '' + - Cover art and music by To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' + all: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +--- diff --git a/_tracks/darkweb/2-darkweb.md b/_tracks/darkweb/2-darkweb.md new file mode 100644 index 0000000..cb53fa2 --- /dev/null +++ b/_tracks/darkweb/2-darkweb.md @@ -0,0 +1,442 @@ +--- +layout: track +path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.mp3 +audio: /assets/albums/darkweb/2-darkweb.mp3 +slug: darkweb/2-darkweb +albumSlug: darkweb +trackSlug: 2-darkweb +coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.jpeg +cover: /assets/albums/darkweb/2-darkweb.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12566016 + duration: 284.94367346938776 +native: + ID3v2.3: + - id: TIT2 + value: Darkweb + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + - id: TCON + value: Cypher Rap + - id: TYER + value: '2019' +quality: + warnings: [] +common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Darkweb + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 +transformed: + ID3v2.3: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' +all: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' +nextTrack: + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.mp3 + audio: /assets/albums/darkweb/3-swipe-instrumental-.mp3 + slug: darkweb/3-swipe-instrumental- + albumSlug: darkweb + trackSlug: 3-swipe-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.jpeg + cover: /assets/albums/darkweb/3-swipe-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12436992 + duration: 282.0179591836735 + native: + ID3v2.3: + - id: TIT2 + value: Swipe (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '3' + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: + - message: Illegal ID3v2 tag length + common: + track: + 'no': 3 + of: null + disk: + 'no': null + of: null + title: Swipe (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' +previousTrack: + path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.mp3 + audio: /assets/albums/darkweb/1-swipe.mp3 + slug: darkweb/1-swipe + albumSlug: darkweb + trackSlug: 1-swipe + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.jpeg + cover: /assets/albums/darkweb/1-swipe.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12388608 + duration: 280.9208163265306 + native: + ID3v2.3: + - id: TIT2 + value: Swipe + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: Swipe + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' +--- diff --git a/_tracks/darkweb/3-swipe-instrumental-.md b/_tracks/darkweb/3-swipe-instrumental-.md new file mode 100644 index 0000000..a4a821c --- /dev/null +++ b/_tracks/darkweb/3-swipe-instrumental-.md @@ -0,0 +1,270 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.mp3 +audio: /assets/albums/darkweb/3-swipe-instrumental-.mp3 +slug: darkweb/3-swipe-instrumental- +albumSlug: darkweb +trackSlug: 3-swipe-instrumental- +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.jpeg +cover: /assets/albums/darkweb/3-swipe-instrumental-.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12436992 + duration: 282.0179591836735 +native: + ID3v2.3: + - id: TIT2 + value: Swipe (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '3' + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' +quality: + warnings: + - message: Illegal ID3v2 tag length +common: + track: + 'no': 3 + of: null + disk: + 'no': null + of: null + title: Swipe (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 +transformed: + ID3v2.3: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' +all: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' +nextTrack: + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.mp3 + audio: /assets/albums/darkweb/4-darkweb-instrumental-.mp3 + slug: darkweb/4-darkweb-instrumental- + albumSlug: darkweb + trackSlug: 4-darkweb-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.jpeg + cover: /assets/albums/darkweb/4-darkweb-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12526848 + duration: 284.05551020408166 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: '' + - id: TALB + value: Darkweb + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cypher Rap + - id: TRCK + value: '4' + - id: COMM + value: + language: XXX + description: Comment + text: Cover art and music by To Setto Setto + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 4 + of: null + disk: + 'no': null + of: null + title: Darkweb (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - '' + - Cover art and music by To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' + all: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +previousTrack: + path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.mp3 + audio: /assets/albums/darkweb/2-darkweb.mp3 + slug: darkweb/2-darkweb + albumSlug: darkweb + trackSlug: 2-darkweb + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/2-darkweb.jpeg + cover: /assets/albums/darkweb/2-darkweb.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12566016 + duration: 284.94367346938776 + native: + ID3v2.3: + - id: TIT2 + value: Darkweb + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + - id: TCON + value: Cypher Rap + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Darkweb + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 + transformed: + ID3v2.3: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' + all: + TIT2: Darkweb + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Y'en a mare de ce web\r\nIl est tout pourri\r\nOn peu plus rien y faire\r\nSeulement pousser des cris\r\nQue personne va entendre\r\nSi t'as pas mille amis\r\nTa home-page va se pendre\r\nPerdu le goût de la vie\r\nEnvois ton Paypal\r\nJ'vais lui faire un refus\r\nAjoute-moi en ami\r\nTu vas kiffer mon flux\r\nViens pas faire ton vieux troll\r\nRien a foutre de toi\r\nT’écris de belles paroles\r\nRien à foutre de toi\r\nPuis au fond de ce noire\r\nJe vois un rayon\r\nUn programme provisoire\r\nPour poser mes sillons\r\nY a une communauté\r\nDe gens mal intégrés\r\nIl sont tous comme moi\r\nMais encore plus tarés\r\nProtocole anonyme\r\nConnexion en chiffré\r\nP2P solidaire\r\nConnexion certifiée\r\nLittéraire digital\r\nTu vas aussi kiffer\r\nÇa s'appelle le Darkweb\r\nTu vas aussi kiffer\r\n\r\nFacegoogle aux gogues\r\nY a plus que des conneries\r\nPropagande démagogue\r\nPetits chats tous mimis\r\nMais c'est quoi cette shit\r\nÇa veut plus rien dire\r\nLes keums envoient leurs bites\r\nComme si elles allaient applaudir\r\nNon! C'est trop con\r\nJe veux pas participer\r\nMais si je joue pas le jeux\r\nJe vais être abandonné\r\nPlus personne entendra\r\nTout ce que j'ai à crier\r\nPlus personne ne lira\r\nTout ce que j'ai à crier\r\nPuis au bout du tunnel\r\nJe vois une lueur étrange\r\nCelle d'un réseau fermé\r\nQui reste ouvert au strange\r\nUn lieu virtuel\r\nUne cité idéelle\r\nUne banque de données\r\nPour les mal intégrés\r\nJe peux y être qui je veux\r\nUn antichrist bien pleb\r\nAvoir beaucoup de cheveux\r\nUn intello du Zagreb\r\nT'as besoin d'faire entendre\r\nTu vas aussi kiffer\r\nLa clef tu peux la prendre\r\nTu vas aussi kiffer" + TCON: Cypher Rap + TYER: '2019' +--- diff --git a/_tracks/darkweb/4-darkweb-instrumental-.md b/_tracks/darkweb/4-darkweb-instrumental-.md new file mode 100644 index 0000000..86330f9 --- /dev/null +++ b/_tracks/darkweb/4-darkweb-instrumental-.md @@ -0,0 +1,442 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.mp3 +audio: /assets/albums/darkweb/4-darkweb-instrumental-.mp3 +slug: darkweb/4-darkweb-instrumental- +albumSlug: darkweb +trackSlug: 4-darkweb-instrumental- +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/4-darkweb-instrumental-.jpeg +cover: /assets/albums/darkweb/4-darkweb-instrumental-.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12526848 + duration: 284.05551020408166 +native: + ID3v2.3: + - id: TIT2 + value: Darkweb (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: '' + - id: TALB + value: Darkweb + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cypher Rap + - id: TRCK + value: '4' + - id: COMM + value: + language: XXX + description: Comment + text: Cover art and music by To Setto Setto + - id: TYER + value: '2019' +quality: + warnings: [] +common: + track: + 'no': 4 + of: null + disk: + 'no': null + of: null + title: Darkweb (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - '' + - Cover art and music by To Setto Setto + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cypher Rap + year: 2019 +transformed: + ID3v2.3: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +all: + TIT2: Darkweb (Instrumental) + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Darkweb + TPE2: 徒 Setto セット + TCON: Cypher Rap + TRCK: '4' + Comment: Cover art and music by To Setto Setto + TYER: '2019' +nextTrack: + path: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.mp3 + audio: /assets/albums/darkweb/1-swipe.mp3 + slug: darkweb/1-swipe + albumSlug: darkweb + trackSlug: 1-swipe + coverPath: /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/1-swipe.jpeg + cover: /assets/albums/darkweb/1-swipe.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12388608 + duration: 280.9208163265306 + native: + ID3v2.3: + - id: TIT2 + value: Swipe + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: >- + Comme tous les après-midis, Assis dans le tram en face d'une jolie + vie, + + Sur mon écran elles sont encore plus sexy. + + Swipe à gauche swipe à droite, + + Celle-ci a l'aire plutôt maladroite, + + Ça m'irait bien ça. + + Mais la personne en face de moi, + + Elle me matte, elle me mire. + + Je ne sais pas quoi faire, + + Qu'est-ce que je vais lui dire? + + Elle a de belles dents! + + Je vais retourner a mon écran. + + je n'ai simplement, + + Pas assez de cran. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + + + Si seulement elle voyait mon flux, + + Je suis sur qu'elle n'en pourrait plus! + + Comment je fais pour l'ajouter? + + Est-ce que Google pourrait la trouver? + + Hashtag jolitram, + + Faudrait que ça devienne viral sur Instagram. + + Ensemble on aurait peut-être un avenir! + + Mais comment coño vais-je lui dire? + + Merde elle appuie sur arrêt! + + Je lui tend mon casque ça le fait! + + Elle donne le siens truc de ouf?! + + Hésitations je m'immisce. + + Cette personne écoute de la bonne musique de glisse. + + + Je swipe à droite, + + Je swipe à gauche, + + Je yeuxt vers l'avant de temps en temps. + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: Swipe + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + - |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: |- + Comme tous les après-midis, Assis dans le tram en face d'une jolie vie, + Sur mon écran elles sont encore plus sexy. + Swipe à gauche swipe à droite, + Celle-ci a l'aire plutôt maladroite, + Ça m'irait bien ça. + Mais la personne en face de moi, + Elle me matte, elle me mire. + Je ne sais pas quoi faire, + Qu'est-ce que je vais lui dire? + Elle a de belles dents! + Je vais retourner a mon écran. + je n'ai simplement, + Pas assez de cran. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + + Si seulement elle voyait mon flux, + Je suis sur qu'elle n'en pourrait plus! + Comment je fais pour l'ajouter? + Est-ce que Google pourrait la trouver? + Hashtag jolitram, + Faudrait que ça devienne viral sur Instagram. + Ensemble on aurait peut-être un avenir! + Mais comment coño vais-je lui dire? + Merde elle appuie sur arrêt! + Je lui tend mon casque ça le fait! + Elle donne le siens truc de ouf?! + Hésitations je m'immisce. + Cette personne écoute de la bonne musique de glisse. + + Je swipe à droite, + Je swipe à gauche, + Je yeuxt vers l'avant de temps en temps. + TCON: Cyber Soul + TYER: '2019' +previousTrack: + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.mp3 + audio: /assets/albums/darkweb/3-swipe-instrumental-.mp3 + slug: darkweb/3-swipe-instrumental- + albumSlug: darkweb + trackSlug: 3-swipe-instrumental- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/darkweb/3-swipe-instrumental-.jpeg + cover: /assets/albums/darkweb/3-swipe-instrumental-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 12436992 + duration: 282.0179591836735 + native: + ID3v2.3: + - id: TIT2 + value: Swipe (Instrumental) + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: Comment + text: >- + Cover art by Mattias Ritarn Lindström, Music by + To Setto Setto + - id: TALB + value: Darkweb + - id: TRCK + value: '3' + - id: TPE2 + value: 徒 Setto セット + - id: TCON + value: Cyber Soul + - id: TYER + value: '2019' + quality: + warnings: + - message: Illegal ID3v2 tag length + common: + track: + 'no': 3 + of: null + disk: + 'no': null + of: null + title: Swipe (Instrumental) + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + album: Darkweb + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2019 + transformed: + ID3v2.3: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' + all: + TIT2: Swipe (Instrumental) + TPE1: 徒 Setto セット + Comment: 'Cover art by Mattias Ritarn Lindström, Music by To Setto Setto' + TALB: Darkweb + TRCK: '3' + TPE2: 徒 Setto セット + TCON: Cyber Soul + TYER: '2019' +--- diff --git a/_tracks/little-bug-ep/1-ding-ding-world.md b/_tracks/little-bug-ep/1-ding-ding-world.md new file mode 100644 index 0000000..51d9edd --- /dev/null +++ b/_tracks/little-bug-ep/1-ding-ding-world.md @@ -0,0 +1,375 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.mp3 +audio: /assets/albums/little-bug-ep/1-ding-ding-world.mp3 +slug: little-bug-ep/1-ding-ding-world +albumSlug: little-bug-ep +trackSlug: 1-ding-ding-world +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.jpeg +cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 9355392 + duration: 212.1404081632653 +native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Ding Ding World + - id: TRCK + value: '1' + - id: COMM + value: &ref_0 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: '' + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: bc760d71-a92d-44a4-8cae-907b26de8947 + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 +quality: + warnings: [] +common: + track: + 'no': 1 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - '' + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Ding Ding World + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 +transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.mp3 + audio: /assets/albums/little-bug-ep/2-little-bug.mp3 + slug: little-bug-ep/2-little-bug + albumSlug: little-bug-ep + trackSlug: 2-little-bug + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.jpeg + cover: /assets/albums/little-bug-ep/2-little-bug.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 6884352 + duration: 156.1077551020408 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Little Bug + - id: TRCK + value: '2' + - id: COMM + value: &ref_1 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: Randulo + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: 7a4ff716-7305-47d2-81b5-2689f1846cdd + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: fbb7ab99-ab85-4dea-be4d-282692d0050d + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - Randulo + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Little Bug + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +previousTrack: *ref_2 +--- diff --git a/_tracks/little-bug-ep/2-little-bug.md b/_tracks/little-bug-ep/2-little-bug.md new file mode 100644 index 0000000..d269dbd --- /dev/null +++ b/_tracks/little-bug-ep/2-little-bug.md @@ -0,0 +1,375 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.mp3 +audio: /assets/albums/little-bug-ep/2-little-bug.mp3 +slug: little-bug-ep/2-little-bug +albumSlug: little-bug-ep +trackSlug: 2-little-bug +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/2-little-bug.jpeg +cover: /assets/albums/little-bug-ep/2-little-bug.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 6884352 + duration: 156.1077551020408 +native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Little Bug + - id: TRCK + value: '2' + - id: COMM + value: &ref_0 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: Randulo + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: 7a4ff716-7305-47d2-81b5-2689f1846cdd + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: fbb7ab99-ab85-4dea-be4d-282692d0050d + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 +quality: + warnings: [] +common: + track: + 'no': 2 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - Randulo + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Little Bug + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 +transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Little Bug + TRCK: '2' + COMM: *ref_0 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': Randulo + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': 7a4ff716-7305-47d2-81b5-2689f1846cdd + 'TXXX:MUSICBRAINZ_TRACKID': fbb7ab99-ab85-4dea-be4d-282692d0050d + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.mp3 + audio: /assets/albums/little-bug-ep/1-ding-ding-world.mp3 + slug: little-bug-ep/1-ding-ding-world + albumSlug: little-bug-ep + trackSlug: 1-ding-ding-world + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/little-bug-ep/1-ding-ding-world.jpeg + cover: /assets/albums/little-bug-ep/1-ding-ding-world.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + numberOfSamples: 9355392 + duration: 212.1404081632653 + native: + ID3v2.3: + - id: TPE1 + value: 徒 Setto セット Feat. Randulo + - id: TALB + value: Little Bug EP + - id: TCON + value: Lo-Fi Hiphop + - id: TIT2 + value: Ding Ding World + - id: TRCK + value: '1' + - id: COMM + value: &ref_1 + language: eng + description: '' + text: 'https://setto.basspistol.com' + - id: TPE2 + value: 徒 Setto セット + - id: 'TXXX:CATALOGNUMBER' + value: BPIST-EP004 + - id: TPOS + value: '1' + - id: 'TXXX:RELEASECOUNTRY' + value: XW + - id: TSO2 + value: 徒 Setto セット + - id: TSOP + value: 徒 Setto セット Feat. Randulo + - id: 'TXXX:ARTISTS' + value: 徒 Setto セット + - id: 'TXXX:ARTISTS' + value: '' + - id: 'TXXX:DISCTOTAL' + value: '1' + - id: 'TXXX:LABEL' + value: Basspistol + - id: 'TXXX:MEDIA' + value: Digital Media + - id: 'TXXX:MUSICBRAINZ_ALBUMARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ALBUMID' + value: 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 31e8e456-0589-47eb-9334-20872851cd3e + - id: 'TXXX:MUSICBRAINZ_ARTISTID' + value: 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + - id: 'TXXX:MUSICBRAINZ_RELEASEGROUPID' + value: 89cd67a2-015f-4843-923c-9c4fb129ac28 + - id: 'TXXX:MUSICBRAINZ_RELEASETRACKID' + value: bc760d71-a92d-44a4-8cae-907b26de8947 + - id: 'TXXX:MUSICBRAINZ_TRACKID' + value: 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + - id: 'TXXX:ORIGINALYEAR' + value: '2021' + - id: 'TXXX:RELEASESTATUS' + value: official + - id: 'TXXX:RELEASETYPE' + value: ep + - id: 'TXXX:TOTALDISCS' + value: '1' + - id: 'TXXX:TOTALTRACKS' + value: '2' + - id: 'TXXX:TRACKTOTAL' + value: '2' + - id: TORY + value: '2021' + - id: TYER + value: '2021' + - id: TDAT + value: 0803 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': 1 + of: null + artists: + - 徒 Setto セット + - '' + artist: 徒 Setto セット Feat. Randulo + album: Little Bug EP + genre: + - Lo-Fi Hiphop + title: Ding Ding World + comment: + - 'https://setto.basspistol.com' + albumartist: 徒 Setto セット + catalognumber: + - BPIST-EP004 + releasecountry: XW + albumartistsort: 徒 Setto セット + artistsort: 徒 Setto セット Feat. Randulo + originalyear: 2021 + year: 2021 + transformed: + ID3v2.3: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 + all: + TPE1: 徒 Setto セット Feat. Randulo + TALB: Little Bug EP + TCON: Lo-Fi Hiphop + TIT2: Ding Ding World + TRCK: '1' + COMM: *ref_1 + TPE2: 徒 Setto セット + 'TXXX:CATALOGNUMBER': BPIST-EP004 + TPOS: '1' + 'TXXX:RELEASECOUNTRY': XW + TSO2: 徒 Setto セット + TSOP: 徒 Setto セット Feat. Randulo + 'TXXX:ARTISTS': '' + 'TXXX:DISCTOTAL': '1' + 'TXXX:LABEL': Basspistol + 'TXXX:MEDIA': Digital Media + 'TXXX:MUSICBRAINZ_ALBUMARTISTID': 31e8e456-0589-47eb-9334-20872851cd3e + 'TXXX:MUSICBRAINZ_ALBUMID': 33eaeafa-4dfb-425b-9e74-01cf2364cc8f + 'TXXX:MUSICBRAINZ_ARTISTID': 95954cb7-fc82-4516-aabc-2b6a4fdeea91 + 'TXXX:MUSICBRAINZ_RELEASEGROUPID': 89cd67a2-015f-4843-923c-9c4fb129ac28 + 'TXXX:MUSICBRAINZ_RELEASETRACKID': bc760d71-a92d-44a4-8cae-907b26de8947 + 'TXXX:MUSICBRAINZ_TRACKID': 1b726152-48f9-44a6-b7fe-117ecb6e16b7 + 'TXXX:ORIGINALYEAR': '2021' + 'TXXX:RELEASESTATUS': official + 'TXXX:RELEASETYPE': ep + 'TXXX:TOTALDISCS': '1' + 'TXXX:TOTALTRACKS': '2' + 'TXXX:TRACKTOTAL': '2' + TORY: '2021' + TYER: '2021' + TDAT: 0803 +previousTrack: *ref_2 +--- diff --git a/_tracks/live-with-hardware/1-ep-life-of-a-dudelini.md b/_tracks/live-with-hardware/1-ep-life-of-a-dudelini.md new file mode 100644 index 0000000..836a247 --- /dev/null +++ b/_tracks/live-with-hardware/1-ep-life-of-a-dudelini.md @@ -0,0 +1,98 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 +audio: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 +slug: live-with-hardware/1-ep-life-of-a-dudelini +albumSlug: live-with-hardware +trackSlug: 1-ep-life-of-a-dudelini +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg +cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg +format: &ref_1 + tagTypes: + - ID3v2.4 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 48000 + numberOfChannels: 2 + bitrate: 192000 + codecProfile: CBR + tool: LAME3.100 + duration: 683.472 +native: &ref_2 + ID3v2.4: + - id: TIT2 + value: EP-Life of a Dudelini + - id: TPE1 + value: 徒 Setto セット + - id: TALB + value: Live with hardware + - id: COMM + value: &ref_0 + language: eng + description: '' + text: Live take + - id: TDRC + value: '2020-04-20' + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul +quality: &ref_3 + warnings: [] +common: &ref_4 + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: EP-Life of a Dudelini + artists: + - 徒 Setto セット + artist: 徒 Setto セット + album: Live with hardware + comment: + - Live take + year: 2020 + date: '2020-04-20' + genre: + - Cybersoul +transformed: &ref_5 + ID3v2.4: + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_0 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul +all: &ref_6 + TIT2: EP-Life of a Dudelini + TPE1: 徒 Setto セット + TALB: Live with hardware + COMM: *ref_0 + TDRC: '2020-04-20' + TRCK: '1' + TCON: Cybersoul +nextTrack: &ref_7 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + audio: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.mp3 + slug: live-with-hardware/1-ep-life-of-a-dudelini + albumSlug: live-with-hardware + trackSlug: 1-ep-life-of-a-dudelini + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + cover: /assets/albums/live-with-hardware/1-ep-life-of-a-dudelini.jpeg + format: *ref_1 + native: *ref_2 + quality: *ref_3 + common: *ref_4 + transformed: *ref_5 + all: *ref_6 +previousTrack: *ref_7 +--- diff --git a/_tracks/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.md b/_tracks/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.md new file mode 100644 index 0000000..371a3af --- /dev/null +++ b/_tracks/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.md @@ -0,0 +1,185 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 +audio: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 +slug: satoshi-mon-ami/1-k-as-tu-fait-de-nous- +albumSlug: satoshi-mon-ami +trackSlug: 1-k-as-tu-fait-de-nous- +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg +cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13433472 + duration: 304.6138775510204 +native: + ID3v2.3: + - id: TIT2 + value: K'as-tu fait de nous? + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' +quality: + warnings: [] +common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: K'as-tu fait de nous? + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 +transformed: + ID3v2.3: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' +all: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + audio: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 + slug: satoshi-mon-ami/2-r-ve-de-toi + albumSlug: satoshi-mon-ami + trackSlug: 2-r-ve-de-toi + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + cover: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8195328 + duration: 185.83510204081634 + native: + ID3v2.3: + - id: TIT2 + value: Rêve de toi + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_1 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Rêve de toi + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' +previousTrack: *ref_2 +--- diff --git a/_tracks/satoshi-mon-ami/2-r-ve-de-toi.md b/_tracks/satoshi-mon-ami/2-r-ve-de-toi.md new file mode 100644 index 0000000..29e9eb7 --- /dev/null +++ b/_tracks/satoshi-mon-ami/2-r-ve-de-toi.md @@ -0,0 +1,185 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 +audio: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.mp3 +slug: satoshi-mon-ami/2-r-ve-de-toi +albumSlug: satoshi-mon-ami +trackSlug: 2-r-ve-de-toi +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg +cover: /assets/albums/satoshi-mon-ami/2-r-ve-de-toi.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 8195328 + duration: 185.83510204081634 +native: + ID3v2.3: + - id: TIT2 + value: Rêve de toi + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_0 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '2' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' +quality: + warnings: [] +common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + title: Rêve de toi + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 +transformed: + ID3v2.3: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' +all: + TIT2: Rêve de toi + TPE1: 徒 Setto セット + COMM: *ref_0 + TALB: Satoshi mon ami + TRCK: '2' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Je rêve de toi\r\nChaque jour je te vois\r\nJe fais pas de faux pas\r\nToujours des commentaires sympas\r\n\r\nTa vie est belle\r\nÇa se voit sur les cocotiers\r\nMais mon label\r\nNe pourras pas me déployer\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, ce n'est pas toi\r\n\r\nJ'ajoute des cœurs\r\nA tous les poste que tu publies\r\nJ’envoie des merdes\r\nA tous les cons qui t'humilient\r\n\r\nTa vie radieuse\r\nIllumine mes après-midi\r\nQuand je me lève\r\nAprès avoir perdu encore une nuit\r\n\r\nUne fois, chaque fois, que mon téléphone\r\nS’allume, s’éclaire, sonne le vibraphone\r\nJ’espère, c'est claire, que c'est la bonne\r\nFois en moi, mais cette fois, toujours pas toi" + TCON: Cyber Soul + TYER: '2018' +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + audio: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.mp3 + slug: satoshi-mon-ami/1-k-as-tu-fait-de-nous- + albumSlug: satoshi-mon-ami + trackSlug: 1-k-as-tu-fait-de-nous- + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + cover: /assets/albums/satoshi-mon-ami/1-k-as-tu-fait-de-nous-.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13433472 + duration: 304.6138775510204 + native: + ID3v2.3: + - id: TIT2 + value: K'as-tu fait de nous? + - id: TPE1 + value: 徒 Setto セット + - id: COMM + value: &ref_1 + language: XXX + description: '' + text: Cover art and music by To Setto Setto + - id: TALB + value: Satoshi mon ami + - id: TRCK + value: '1' + - id: TPE2 + value: 徒 Setto セット + - id: COMM + value: + language: XXX + description: UNSYNCEDLYRICS + text: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + - id: TCON + value: Cyber Soul + - id: TYER + value: '2018' + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + title: K'as-tu fait de nous? + artists: + - 徒 Setto セット + artist: 徒 Setto セット + comment: + - Cover art and music by To Setto Setto + - "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + album: Satoshi mon ami + albumartist: 徒 Setto セット + genre: + - Cyber Soul + year: 2018 + transformed: + ID3v2.3: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' + all: + TIT2: K'as-tu fait de nous? + TPE1: 徒 Setto セット + COMM: *ref_1 + TALB: Satoshi mon ami + TRCK: '1' + TPE2: 徒 Setto セット + UNSYNCEDLYRICS: "Qu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\nAcid est la tribe\r\nCyberpunk le game\r\nSur des reseau de bribe\r\non fait monter le fame\r\nMeme pas besoin de files\r\nIsole sur l'iles\r\non fait un tour au grotte\r\npour pas que la story capotte\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\n\r\nSi la police nous ajoute\r\nNouvelle vie nouveau compte\r\nOn tourne le dos au toute\r\non delete sans honte\r\nMeme pas besoin d'ecrire\r\ntu peux mäentendre rire\r\nen tour de face a face\r\nQui brise la glace\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\n\r\n24 heures pour dechiffre\r\nOn dirait une invitation\r\nLa story que t'as balancer\r\nCryptokids une seul nation\r\ncelle des rave et du reve\r\nHilife a plein poumons\r\nLe flux n'as pas de treve\r\nEt en suede il mange du saumon\r\n\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou\r\nQu'as-tu fais de nous\r\nWTF coucou\r\nQu'as tu fais de nous\r\nWTF coucou" + TCON: Cyber Soul + TYER: '2018' +previousTrack: *ref_2 +--- diff --git a/_tracks/unmet-dependencies/1-dependency-error.md b/_tracks/unmet-dependencies/1-dependency-error.md new file mode 100644 index 0000000..ad2aea6 --- /dev/null +++ b/_tracks/unmet-dependencies/1-dependency-error.md @@ -0,0 +1,214 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.mp3 +audio: /assets/albums/unmet-dependencies/1-dependency-error.mp3 +slug: unmet-dependencies/1-dependency-error +albumSlug: unmet-dependencies +trackSlug: 1-dependency-error +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.jpeg +cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13817088 + duration: 313.31265306122447 +native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Dependency Error + - id: USLT + value: &ref_0 + language: eng + description: '' + text: | + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + There is an error with my dependencies + Consultd 1.2 and emplyomentd 1.70 + I cannot pay my rent without their libraries + And to install I need to share my salary + Where do I fit in this society + The more I look and the less I see + They want no robots nor do they want me + Because work is a point in the agenda of the party + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + My liver isn't black market worthy + And my master degree from a street university + My ambitions are low and I am debt free + There is no room in the industry for robots like me + Don't get me wrong I would also like to be + Installed and running and compatible with society + But I am running a different library + Because my kernel is still libre and free + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + - id: TYER + value: '2020' + - id: TDAT + value: 0208 +quality: + warnings: [] +common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Dependency Error + year: 2020 +transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 +all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.mp3 + audio: /assets/albums/unmet-dependencies/2-pingnu.mp3 + slug: unmet-dependencies/2-pingnu + albumSlug: unmet-dependencies + trackSlug: 2-pingnu + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.jpeg + cover: /assets/albums/unmet-dependencies/2-pingnu.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9795456 + duration: 222.1191836734694 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '2' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Pingnu + - id: USLT + value: &ref_1 + language: eng + description: '' + text: | + I’m a little Pingu, riding on a GNU. + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could take me in. + Your computer and i could change the world we’re in. + Your freedom is being diluted. + And your code is being polluted. + + I’m a big GNU with my little Pingu, + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could compute. + Your freedom is not to dilute, + Someone has taken your tool into dispute, + This is what together we should refute. + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Pingnu + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 +previousTrack: *ref_2 +--- diff --git a/_tracks/unmet-dependencies/2-pingnu.md b/_tracks/unmet-dependencies/2-pingnu.md new file mode 100644 index 0000000..18cca6d --- /dev/null +++ b/_tracks/unmet-dependencies/2-pingnu.md @@ -0,0 +1,214 @@ +--- +layout: track +path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.mp3 +audio: /assets/albums/unmet-dependencies/2-pingnu.mp3 +slug: unmet-dependencies/2-pingnu +albumSlug: unmet-dependencies +trackSlug: 2-pingnu +coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/2-pingnu.jpeg +cover: /assets/albums/unmet-dependencies/2-pingnu.jpeg +format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 9795456 + duration: 222.1191836734694 +native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '2' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Pingnu + - id: USLT + value: &ref_0 + language: eng + description: '' + text: | + I’m a little Pingu, riding on a GNU. + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could take me in. + Your computer and i could change the world we’re in. + Your freedom is being diluted. + And your code is being polluted. + + I’m a big GNU with my little Pingu, + Looking at the world, looking at you. + Free at the core, i wonder why don’t you, + Look at me the way i look at you. + + It would be so nice, if you could compute. + Your freedom is not to dilute, + Someone has taken your tool into dispute, + This is what together we should refute. + - id: TYER + value: '2020' + - id: TDAT + value: 0208 +quality: + warnings: [] +common: + track: + 'no': 2 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Pingnu + year: 2020 +transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 +all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '2' + TCON: Cybersoul + TIT2: Pingnu + USLT: *ref_0 + TYER: '2020' + TDAT: 0208 +nextTrack: &ref_2 + path: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.mp3 + audio: /assets/albums/unmet-dependencies/1-dependency-error.mp3 + slug: unmet-dependencies/1-dependency-error + albumSlug: unmet-dependencies + trackSlug: 1-dependency-error + coverPath: >- + /mnt/usb32gb/organized-setto.media/assets/albums/unmet-dependencies/1-dependency-error.jpeg + cover: /assets/albums/unmet-dependencies/1-dependency-error.jpeg + format: + tagTypes: + - ID3v2.3 + trackInfo: [] + lossless: false + container: MPEG + codec: MPEG 1 Layer 3 + sampleRate: 44100 + numberOfChannels: 2 + bitrate: 128000 + codecProfile: CBR + numberOfSamples: 13817088 + duration: 313.31265306122447 + native: + ID3v2.3: + - id: TPE1 + value: 徒 setto セット + - id: TALB + value: Unmet Dependencies + - id: TRCK + value: '1' + - id: TCON + value: Cybersoul + - id: TIT2 + value: Dependency Error + - id: USLT + value: &ref_1 + language: eng + description: '' + text: | + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + There is an error with my dependencies + Consultd 1.2 and emplyomentd 1.70 + I cannot pay my rent without their libraries + And to install I need to share my salary + Where do I fit in this society + The more I look and the less I see + They want no robots nor do they want me + Because work is a point in the agenda of the party + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + + My liver isn't black market worthy + And my master degree from a street university + My ambitions are low and I am debt free + There is no room in the industry for robots like me + Don't get me wrong I would also like to be + Installed and running and compatible with society + But I am running a different library + Because my kernel is still libre and free + + Sudo apt update + Sudo apt upgrade + Sudo apt update + Sudo apt upgrade + - id: TYER + value: '2020' + - id: TDAT + value: 0208 + quality: + warnings: [] + common: + track: + 'no': 1 + of: null + disk: + 'no': null + of: null + artists: + - 徒 setto セット + artist: 徒 setto セット + album: Unmet Dependencies + genre: + - Cybersoul + title: Dependency Error + year: 2020 + transformed: + ID3v2.3: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 + all: + TPE1: 徒 setto セット + TALB: Unmet Dependencies + TRCK: '1' + TCON: Cybersoul + TIT2: Dependency Error + USLT: *ref_1 + TYER: '2020' + TDAT: 0208 +previousTrack: *ref_2 +--- diff --git a/about.md b/about.md new file mode 100644 index 0000000..bb957a6 --- /dev/null +++ b/about.md @@ -0,0 +1,18 @@ +--- +title: About +layout: page +description: WTF is 徒 setto セット and what does the funky characters mean? Why so cryptic and whodafuq? +image: /images/pages/creds.jpg +--- + +## Set, Party, Gang + +徒 setto セット is pronounced "To Setto Setto". I am the brainchild of wtfcoucou incarnated by Sethybwoy. Initially abandoned, this project first made sense as the post VHS-video era came to be. Cypher-punk at core, induced by popcorn chewing threads in obscure chat-rooms, my music is ▓▓▓▓▓▓▓ and ▓▓▓▓▓▓▓▓▓▓\! + +The true identity of my meat-bag has been doxxed several times and by now it's basically OSINT. Regardless, I don't like to talk about it, because who I am is not important. For all I care You could be Me\! Personally I wish I was a program, a Secret Squirrel, or just a plain good old Talefjant… What matters is the music and i would never dare to come between you and your relationship to it. Because the music became yours from the moment it left my computer to go out on the World Wild Web. + +Instead i like to talk about important things, like encryption, open protocols, memetic mythology, how to build a meshed-network or which autotune is best for GNU+Linux. For that i can be found on [matrix](https://matrix.to/#/!YQcdVviFQNGYFMYrxD:matrix.org?via=matrix.org){: target="_blank" rel="noopener noreferrer"} and [telegram.](https://t.me/tosettosetto){: target="_blank" rel="noopener noreferrer"} Or by encrypted email to setto@basspistol.com. (I rarely respond to emails if they aren't [GPG](https://keyserver.ubuntu.com/pks/lookup?search=setto%40basspistol.com&fingerprint=on&op=index&fbclid=IwAR14bD84366bC6e3XNV6nYkOy7DCcm5cBgM6Jmp74xWpdKdWsx3QaR77O1Y){: target="_blank" rel="noopener noreferrer"} signed.) + +I like to sing in french because it's a dead language in Cyberspace. But it sounds lit and is quite functional for poetry. However, if I could I would probably sing in Haskell. At some point I will. + +Hope you like my shit, or hate it for that matter\! Just make sure you share it\! \ No newline at end of file diff --git a/android-icon-192x192-dunplab-manifest-9805.png b/android-icon-192x192-dunplab-manifest-9805.png new file mode 100644 index 0000000..0f1072d Binary files /dev/null and b/android-icon-192x192-dunplab-manifest-9805.png differ diff --git a/apple-icon-114x114-dunplab-manifest-9805.png b/apple-icon-114x114-dunplab-manifest-9805.png new file mode 100644 index 0000000..d257c17 Binary files /dev/null and b/apple-icon-114x114-dunplab-manifest-9805.png differ diff --git a/apple-icon-120x120-dunplab-manifest-9805.png b/apple-icon-120x120-dunplab-manifest-9805.png new file mode 100644 index 0000000..86564bf Binary files /dev/null and b/apple-icon-120x120-dunplab-manifest-9805.png differ diff --git a/apple-icon-144x144-dunplab-manifest-9805.png b/apple-icon-144x144-dunplab-manifest-9805.png new file mode 100644 index 0000000..221ed3d Binary files /dev/null and b/apple-icon-144x144-dunplab-manifest-9805.png differ diff --git a/apple-icon-152x152-dunplab-manifest-9805.png b/apple-icon-152x152-dunplab-manifest-9805.png new file mode 100644 index 0000000..3a2f305 Binary files /dev/null and b/apple-icon-152x152-dunplab-manifest-9805.png differ diff --git a/apple-icon-180x180-dunplab-manifest-9805.png b/apple-icon-180x180-dunplab-manifest-9805.png new file mode 100644 index 0000000..4ec1f53 Binary files /dev/null and b/apple-icon-180x180-dunplab-manifest-9805.png differ diff --git a/apple-icon-57x57-dunplab-manifest-9805.png b/apple-icon-57x57-dunplab-manifest-9805.png new file mode 100644 index 0000000..d8b5822 Binary files /dev/null and b/apple-icon-57x57-dunplab-manifest-9805.png differ diff --git a/apple-icon-60x60-dunplab-manifest-9805.png b/apple-icon-60x60-dunplab-manifest-9805.png new file mode 100644 index 0000000..4d59c8a Binary files /dev/null and b/apple-icon-60x60-dunplab-manifest-9805.png differ diff --git a/apple-icon-72x72-dunplab-manifest-9805.png b/apple-icon-72x72-dunplab-manifest-9805.png new file mode 100644 index 0000000..55550c9 Binary files /dev/null and b/apple-icon-72x72-dunplab-manifest-9805.png differ diff --git a/apple-icon-76x76-dunplab-manifest-9805.png b/apple-icon-76x76-dunplab-manifest-9805.png new file mode 100644 index 0000000..3372539 Binary files /dev/null and b/apple-icon-76x76-dunplab-manifest-9805.png differ diff --git a/apple-touch-icon.png b/apple-touch-icon.png new file mode 100644 index 0000000..cd83253 Binary files /dev/null and b/apple-touch-icon.png differ diff --git a/assets/css/all.min.css b/assets/css/all.min.css new file mode 100644 index 0000000..f7eacc8 --- /dev/null +++ b/assets/css/all.min.css @@ -0,0 +1,5 @@ +/*! + * Font Awesome Free 5.14.0 by @fontawesome - https://fontawesome.com + * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License) + */ +.fa,.fab,.fad,.fal,.far,.fas{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;display:inline-block;font-style:normal;font-variant:normal;text-rendering:auto;line-height:1}.fa-lg{font-size:1.33333em;line-height:.75em;vertical-align:-.0667em}.fa-xs{font-size:.75em}.fa-sm{font-size:.875em}.fa-1x{font-size:1em}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-6x{font-size:6em}.fa-7x{font-size:7em}.fa-8x{font-size:8em}.fa-9x{font-size:9em}.fa-10x{font-size:10em}.fa-fw{text-align:center;width:1.25em}.fa-ul{list-style-type:none;margin-left:2.5em;padding-left:0}.fa-ul>li{position:relative}.fa-li{left:-2em;position:absolute;text-align:center;width:2em;line-height:inherit}.fa-border{border:.08em solid #eee;border-radius:.1em;padding:.2em .25em .15em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left,.fab.fa-pull-left,.fal.fa-pull-left,.far.fa-pull-left,.fas.fa-pull-left{margin-right:.3em}.fa.fa-pull-right,.fab.fa-pull-right,.fal.fa-pull-right,.far.fa-pull-right,.fas.fa-pull-right{margin-left:.3em}.fa-spin{-webkit-animation:fa-spin 2s linear infinite;animation:fa-spin 2s linear infinite}.fa-pulse{-webkit-animation:fa-spin 1s steps(8) infinite;animation:fa-spin 1s steps(8) infinite}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";-webkit-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";-webkit-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";-webkit-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";-webkit-transform:scaleX(-1);transform:scaleX(-1)}.fa-flip-vertical{-webkit-transform:scaleY(-1);transform:scaleY(-1)}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical,.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical{-webkit-transform:scale(-1);transform:scale(-1)}:root .fa-flip-both,:root .fa-flip-horizontal,:root .fa-flip-vertical,:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270{-webkit-filter:none;filter:none}.fa-stack{display:inline-block;height:2em;line-height:2em;position:relative;vertical-align:middle;width:2.5em}.fa-stack-1x,.fa-stack-2x{left:0;position:absolute;text-align:center;width:100%}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-500px:before{content:"\f26e"}.fa-accessible-icon:before{content:"\f368"}.fa-accusoft:before{content:"\f369"}.fa-acquisitions-incorporated:before{content:"\f6af"}.fa-ad:before{content:"\f641"}.fa-address-book:before{content:"\f2b9"}.fa-address-card:before{content:"\f2bb"}.fa-adjust:before{content:"\f042"}.fa-adn:before{content:"\f170"}.fa-adobe:before{content:"\f778"}.fa-adversal:before{content:"\f36a"}.fa-affiliatetheme:before{content:"\f36b"}.fa-air-freshener:before{content:"\f5d0"}.fa-airbnb:before{content:"\f834"}.fa-algolia:before{content:"\f36c"}.fa-align-center:before{content:"\f037"}.fa-align-justify:before{content:"\f039"}.fa-align-left:before{content:"\f036"}.fa-align-right:before{content:"\f038"}.fa-alipay:before{content:"\f642"}.fa-allergies:before{content:"\f461"}.fa-amazon:before{content:"\f270"}.fa-amazon-pay:before{content:"\f42c"}.fa-ambulance:before{content:"\f0f9"}.fa-american-sign-language-interpreting:before{content:"\f2a3"}.fa-amilia:before{content:"\f36d"}.fa-anchor:before{content:"\f13d"}.fa-android:before{content:"\f17b"}.fa-angellist:before{content:"\f209"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-down:before{content:"\f107"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angry:before{content:"\f556"}.fa-angrycreative:before{content:"\f36e"}.fa-angular:before{content:"\f420"}.fa-ankh:before{content:"\f644"}.fa-app-store:before{content:"\f36f"}.fa-app-store-ios:before{content:"\f370"}.fa-apper:before{content:"\f371"}.fa-apple:before{content:"\f179"}.fa-apple-alt:before{content:"\f5d1"}.fa-apple-pay:before{content:"\f415"}.fa-archive:before{content:"\f187"}.fa-archway:before{content:"\f557"}.fa-arrow-alt-circle-down:before{content:"\f358"}.fa-arrow-alt-circle-left:before{content:"\f359"}.fa-arrow-alt-circle-right:before{content:"\f35a"}.fa-arrow-alt-circle-up:before{content:"\f35b"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-down:before{content:"\f063"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrows-alt:before{content:"\f0b2"}.fa-arrows-alt-h:before{content:"\f337"}.fa-arrows-alt-v:before{content:"\f338"}.fa-artstation:before{content:"\f77a"}.fa-assistive-listening-systems:before{content:"\f2a2"}.fa-asterisk:before{content:"\f069"}.fa-asymmetrik:before{content:"\f372"}.fa-at:before{content:"\f1fa"}.fa-atlas:before{content:"\f558"}.fa-atlassian:before{content:"\f77b"}.fa-atom:before{content:"\f5d2"}.fa-audible:before{content:"\f373"}.fa-audio-description:before{content:"\f29e"}.fa-autoprefixer:before{content:"\f41c"}.fa-avianex:before{content:"\f374"}.fa-aviato:before{content:"\f421"}.fa-award:before{content:"\f559"}.fa-aws:before{content:"\f375"}.fa-baby:before{content:"\f77c"}.fa-baby-carriage:before{content:"\f77d"}.fa-backspace:before{content:"\f55a"}.fa-backward:before{content:"\f04a"}.fa-bacon:before{content:"\f7e5"}.fa-bacteria:before{content:"\e059"}.fa-bacterium:before{content:"\e05a"}.fa-bahai:before{content:"\f666"}.fa-balance-scale:before{content:"\f24e"}.fa-balance-scale-left:before{content:"\f515"}.fa-balance-scale-right:before{content:"\f516"}.fa-ban:before{content:"\f05e"}.fa-band-aid:before{content:"\f462"}.fa-bandcamp:before{content:"\f2d5"}.fa-barcode:before{content:"\f02a"}.fa-bars:before{content:"\f0c9"}.fa-baseball-ball:before{content:"\f433"}.fa-basketball-ball:before{content:"\f434"}.fa-bath:before{content:"\f2cd"}.fa-battery-empty:before{content:"\f244"}.fa-battery-full:before{content:"\f240"}.fa-battery-half:before{content:"\f242"}.fa-battery-quarter:before{content:"\f243"}.fa-battery-three-quarters:before{content:"\f241"}.fa-battle-net:before{content:"\f835"}.fa-bed:before{content:"\f236"}.fa-beer:before{content:"\f0fc"}.fa-behance:before{content:"\f1b4"}.fa-behance-square:before{content:"\f1b5"}.fa-bell:before{content:"\f0f3"}.fa-bell-slash:before{content:"\f1f6"}.fa-bezier-curve:before{content:"\f55b"}.fa-bible:before{content:"\f647"}.fa-bicycle:before{content:"\f206"}.fa-biking:before{content:"\f84a"}.fa-bimobject:before{content:"\f378"}.fa-binoculars:before{content:"\f1e5"}.fa-biohazard:before{content:"\f780"}.fa-birthday-cake:before{content:"\f1fd"}.fa-bitbucket:before{content:"\f171"}.fa-bitcoin:before{content:"\f379"}.fa-bity:before{content:"\f37a"}.fa-black-tie:before{content:"\f27e"}.fa-blackberry:before{content:"\f37b"}.fa-blender:before{content:"\f517"}.fa-blender-phone:before{content:"\f6b6"}.fa-blind:before{content:"\f29d"}.fa-blog:before{content:"\f781"}.fa-blogger:before{content:"\f37c"}.fa-blogger-b:before{content:"\f37d"}.fa-bluetooth:before{content:"\f293"}.fa-bluetooth-b:before{content:"\f294"}.fa-bold:before{content:"\f032"}.fa-bolt:before{content:"\f0e7"}.fa-bomb:before{content:"\f1e2"}.fa-bone:before{content:"\f5d7"}.fa-bong:before{content:"\f55c"}.fa-book:before{content:"\f02d"}.fa-book-dead:before{content:"\f6b7"}.fa-book-medical:before{content:"\f7e6"}.fa-book-open:before{content:"\f518"}.fa-book-reader:before{content:"\f5da"}.fa-bookmark:before{content:"\f02e"}.fa-bootstrap:before{content:"\f836"}.fa-border-all:before{content:"\f84c"}.fa-border-none:before{content:"\f850"}.fa-border-style:before{content:"\f853"}.fa-bowling-ball:before{content:"\f436"}.fa-box:before{content:"\f466"}.fa-box-open:before{content:"\f49e"}.fa-box-tissue:before{content:"\e05b"}.fa-boxes:before{content:"\f468"}.fa-braille:before{content:"\f2a1"}.fa-brain:before{content:"\f5dc"}.fa-bread-slice:before{content:"\f7ec"}.fa-briefcase:before{content:"\f0b1"}.fa-briefcase-medical:before{content:"\f469"}.fa-broadcast-tower:before{content:"\f519"}.fa-broom:before{content:"\f51a"}.fa-brush:before{content:"\f55d"}.fa-btc:before{content:"\f15a"}.fa-buffer:before{content:"\f837"}.fa-bug:before{content:"\f188"}.fa-building:before{content:"\f1ad"}.fa-bullhorn:before{content:"\f0a1"}.fa-bullseye:before{content:"\f140"}.fa-burn:before{content:"\f46a"}.fa-buromobelexperte:before{content:"\f37f"}.fa-bus:before{content:"\f207"}.fa-bus-alt:before{content:"\f55e"}.fa-business-time:before{content:"\f64a"}.fa-buy-n-large:before{content:"\f8a6"}.fa-buysellads:before{content:"\f20d"}.fa-calculator:before{content:"\f1ec"}.fa-calendar:before{content:"\f133"}.fa-calendar-alt:before{content:"\f073"}.fa-calendar-check:before{content:"\f274"}.fa-calendar-day:before{content:"\f783"}.fa-calendar-minus:before{content:"\f272"}.fa-calendar-plus:before{content:"\f271"}.fa-calendar-times:before{content:"\f273"}.fa-calendar-week:before{content:"\f784"}.fa-camera:before{content:"\f030"}.fa-camera-retro:before{content:"\f083"}.fa-campground:before{content:"\f6bb"}.fa-canadian-maple-leaf:before{content:"\f785"}.fa-candy-cane:before{content:"\f786"}.fa-cannabis:before{content:"\f55f"}.fa-capsules:before{content:"\f46b"}.fa-car:before{content:"\f1b9"}.fa-car-alt:before{content:"\f5de"}.fa-car-battery:before{content:"\f5df"}.fa-car-crash:before{content:"\f5e1"}.fa-car-side:before{content:"\f5e4"}.fa-caravan:before{content:"\f8ff"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-caret-square-down:before{content:"\f150"}.fa-caret-square-left:before{content:"\f191"}.fa-caret-square-right:before{content:"\f152"}.fa-caret-square-up:before{content:"\f151"}.fa-caret-up:before{content:"\f0d8"}.fa-carrot:before{content:"\f787"}.fa-cart-arrow-down:before{content:"\f218"}.fa-cart-plus:before{content:"\f217"}.fa-cash-register:before{content:"\f788"}.fa-cat:before{content:"\f6be"}.fa-cc-amazon-pay:before{content:"\f42d"}.fa-cc-amex:before{content:"\f1f3"}.fa-cc-apple-pay:before{content:"\f416"}.fa-cc-diners-club:before{content:"\f24c"}.fa-cc-discover:before{content:"\f1f2"}.fa-cc-jcb:before{content:"\f24b"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-cc-paypal:before{content:"\f1f4"}.fa-cc-stripe:before{content:"\f1f5"}.fa-cc-visa:before{content:"\f1f0"}.fa-centercode:before{content:"\f380"}.fa-centos:before{content:"\f789"}.fa-certificate:before{content:"\f0a3"}.fa-chair:before{content:"\f6c0"}.fa-chalkboard:before{content:"\f51b"}.fa-chalkboard-teacher:before{content:"\f51c"}.fa-charging-station:before{content:"\f5e7"}.fa-chart-area:before{content:"\f1fe"}.fa-chart-bar:before{content:"\f080"}.fa-chart-line:before{content:"\f201"}.fa-chart-pie:before{content:"\f200"}.fa-check:before{content:"\f00c"}.fa-check-circle:before{content:"\f058"}.fa-check-double:before{content:"\f560"}.fa-check-square:before{content:"\f14a"}.fa-cheese:before{content:"\f7ef"}.fa-chess:before{content:"\f439"}.fa-chess-bishop:before{content:"\f43a"}.fa-chess-board:before{content:"\f43c"}.fa-chess-king:before{content:"\f43f"}.fa-chess-knight:before{content:"\f441"}.fa-chess-pawn:before{content:"\f443"}.fa-chess-queen:before{content:"\f445"}.fa-chess-rook:before{content:"\f447"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-down:before{content:"\f078"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-chevron-up:before{content:"\f077"}.fa-child:before{content:"\f1ae"}.fa-chrome:before{content:"\f268"}.fa-chromecast:before{content:"\f838"}.fa-church:before{content:"\f51d"}.fa-circle:before{content:"\f111"}.fa-circle-notch:before{content:"\f1ce"}.fa-city:before{content:"\f64f"}.fa-clinic-medical:before{content:"\f7f2"}.fa-clipboard:before{content:"\f328"}.fa-clipboard-check:before{content:"\f46c"}.fa-clipboard-list:before{content:"\f46d"}.fa-clock:before{content:"\f017"}.fa-clone:before{content:"\f24d"}.fa-closed-captioning:before{content:"\f20a"}.fa-cloud:before{content:"\f0c2"}.fa-cloud-download-alt:before{content:"\f381"}.fa-cloud-meatball:before{content:"\f73b"}.fa-cloud-moon:before{content:"\f6c3"}.fa-cloud-moon-rain:before{content:"\f73c"}.fa-cloud-rain:before{content:"\f73d"}.fa-cloud-showers-heavy:before{content:"\f740"}.fa-cloud-sun:before{content:"\f6c4"}.fa-cloud-sun-rain:before{content:"\f743"}.fa-cloud-upload-alt:before{content:"\f382"}.fa-cloudscale:before{content:"\f383"}.fa-cloudsmith:before{content:"\f384"}.fa-cloudversify:before{content:"\f385"}.fa-cocktail:before{content:"\f561"}.fa-code:before{content:"\f121"}.fa-code-branch:before{content:"\f126"}.fa-codepen:before{content:"\f1cb"}.fa-codiepie:before{content:"\f284"}.fa-coffee:before{content:"\f0f4"}.fa-cog:before{content:"\f013"}.fa-cogs:before{content:"\f085"}.fa-coins:before{content:"\f51e"}.fa-columns:before{content:"\f0db"}.fa-comment:before{content:"\f075"}.fa-comment-alt:before{content:"\f27a"}.fa-comment-dollar:before{content:"\f651"}.fa-comment-dots:before{content:"\f4ad"}.fa-comment-medical:before{content:"\f7f5"}.fa-comment-slash:before{content:"\f4b3"}.fa-comments:before{content:"\f086"}.fa-comments-dollar:before{content:"\f653"}.fa-compact-disc:before{content:"\f51f"}.fa-compass:before{content:"\f14e"}.fa-compress:before{content:"\f066"}.fa-compress-alt:before{content:"\f422"}.fa-compress-arrows-alt:before{content:"\f78c"}.fa-concierge-bell:before{content:"\f562"}.fa-confluence:before{content:"\f78d"}.fa-connectdevelop:before{content:"\f20e"}.fa-contao:before{content:"\f26d"}.fa-cookie:before{content:"\f563"}.fa-cookie-bite:before{content:"\f564"}.fa-copy:before{content:"\f0c5"}.fa-copyright:before{content:"\f1f9"}.fa-cotton-bureau:before{content:"\f89e"}.fa-couch:before{content:"\f4b8"}.fa-cpanel:before{content:"\f388"}.fa-creative-commons:before{content:"\f25e"}.fa-creative-commons-by:before{content:"\f4e7"}.fa-creative-commons-nc:before{content:"\f4e8"}.fa-creative-commons-nc-eu:before{content:"\f4e9"}.fa-creative-commons-nc-jp:before{content:"\f4ea"}.fa-creative-commons-nd:before{content:"\f4eb"}.fa-creative-commons-pd:before{content:"\f4ec"}.fa-creative-commons-pd-alt:before{content:"\f4ed"}.fa-creative-commons-remix:before{content:"\f4ee"}.fa-creative-commons-sa:before{content:"\f4ef"}.fa-creative-commons-sampling:before{content:"\f4f0"}.fa-creative-commons-sampling-plus:before{content:"\f4f1"}.fa-creative-commons-share:before{content:"\f4f2"}.fa-creative-commons-zero:before{content:"\f4f3"}.fa-credit-card:before{content:"\f09d"}.fa-critical-role:before{content:"\f6c9"}.fa-crop:before{content:"\f125"}.fa-crop-alt:before{content:"\f565"}.fa-cross:before{content:"\f654"}.fa-crosshairs:before{content:"\f05b"}.fa-crow:before{content:"\f520"}.fa-crown:before{content:"\f521"}.fa-crutch:before{content:"\f7f7"}.fa-css3:before{content:"\f13c"}.fa-css3-alt:before{content:"\f38b"}.fa-cube:before{content:"\f1b2"}.fa-cubes:before{content:"\f1b3"}.fa-cut:before{content:"\f0c4"}.fa-cuttlefish:before{content:"\f38c"}.fa-d-and-d:before{content:"\f38d"}.fa-d-and-d-beyond:before{content:"\f6ca"}.fa-dailymotion:before{content:"\e052"}.fa-dashcube:before{content:"\f210"}.fa-database:before{content:"\f1c0"}.fa-deaf:before{content:"\f2a4"}.fa-deezer:before{content:"\e077"}.fa-delicious:before{content:"\f1a5"}.fa-democrat:before{content:"\f747"}.fa-deploydog:before{content:"\f38e"}.fa-deskpro:before{content:"\f38f"}.fa-desktop:before{content:"\f108"}.fa-dev:before{content:"\f6cc"}.fa-deviantart:before{content:"\f1bd"}.fa-dharmachakra:before{content:"\f655"}.fa-dhl:before{content:"\f790"}.fa-diagnoses:before{content:"\f470"}.fa-diaspora:before{content:"\f791"}.fa-dice:before{content:"\f522"}.fa-dice-d20:before{content:"\f6cf"}.fa-dice-d6:before{content:"\f6d1"}.fa-dice-five:before{content:"\f523"}.fa-dice-four:before{content:"\f524"}.fa-dice-one:before{content:"\f525"}.fa-dice-six:before{content:"\f526"}.fa-dice-three:before{content:"\f527"}.fa-dice-two:before{content:"\f528"}.fa-digg:before{content:"\f1a6"}.fa-digital-ocean:before{content:"\f391"}.fa-digital-tachograph:before{content:"\f566"}.fa-directions:before{content:"\f5eb"}.fa-discord:before{content:"\f392"}.fa-discourse:before{content:"\f393"}.fa-disease:before{content:"\f7fa"}.fa-divide:before{content:"\f529"}.fa-dizzy:before{content:"\f567"}.fa-dna:before{content:"\f471"}.fa-dochub:before{content:"\f394"}.fa-docker:before{content:"\f395"}.fa-dog:before{content:"\f6d3"}.fa-dollar-sign:before{content:"\f155"}.fa-dolly:before{content:"\f472"}.fa-dolly-flatbed:before{content:"\f474"}.fa-donate:before{content:"\f4b9"}.fa-door-closed:before{content:"\f52a"}.fa-door-open:before{content:"\f52b"}.fa-dot-circle:before{content:"\f192"}.fa-dove:before{content:"\f4ba"}.fa-download:before{content:"\f019"}.fa-draft2digital:before{content:"\f396"}.fa-drafting-compass:before{content:"\f568"}.fa-dragon:before{content:"\f6d5"}.fa-draw-polygon:before{content:"\f5ee"}.fa-dribbble:before{content:"\f17d"}.fa-dribbble-square:before{content:"\f397"}.fa-dropbox:before{content:"\f16b"}.fa-drum:before{content:"\f569"}.fa-drum-steelpan:before{content:"\f56a"}.fa-drumstick-bite:before{content:"\f6d7"}.fa-drupal:before{content:"\f1a9"}.fa-dumbbell:before{content:"\f44b"}.fa-dumpster:before{content:"\f793"}.fa-dumpster-fire:before{content:"\f794"}.fa-dungeon:before{content:"\f6d9"}.fa-dyalog:before{content:"\f399"}.fa-earlybirds:before{content:"\f39a"}.fa-ebay:before{content:"\f4f4"}.fa-edge:before{content:"\f282"}.fa-edge-legacy:before{content:"\e078"}.fa-edit:before{content:"\f044"}.fa-egg:before{content:"\f7fb"}.fa-eject:before{content:"\f052"}.fa-elementor:before{content:"\f430"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-ello:before{content:"\f5f1"}.fa-ember:before{content:"\f423"}.fa-empire:before{content:"\f1d1"}.fa-envelope:before{content:"\f0e0"}.fa-envelope-open:before{content:"\f2b6"}.fa-envelope-open-text:before{content:"\f658"}.fa-envelope-square:before{content:"\f199"}.fa-envira:before{content:"\f299"}.fa-equals:before{content:"\f52c"}.fa-eraser:before{content:"\f12d"}.fa-erlang:before{content:"\f39d"}.fa-ethereum:before{content:"\f42e"}.fa-ethernet:before{content:"\f796"}.fa-etsy:before{content:"\f2d7"}.fa-euro-sign:before{content:"\f153"}.fa-evernote:before{content:"\f839"}.fa-exchange-alt:before{content:"\f362"}.fa-exclamation:before{content:"\f12a"}.fa-exclamation-circle:before{content:"\f06a"}.fa-exclamation-triangle:before{content:"\f071"}.fa-expand:before{content:"\f065"}.fa-expand-alt:before{content:"\f424"}.fa-expand-arrows-alt:before{content:"\f31e"}.fa-expeditedssl:before{content:"\f23e"}.fa-external-link-alt:before{content:"\f35d"}.fa-external-link-square-alt:before{content:"\f360"}.fa-eye:before{content:"\f06e"}.fa-eye-dropper:before{content:"\f1fb"}.fa-eye-slash:before{content:"\f070"}.fa-facebook:before{content:"\f09a"}.fa-facebook-f:before{content:"\f39e"}.fa-facebook-messenger:before{content:"\f39f"}.fa-facebook-square:before{content:"\f082"}.fa-fan:before{content:"\f863"}.fa-fantasy-flight-games:before{content:"\f6dc"}.fa-fast-backward:before{content:"\f049"}.fa-fast-forward:before{content:"\f050"}.fa-faucet:before{content:"\e005"}.fa-fax:before{content:"\f1ac"}.fa-feather:before{content:"\f52d"}.fa-feather-alt:before{content:"\f56b"}.fa-fedex:before{content:"\f797"}.fa-fedora:before{content:"\f798"}.fa-female:before{content:"\f182"}.fa-fighter-jet:before{content:"\f0fb"}.fa-figma:before{content:"\f799"}.fa-file:before{content:"\f15b"}.fa-file-alt:before{content:"\f15c"}.fa-file-archive:before{content:"\f1c6"}.fa-file-audio:before{content:"\f1c7"}.fa-file-code:before{content:"\f1c9"}.fa-file-contract:before{content:"\f56c"}.fa-file-csv:before{content:"\f6dd"}.fa-file-download:before{content:"\f56d"}.fa-file-excel:before{content:"\f1c3"}.fa-file-export:before{content:"\f56e"}.fa-file-image:before{content:"\f1c5"}.fa-file-import:before{content:"\f56f"}.fa-file-invoice:before{content:"\f570"}.fa-file-invoice-dollar:before{content:"\f571"}.fa-file-medical:before{content:"\f477"}.fa-file-medical-alt:before{content:"\f478"}.fa-file-pdf:before{content:"\f1c1"}.fa-file-powerpoint:before{content:"\f1c4"}.fa-file-prescription:before{content:"\f572"}.fa-file-signature:before{content:"\f573"}.fa-file-upload:before{content:"\f574"}.fa-file-video:before{content:"\f1c8"}.fa-file-word:before{content:"\f1c2"}.fa-fill:before{content:"\f575"}.fa-fill-drip:before{content:"\f576"}.fa-film:before{content:"\f008"}.fa-filter:before{content:"\f0b0"}.fa-fingerprint:before{content:"\f577"}.fa-fire:before{content:"\f06d"}.fa-fire-alt:before{content:"\f7e4"}.fa-fire-extinguisher:before{content:"\f134"}.fa-firefox:before{content:"\f269"}.fa-firefox-browser:before{content:"\e007"}.fa-first-aid:before{content:"\f479"}.fa-first-order:before{content:"\f2b0"}.fa-first-order-alt:before{content:"\f50a"}.fa-firstdraft:before{content:"\f3a1"}.fa-fish:before{content:"\f578"}.fa-fist-raised:before{content:"\f6de"}.fa-flag:before{content:"\f024"}.fa-flag-checkered:before{content:"\f11e"}.fa-flag-usa:before{content:"\f74d"}.fa-flask:before{content:"\f0c3"}.fa-flickr:before{content:"\f16e"}.fa-flipboard:before{content:"\f44d"}.fa-flushed:before{content:"\f579"}.fa-fly:before{content:"\f417"}.fa-folder:before{content:"\f07b"}.fa-folder-minus:before{content:"\f65d"}.fa-folder-open:before{content:"\f07c"}.fa-folder-plus:before{content:"\f65e"}.fa-font:before{content:"\f031"}.fa-font-awesome:before{content:"\f2b4"}.fa-font-awesome-alt:before{content:"\f35c"}.fa-font-awesome-flag:before{content:"\f425"}.fa-font-awesome-logo-full:before{content:"\f4e6"}.fa-fonticons:before{content:"\f280"}.fa-fonticons-fi:before{content:"\f3a2"}.fa-football-ball:before{content:"\f44e"}.fa-fort-awesome:before{content:"\f286"}.fa-fort-awesome-alt:before{content:"\f3a3"}.fa-forumbee:before{content:"\f211"}.fa-forward:before{content:"\f04e"}.fa-foursquare:before{content:"\f180"}.fa-free-code-camp:before{content:"\f2c5"}.fa-freebsd:before{content:"\f3a4"}.fa-frog:before{content:"\f52e"}.fa-frown:before{content:"\f119"}.fa-frown-open:before{content:"\f57a"}.fa-fulcrum:before{content:"\f50b"}.fa-funnel-dollar:before{content:"\f662"}.fa-futbol:before{content:"\f1e3"}.fa-galactic-republic:before{content:"\f50c"}.fa-galactic-senate:before{content:"\f50d"}.fa-gamepad:before{content:"\f11b"}.fa-gas-pump:before{content:"\f52f"}.fa-gavel:before{content:"\f0e3"}.fa-gem:before{content:"\f3a5"}.fa-genderless:before{content:"\f22d"}.fa-get-pocket:before{content:"\f265"}.fa-gg:before{content:"\f260"}.fa-gg-circle:before{content:"\f261"}.fa-ghost:before{content:"\f6e2"}.fa-gift:before{content:"\f06b"}.fa-gifts:before{content:"\f79c"}.fa-git:before{content:"\f1d3"}.fa-git-alt:before{content:"\f841"}.fa-git-square:before{content:"\f1d2"}.fa-github:before{content:"\f09b"}.fa-github-alt:before{content:"\f113"}.fa-github-square:before{content:"\f092"}.fa-gitkraken:before{content:"\f3a6"}.fa-gitlab:before{content:"\f296"}.fa-gitter:before{content:"\f426"}.fa-glass-cheers:before{content:"\f79f"}.fa-glass-martini:before{content:"\f000"}.fa-glass-martini-alt:before{content:"\f57b"}.fa-glass-whiskey:before{content:"\f7a0"}.fa-glasses:before{content:"\f530"}.fa-glide:before{content:"\f2a5"}.fa-glide-g:before{content:"\f2a6"}.fa-globe:before{content:"\f0ac"}.fa-globe-africa:before{content:"\f57c"}.fa-globe-americas:before{content:"\f57d"}.fa-globe-asia:before{content:"\f57e"}.fa-globe-europe:before{content:"\f7a2"}.fa-gofore:before{content:"\f3a7"}.fa-golf-ball:before{content:"\f450"}.fa-goodreads:before{content:"\f3a8"}.fa-goodreads-g:before{content:"\f3a9"}.fa-google:before{content:"\f1a0"}.fa-google-drive:before{content:"\f3aa"}.fa-google-pay:before{content:"\e079"}.fa-google-play:before{content:"\f3ab"}.fa-google-plus:before{content:"\f2b3"}.fa-google-plus-g:before{content:"\f0d5"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-wallet:before{content:"\f1ee"}.fa-gopuram:before{content:"\f664"}.fa-graduation-cap:before{content:"\f19d"}.fa-gratipay:before{content:"\f184"}.fa-grav:before{content:"\f2d6"}.fa-greater-than:before{content:"\f531"}.fa-greater-than-equal:before{content:"\f532"}.fa-grimace:before{content:"\f57f"}.fa-grin:before{content:"\f580"}.fa-grin-alt:before{content:"\f581"}.fa-grin-beam:before{content:"\f582"}.fa-grin-beam-sweat:before{content:"\f583"}.fa-grin-hearts:before{content:"\f584"}.fa-grin-squint:before{content:"\f585"}.fa-grin-squint-tears:before{content:"\f586"}.fa-grin-stars:before{content:"\f587"}.fa-grin-tears:before{content:"\f588"}.fa-grin-tongue:before{content:"\f589"}.fa-grin-tongue-squint:before{content:"\f58a"}.fa-grin-tongue-wink:before{content:"\f58b"}.fa-grin-wink:before{content:"\f58c"}.fa-grip-horizontal:before{content:"\f58d"}.fa-grip-lines:before{content:"\f7a4"}.fa-grip-lines-vertical:before{content:"\f7a5"}.fa-grip-vertical:before{content:"\f58e"}.fa-gripfire:before{content:"\f3ac"}.fa-grunt:before{content:"\f3ad"}.fa-guitar:before{content:"\f7a6"}.fa-gulp:before{content:"\f3ae"}.fa-h-square:before{content:"\f0fd"}.fa-hacker-news:before{content:"\f1d4"}.fa-hacker-news-square:before{content:"\f3af"}.fa-hackerrank:before{content:"\f5f7"}.fa-hamburger:before{content:"\f805"}.fa-hammer:before{content:"\f6e3"}.fa-hamsa:before{content:"\f665"}.fa-hand-holding:before{content:"\f4bd"}.fa-hand-holding-heart:before{content:"\f4be"}.fa-hand-holding-medical:before{content:"\e05c"}.fa-hand-holding-usd:before{content:"\f4c0"}.fa-hand-holding-water:before{content:"\f4c1"}.fa-hand-lizard:before{content:"\f258"}.fa-hand-middle-finger:before{content:"\f806"}.fa-hand-paper:before{content:"\f256"}.fa-hand-peace:before{content:"\f25b"}.fa-hand-point-down:before{content:"\f0a7"}.fa-hand-point-left:before{content:"\f0a5"}.fa-hand-point-right:before{content:"\f0a4"}.fa-hand-point-up:before{content:"\f0a6"}.fa-hand-pointer:before{content:"\f25a"}.fa-hand-rock:before{content:"\f255"}.fa-hand-scissors:before{content:"\f257"}.fa-hand-sparkles:before{content:"\e05d"}.fa-hand-spock:before{content:"\f259"}.fa-hands:before{content:"\f4c2"}.fa-hands-helping:before{content:"\f4c4"}.fa-hands-wash:before{content:"\e05e"}.fa-handshake:before{content:"\f2b5"}.fa-handshake-alt-slash:before{content:"\e05f"}.fa-handshake-slash:before{content:"\e060"}.fa-hanukiah:before{content:"\f6e6"}.fa-hard-hat:before{content:"\f807"}.fa-hashtag:before{content:"\f292"}.fa-hat-cowboy:before{content:"\f8c0"}.fa-hat-cowboy-side:before{content:"\f8c1"}.fa-hat-wizard:before{content:"\f6e8"}.fa-hdd:before{content:"\f0a0"}.fa-head-side-cough:before{content:"\e061"}.fa-head-side-cough-slash:before{content:"\e062"}.fa-head-side-mask:before{content:"\e063"}.fa-head-side-virus:before{content:"\e064"}.fa-heading:before{content:"\f1dc"}.fa-headphones:before{content:"\f025"}.fa-headphones-alt:before{content:"\f58f"}.fa-headset:before{content:"\f590"}.fa-heart:before{content:"\f004"}.fa-heart-broken:before{content:"\f7a9"}.fa-heartbeat:before{content:"\f21e"}.fa-helicopter:before{content:"\f533"}.fa-highlighter:before{content:"\f591"}.fa-hiking:before{content:"\f6ec"}.fa-hippo:before{content:"\f6ed"}.fa-hips:before{content:"\f452"}.fa-hire-a-helper:before{content:"\f3b0"}.fa-history:before{content:"\f1da"}.fa-hockey-puck:before{content:"\f453"}.fa-holly-berry:before{content:"\f7aa"}.fa-home:before{content:"\f015"}.fa-hooli:before{content:"\f427"}.fa-hornbill:before{content:"\f592"}.fa-horse:before{content:"\f6f0"}.fa-horse-head:before{content:"\f7ab"}.fa-hospital:before{content:"\f0f8"}.fa-hospital-alt:before{content:"\f47d"}.fa-hospital-symbol:before{content:"\f47e"}.fa-hospital-user:before{content:"\f80d"}.fa-hot-tub:before{content:"\f593"}.fa-hotdog:before{content:"\f80f"}.fa-hotel:before{content:"\f594"}.fa-hotjar:before{content:"\f3b1"}.fa-hourglass:before{content:"\f254"}.fa-hourglass-end:before{content:"\f253"}.fa-hourglass-half:before{content:"\f252"}.fa-hourglass-start:before{content:"\f251"}.fa-house-damage:before{content:"\f6f1"}.fa-house-user:before{content:"\e065"}.fa-houzz:before{content:"\f27c"}.fa-hryvnia:before{content:"\f6f2"}.fa-html5:before{content:"\f13b"}.fa-hubspot:before{content:"\f3b2"}.fa-i-cursor:before{content:"\f246"}.fa-ice-cream:before{content:"\f810"}.fa-icicles:before{content:"\f7ad"}.fa-icons:before{content:"\f86d"}.fa-id-badge:before{content:"\f2c1"}.fa-id-card:before{content:"\f2c2"}.fa-id-card-alt:before{content:"\f47f"}.fa-ideal:before{content:"\e013"}.fa-igloo:before{content:"\f7ae"}.fa-image:before{content:"\f03e"}.fa-images:before{content:"\f302"}.fa-imdb:before{content:"\f2d8"}.fa-inbox:before{content:"\f01c"}.fa-indent:before{content:"\f03c"}.fa-industry:before{content:"\f275"}.fa-infinity:before{content:"\f534"}.fa-info:before{content:"\f129"}.fa-info-circle:before{content:"\f05a"}.fa-instagram:before{content:"\f16d"}.fa-instagram-square:before{content:"\e055"}.fa-intercom:before{content:"\f7af"}.fa-internet-explorer:before{content:"\f26b"}.fa-invision:before{content:"\f7b0"}.fa-ioxhost:before{content:"\f208"}.fa-italic:before{content:"\f033"}.fa-itch-io:before{content:"\f83a"}.fa-itunes:before{content:"\f3b4"}.fa-itunes-note:before{content:"\f3b5"}.fa-java:before{content:"\f4e4"}.fa-jedi:before{content:"\f669"}.fa-jedi-order:before{content:"\f50e"}.fa-jenkins:before{content:"\f3b6"}.fa-jira:before{content:"\f7b1"}.fa-joget:before{content:"\f3b7"}.fa-joint:before{content:"\f595"}.fa-joomla:before{content:"\f1aa"}.fa-journal-whills:before{content:"\f66a"}.fa-js:before{content:"\f3b8"}.fa-js-square:before{content:"\f3b9"}.fa-jsfiddle:before{content:"\f1cc"}.fa-kaaba:before{content:"\f66b"}.fa-kaggle:before{content:"\f5fa"}.fa-key:before{content:"\f084"}.fa-keybase:before{content:"\f4f5"}.fa-keyboard:before{content:"\f11c"}.fa-keycdn:before{content:"\f3ba"}.fa-khanda:before{content:"\f66d"}.fa-kickstarter:before{content:"\f3bb"}.fa-kickstarter-k:before{content:"\f3bc"}.fa-kiss:before{content:"\f596"}.fa-kiss-beam:before{content:"\f597"}.fa-kiss-wink-heart:before{content:"\f598"}.fa-kiwi-bird:before{content:"\f535"}.fa-korvue:before{content:"\f42f"}.fa-landmark:before{content:"\f66f"}.fa-language:before{content:"\f1ab"}.fa-laptop:before{content:"\f109"}.fa-laptop-code:before{content:"\f5fc"}.fa-laptop-house:before{content:"\e066"}.fa-laptop-medical:before{content:"\f812"}.fa-laravel:before{content:"\f3bd"}.fa-lastfm:before{content:"\f202"}.fa-lastfm-square:before{content:"\f203"}.fa-laugh:before{content:"\f599"}.fa-laugh-beam:before{content:"\f59a"}.fa-laugh-squint:before{content:"\f59b"}.fa-laugh-wink:before{content:"\f59c"}.fa-layer-group:before{content:"\f5fd"}.fa-leaf:before{content:"\f06c"}.fa-leanpub:before{content:"\f212"}.fa-lemon:before{content:"\f094"}.fa-less:before{content:"\f41d"}.fa-less-than:before{content:"\f536"}.fa-less-than-equal:before{content:"\f537"}.fa-level-down-alt:before{content:"\f3be"}.fa-level-up-alt:before{content:"\f3bf"}.fa-life-ring:before{content:"\f1cd"}.fa-lightbulb:before{content:"\f0eb"}.fa-line:before{content:"\f3c0"}.fa-link:before{content:"\f0c1"}.fa-linkedin:before{content:"\f08c"}.fa-linkedin-in:before{content:"\f0e1"}.fa-linode:before{content:"\f2b8"}.fa-linux:before{content:"\f17c"}.fa-lira-sign:before{content:"\f195"}.fa-list:before{content:"\f03a"}.fa-list-alt:before{content:"\f022"}.fa-list-ol:before{content:"\f0cb"}.fa-list-ul:before{content:"\f0ca"}.fa-location-arrow:before{content:"\f124"}.fa-lock:before{content:"\f023"}.fa-lock-open:before{content:"\f3c1"}.fa-long-arrow-alt-down:before{content:"\f309"}.fa-long-arrow-alt-left:before{content:"\f30a"}.fa-long-arrow-alt-right:before{content:"\f30b"}.fa-long-arrow-alt-up:before{content:"\f30c"}.fa-low-vision:before{content:"\f2a8"}.fa-luggage-cart:before{content:"\f59d"}.fa-lungs:before{content:"\f604"}.fa-lungs-virus:before{content:"\e067"}.fa-lyft:before{content:"\f3c3"}.fa-magento:before{content:"\f3c4"}.fa-magic:before{content:"\f0d0"}.fa-magnet:before{content:"\f076"}.fa-mail-bulk:before{content:"\f674"}.fa-mailchimp:before{content:"\f59e"}.fa-male:before{content:"\f183"}.fa-mandalorian:before{content:"\f50f"}.fa-map:before{content:"\f279"}.fa-map-marked:before{content:"\f59f"}.fa-map-marked-alt:before{content:"\f5a0"}.fa-map-marker:before{content:"\f041"}.fa-map-marker-alt:before{content:"\f3c5"}.fa-map-pin:before{content:"\f276"}.fa-map-signs:before{content:"\f277"}.fa-markdown:before{content:"\f60f"}.fa-marker:before{content:"\f5a1"}.fa-mars:before{content:"\f222"}.fa-mars-double:before{content:"\f227"}.fa-mars-stroke:before{content:"\f229"}.fa-mars-stroke-h:before{content:"\f22b"}.fa-mars-stroke-v:before{content:"\f22a"}.fa-mask:before{content:"\f6fa"}.fa-mastodon:before{content:"\f4f6"}.fa-maxcdn:before{content:"\f136"}.fa-mdb:before{content:"\f8ca"}.fa-medal:before{content:"\f5a2"}.fa-medapps:before{content:"\f3c6"}.fa-medium:before{content:"\f23a"}.fa-medium-m:before{content:"\f3c7"}.fa-medkit:before{content:"\f0fa"}.fa-medrt:before{content:"\f3c8"}.fa-meetup:before{content:"\f2e0"}.fa-megaport:before{content:"\f5a3"}.fa-meh:before{content:"\f11a"}.fa-meh-blank:before{content:"\f5a4"}.fa-meh-rolling-eyes:before{content:"\f5a5"}.fa-memory:before{content:"\f538"}.fa-mendeley:before{content:"\f7b3"}.fa-menorah:before{content:"\f676"}.fa-mercury:before{content:"\f223"}.fa-meteor:before{content:"\f753"}.fa-microblog:before{content:"\e01a"}.fa-microchip:before{content:"\f2db"}.fa-microphone:before{content:"\f130"}.fa-microphone-alt:before{content:"\f3c9"}.fa-microphone-alt-slash:before{content:"\f539"}.fa-microphone-slash:before{content:"\f131"}.fa-microscope:before{content:"\f610"}.fa-microsoft:before{content:"\f3ca"}.fa-minus:before{content:"\f068"}.fa-minus-circle:before{content:"\f056"}.fa-minus-square:before{content:"\f146"}.fa-mitten:before{content:"\f7b5"}.fa-mix:before{content:"\f3cb"}.fa-mixcloud:before{content:"\f289"}.fa-mixer:before{content:"\e056"}.fa-mizuni:before{content:"\f3cc"}.fa-mobile:before{content:"\f10b"}.fa-mobile-alt:before{content:"\f3cd"}.fa-modx:before{content:"\f285"}.fa-monero:before{content:"\f3d0"}.fa-money-bill:before{content:"\f0d6"}.fa-money-bill-alt:before{content:"\f3d1"}.fa-money-bill-wave:before{content:"\f53a"}.fa-money-bill-wave-alt:before{content:"\f53b"}.fa-money-check:before{content:"\f53c"}.fa-money-check-alt:before{content:"\f53d"}.fa-monument:before{content:"\f5a6"}.fa-moon:before{content:"\f186"}.fa-mortar-pestle:before{content:"\f5a7"}.fa-mosque:before{content:"\f678"}.fa-motorcycle:before{content:"\f21c"}.fa-mountain:before{content:"\f6fc"}.fa-mouse:before{content:"\f8cc"}.fa-mouse-pointer:before{content:"\f245"}.fa-mug-hot:before{content:"\f7b6"}.fa-music:before{content:"\f001"}.fa-napster:before{content:"\f3d2"}.fa-neos:before{content:"\f612"}.fa-network-wired:before{content:"\f6ff"}.fa-neuter:before{content:"\f22c"}.fa-newspaper:before{content:"\f1ea"}.fa-nimblr:before{content:"\f5a8"}.fa-node:before{content:"\f419"}.fa-node-js:before{content:"\f3d3"}.fa-not-equal:before{content:"\f53e"}.fa-notes-medical:before{content:"\f481"}.fa-npm:before{content:"\f3d4"}.fa-ns8:before{content:"\f3d5"}.fa-nutritionix:before{content:"\f3d6"}.fa-object-group:before{content:"\f247"}.fa-object-ungroup:before{content:"\f248"}.fa-odnoklassniki:before{content:"\f263"}.fa-odnoklassniki-square:before{content:"\f264"}.fa-oil-can:before{content:"\f613"}.fa-old-republic:before{content:"\f510"}.fa-om:before{content:"\f679"}.fa-opencart:before{content:"\f23d"}.fa-openid:before{content:"\f19b"}.fa-opera:before{content:"\f26a"}.fa-optin-monster:before{content:"\f23c"}.fa-orcid:before{content:"\f8d2"}.fa-osi:before{content:"\f41a"}.fa-otter:before{content:"\f700"}.fa-outdent:before{content:"\f03b"}.fa-page4:before{content:"\f3d7"}.fa-pagelines:before{content:"\f18c"}.fa-pager:before{content:"\f815"}.fa-paint-brush:before{content:"\f1fc"}.fa-paint-roller:before{content:"\f5aa"}.fa-palette:before{content:"\f53f"}.fa-palfed:before{content:"\f3d8"}.fa-pallet:before{content:"\f482"}.fa-paper-plane:before{content:"\f1d8"}.fa-paperclip:before{content:"\f0c6"}.fa-parachute-box:before{content:"\f4cd"}.fa-paragraph:before{content:"\f1dd"}.fa-parking:before{content:"\f540"}.fa-passport:before{content:"\f5ab"}.fa-pastafarianism:before{content:"\f67b"}.fa-paste:before{content:"\f0ea"}.fa-patreon:before{content:"\f3d9"}.fa-pause:before{content:"\f04c"}.fa-pause-circle:before{content:"\f28b"}.fa-paw:before{content:"\f1b0"}.fa-paypal:before{content:"\f1ed"}.fa-peace:before{content:"\f67c"}.fa-pen:before{content:"\f304"}.fa-pen-alt:before{content:"\f305"}.fa-pen-fancy:before{content:"\f5ac"}.fa-pen-nib:before{content:"\f5ad"}.fa-pen-square:before{content:"\f14b"}.fa-pencil-alt:before{content:"\f303"}.fa-pencil-ruler:before{content:"\f5ae"}.fa-penny-arcade:before{content:"\f704"}.fa-people-arrows:before{content:"\e068"}.fa-people-carry:before{content:"\f4ce"}.fa-pepper-hot:before{content:"\f816"}.fa-percent:before{content:"\f295"}.fa-percentage:before{content:"\f541"}.fa-periscope:before{content:"\f3da"}.fa-person-booth:before{content:"\f756"}.fa-phabricator:before{content:"\f3db"}.fa-phoenix-framework:before{content:"\f3dc"}.fa-phoenix-squadron:before{content:"\f511"}.fa-phone:before{content:"\f095"}.fa-phone-alt:before{content:"\f879"}.fa-phone-slash:before{content:"\f3dd"}.fa-phone-square:before{content:"\f098"}.fa-phone-square-alt:before{content:"\f87b"}.fa-phone-volume:before{content:"\f2a0"}.fa-photo-video:before{content:"\f87c"}.fa-php:before{content:"\f457"}.fa-pied-piper:before{content:"\f2ae"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-pied-piper-hat:before{content:"\f4e5"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-pied-piper-square:before{content:"\e01e"}.fa-piggy-bank:before{content:"\f4d3"}.fa-pills:before{content:"\f484"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-p:before{content:"\f231"}.fa-pinterest-square:before{content:"\f0d3"}.fa-pizza-slice:before{content:"\f818"}.fa-place-of-worship:before{content:"\f67f"}.fa-plane:before{content:"\f072"}.fa-plane-arrival:before{content:"\f5af"}.fa-plane-departure:before{content:"\f5b0"}.fa-plane-slash:before{content:"\e069"}.fa-play:before{content:"\f04b"}.fa-play-circle:before{content:"\f144"}.fa-playstation:before{content:"\f3df"}.fa-plug:before{content:"\f1e6"}.fa-plus:before{content:"\f067"}.fa-plus-circle:before{content:"\f055"}.fa-plus-square:before{content:"\f0fe"}.fa-podcast:before{content:"\f2ce"}.fa-poll:before{content:"\f681"}.fa-poll-h:before{content:"\f682"}.fa-poo:before{content:"\f2fe"}.fa-poo-storm:before{content:"\f75a"}.fa-poop:before{content:"\f619"}.fa-portrait:before{content:"\f3e0"}.fa-pound-sign:before{content:"\f154"}.fa-power-off:before{content:"\f011"}.fa-pray:before{content:"\f683"}.fa-praying-hands:before{content:"\f684"}.fa-prescription:before{content:"\f5b1"}.fa-prescription-bottle:before{content:"\f485"}.fa-prescription-bottle-alt:before{content:"\f486"}.fa-print:before{content:"\f02f"}.fa-procedures:before{content:"\f487"}.fa-product-hunt:before{content:"\f288"}.fa-project-diagram:before{content:"\f542"}.fa-pump-medical:before{content:"\e06a"}.fa-pump-soap:before{content:"\e06b"}.fa-pushed:before{content:"\f3e1"}.fa-puzzle-piece:before{content:"\f12e"}.fa-python:before{content:"\f3e2"}.fa-qq:before{content:"\f1d6"}.fa-qrcode:before{content:"\f029"}.fa-question:before{content:"\f128"}.fa-question-circle:before{content:"\f059"}.fa-quidditch:before{content:"\f458"}.fa-quinscape:before{content:"\f459"}.fa-quora:before{content:"\f2c4"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-quran:before{content:"\f687"}.fa-r-project:before{content:"\f4f7"}.fa-radiation:before{content:"\f7b9"}.fa-radiation-alt:before{content:"\f7ba"}.fa-rainbow:before{content:"\f75b"}.fa-random:before{content:"\f074"}.fa-raspberry-pi:before{content:"\f7bb"}.fa-ravelry:before{content:"\f2d9"}.fa-react:before{content:"\f41b"}.fa-reacteurope:before{content:"\f75d"}.fa-readme:before{content:"\f4d5"}.fa-rebel:before{content:"\f1d0"}.fa-receipt:before{content:"\f543"}.fa-record-vinyl:before{content:"\f8d9"}.fa-recycle:before{content:"\f1b8"}.fa-red-river:before{content:"\f3e3"}.fa-reddit:before{content:"\f1a1"}.fa-reddit-alien:before{content:"\f281"}.fa-reddit-square:before{content:"\f1a2"}.fa-redhat:before{content:"\f7bc"}.fa-redo:before{content:"\f01e"}.fa-redo-alt:before{content:"\f2f9"}.fa-registered:before{content:"\f25d"}.fa-remove-format:before{content:"\f87d"}.fa-renren:before{content:"\f18b"}.fa-reply:before{content:"\f3e5"}.fa-reply-all:before{content:"\f122"}.fa-replyd:before{content:"\f3e6"}.fa-republican:before{content:"\f75e"}.fa-researchgate:before{content:"\f4f8"}.fa-resolving:before{content:"\f3e7"}.fa-restroom:before{content:"\f7bd"}.fa-retweet:before{content:"\f079"}.fa-rev:before{content:"\f5b2"}.fa-ribbon:before{content:"\f4d6"}.fa-ring:before{content:"\f70b"}.fa-road:before{content:"\f018"}.fa-robot:before{content:"\f544"}.fa-rocket:before{content:"\f135"}.fa-rocketchat:before{content:"\f3e8"}.fa-rockrms:before{content:"\f3e9"}.fa-route:before{content:"\f4d7"}.fa-rss:before{content:"\f09e"}.fa-rss-square:before{content:"\f143"}.fa-ruble-sign:before{content:"\f158"}.fa-ruler:before{content:"\f545"}.fa-ruler-combined:before{content:"\f546"}.fa-ruler-horizontal:before{content:"\f547"}.fa-ruler-vertical:before{content:"\f548"}.fa-running:before{content:"\f70c"}.fa-rupee-sign:before{content:"\f156"}.fa-rust:before{content:"\e07a"}.fa-sad-cry:before{content:"\f5b3"}.fa-sad-tear:before{content:"\f5b4"}.fa-safari:before{content:"\f267"}.fa-salesforce:before{content:"\f83b"}.fa-sass:before{content:"\f41e"}.fa-satellite:before{content:"\f7bf"}.fa-satellite-dish:before{content:"\f7c0"}.fa-save:before{content:"\f0c7"}.fa-schlix:before{content:"\f3ea"}.fa-school:before{content:"\f549"}.fa-screwdriver:before{content:"\f54a"}.fa-scribd:before{content:"\f28a"}.fa-scroll:before{content:"\f70e"}.fa-sd-card:before{content:"\f7c2"}.fa-search:before{content:"\f002"}.fa-search-dollar:before{content:"\f688"}.fa-search-location:before{content:"\f689"}.fa-search-minus:before{content:"\f010"}.fa-search-plus:before{content:"\f00e"}.fa-searchengin:before{content:"\f3eb"}.fa-seedling:before{content:"\f4d8"}.fa-sellcast:before{content:"\f2da"}.fa-sellsy:before{content:"\f213"}.fa-server:before{content:"\f233"}.fa-servicestack:before{content:"\f3ec"}.fa-shapes:before{content:"\f61f"}.fa-share:before{content:"\f064"}.fa-share-alt:before{content:"\f1e0"}.fa-share-alt-square:before{content:"\f1e1"}.fa-share-square:before{content:"\f14d"}.fa-shekel-sign:before{content:"\f20b"}.fa-shield-alt:before{content:"\f3ed"}.fa-shield-virus:before{content:"\e06c"}.fa-ship:before{content:"\f21a"}.fa-shipping-fast:before{content:"\f48b"}.fa-shirtsinbulk:before{content:"\f214"}.fa-shoe-prints:before{content:"\f54b"}.fa-shopify:before{content:"\e057"}.fa-shopping-bag:before{content:"\f290"}.fa-shopping-basket:before{content:"\f291"}.fa-shopping-cart:before{content:"\f07a"}.fa-shopware:before{content:"\f5b5"}.fa-shower:before{content:"\f2cc"}.fa-shuttle-van:before{content:"\f5b6"}.fa-sign:before{content:"\f4d9"}.fa-sign-in-alt:before{content:"\f2f6"}.fa-sign-language:before{content:"\f2a7"}.fa-sign-out-alt:before{content:"\f2f5"}.fa-signal:before{content:"\f012"}.fa-signature:before{content:"\f5b7"}.fa-sim-card:before{content:"\f7c4"}.fa-simplybuilt:before{content:"\f215"}.fa-sink:before{content:"\e06d"}.fa-sistrix:before{content:"\f3ee"}.fa-sitemap:before{content:"\f0e8"}.fa-sith:before{content:"\f512"}.fa-skating:before{content:"\f7c5"}.fa-sketch:before{content:"\f7c6"}.fa-skiing:before{content:"\f7c9"}.fa-skiing-nordic:before{content:"\f7ca"}.fa-skull:before{content:"\f54c"}.fa-skull-crossbones:before{content:"\f714"}.fa-skyatlas:before{content:"\f216"}.fa-skype:before{content:"\f17e"}.fa-slack:before{content:"\f198"}.fa-slack-hash:before{content:"\f3ef"}.fa-slash:before{content:"\f715"}.fa-sleigh:before{content:"\f7cc"}.fa-sliders-h:before{content:"\f1de"}.fa-slideshare:before{content:"\f1e7"}.fa-smile:before{content:"\f118"}.fa-smile-beam:before{content:"\f5b8"}.fa-smile-wink:before{content:"\f4da"}.fa-smog:before{content:"\f75f"}.fa-smoking:before{content:"\f48d"}.fa-smoking-ban:before{content:"\f54d"}.fa-sms:before{content:"\f7cd"}.fa-snapchat:before{content:"\f2ab"}.fa-snapchat-ghost:before{content:"\f2ac"}.fa-snapchat-square:before{content:"\f2ad"}.fa-snowboarding:before{content:"\f7ce"}.fa-snowflake:before{content:"\f2dc"}.fa-snowman:before{content:"\f7d0"}.fa-snowplow:before{content:"\f7d2"}.fa-soap:before{content:"\e06e"}.fa-socks:before{content:"\f696"}.fa-solar-panel:before{content:"\f5ba"}.fa-sort:before{content:"\f0dc"}.fa-sort-alpha-down:before{content:"\f15d"}.fa-sort-alpha-down-alt:before{content:"\f881"}.fa-sort-alpha-up:before{content:"\f15e"}.fa-sort-alpha-up-alt:before{content:"\f882"}.fa-sort-amount-down:before{content:"\f160"}.fa-sort-amount-down-alt:before{content:"\f884"}.fa-sort-amount-up:before{content:"\f161"}.fa-sort-amount-up-alt:before{content:"\f885"}.fa-sort-down:before{content:"\f0dd"}.fa-sort-numeric-down:before{content:"\f162"}.fa-sort-numeric-down-alt:before{content:"\f886"}.fa-sort-numeric-up:before{content:"\f163"}.fa-sort-numeric-up-alt:before{content:"\f887"}.fa-sort-up:before{content:"\f0de"}.fa-soundcloud:before{content:"\f1be"}.fa-sourcetree:before{content:"\f7d3"}.fa-spa:before{content:"\f5bb"}.fa-space-shuttle:before{content:"\f197"}.fa-speakap:before{content:"\f3f3"}.fa-speaker-deck:before{content:"\f83c"}.fa-spell-check:before{content:"\f891"}.fa-spider:before{content:"\f717"}.fa-spinner:before{content:"\f110"}.fa-splotch:before{content:"\f5bc"}.fa-spotify:before{content:"\f1bc"}.fa-spray-can:before{content:"\f5bd"}.fa-square:before{content:"\f0c8"}.fa-square-full:before{content:"\f45c"}.fa-square-root-alt:before{content:"\f698"}.fa-squarespace:before{content:"\f5be"}.fa-stack-exchange:before{content:"\f18d"}.fa-stack-overflow:before{content:"\f16c"}.fa-stackpath:before{content:"\f842"}.fa-stamp:before{content:"\f5bf"}.fa-star:before{content:"\f005"}.fa-star-and-crescent:before{content:"\f699"}.fa-star-half:before{content:"\f089"}.fa-star-half-alt:before{content:"\f5c0"}.fa-star-of-david:before{content:"\f69a"}.fa-star-of-life:before{content:"\f621"}.fa-staylinked:before{content:"\f3f5"}.fa-steam:before{content:"\f1b6"}.fa-steam-square:before{content:"\f1b7"}.fa-steam-symbol:before{content:"\f3f6"}.fa-step-backward:before{content:"\f048"}.fa-step-forward:before{content:"\f051"}.fa-stethoscope:before{content:"\f0f1"}.fa-sticker-mule:before{content:"\f3f7"}.fa-sticky-note:before{content:"\f249"}.fa-stop:before{content:"\f04d"}.fa-stop-circle:before{content:"\f28d"}.fa-stopwatch:before{content:"\f2f2"}.fa-stopwatch-20:before{content:"\e06f"}.fa-store:before{content:"\f54e"}.fa-store-alt:before{content:"\f54f"}.fa-store-alt-slash:before{content:"\e070"}.fa-store-slash:before{content:"\e071"}.fa-strava:before{content:"\f428"}.fa-stream:before{content:"\f550"}.fa-street-view:before{content:"\f21d"}.fa-strikethrough:before{content:"\f0cc"}.fa-stripe:before{content:"\f429"}.fa-stripe-s:before{content:"\f42a"}.fa-stroopwafel:before{content:"\f551"}.fa-studiovinari:before{content:"\f3f8"}.fa-stumbleupon:before{content:"\f1a4"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-subscript:before{content:"\f12c"}.fa-subway:before{content:"\f239"}.fa-suitcase:before{content:"\f0f2"}.fa-suitcase-rolling:before{content:"\f5c1"}.fa-sun:before{content:"\f185"}.fa-superpowers:before{content:"\f2dd"}.fa-superscript:before{content:"\f12b"}.fa-supple:before{content:"\f3f9"}.fa-surprise:before{content:"\f5c2"}.fa-suse:before{content:"\f7d6"}.fa-swatchbook:before{content:"\f5c3"}.fa-swift:before{content:"\f8e1"}.fa-swimmer:before{content:"\f5c4"}.fa-swimming-pool:before{content:"\f5c5"}.fa-symfony:before{content:"\f83d"}.fa-synagogue:before{content:"\f69b"}.fa-sync:before{content:"\f021"}.fa-sync-alt:before{content:"\f2f1"}.fa-syringe:before{content:"\f48e"}.fa-table:before{content:"\f0ce"}.fa-table-tennis:before{content:"\f45d"}.fa-tablet:before{content:"\f10a"}.fa-tablet-alt:before{content:"\f3fa"}.fa-tablets:before{content:"\f490"}.fa-tachometer-alt:before{content:"\f3fd"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-tape:before{content:"\f4db"}.fa-tasks:before{content:"\f0ae"}.fa-taxi:before{content:"\f1ba"}.fa-teamspeak:before{content:"\f4f9"}.fa-teeth:before{content:"\f62e"}.fa-teeth-open:before{content:"\f62f"}.fa-telegram:before{content:"\f2c6"}.fa-telegram-plane:before{content:"\f3fe"}.fa-temperature-high:before{content:"\f769"}.fa-temperature-low:before{content:"\f76b"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-tenge:before{content:"\f7d7"}.fa-terminal:before{content:"\f120"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-th:before{content:"\f00a"}.fa-th-large:before{content:"\f009"}.fa-th-list:before{content:"\f00b"}.fa-the-red-yeti:before{content:"\f69d"}.fa-theater-masks:before{content:"\f630"}.fa-themeco:before{content:"\f5c6"}.fa-themeisle:before{content:"\f2b2"}.fa-thermometer:before{content:"\f491"}.fa-thermometer-empty:before{content:"\f2cb"}.fa-thermometer-full:before{content:"\f2c7"}.fa-thermometer-half:before{content:"\f2c9"}.fa-thermometer-quarter:before{content:"\f2ca"}.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-think-peaks:before{content:"\f731"}.fa-thumbs-down:before{content:"\f165"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbtack:before{content:"\f08d"}.fa-ticket-alt:before{content:"\f3ff"}.fa-tiktok:before{content:"\e07b"}.fa-times:before{content:"\f00d"}.fa-times-circle:before{content:"\f057"}.fa-tint:before{content:"\f043"}.fa-tint-slash:before{content:"\f5c7"}.fa-tired:before{content:"\f5c8"}.fa-toggle-off:before{content:"\f204"}.fa-toggle-on:before{content:"\f205"}.fa-toilet:before{content:"\f7d8"}.fa-toilet-paper:before{content:"\f71e"}.fa-toilet-paper-slash:before{content:"\e072"}.fa-toolbox:before{content:"\f552"}.fa-tools:before{content:"\f7d9"}.fa-tooth:before{content:"\f5c9"}.fa-torah:before{content:"\f6a0"}.fa-torii-gate:before{content:"\f6a1"}.fa-tractor:before{content:"\f722"}.fa-trade-federation:before{content:"\f513"}.fa-trademark:before{content:"\f25c"}.fa-traffic-light:before{content:"\f637"}.fa-trailer:before{content:"\e041"}.fa-train:before{content:"\f238"}.fa-tram:before{content:"\f7da"}.fa-transgender:before{content:"\f224"}.fa-transgender-alt:before{content:"\f225"}.fa-trash:before{content:"\f1f8"}.fa-trash-alt:before{content:"\f2ed"}.fa-trash-restore:before{content:"\f829"}.fa-trash-restore-alt:before{content:"\f82a"}.fa-tree:before{content:"\f1bb"}.fa-trello:before{content:"\f181"}.fa-tripadvisor:before{content:"\f262"}.fa-trophy:before{content:"\f091"}.fa-truck:before{content:"\f0d1"}.fa-truck-loading:before{content:"\f4de"}.fa-truck-monster:before{content:"\f63b"}.fa-truck-moving:before{content:"\f4df"}.fa-truck-pickup:before{content:"\f63c"}.fa-tshirt:before{content:"\f553"}.fa-tty:before{content:"\f1e4"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-tv:before{content:"\f26c"}.fa-twitch:before{content:"\f1e8"}.fa-twitter:before{content:"\f099"}.fa-twitter-square:before{content:"\f081"}.fa-typo3:before{content:"\f42b"}.fa-uber:before{content:"\f402"}.fa-ubuntu:before{content:"\f7df"}.fa-uikit:before{content:"\f403"}.fa-umbraco:before{content:"\f8e8"}.fa-umbrella:before{content:"\f0e9"}.fa-umbrella-beach:before{content:"\f5ca"}.fa-underline:before{content:"\f0cd"}.fa-undo:before{content:"\f0e2"}.fa-undo-alt:before{content:"\f2ea"}.fa-uniregistry:before{content:"\f404"}.fa-unity:before{content:"\e049"}.fa-universal-access:before{content:"\f29a"}.fa-university:before{content:"\f19c"}.fa-unlink:before{content:"\f127"}.fa-unlock:before{content:"\f09c"}.fa-unlock-alt:before{content:"\f13e"}.fa-unsplash:before{content:"\e07c"}.fa-untappd:before{content:"\f405"}.fa-upload:before{content:"\f093"}.fa-ups:before{content:"\f7e0"}.fa-usb:before{content:"\f287"}.fa-user:before{content:"\f007"}.fa-user-alt:before{content:"\f406"}.fa-user-alt-slash:before{content:"\f4fa"}.fa-user-astronaut:before{content:"\f4fb"}.fa-user-check:before{content:"\f4fc"}.fa-user-circle:before{content:"\f2bd"}.fa-user-clock:before{content:"\f4fd"}.fa-user-cog:before{content:"\f4fe"}.fa-user-edit:before{content:"\f4ff"}.fa-user-friends:before{content:"\f500"}.fa-user-graduate:before{content:"\f501"}.fa-user-injured:before{content:"\f728"}.fa-user-lock:before{content:"\f502"}.fa-user-md:before{content:"\f0f0"}.fa-user-minus:before{content:"\f503"}.fa-user-ninja:before{content:"\f504"}.fa-user-nurse:before{content:"\f82f"}.fa-user-plus:before{content:"\f234"}.fa-user-secret:before{content:"\f21b"}.fa-user-shield:before{content:"\f505"}.fa-user-slash:before{content:"\f506"}.fa-user-tag:before{content:"\f507"}.fa-user-tie:before{content:"\f508"}.fa-user-times:before{content:"\f235"}.fa-users:before{content:"\f0c0"}.fa-users-cog:before{content:"\f509"}.fa-users-slash:before{content:"\e073"}.fa-usps:before{content:"\f7e1"}.fa-ussunnah:before{content:"\f407"}.fa-utensil-spoon:before{content:"\f2e5"}.fa-utensils:before{content:"\f2e7"}.fa-vaadin:before{content:"\f408"}.fa-vector-square:before{content:"\f5cb"}.fa-venus:before{content:"\f221"}.fa-venus-double:before{content:"\f226"}.fa-venus-mars:before{content:"\f228"}.fa-viacoin:before{content:"\f237"}.fa-viadeo:before{content:"\f2a9"}.fa-viadeo-square:before{content:"\f2aa"}.fa-vial:before{content:"\f492"}.fa-vials:before{content:"\f493"}.fa-viber:before{content:"\f409"}.fa-video:before{content:"\f03d"}.fa-video-slash:before{content:"\f4e2"}.fa-vihara:before{content:"\f6a7"}.fa-vimeo:before{content:"\f40a"}.fa-vimeo-square:before{content:"\f194"}.fa-vimeo-v:before{content:"\f27d"}.fa-vine:before{content:"\f1ca"}.fa-virus:before{content:"\e074"}.fa-virus-slash:before{content:"\e075"}.fa-viruses:before{content:"\e076"}.fa-vk:before{content:"\f189"}.fa-vnv:before{content:"\f40b"}.fa-voicemail:before{content:"\f897"}.fa-volleyball-ball:before{content:"\f45f"}.fa-volume-down:before{content:"\f027"}.fa-volume-mute:before{content:"\f6a9"}.fa-volume-off:before{content:"\f026"}.fa-volume-up:before{content:"\f028"}.fa-vote-yea:before{content:"\f772"}.fa-vr-cardboard:before{content:"\f729"}.fa-vuejs:before{content:"\f41f"}.fa-walking:before{content:"\f554"}.fa-wallet:before{content:"\f555"}.fa-warehouse:before{content:"\f494"}.fa-water:before{content:"\f773"}.fa-wave-square:before{content:"\f83e"}.fa-waze:before{content:"\f83f"}.fa-weebly:before{content:"\f5cc"}.fa-weibo:before{content:"\f18a"}.fa-weight:before{content:"\f496"}.fa-weight-hanging:before{content:"\f5cd"}.fa-weixin:before{content:"\f1d7"}.fa-whatsapp:before{content:"\f232"}.fa-whatsapp-square:before{content:"\f40c"}.fa-wheelchair:before{content:"\f193"}.fa-whmcs:before{content:"\f40d"}.fa-wifi:before{content:"\f1eb"}.fa-wikipedia-w:before{content:"\f266"}.fa-wind:before{content:"\f72e"}.fa-window-close:before{content:"\f410"}.fa-window-maximize:before{content:"\f2d0"}.fa-window-minimize:before{content:"\f2d1"}.fa-window-restore:before{content:"\f2d2"}.fa-windows:before{content:"\f17a"}.fa-wine-bottle:before{content:"\f72f"}.fa-wine-glass:before{content:"\f4e3"}.fa-wine-glass-alt:before{content:"\f5ce"}.fa-wix:before{content:"\f5cf"}.fa-wizards-of-the-coast:before{content:"\f730"}.fa-wolf-pack-battalion:before{content:"\f514"}.fa-won-sign:before{content:"\f159"}.fa-wordpress:before{content:"\f19a"}.fa-wordpress-simple:before{content:"\f411"}.fa-wpbeginner:before{content:"\f297"}.fa-wpexplorer:before{content:"\f2de"}.fa-wpforms:before{content:"\f298"}.fa-wpressr:before{content:"\f3e4"}.fa-wrench:before{content:"\f0ad"}.fa-x-ray:before{content:"\f497"}.fa-xbox:before{content:"\f412"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-y-combinator:before{content:"\f23b"}.fa-yahoo:before{content:"\f19e"}.fa-yammer:before{content:"\f840"}.fa-yandex:before{content:"\f413"}.fa-yandex-international:before{content:"\f414"}.fa-yarn:before{content:"\f7e3"}.fa-yelp:before{content:"\f1e9"}.fa-yen-sign:before{content:"\f157"}.fa-yin-yang:before{content:"\f6ad"}.fa-yoast:before{content:"\f2b1"}.fa-youtube:before{content:"\f167"}.fa-youtube-square:before{content:"\f431"}.fa-zhihu:before{content:"\f63f"}.sr-only{border:0;clip:rect(0,0,0,0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.sr-only-focusable:active,.sr-only-focusable:focus{clip:auto;height:auto;margin:0;overflow:visible;position:static;width:auto}@font-face{font-family:"Font Awesome 5 Brands";font-style:normal;font-weight:400;font-display:block;src:url(../webfonts/fa-brands-400.eot);src:url(../webfonts/fa-brands-400.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-brands-400.woff2) format("woff2"),url(../webfonts/fa-brands-400.woff) format("woff"),url(../webfonts/fa-brands-400.ttf) format("truetype"),url(../webfonts/fa-brands-400.svg#fontawesome) format("svg")}.fab{font-family:"Font Awesome 5 Brands"}@font-face{font-family:"Font Awesome 5 Free";font-style:normal;font-weight:400;font-display:block;src:url(../webfonts/fa-regular-400.eot);src:url(../webfonts/fa-regular-400.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-regular-400.woff2) format("woff2"),url(../webfonts/fa-regular-400.woff) format("woff"),url(../webfonts/fa-regular-400.ttf) format("truetype"),url(../webfonts/fa-regular-400.svg#fontawesome) format("svg")}.fab,.far{font-weight:400}@font-face{font-family:"Font Awesome 5 Free";font-style:normal;font-weight:900;font-display:block;src:url(../webfonts/fa-solid-900.eot);src:url(../webfonts/fa-solid-900.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-solid-900.woff2) format("woff2"),url(../webfonts/fa-solid-900.woff) format("woff"),url(../webfonts/fa-solid-900.ttf) format("truetype"),url(../webfonts/fa-solid-900.svg#fontawesome) format("svg")}.fa,.far,.fas{font-family:"Font Awesome 5 Free"}.fa,.fas{font-weight:900} \ No newline at end of file diff --git a/assets/css/colors-20210906.css b/assets/css/colors-20210906.css new file mode 100644 index 0000000..f6d8648 --- /dev/null +++ b/assets/css/colors-20210906.css @@ -0,0 +1,16 @@ +--- +layout: nil +--- +:root { +--bg: {{ site.data.colors.bg_rgba }}; +--bg-alt: {{ site.data.colors.bg-alt_rgba }}; +--fg: {{ site.data.colors.fg_rgba }}; +--fg-alt: {{ site.data.colors.fg-alt_rgba }}; +--border: {{ site.data.colors.border_rgba }}; +--border-alt: {{ site.data.colors.border-alt_rgba }}; +--accent1: {{ site.data.colors.accent1_rgba }}; +--accent1-alt: {{ site.data.colors.accent1-alt_rgba }}; +--accent2: {{ site.data.colors.accent2_rgba }}; +--accent2-alt: {{ site.data.colors.accent2-alt_rgba }}; + +} diff --git a/assets/css/font-awesome.min.css b/assets/css/font-awesome.min.css new file mode 100644 index 0000000..540440c --- /dev/null +++ b/assets/css/font-awesome.min.css @@ -0,0 +1,4 @@ +/*! + * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome + * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) + */@font-face{font-family:'FontAwesome';src:url('../fonts/fontawesome-webfont.eot?v=4.7.0');src:url('../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'),url('../fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'),url('../fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'),url('../fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'),url('../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg');font-weight:normal;font-style:normal}.fa{display:inline-block;font:normal normal normal 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.33333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.28571429em;text-align:center}.fa-ul{padding-left:0;margin-left:2.14285714em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.14285714em;width:2.14285714em;top:.14285714em;text-align:center}.fa-li.fa-lg{left:-1.85714286em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{-webkit-animation:fa-spin 2s infinite linear;animation:fa-spin 2s infinite linear}.fa-pulse{-webkit-animation:fa-spin 1s infinite steps(8);animation:fa-spin 1s infinite steps(8)}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";-webkit-transform:rotate(90deg);-ms-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";-webkit-transform:rotate(180deg);-ms-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";-webkit-transform:rotate(270deg);-ms-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";-webkit-transform:scale(-1, 1);-ms-transform:scale(-1, 1);transform:scale(-1, 1)}.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";-webkit-transform:scale(1, -1);-ms-transform:scale(1, -1);transform:scale(1, -1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:"\f000"}.fa-music:before{content:"\f001"}.fa-search:before{content:"\f002"}.fa-envelope-o:before{content:"\f003"}.fa-heart:before{content:"\f004"}.fa-star:before{content:"\f005"}.fa-star-o:before{content:"\f006"}.fa-user:before{content:"\f007"}.fa-film:before{content:"\f008"}.fa-th-large:before{content:"\f009"}.fa-th:before{content:"\f00a"}.fa-th-list:before{content:"\f00b"}.fa-check:before{content:"\f00c"}.fa-remove:before,.fa-close:before,.fa-times:before{content:"\f00d"}.fa-search-plus:before{content:"\f00e"}.fa-search-minus:before{content:"\f010"}.fa-power-off:before{content:"\f011"}.fa-signal:before{content:"\f012"}.fa-gear:before,.fa-cog:before{content:"\f013"}.fa-trash-o:before{content:"\f014"}.fa-home:before{content:"\f015"}.fa-file-o:before{content:"\f016"}.fa-clock-o:before{content:"\f017"}.fa-road:before{content:"\f018"}.fa-download:before{content:"\f019"}.fa-arrow-circle-o-down:before{content:"\f01a"}.fa-arrow-circle-o-up:before{content:"\f01b"}.fa-inbox:before{content:"\f01c"}.fa-play-circle-o:before{content:"\f01d"}.fa-rotate-right:before,.fa-repeat:before{content:"\f01e"}.fa-refresh:before{content:"\f021"}.fa-list-alt:before{content:"\f022"}.fa-lock:before{content:"\f023"}.fa-flag:before{content:"\f024"}.fa-headphones:before{content:"\f025"}.fa-volume-off:before{content:"\f026"}.fa-volume-down:before{content:"\f027"}.fa-volume-up:before{content:"\f028"}.fa-qrcode:before{content:"\f029"}.fa-barcode:before{content:"\f02a"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-book:before{content:"\f02d"}.fa-bookmark:before{content:"\f02e"}.fa-print:before{content:"\f02f"}.fa-camera:before{content:"\f030"}.fa-font:before{content:"\f031"}.fa-bold:before{content:"\f032"}.fa-italic:before{content:"\f033"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-align-left:before{content:"\f036"}.fa-align-center:before{content:"\f037"}.fa-align-right:before{content:"\f038"}.fa-align-justify:before{content:"\f039"}.fa-list:before{content:"\f03a"}.fa-dedent:before,.fa-outdent:before{content:"\f03b"}.fa-indent:before{content:"\f03c"}.fa-video-camera:before{content:"\f03d"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:"\f03e"}.fa-pencil:before{content:"\f040"}.fa-map-marker:before{content:"\f041"}.fa-adjust:before{content:"\f042"}.fa-tint:before{content:"\f043"}.fa-edit:before,.fa-pencil-square-o:before{content:"\f044"}.fa-share-square-o:before{content:"\f045"}.fa-check-square-o:before{content:"\f046"}.fa-arrows:before{content:"\f047"}.fa-step-backward:before{content:"\f048"}.fa-fast-backward:before{content:"\f049"}.fa-backward:before{content:"\f04a"}.fa-play:before{content:"\f04b"}.fa-pause:before{content:"\f04c"}.fa-stop:before{content:"\f04d"}.fa-forward:before{content:"\f04e"}.fa-fast-forward:before{content:"\f050"}.fa-step-forward:before{content:"\f051"}.fa-eject:before{content:"\f052"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-plus-circle:before{content:"\f055"}.fa-minus-circle:before{content:"\f056"}.fa-times-circle:before{content:"\f057"}.fa-check-circle:before{content:"\f058"}.fa-question-circle:before{content:"\f059"}.fa-info-circle:before{content:"\f05a"}.fa-crosshairs:before{content:"\f05b"}.fa-times-circle-o:before{content:"\f05c"}.fa-check-circle-o:before{content:"\f05d"}.fa-ban:before{content:"\f05e"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrow-down:before{content:"\f063"}.fa-mail-forward:before,.fa-share:before{content:"\f064"}.fa-expand:before{content:"\f065"}.fa-compress:before{content:"\f066"}.fa-plus:before{content:"\f067"}.fa-minus:before{content:"\f068"}.fa-asterisk:before{content:"\f069"}.fa-exclamation-circle:before{content:"\f06a"}.fa-gift:before{content:"\f06b"}.fa-leaf:before{content:"\f06c"}.fa-fire:before{content:"\f06d"}.fa-eye:before{content:"\f06e"}.fa-eye-slash:before{content:"\f070"}.fa-warning:before,.fa-exclamation-triangle:before{content:"\f071"}.fa-plane:before{content:"\f072"}.fa-calendar:before{content:"\f073"}.fa-random:before{content:"\f074"}.fa-comment:before{content:"\f075"}.fa-magnet:before{content:"\f076"}.fa-chevron-up:before{content:"\f077"}.fa-chevron-down:before{content:"\f078"}.fa-retweet:before{content:"\f079"}.fa-shopping-cart:before{content:"\f07a"}.fa-folder:before{content:"\f07b"}.fa-folder-open:before{content:"\f07c"}.fa-arrows-v:before{content:"\f07d"}.fa-arrows-h:before{content:"\f07e"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:"\f080"}.fa-twitter-square:before{content:"\f081"}.fa-facebook-square:before{content:"\f082"}.fa-camera-retro:before{content:"\f083"}.fa-key:before{content:"\f084"}.fa-gears:before,.fa-cogs:before{content:"\f085"}.fa-comments:before{content:"\f086"}.fa-thumbs-o-up:before{content:"\f087"}.fa-thumbs-o-down:before{content:"\f088"}.fa-star-half:before{content:"\f089"}.fa-heart-o:before{content:"\f08a"}.fa-sign-out:before{content:"\f08b"}.fa-linkedin-square:before{content:"\f08c"}.fa-thumb-tack:before{content:"\f08d"}.fa-external-link:before{content:"\f08e"}.fa-sign-in:before{content:"\f090"}.fa-trophy:before{content:"\f091"}.fa-github-square:before{content:"\f092"}.fa-upload:before{content:"\f093"}.fa-lemon-o:before{content:"\f094"}.fa-phone:before{content:"\f095"}.fa-square-o:before{content:"\f096"}.fa-bookmark-o:before{content:"\f097"}.fa-phone-square:before{content:"\f098"}.fa-twitter:before{content:"\f099"}.fa-facebook-f:before,.fa-facebook:before{content:"\f09a"}.fa-github:before{content:"\f09b"}.fa-unlock:before{content:"\f09c"}.fa-credit-card:before{content:"\f09d"}.fa-feed:before,.fa-rss:before{content:"\f09e"}.fa-hdd-o:before{content:"\f0a0"}.fa-bullhorn:before{content:"\f0a1"}.fa-bell:before{content:"\f0f3"}.fa-certificate:before{content:"\f0a3"}.fa-hand-o-right:before{content:"\f0a4"}.fa-hand-o-left:before{content:"\f0a5"}.fa-hand-o-up:before{content:"\f0a6"}.fa-hand-o-down:before{content:"\f0a7"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-globe:before{content:"\f0ac"}.fa-wrench:before{content:"\f0ad"}.fa-tasks:before{content:"\f0ae"}.fa-filter:before{content:"\f0b0"}.fa-briefcase:before{content:"\f0b1"}.fa-arrows-alt:before{content:"\f0b2"}.fa-group:before,.fa-users:before{content:"\f0c0"}.fa-chain:before,.fa-link:before{content:"\f0c1"}.fa-cloud:before{content:"\f0c2"}.fa-flask:before{content:"\f0c3"}.fa-cut:before,.fa-scissors:before{content:"\f0c4"}.fa-copy:before,.fa-files-o:before{content:"\f0c5"}.fa-paperclip:before{content:"\f0c6"}.fa-save:before,.fa-floppy-o:before{content:"\f0c7"}.fa-square:before{content:"\f0c8"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:"\f0c9"}.fa-list-ul:before{content:"\f0ca"}.fa-list-ol:before{content:"\f0cb"}.fa-strikethrough:before{content:"\f0cc"}.fa-underline:before{content:"\f0cd"}.fa-table:before{content:"\f0ce"}.fa-magic:before{content:"\f0d0"}.fa-truck:before{content:"\f0d1"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-square:before{content:"\f0d3"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-plus:before{content:"\f0d5"}.fa-money:before{content:"\f0d6"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-up:before{content:"\f0d8"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-columns:before{content:"\f0db"}.fa-unsorted:before,.fa-sort:before{content:"\f0dc"}.fa-sort-down:before,.fa-sort-desc:before{content:"\f0dd"}.fa-sort-up:before,.fa-sort-asc:before{content:"\f0de"}.fa-envelope:before{content:"\f0e0"}.fa-linkedin:before{content:"\f0e1"}.fa-rotate-left:before,.fa-undo:before{content:"\f0e2"}.fa-legal:before,.fa-gavel:before{content:"\f0e3"}.fa-dashboard:before,.fa-tachometer:before{content:"\f0e4"}.fa-comment-o:before{content:"\f0e5"}.fa-comments-o:before{content:"\f0e6"}.fa-flash:before,.fa-bolt:before{content:"\f0e7"}.fa-sitemap:before{content:"\f0e8"}.fa-umbrella:before{content:"\f0e9"}.fa-paste:before,.fa-clipboard:before{content:"\f0ea"}.fa-lightbulb-o:before{content:"\f0eb"}.fa-exchange:before{content:"\f0ec"}.fa-cloud-download:before{content:"\f0ed"}.fa-cloud-upload:before{content:"\f0ee"}.fa-user-md:before{content:"\f0f0"}.fa-stethoscope:before{content:"\f0f1"}.fa-suitcase:before{content:"\f0f2"}.fa-bell-o:before{content:"\f0a2"}.fa-coffee:before{content:"\f0f4"}.fa-cutlery:before{content:"\f0f5"}.fa-file-text-o:before{content:"\f0f6"}.fa-building-o:before{content:"\f0f7"}.fa-hospital-o:before{content:"\f0f8"}.fa-ambulance:before{content:"\f0f9"}.fa-medkit:before{content:"\f0fa"}.fa-fighter-jet:before{content:"\f0fb"}.fa-beer:before{content:"\f0fc"}.fa-h-square:before{content:"\f0fd"}.fa-plus-square:before{content:"\f0fe"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angle-down:before{content:"\f107"}.fa-desktop:before{content:"\f108"}.fa-laptop:before{content:"\f109"}.fa-tablet:before{content:"\f10a"}.fa-mobile-phone:before,.fa-mobile:before{content:"\f10b"}.fa-circle-o:before{content:"\f10c"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-spinner:before{content:"\f110"}.fa-circle:before{content:"\f111"}.fa-mail-reply:before,.fa-reply:before{content:"\f112"}.fa-github-alt:before{content:"\f113"}.fa-folder-o:before{content:"\f114"}.fa-folder-open-o:before{content:"\f115"}.fa-smile-o:before{content:"\f118"}.fa-frown-o:before{content:"\f119"}.fa-meh-o:before{content:"\f11a"}.fa-gamepad:before{content:"\f11b"}.fa-keyboard-o:before{content:"\f11c"}.fa-flag-o:before{content:"\f11d"}.fa-flag-checkered:before{content:"\f11e"}.fa-terminal:before{content:"\f120"}.fa-code:before{content:"\f121"}.fa-mail-reply-all:before,.fa-reply-all:before{content:"\f122"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:"\f123"}.fa-location-arrow:before{content:"\f124"}.fa-crop:before{content:"\f125"}.fa-code-fork:before{content:"\f126"}.fa-unlink:before,.fa-chain-broken:before{content:"\f127"}.fa-question:before{content:"\f128"}.fa-info:before{content:"\f129"}.fa-exclamation:before{content:"\f12a"}.fa-superscript:before{content:"\f12b"}.fa-subscript:before{content:"\f12c"}.fa-eraser:before{content:"\f12d"}.fa-puzzle-piece:before{content:"\f12e"}.fa-microphone:before{content:"\f130"}.fa-microphone-slash:before{content:"\f131"}.fa-shield:before{content:"\f132"}.fa-calendar-o:before{content:"\f133"}.fa-fire-extinguisher:before{content:"\f134"}.fa-rocket:before{content:"\f135"}.fa-maxcdn:before{content:"\f136"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-html5:before{content:"\f13b"}.fa-css3:before{content:"\f13c"}.fa-anchor:before{content:"\f13d"}.fa-unlock-alt:before{content:"\f13e"}.fa-bullseye:before{content:"\f140"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-rss-square:before{content:"\f143"}.fa-play-circle:before{content:"\f144"}.fa-ticket:before{content:"\f145"}.fa-minus-square:before{content:"\f146"}.fa-minus-square-o:before{content:"\f147"}.fa-level-up:before{content:"\f148"}.fa-level-down:before{content:"\f149"}.fa-check-square:before{content:"\f14a"}.fa-pencil-square:before{content:"\f14b"}.fa-external-link-square:before{content:"\f14c"}.fa-share-square:before{content:"\f14d"}.fa-compass:before{content:"\f14e"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:"\f150"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:"\f151"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:"\f152"}.fa-euro:before,.fa-eur:before{content:"\f153"}.fa-gbp:before{content:"\f154"}.fa-dollar:before,.fa-usd:before{content:"\f155"}.fa-rupee:before,.fa-inr:before{content:"\f156"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:"\f157"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:"\f158"}.fa-won:before,.fa-krw:before{content:"\f159"}.fa-bitcoin:before,.fa-btc:before{content:"\f15a"}.fa-file:before{content:"\f15b"}.fa-file-text:before{content:"\f15c"}.fa-sort-alpha-asc:before{content:"\f15d"}.fa-sort-alpha-desc:before{content:"\f15e"}.fa-sort-amount-asc:before{content:"\f160"}.fa-sort-amount-desc:before{content:"\f161"}.fa-sort-numeric-asc:before{content:"\f162"}.fa-sort-numeric-desc:before{content:"\f163"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbs-down:before{content:"\f165"}.fa-youtube-square:before{content:"\f166"}.fa-youtube:before{content:"\f167"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-youtube-play:before{content:"\f16a"}.fa-dropbox:before{content:"\f16b"}.fa-stack-overflow:before{content:"\f16c"}.fa-instagram:before{content:"\f16d"}.fa-flickr:before{content:"\f16e"}.fa-adn:before{content:"\f170"}.fa-bitbucket:before{content:"\f171"}.fa-bitbucket-square:before{content:"\f172"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-long-arrow-down:before{content:"\f175"}.fa-long-arrow-up:before{content:"\f176"}.fa-long-arrow-left:before{content:"\f177"}.fa-long-arrow-right:before{content:"\f178"}.fa-apple:before{content:"\f179"}.fa-windows:before{content:"\f17a"}.fa-android:before{content:"\f17b"}.fa-linux:before{content:"\f17c"}.fa-dribbble:before{content:"\f17d"}.fa-skype:before{content:"\f17e"}.fa-foursquare:before{content:"\f180"}.fa-trello:before{content:"\f181"}.fa-female:before{content:"\f182"}.fa-male:before{content:"\f183"}.fa-gittip:before,.fa-gratipay:before{content:"\f184"}.fa-sun-o:before{content:"\f185"}.fa-moon-o:before{content:"\f186"}.fa-archive:before{content:"\f187"}.fa-bug:before{content:"\f188"}.fa-vk:before{content:"\f189"}.fa-weibo:before{content:"\f18a"}.fa-renren:before{content:"\f18b"}.fa-pagelines:before{content:"\f18c"}.fa-stack-exchange:before{content:"\f18d"}.fa-arrow-circle-o-right:before{content:"\f18e"}.fa-arrow-circle-o-left:before{content:"\f190"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:"\f191"}.fa-dot-circle-o:before{content:"\f192"}.fa-wheelchair:before{content:"\f193"}.fa-vimeo-square:before{content:"\f194"}.fa-turkish-lira:before,.fa-try:before{content:"\f195"}.fa-plus-square-o:before{content:"\f196"}.fa-space-shuttle:before{content:"\f197"}.fa-slack:before{content:"\f198"}.fa-envelope-square:before{content:"\f199"}.fa-wordpress:before{content:"\f19a"}.fa-openid:before{content:"\f19b"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:"\f19c"}.fa-mortar-board:before,.fa-graduation-cap:before{content:"\f19d"}.fa-yahoo:before{content:"\f19e"}.fa-google:before{content:"\f1a0"}.fa-reddit:before{content:"\f1a1"}.fa-reddit-square:before{content:"\f1a2"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-stumbleupon:before{content:"\f1a4"}.fa-delicious:before{content:"\f1a5"}.fa-digg:before{content:"\f1a6"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-drupal:before{content:"\f1a9"}.fa-joomla:before{content:"\f1aa"}.fa-language:before{content:"\f1ab"}.fa-fax:before{content:"\f1ac"}.fa-building:before{content:"\f1ad"}.fa-child:before{content:"\f1ae"}.fa-paw:before{content:"\f1b0"}.fa-spoon:before{content:"\f1b1"}.fa-cube:before{content:"\f1b2"}.fa-cubes:before{content:"\f1b3"}.fa-behance:before{content:"\f1b4"}.fa-behance-square:before{content:"\f1b5"}.fa-steam:before{content:"\f1b6"}.fa-steam-square:before{content:"\f1b7"}.fa-recycle:before{content:"\f1b8"}.fa-automobile:before,.fa-car:before{content:"\f1b9"}.fa-cab:before,.fa-taxi:before{content:"\f1ba"}.fa-tree:before{content:"\f1bb"}.fa-spotify:before{content:"\f1bc"}.fa-deviantart:before{content:"\f1bd"}.fa-soundcloud:before{content:"\f1be"}.fa-database:before{content:"\f1c0"}.fa-file-pdf-o:before{content:"\f1c1"}.fa-file-word-o:before{content:"\f1c2"}.fa-file-excel-o:before{content:"\f1c3"}.fa-file-powerpoint-o:before{content:"\f1c4"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:"\f1c5"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:"\f1c6"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:"\f1c7"}.fa-file-movie-o:before,.fa-file-video-o:before{content:"\f1c8"}.fa-file-code-o:before{content:"\f1c9"}.fa-vine:before{content:"\f1ca"}.fa-codepen:before{content:"\f1cb"}.fa-jsfiddle:before{content:"\f1cc"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:"\f1cd"}.fa-circle-o-notch:before{content:"\f1ce"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:"\f1d0"}.fa-ge:before,.fa-empire:before{content:"\f1d1"}.fa-git-square:before{content:"\f1d2"}.fa-git:before{content:"\f1d3"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:"\f1d4"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-qq:before{content:"\f1d6"}.fa-wechat:before,.fa-weixin:before{content:"\f1d7"}.fa-send:before,.fa-paper-plane:before{content:"\f1d8"}.fa-send-o:before,.fa-paper-plane-o:before{content:"\f1d9"}.fa-history:before{content:"\f1da"}.fa-circle-thin:before{content:"\f1db"}.fa-header:before{content:"\f1dc"}.fa-paragraph:before{content:"\f1dd"}.fa-sliders:before{content:"\f1de"}.fa-share-alt:before{content:"\f1e0"}.fa-share-alt-square:before{content:"\f1e1"}.fa-bomb:before{content:"\f1e2"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:"\f1e3"}.fa-tty:before{content:"\f1e4"}.fa-binoculars:before{content:"\f1e5"}.fa-plug:before{content:"\f1e6"}.fa-slideshare:before{content:"\f1e7"}.fa-twitch:before{content:"\f1e8"}.fa-yelp:before{content:"\f1e9"}.fa-newspaper-o:before{content:"\f1ea"}.fa-wifi:before{content:"\f1eb"}.fa-calculator:before{content:"\f1ec"}.fa-paypal:before{content:"\f1ed"}.fa-google-wallet:before{content:"\f1ee"}.fa-cc-visa:before{content:"\f1f0"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-cc-discover:before{content:"\f1f2"}.fa-cc-amex:before{content:"\f1f3"}.fa-cc-paypal:before{content:"\f1f4"}.fa-cc-stripe:before{content:"\f1f5"}.fa-bell-slash:before{content:"\f1f6"}.fa-bell-slash-o:before{content:"\f1f7"}.fa-trash:before{content:"\f1f8"}.fa-copyright:before{content:"\f1f9"}.fa-at:before{content:"\f1fa"}.fa-eyedropper:before{content:"\f1fb"}.fa-paint-brush:before{content:"\f1fc"}.fa-birthday-cake:before{content:"\f1fd"}.fa-area-chart:before{content:"\f1fe"}.fa-pie-chart:before{content:"\f200"}.fa-line-chart:before{content:"\f201"}.fa-lastfm:before{content:"\f202"}.fa-lastfm-square:before{content:"\f203"}.fa-toggle-off:before{content:"\f204"}.fa-toggle-on:before{content:"\f205"}.fa-bicycle:before{content:"\f206"}.fa-bus:before{content:"\f207"}.fa-ioxhost:before{content:"\f208"}.fa-angellist:before{content:"\f209"}.fa-cc:before{content:"\f20a"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:"\f20b"}.fa-meanpath:before{content:"\f20c"}.fa-buysellads:before{content:"\f20d"}.fa-connectdevelop:before{content:"\f20e"}.fa-dashcube:before{content:"\f210"}.fa-forumbee:before{content:"\f211"}.fa-leanpub:before{content:"\f212"}.fa-sellsy:before{content:"\f213"}.fa-shirtsinbulk:before{content:"\f214"}.fa-simplybuilt:before{content:"\f215"}.fa-skyatlas:before{content:"\f216"}.fa-cart-plus:before{content:"\f217"}.fa-cart-arrow-down:before{content:"\f218"}.fa-diamond:before{content:"\f219"}.fa-ship:before{content:"\f21a"}.fa-user-secret:before{content:"\f21b"}.fa-motorcycle:before{content:"\f21c"}.fa-street-view:before{content:"\f21d"}.fa-heartbeat:before{content:"\f21e"}.fa-venus:before{content:"\f221"}.fa-mars:before{content:"\f222"}.fa-mercury:before{content:"\f223"}.fa-intersex:before,.fa-transgender:before{content:"\f224"}.fa-transgender-alt:before{content:"\f225"}.fa-venus-double:before{content:"\f226"}.fa-mars-double:before{content:"\f227"}.fa-venus-mars:before{content:"\f228"}.fa-mars-stroke:before{content:"\f229"}.fa-mars-stroke-v:before{content:"\f22a"}.fa-mars-stroke-h:before{content:"\f22b"}.fa-neuter:before{content:"\f22c"}.fa-genderless:before{content:"\f22d"}.fa-facebook-official:before{content:"\f230"}.fa-pinterest-p:before{content:"\f231"}.fa-whatsapp:before{content:"\f232"}.fa-server:before{content:"\f233"}.fa-user-plus:before{content:"\f234"}.fa-user-times:before{content:"\f235"}.fa-hotel:before,.fa-bed:before{content:"\f236"}.fa-viacoin:before{content:"\f237"}.fa-train:before{content:"\f238"}.fa-subway:before{content:"\f239"}.fa-medium:before{content:"\f23a"}.fa-yc:before,.fa-y-combinator:before{content:"\f23b"}.fa-optin-monster:before{content:"\f23c"}.fa-opencart:before{content:"\f23d"}.fa-expeditedssl:before{content:"\f23e"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:"\f240"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:"\f241"}.fa-battery-2:before,.fa-battery-half:before{content:"\f242"}.fa-battery-1:before,.fa-battery-quarter:before{content:"\f243"}.fa-battery-0:before,.fa-battery-empty:before{content:"\f244"}.fa-mouse-pointer:before{content:"\f245"}.fa-i-cursor:before{content:"\f246"}.fa-object-group:before{content:"\f247"}.fa-object-ungroup:before{content:"\f248"}.fa-sticky-note:before{content:"\f249"}.fa-sticky-note-o:before{content:"\f24a"}.fa-cc-jcb:before{content:"\f24b"}.fa-cc-diners-club:before{content:"\f24c"}.fa-clone:before{content:"\f24d"}.fa-balance-scale:before{content:"\f24e"}.fa-hourglass-o:before{content:"\f250"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:"\f251"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:"\f252"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:"\f253"}.fa-hourglass:before{content:"\f254"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:"\f255"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:"\f256"}.fa-hand-scissors-o:before{content:"\f257"}.fa-hand-lizard-o:before{content:"\f258"}.fa-hand-spock-o:before{content:"\f259"}.fa-hand-pointer-o:before{content:"\f25a"}.fa-hand-peace-o:before{content:"\f25b"}.fa-trademark:before{content:"\f25c"}.fa-registered:before{content:"\f25d"}.fa-creative-commons:before{content:"\f25e"}.fa-gg:before{content:"\f260"}.fa-gg-circle:before{content:"\f261"}.fa-tripadvisor:before{content:"\f262"}.fa-odnoklassniki:before{content:"\f263"}.fa-odnoklassniki-square:before{content:"\f264"}.fa-get-pocket:before{content:"\f265"}.fa-wikipedia-w:before{content:"\f266"}.fa-safari:before{content:"\f267"}.fa-chrome:before{content:"\f268"}.fa-firefox:before{content:"\f269"}.fa-opera:before{content:"\f26a"}.fa-internet-explorer:before{content:"\f26b"}.fa-tv:before,.fa-television:before{content:"\f26c"}.fa-contao:before{content:"\f26d"}.fa-500px:before{content:"\f26e"}.fa-amazon:before{content:"\f270"}.fa-calendar-plus-o:before{content:"\f271"}.fa-calendar-minus-o:before{content:"\f272"}.fa-calendar-times-o:before{content:"\f273"}.fa-calendar-check-o:before{content:"\f274"}.fa-industry:before{content:"\f275"}.fa-map-pin:before{content:"\f276"}.fa-map-signs:before{content:"\f277"}.fa-map-o:before{content:"\f278"}.fa-map:before{content:"\f279"}.fa-commenting:before{content:"\f27a"}.fa-commenting-o:before{content:"\f27b"}.fa-houzz:before{content:"\f27c"}.fa-vimeo:before{content:"\f27d"}.fa-black-tie:before{content:"\f27e"}.fa-fonticons:before{content:"\f280"}.fa-reddit-alien:before{content:"\f281"}.fa-edge:before{content:"\f282"}.fa-credit-card-alt:before{content:"\f283"}.fa-codiepie:before{content:"\f284"}.fa-modx:before{content:"\f285"}.fa-fort-awesome:before{content:"\f286"}.fa-usb:before{content:"\f287"}.fa-product-hunt:before{content:"\f288"}.fa-mixcloud:before{content:"\f289"}.fa-scribd:before{content:"\f28a"}.fa-pause-circle:before{content:"\f28b"}.fa-pause-circle-o:before{content:"\f28c"}.fa-stop-circle:before{content:"\f28d"}.fa-stop-circle-o:before{content:"\f28e"}.fa-shopping-bag:before{content:"\f290"}.fa-shopping-basket:before{content:"\f291"}.fa-hashtag:before{content:"\f292"}.fa-bluetooth:before{content:"\f293"}.fa-bluetooth-b:before{content:"\f294"}.fa-percent:before{content:"\f295"}.fa-gitlab:before{content:"\f296"}.fa-wpbeginner:before{content:"\f297"}.fa-wpforms:before{content:"\f298"}.fa-envira:before{content:"\f299"}.fa-universal-access:before{content:"\f29a"}.fa-wheelchair-alt:before{content:"\f29b"}.fa-question-circle-o:before{content:"\f29c"}.fa-blind:before{content:"\f29d"}.fa-audio-description:before{content:"\f29e"}.fa-volume-control-phone:before{content:"\f2a0"}.fa-braille:before{content:"\f2a1"}.fa-assistive-listening-systems:before{content:"\f2a2"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:"\f2a3"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:"\f2a4"}.fa-glide:before{content:"\f2a5"}.fa-glide-g:before{content:"\f2a6"}.fa-signing:before,.fa-sign-language:before{content:"\f2a7"}.fa-low-vision:before{content:"\f2a8"}.fa-viadeo:before{content:"\f2a9"}.fa-viadeo-square:before{content:"\f2aa"}.fa-snapchat:before{content:"\f2ab"}.fa-snapchat-ghost:before{content:"\f2ac"}.fa-snapchat-square:before{content:"\f2ad"}.fa-pied-piper:before{content:"\f2ae"}.fa-first-order:before{content:"\f2b0"}.fa-yoast:before{content:"\f2b1"}.fa-themeisle:before{content:"\f2b2"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:"\f2b3"}.fa-fa:before,.fa-font-awesome:before{content:"\f2b4"}.fa-handshake-o:before{content:"\f2b5"}.fa-envelope-open:before{content:"\f2b6"}.fa-envelope-open-o:before{content:"\f2b7"}.fa-linode:before{content:"\f2b8"}.fa-address-book:before{content:"\f2b9"}.fa-address-book-o:before{content:"\f2ba"}.fa-vcard:before,.fa-address-card:before{content:"\f2bb"}.fa-vcard-o:before,.fa-address-card-o:before{content:"\f2bc"}.fa-user-circle:before{content:"\f2bd"}.fa-user-circle-o:before{content:"\f2be"}.fa-user-o:before{content:"\f2c0"}.fa-id-badge:before{content:"\f2c1"}.fa-drivers-license:before,.fa-id-card:before{content:"\f2c2"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:"\f2c3"}.fa-quora:before{content:"\f2c4"}.fa-free-code-camp:before{content:"\f2c5"}.fa-telegram:before{content:"\f2c6"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:"\f2c7"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:"\f2c9"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:"\f2ca"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:"\f2cb"}.fa-shower:before{content:"\f2cc"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:"\f2cd"}.fa-podcast:before{content:"\f2ce"}.fa-window-maximize:before{content:"\f2d0"}.fa-window-minimize:before{content:"\f2d1"}.fa-window-restore:before{content:"\f2d2"}.fa-times-rectangle:before,.fa-window-close:before{content:"\f2d3"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:"\f2d4"}.fa-bandcamp:before{content:"\f2d5"}.fa-grav:before{content:"\f2d6"}.fa-etsy:before{content:"\f2d7"}.fa-imdb:before{content:"\f2d8"}.fa-ravelry:before{content:"\f2d9"}.fa-eercast:before{content:"\f2da"}.fa-microchip:before{content:"\f2db"}.fa-snowflake-o:before{content:"\f2dc"}.fa-superpowers:before{content:"\f2dd"}.fa-wpexplorer:before{content:"\f2de"}.fa-meetup:before{content:"\f2e0"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto} diff --git a/assets/css/fontawesome-all.min.css b/assets/css/fontawesome-all.min.css new file mode 100644 index 0000000..b7d052b --- /dev/null +++ b/assets/css/fontawesome-all.min.css @@ -0,0 +1,5 @@ +/*! + * Font Awesome Free 5.9.0 by @fontawesome - https://fontawesome.com + * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License) + */ +.fa,.fab,.fal,.far,.fas{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;display:inline-block;font-style:normal;font-variant:normal;text-rendering:auto;line-height:1}.fa-lg{font-size:1.33333em;line-height:.75em;vertical-align:-.0667em}.fa-xs{font-size:.75em}.fa-sm{font-size:.875em}.fa-1x{font-size:1em}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-6x{font-size:6em}.fa-7x{font-size:7em}.fa-8x{font-size:8em}.fa-9x{font-size:9em}.fa-10x{font-size:10em}.fa-fw{text-align:center;width:1.25em}.fa-ul{list-style-type:none;margin-left:2.5em;padding-left:0}.fa-ul>li{position:relative}.fa-li{left:-2em;position:absolute;text-align:center;width:2em;line-height:inherit}.fa-border{border:.08em solid #eee;border-radius:.1em;padding:.2em .25em .15em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left,.fab.fa-pull-left,.fal.fa-pull-left,.far.fa-pull-left,.fas.fa-pull-left{margin-right:.3em}.fa.fa-pull-right,.fab.fa-pull-right,.fal.fa-pull-right,.far.fa-pull-right,.fas.fa-pull-right{margin-left:.3em}.fa-spin{animation:fa-spin 2s infinite linear}.fa-pulse{animation:fa-spin 1s infinite steps(8)}@keyframes fa-spin{0%{transform:rotate(0deg)}to{transform:rotate(1turn)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";transform:scaleX(-1)}.fa-flip-vertical{transform:scaleY(-1)}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical,.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical{transform:scale(-1)}:root .fa-flip-both,:root .fa-flip-horizontal,:root .fa-flip-vertical,:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270{filter:none}.fa-stack{display:inline-block;height:2em;line-height:2em;position:relative;vertical-align:middle;width:2.5em}.fa-stack-1x,.fa-stack-2x{left:0;position:absolute;text-align:center;width:100%}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-500px:before{content:"\f26e"}.fa-accessible-icon:before{content:"\f368"}.fa-accusoft:before{content:"\f369"}.fa-acquisitions-incorporated:before{content:"\f6af"}.fa-ad:before{content:"\f641"}.fa-address-book:before{content:"\f2b9"}.fa-address-card:before{content:"\f2bb"}.fa-adjust:before{content:"\f042"}.fa-adn:before{content:"\f170"}.fa-adobe:before{content:"\f778"}.fa-adversal:before{content:"\f36a"}.fa-affiliatetheme:before{content:"\f36b"}.fa-air-freshener:before{content:"\f5d0"}.fa-airbnb:before{content:"\f834"}.fa-algolia:before{content:"\f36c"}.fa-align-center:before{content:"\f037"}.fa-align-justify:before{content:"\f039"}.fa-align-left:before{content:"\f036"}.fa-align-right:before{content:"\f038"}.fa-alipay:before{content:"\f642"}.fa-allergies:before{content:"\f461"}.fa-amazon:before{content:"\f270"}.fa-amazon-pay:before{content:"\f42c"}.fa-ambulance:before{content:"\f0f9"}.fa-american-sign-language-interpreting:before{content:"\f2a3"}.fa-amilia:before{content:"\f36d"}.fa-anchor:before{content:"\f13d"}.fa-android:before{content:"\f17b"}.fa-angellist:before{content:"\f209"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-down:before{content:"\f107"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angry:before{content:"\f556"}.fa-angrycreative:before{content:"\f36e"}.fa-angular:before{content:"\f420"}.fa-ankh:before{content:"\f644"}.fa-app-store:before{content:"\f36f"}.fa-app-store-ios:before{content:"\f370"}.fa-apper:before{content:"\f371"}.fa-apple:before{content:"\f179"}.fa-apple-alt:before{content:"\f5d1"}.fa-apple-pay:before{content:"\f415"}.fa-archive:before{content:"\f187"}.fa-archway:before{content:"\f557"}.fa-arrow-alt-circle-down:before{content:"\f358"}.fa-arrow-alt-circle-left:before{content:"\f359"}.fa-arrow-alt-circle-right:before{content:"\f35a"}.fa-arrow-alt-circle-up:before{content:"\f35b"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-down:before{content:"\f063"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrows-alt:before{content:"\f0b2"}.fa-arrows-alt-h:before{content:"\f337"}.fa-arrows-alt-v:before{content:"\f338"}.fa-artstation:before{content:"\f77a"}.fa-assistive-listening-systems:before{content:"\f2a2"}.fa-asterisk:before{content:"\f069"}.fa-asymmetrik:before{content:"\f372"}.fa-at:before{content:"\f1fa"}.fa-atlas:before{content:"\f558"}.fa-atlassian:before{content:"\f77b"}.fa-atom:before{content:"\f5d2"}.fa-audible:before{content:"\f373"}.fa-audio-description:before{content:"\f29e"}.fa-autoprefixer:before{content:"\f41c"}.fa-avianex:before{content:"\f374"}.fa-aviato:before{content:"\f421"}.fa-award:before{content:"\f559"}.fa-aws:before{content:"\f375"}.fa-baby:before{content:"\f77c"}.fa-baby-carriage:before{content:"\f77d"}.fa-backspace:before{content:"\f55a"}.fa-backward:before{content:"\f04a"}.fa-bacon:before{content:"\f7e5"}.fa-balance-scale:before{content:"\f24e"}.fa-balance-scale-left:before{content:"\f515"}.fa-balance-scale-right:before{content:"\f516"}.fa-ban:before{content:"\f05e"}.fa-band-aid:before{content:"\f462"}.fa-bandcamp:before{content:"\f2d5"}.fa-barcode:before{content:"\f02a"}.fa-bars:before{content:"\f0c9"}.fa-baseball-ball:before{content:"\f433"}.fa-basketball-ball:before{content:"\f434"}.fa-bath:before{content:"\f2cd"}.fa-battery-empty:before{content:"\f244"}.fa-battery-full:before{content:"\f240"}.fa-battery-half:before{content:"\f242"}.fa-battery-quarter:before{content:"\f243"}.fa-battery-three-quarters:before{content:"\f241"}.fa-battle-net:before{content:"\f835"}.fa-bed:before{content:"\f236"}.fa-beer:before{content:"\f0fc"}.fa-behance:before{content:"\f1b4"}.fa-behance-square:before{content:"\f1b5"}.fa-bell:before{content:"\f0f3"}.fa-bell-slash:before{content:"\f1f6"}.fa-bezier-curve:before{content:"\f55b"}.fa-bible:before{content:"\f647"}.fa-bicycle:before{content:"\f206"}.fa-biking:before{content:"\f84a"}.fa-bimobject:before{content:"\f378"}.fa-binoculars:before{content:"\f1e5"}.fa-biohazard:before{content:"\f780"}.fa-birthday-cake:before{content:"\f1fd"}.fa-bitbucket:before{content:"\f171"}.fa-bitcoin:before{content:"\f379"}.fa-bity:before{content:"\f37a"}.fa-black-tie:before{content:"\f27e"}.fa-blackberry:before{content:"\f37b"}.fa-blender:before{content:"\f517"}.fa-blender-phone:before{content:"\f6b6"}.fa-blind:before{content:"\f29d"}.fa-blog:before{content:"\f781"}.fa-blogger:before{content:"\f37c"}.fa-blogger-b:before{content:"\f37d"}.fa-bluetooth:before{content:"\f293"}.fa-bluetooth-b:before{content:"\f294"}.fa-bold:before{content:"\f032"}.fa-bolt:before{content:"\f0e7"}.fa-bomb:before{content:"\f1e2"}.fa-bone:before{content:"\f5d7"}.fa-bong:before{content:"\f55c"}.fa-book:before{content:"\f02d"}.fa-book-dead:before{content:"\f6b7"}.fa-book-medical:before{content:"\f7e6"}.fa-book-open:before{content:"\f518"}.fa-book-reader:before{content:"\f5da"}.fa-bookmark:before{content:"\f02e"}.fa-bootstrap:before{content:"\f836"}.fa-border-all:before{content:"\f84c"}.fa-border-none:before{content:"\f850"}.fa-border-style:before{content:"\f853"}.fa-bowling-ball:before{content:"\f436"}.fa-box:before{content:"\f466"}.fa-box-open:before{content:"\f49e"}.fa-boxes:before{content:"\f468"}.fa-braille:before{content:"\f2a1"}.fa-brain:before{content:"\f5dc"}.fa-bread-slice:before{content:"\f7ec"}.fa-briefcase:before{content:"\f0b1"}.fa-briefcase-medical:before{content:"\f469"}.fa-broadcast-tower:before{content:"\f519"}.fa-broom:before{content:"\f51a"}.fa-brush:before{content:"\f55d"}.fa-btc:before{content:"\f15a"}.fa-buffer:before{content:"\f837"}.fa-bug:before{content:"\f188"}.fa-building:before{content:"\f1ad"}.fa-bullhorn:before{content:"\f0a1"}.fa-bullseye:before{content:"\f140"}.fa-burn:before{content:"\f46a"}.fa-buromobelexperte:before{content:"\f37f"}.fa-bus:before{content:"\f207"}.fa-bus-alt:before{content:"\f55e"}.fa-business-time:before{content:"\f64a"}.fa-buysellads:before{content:"\f20d"}.fa-calculator:before{content:"\f1ec"}.fa-calendar:before{content:"\f133"}.fa-calendar-alt:before{content:"\f073"}.fa-calendar-check:before{content:"\f274"}.fa-calendar-day:before{content:"\f783"}.fa-calendar-minus:before{content:"\f272"}.fa-calendar-plus:before{content:"\f271"}.fa-calendar-times:before{content:"\f273"}.fa-calendar-week:before{content:"\f784"}.fa-camera:before{content:"\f030"}.fa-camera-retro:before{content:"\f083"}.fa-campground:before{content:"\f6bb"}.fa-canadian-maple-leaf:before{content:"\f785"}.fa-candy-cane:before{content:"\f786"}.fa-cannabis:before{content:"\f55f"}.fa-capsules:before{content:"\f46b"}.fa-car:before{content:"\f1b9"}.fa-car-alt:before{content:"\f5de"}.fa-car-battery:before{content:"\f5df"}.fa-car-crash:before{content:"\f5e1"}.fa-car-side:before{content:"\f5e4"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-caret-square-down:before{content:"\f150"}.fa-caret-square-left:before{content:"\f191"}.fa-caret-square-right:before{content:"\f152"}.fa-caret-square-up:before{content:"\f151"}.fa-caret-up:before{content:"\f0d8"}.fa-carrot:before{content:"\f787"}.fa-cart-arrow-down:before{content:"\f218"}.fa-cart-plus:before{content:"\f217"}.fa-cash-register:before{content:"\f788"}.fa-cat:before{content:"\f6be"}.fa-cc-amazon-pay:before{content:"\f42d"}.fa-cc-amex:before{content:"\f1f3"}.fa-cc-apple-pay:before{content:"\f416"}.fa-cc-diners-club:before{content:"\f24c"}.fa-cc-discover:before{content:"\f1f2"}.fa-cc-jcb:before{content:"\f24b"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-cc-paypal:before{content:"\f1f4"}.fa-cc-stripe:before{content:"\f1f5"}.fa-cc-visa:before{content:"\f1f0"}.fa-centercode:before{content:"\f380"}.fa-centos:before{content:"\f789"}.fa-certificate:before{content:"\f0a3"}.fa-chair:before{content:"\f6c0"}.fa-chalkboard:before{content:"\f51b"}.fa-chalkboard-teacher:before{content:"\f51c"}.fa-charging-station:before{content:"\f5e7"}.fa-chart-area:before{content:"\f1fe"}.fa-chart-bar:before{content:"\f080"}.fa-chart-line:before{content:"\f201"}.fa-chart-pie:before{content:"\f200"}.fa-check:before{content:"\f00c"}.fa-check-circle:before{content:"\f058"}.fa-check-double:before{content:"\f560"}.fa-check-square:before{content:"\f14a"}.fa-cheese:before{content:"\f7ef"}.fa-chess:before{content:"\f439"}.fa-chess-bishop:before{content:"\f43a"}.fa-chess-board:before{content:"\f43c"}.fa-chess-king:before{content:"\f43f"}.fa-chess-knight:before{content:"\f441"}.fa-chess-pawn:before{content:"\f443"}.fa-chess-queen:before{content:"\f445"}.fa-chess-rook:before{content:"\f447"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-down:before{content:"\f078"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-chevron-up:before{content:"\f077"}.fa-child:before{content:"\f1ae"}.fa-chrome:before{content:"\f268"}.fa-chromecast:before{content:"\f838"}.fa-church:before{content:"\f51d"}.fa-circle:before{content:"\f111"}.fa-circle-notch:before{content:"\f1ce"}.fa-city:before{content:"\f64f"}.fa-clinic-medical:before{content:"\f7f2"}.fa-clipboard:before{content:"\f328"}.fa-clipboard-check:before{content:"\f46c"}.fa-clipboard-list:before{content:"\f46d"}.fa-clock:before{content:"\f017"}.fa-clone:before{content:"\f24d"}.fa-closed-captioning:before{content:"\f20a"}.fa-cloud:before{content:"\f0c2"}.fa-cloud-download-alt:before{content:"\f381"}.fa-cloud-meatball:before{content:"\f73b"}.fa-cloud-moon:before{content:"\f6c3"}.fa-cloud-moon-rain:before{content:"\f73c"}.fa-cloud-rain:before{content:"\f73d"}.fa-cloud-showers-heavy:before{content:"\f740"}.fa-cloud-sun:before{content:"\f6c4"}.fa-cloud-sun-rain:before{content:"\f743"}.fa-cloud-upload-alt:before{content:"\f382"}.fa-cloudscale:before{content:"\f383"}.fa-cloudsmith:before{content:"\f384"}.fa-cloudversify:before{content:"\f385"}.fa-cocktail:before{content:"\f561"}.fa-code:before{content:"\f121"}.fa-code-branch:before{content:"\f126"}.fa-codepen:before{content:"\f1cb"}.fa-codiepie:before{content:"\f284"}.fa-coffee:before{content:"\f0f4"}.fa-cog:before{content:"\f013"}.fa-cogs:before{content:"\f085"}.fa-coins:before{content:"\f51e"}.fa-columns:before{content:"\f0db"}.fa-comment:before{content:"\f075"}.fa-comment-alt:before{content:"\f27a"}.fa-comment-dollar:before{content:"\f651"}.fa-comment-dots:before{content:"\f4ad"}.fa-comment-medical:before{content:"\f7f5"}.fa-comment-slash:before{content:"\f4b3"}.fa-comments:before{content:"\f086"}.fa-comments-dollar:before{content:"\f653"}.fa-compact-disc:before{content:"\f51f"}.fa-compass:before{content:"\f14e"}.fa-compress:before{content:"\f066"}.fa-compress-arrows-alt:before{content:"\f78c"}.fa-concierge-bell:before{content:"\f562"}.fa-confluence:before{content:"\f78d"}.fa-connectdevelop:before{content:"\f20e"}.fa-contao:before{content:"\f26d"}.fa-cookie:before{content:"\f563"}.fa-cookie-bite:before{content:"\f564"}.fa-copy:before{content:"\f0c5"}.fa-copyright:before{content:"\f1f9"}.fa-couch:before{content:"\f4b8"}.fa-cpanel:before{content:"\f388"}.fa-creative-commons:before{content:"\f25e"}.fa-creative-commons-by:before{content:"\f4e7"}.fa-creative-commons-nc:before{content:"\f4e8"}.fa-creative-commons-nc-eu:before{content:"\f4e9"}.fa-creative-commons-nc-jp:before{content:"\f4ea"}.fa-creative-commons-nd:before{content:"\f4eb"}.fa-creative-commons-pd:before{content:"\f4ec"}.fa-creative-commons-pd-alt:before{content:"\f4ed"}.fa-creative-commons-remix:before{content:"\f4ee"}.fa-creative-commons-sa:before{content:"\f4ef"}.fa-creative-commons-sampling:before{content:"\f4f0"}.fa-creative-commons-sampling-plus:before{content:"\f4f1"}.fa-creative-commons-share:before{content:"\f4f2"}.fa-creative-commons-zero:before{content:"\f4f3"}.fa-credit-card:before{content:"\f09d"}.fa-critical-role:before{content:"\f6c9"}.fa-crop:before{content:"\f125"}.fa-crop-alt:before{content:"\f565"}.fa-cross:before{content:"\f654"}.fa-crosshairs:before{content:"\f05b"}.fa-crow:before{content:"\f520"}.fa-crown:before{content:"\f521"}.fa-crutch:before{content:"\f7f7"}.fa-css3:before{content:"\f13c"}.fa-css3-alt:before{content:"\f38b"}.fa-cube:before{content:"\f1b2"}.fa-cubes:before{content:"\f1b3"}.fa-cut:before{content:"\f0c4"}.fa-cuttlefish:before{content:"\f38c"}.fa-d-and-d:before{content:"\f38d"}.fa-d-and-d-beyond:before{content:"\f6ca"}.fa-dashcube:before{content:"\f210"}.fa-database:before{content:"\f1c0"}.fa-deaf:before{content:"\f2a4"}.fa-delicious:before{content:"\f1a5"}.fa-democrat:before{content:"\f747"}.fa-deploydog:before{content:"\f38e"}.fa-deskpro:before{content:"\f38f"}.fa-desktop:before{content:"\f108"}.fa-dev:before{content:"\f6cc"}.fa-deviantart:before{content:"\f1bd"}.fa-dharmachakra:before{content:"\f655"}.fa-dhl:before{content:"\f790"}.fa-diagnoses:before{content:"\f470"}.fa-diaspora:before{content:"\f791"}.fa-dice:before{content:"\f522"}.fa-dice-d20:before{content:"\f6cf"}.fa-dice-d6:before{content:"\f6d1"}.fa-dice-five:before{content:"\f523"}.fa-dice-four:before{content:"\f524"}.fa-dice-one:before{content:"\f525"}.fa-dice-six:before{content:"\f526"}.fa-dice-three:before{content:"\f527"}.fa-dice-two:before{content:"\f528"}.fa-digg:before{content:"\f1a6"}.fa-digital-ocean:before{content:"\f391"}.fa-digital-tachograph:before{content:"\f566"}.fa-directions:before{content:"\f5eb"}.fa-discord:before{content:"\f392"}.fa-discourse:before{content:"\f393"}.fa-divide:before{content:"\f529"}.fa-dizzy:before{content:"\f567"}.fa-dna:before{content:"\f471"}.fa-dochub:before{content:"\f394"}.fa-docker:before{content:"\f395"}.fa-dog:before{content:"\f6d3"}.fa-dollar-sign:before{content:"\f155"}.fa-dolly:before{content:"\f472"}.fa-dolly-flatbed:before{content:"\f474"}.fa-donate:before{content:"\f4b9"}.fa-door-closed:before{content:"\f52a"}.fa-door-open:before{content:"\f52b"}.fa-dot-circle:before{content:"\f192"}.fa-dove:before{content:"\f4ba"}.fa-download:before{content:"\f019"}.fa-draft2digital:before{content:"\f396"}.fa-drafting-compass:before{content:"\f568"}.fa-dragon:before{content:"\f6d5"}.fa-draw-polygon:before{content:"\f5ee"}.fa-dribbble:before{content:"\f17d"}.fa-dribbble-square:before{content:"\f397"}.fa-dropbox:before{content:"\f16b"}.fa-drum:before{content:"\f569"}.fa-drum-steelpan:before{content:"\f56a"}.fa-drumstick-bite:before{content:"\f6d7"}.fa-drupal:before{content:"\f1a9"}.fa-dumbbell:before{content:"\f44b"}.fa-dumpster:before{content:"\f793"}.fa-dumpster-fire:before{content:"\f794"}.fa-dungeon:before{content:"\f6d9"}.fa-dyalog:before{content:"\f399"}.fa-earlybirds:before{content:"\f39a"}.fa-ebay:before{content:"\f4f4"}.fa-edge:before{content:"\f282"}.fa-edit:before{content:"\f044"}.fa-egg:before{content:"\f7fb"}.fa-eject:before{content:"\f052"}.fa-elementor:before{content:"\f430"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-ello:before{content:"\f5f1"}.fa-ember:before{content:"\f423"}.fa-empire:before{content:"\f1d1"}.fa-envelope:before{content:"\f0e0"}.fa-envelope-open:before{content:"\f2b6"}.fa-envelope-open-text:before{content:"\f658"}.fa-envelope-square:before{content:"\f199"}.fa-envira:before{content:"\f299"}.fa-equals:before{content:"\f52c"}.fa-eraser:before{content:"\f12d"}.fa-erlang:before{content:"\f39d"}.fa-ethereum:before{content:"\f42e"}.fa-ethernet:before{content:"\f796"}.fa-etsy:before{content:"\f2d7"}.fa-euro-sign:before{content:"\f153"}.fa-evernote:before{content:"\f839"}.fa-exchange-alt:before{content:"\f362"}.fa-exclamation:before{content:"\f12a"}.fa-exclamation-circle:before{content:"\f06a"}.fa-exclamation-triangle:before{content:"\f071"}.fa-expand:before{content:"\f065"}.fa-expand-arrows-alt:before{content:"\f31e"}.fa-expeditedssl:before{content:"\f23e"}.fa-external-link-alt:before{content:"\f35d"}.fa-external-link-square-alt:before{content:"\f360"}.fa-eye:before{content:"\f06e"}.fa-eye-dropper:before{content:"\f1fb"}.fa-eye-slash:before{content:"\f070"}.fa-facebook:before{content:"\f09a"}.fa-facebook-f:before{content:"\f39e"}.fa-facebook-messenger:before{content:"\f39f"}.fa-facebook-square:before{content:"\f082"}.fa-fan:before{content:"\f863"}.fa-fantasy-flight-games:before{content:"\f6dc"}.fa-fast-backward:before{content:"\f049"}.fa-fast-forward:before{content:"\f050"}.fa-fax:before{content:"\f1ac"}.fa-feather:before{content:"\f52d"}.fa-feather-alt:before{content:"\f56b"}.fa-fedex:before{content:"\f797"}.fa-fedora:before{content:"\f798"}.fa-female:before{content:"\f182"}.fa-fighter-jet:before{content:"\f0fb"}.fa-figma:before{content:"\f799"}.fa-file:before{content:"\f15b"}.fa-file-alt:before{content:"\f15c"}.fa-file-archive:before{content:"\f1c6"}.fa-file-audio:before{content:"\f1c7"}.fa-file-code:before{content:"\f1c9"}.fa-file-contract:before{content:"\f56c"}.fa-file-csv:before{content:"\f6dd"}.fa-file-download:before{content:"\f56d"}.fa-file-excel:before{content:"\f1c3"}.fa-file-export:before{content:"\f56e"}.fa-file-image:before{content:"\f1c5"}.fa-file-import:before{content:"\f56f"}.fa-file-invoice:before{content:"\f570"}.fa-file-invoice-dollar:before{content:"\f571"}.fa-file-medical:before{content:"\f477"}.fa-file-medical-alt:before{content:"\f478"}.fa-file-pdf:before{content:"\f1c1"}.fa-file-powerpoint:before{content:"\f1c4"}.fa-file-prescription:before{content:"\f572"}.fa-file-signature:before{content:"\f573"}.fa-file-upload:before{content:"\f574"}.fa-file-video:before{content:"\f1c8"}.fa-file-word:before{content:"\f1c2"}.fa-fill:before{content:"\f575"}.fa-fill-drip:before{content:"\f576"}.fa-film:before{content:"\f008"}.fa-filter:before{content:"\f0b0"}.fa-fingerprint:before{content:"\f577"}.fa-fire:before{content:"\f06d"}.fa-fire-alt:before{content:"\f7e4"}.fa-fire-extinguisher:before{content:"\f134"}.fa-firefox:before{content:"\f269"}.fa-first-aid:before{content:"\f479"}.fa-first-order:before{content:"\f2b0"}.fa-first-order-alt:before{content:"\f50a"}.fa-firstdraft:before{content:"\f3a1"}.fa-fish:before{content:"\f578"}.fa-fist-raised:before{content:"\f6de"}.fa-flag:before{content:"\f024"}.fa-flag-checkered:before{content:"\f11e"}.fa-flag-usa:before{content:"\f74d"}.fa-flask:before{content:"\f0c3"}.fa-flickr:before{content:"\f16e"}.fa-flipboard:before{content:"\f44d"}.fa-flushed:before{content:"\f579"}.fa-fly:before{content:"\f417"}.fa-folder:before{content:"\f07b"}.fa-folder-minus:before{content:"\f65d"}.fa-folder-open:before{content:"\f07c"}.fa-folder-plus:before{content:"\f65e"}.fa-font:before{content:"\f031"}.fa-font-awesome:before{content:"\f2b4"}.fa-font-awesome-alt:before{content:"\f35c"}.fa-font-awesome-flag:before{content:"\f425"}.fa-font-awesome-logo-full:before{content:"\f4e6"}.fa-fonticons:before{content:"\f280"}.fa-fonticons-fi:before{content:"\f3a2"}.fa-football-ball:before{content:"\f44e"}.fa-fort-awesome:before{content:"\f286"}.fa-fort-awesome-alt:before{content:"\f3a3"}.fa-forumbee:before{content:"\f211"}.fa-forward:before{content:"\f04e"}.fa-foursquare:before{content:"\f180"}.fa-free-code-camp:before{content:"\f2c5"}.fa-freebsd:before{content:"\f3a4"}.fa-frog:before{content:"\f52e"}.fa-frown:before{content:"\f119"}.fa-frown-open:before{content:"\f57a"}.fa-fulcrum:before{content:"\f50b"}.fa-funnel-dollar:before{content:"\f662"}.fa-futbol:before{content:"\f1e3"}.fa-galactic-republic:before{content:"\f50c"}.fa-galactic-senate:before{content:"\f50d"}.fa-gamepad:before{content:"\f11b"}.fa-gas-pump:before{content:"\f52f"}.fa-gavel:before{content:"\f0e3"}.fa-gem:before{content:"\f3a5"}.fa-genderless:before{content:"\f22d"}.fa-get-pocket:before{content:"\f265"}.fa-gg:before{content:"\f260"}.fa-gg-circle:before{content:"\f261"}.fa-ghost:before{content:"\f6e2"}.fa-gift:before{content:"\f06b"}.fa-gifts:before{content:"\f79c"}.fa-git:before{content:"\f1d3"}.fa-git-alt:before{content:"\f841"}.fa-git-square:before{content:"\f1d2"}.fa-github:before{content:"\f09b"}.fa-github-alt:before{content:"\f113"}.fa-github-square:before{content:"\f092"}.fa-gitkraken:before{content:"\f3a6"}.fa-gitlab:before{content:"\f296"}.fa-gitter:before{content:"\f426"}.fa-glass-cheers:before{content:"\f79f"}.fa-glass-martini:before{content:"\f000"}.fa-glass-martini-alt:before{content:"\f57b"}.fa-glass-whiskey:before{content:"\f7a0"}.fa-glasses:before{content:"\f530"}.fa-glide:before{content:"\f2a5"}.fa-glide-g:before{content:"\f2a6"}.fa-globe:before{content:"\f0ac"}.fa-globe-africa:before{content:"\f57c"}.fa-globe-americas:before{content:"\f57d"}.fa-globe-asia:before{content:"\f57e"}.fa-globe-europe:before{content:"\f7a2"}.fa-gofore:before{content:"\f3a7"}.fa-golf-ball:before{content:"\f450"}.fa-goodreads:before{content:"\f3a8"}.fa-goodreads-g:before{content:"\f3a9"}.fa-google:before{content:"\f1a0"}.fa-google-drive:before{content:"\f3aa"}.fa-google-play:before{content:"\f3ab"}.fa-google-plus:before{content:"\f2b3"}.fa-google-plus-g:before{content:"\f0d5"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-wallet:before{content:"\f1ee"}.fa-gopuram:before{content:"\f664"}.fa-graduation-cap:before{content:"\f19d"}.fa-gratipay:before{content:"\f184"}.fa-grav:before{content:"\f2d6"}.fa-greater-than:before{content:"\f531"}.fa-greater-than-equal:before{content:"\f532"}.fa-grimace:before{content:"\f57f"}.fa-grin:before{content:"\f580"}.fa-grin-alt:before{content:"\f581"}.fa-grin-beam:before{content:"\f582"}.fa-grin-beam-sweat:before{content:"\f583"}.fa-grin-hearts:before{content:"\f584"}.fa-grin-squint:before{content:"\f585"}.fa-grin-squint-tears:before{content:"\f586"}.fa-grin-stars:before{content:"\f587"}.fa-grin-tears:before{content:"\f588"}.fa-grin-tongue:before{content:"\f589"}.fa-grin-tongue-squint:before{content:"\f58a"}.fa-grin-tongue-wink:before{content:"\f58b"}.fa-grin-wink:before{content:"\f58c"}.fa-grip-horizontal:before{content:"\f58d"}.fa-grip-lines:before{content:"\f7a4"}.fa-grip-lines-vertical:before{content:"\f7a5"}.fa-grip-vertical:before{content:"\f58e"}.fa-gripfire:before{content:"\f3ac"}.fa-grunt:before{content:"\f3ad"}.fa-guitar:before{content:"\f7a6"}.fa-gulp:before{content:"\f3ae"}.fa-h-square:before{content:"\f0fd"}.fa-hacker-news:before{content:"\f1d4"}.fa-hacker-news-square:before{content:"\f3af"}.fa-hackerrank:before{content:"\f5f7"}.fa-hamburger:before{content:"\f805"}.fa-hammer:before{content:"\f6e3"}.fa-hamsa:before{content:"\f665"}.fa-hand-holding:before{content:"\f4bd"}.fa-hand-holding-heart:before{content:"\f4be"}.fa-hand-holding-usd:before{content:"\f4c0"}.fa-hand-lizard:before{content:"\f258"}.fa-hand-middle-finger:before{content:"\f806"}.fa-hand-paper:before{content:"\f256"}.fa-hand-peace:before{content:"\f25b"}.fa-hand-point-down:before{content:"\f0a7"}.fa-hand-point-left:before{content:"\f0a5"}.fa-hand-point-right:before{content:"\f0a4"}.fa-hand-point-up:before{content:"\f0a6"}.fa-hand-pointer:before{content:"\f25a"}.fa-hand-rock:before{content:"\f255"}.fa-hand-scissors:before{content:"\f257"}.fa-hand-spock:before{content:"\f259"}.fa-hands:before{content:"\f4c2"}.fa-hands-helping:before{content:"\f4c4"}.fa-handshake:before{content:"\f2b5"}.fa-hanukiah:before{content:"\f6e6"}.fa-hard-hat:before{content:"\f807"}.fa-hashtag:before{content:"\f292"}.fa-hat-wizard:before{content:"\f6e8"}.fa-haykal:before{content:"\f666"}.fa-hdd:before{content:"\f0a0"}.fa-heading:before{content:"\f1dc"}.fa-headphones:before{content:"\f025"}.fa-headphones-alt:before{content:"\f58f"}.fa-headset:before{content:"\f590"}.fa-heart:before{content:"\f004"}.fa-heart-broken:before{content:"\f7a9"}.fa-heartbeat:before{content:"\f21e"}.fa-helicopter:before{content:"\f533"}.fa-highlighter:before{content:"\f591"}.fa-hiking:before{content:"\f6ec"}.fa-hippo:before{content:"\f6ed"}.fa-hips:before{content:"\f452"}.fa-hire-a-helper:before{content:"\f3b0"}.fa-history:before{content:"\f1da"}.fa-hockey-puck:before{content:"\f453"}.fa-holly-berry:before{content:"\f7aa"}.fa-home:before{content:"\f015"}.fa-hooli:before{content:"\f427"}.fa-hornbill:before{content:"\f592"}.fa-horse:before{content:"\f6f0"}.fa-horse-head:before{content:"\f7ab"}.fa-hospital:before{content:"\f0f8"}.fa-hospital-alt:before{content:"\f47d"}.fa-hospital-symbol:before{content:"\f47e"}.fa-hot-tub:before{content:"\f593"}.fa-hotdog:before{content:"\f80f"}.fa-hotel:before{content:"\f594"}.fa-hotjar:before{content:"\f3b1"}.fa-hourglass:before{content:"\f254"}.fa-hourglass-end:before{content:"\f253"}.fa-hourglass-half:before{content:"\f252"}.fa-hourglass-start:before{content:"\f251"}.fa-house-damage:before{content:"\f6f1"}.fa-houzz:before{content:"\f27c"}.fa-hryvnia:before{content:"\f6f2"}.fa-html5:before{content:"\f13b"}.fa-hubspot:before{content:"\f3b2"}.fa-i-cursor:before{content:"\f246"}.fa-ice-cream:before{content:"\f810"}.fa-icicles:before{content:"\f7ad"}.fa-icons:before{content:"\f86d"}.fa-id-badge:before{content:"\f2c1"}.fa-id-card:before{content:"\f2c2"}.fa-id-card-alt:before{content:"\f47f"}.fa-igloo:before{content:"\f7ae"}.fa-image:before{content:"\f03e"}.fa-images:before{content:"\f302"}.fa-imdb:before{content:"\f2d8"}.fa-inbox:before{content:"\f01c"}.fa-indent:before{content:"\f03c"}.fa-industry:before{content:"\f275"}.fa-infinity:before{content:"\f534"}.fa-info:before{content:"\f129"}.fa-info-circle:before{content:"\f05a"}.fa-instagram:before{content:"\f16d"}.fa-intercom:before{content:"\f7af"}.fa-internet-explorer:before{content:"\f26b"}.fa-invision:before{content:"\f7b0"}.fa-ioxhost:before{content:"\f208"}.fa-italic:before{content:"\f033"}.fa-itch-io:before{content:"\f83a"}.fa-itunes:before{content:"\f3b4"}.fa-itunes-note:before{content:"\f3b5"}.fa-java:before{content:"\f4e4"}.fa-jedi:before{content:"\f669"}.fa-jedi-order:before{content:"\f50e"}.fa-jenkins:before{content:"\f3b6"}.fa-jira:before{content:"\f7b1"}.fa-joget:before{content:"\f3b7"}.fa-joint:before{content:"\f595"}.fa-joomla:before{content:"\f1aa"}.fa-journal-whills:before{content:"\f66a"}.fa-js:before{content:"\f3b8"}.fa-js-square:before{content:"\f3b9"}.fa-jsfiddle:before{content:"\f1cc"}.fa-kaaba:before{content:"\f66b"}.fa-kaggle:before{content:"\f5fa"}.fa-key:before{content:"\f084"}.fa-keybase:before{content:"\f4f5"}.fa-keyboard:before{content:"\f11c"}.fa-keycdn:before{content:"\f3ba"}.fa-khanda:before{content:"\f66d"}.fa-kickstarter:before{content:"\f3bb"}.fa-kickstarter-k:before{content:"\f3bc"}.fa-kiss:before{content:"\f596"}.fa-kiss-beam:before{content:"\f597"}.fa-kiss-wink-heart:before{content:"\f598"}.fa-kiwi-bird:before{content:"\f535"}.fa-korvue:before{content:"\f42f"}.fa-landmark:before{content:"\f66f"}.fa-language:before{content:"\f1ab"}.fa-laptop:before{content:"\f109"}.fa-laptop-code:before{content:"\f5fc"}.fa-laptop-medical:before{content:"\f812"}.fa-laravel:before{content:"\f3bd"}.fa-lastfm:before{content:"\f202"}.fa-lastfm-square:before{content:"\f203"}.fa-laugh:before{content:"\f599"}.fa-laugh-beam:before{content:"\f59a"}.fa-laugh-squint:before{content:"\f59b"}.fa-laugh-wink:before{content:"\f59c"}.fa-layer-group:before{content:"\f5fd"}.fa-leaf:before{content:"\f06c"}.fa-leanpub:before{content:"\f212"}.fa-lemon:before{content:"\f094"}.fa-less:before{content:"\f41d"}.fa-less-than:before{content:"\f536"}.fa-less-than-equal:before{content:"\f537"}.fa-level-down-alt:before{content:"\f3be"}.fa-level-up-alt:before{content:"\f3bf"}.fa-life-ring:before{content:"\f1cd"}.fa-lightbulb:before{content:"\f0eb"}.fa-line:before{content:"\f3c0"}.fa-link:before{content:"\f0c1"}.fa-linkedin:before{content:"\f08c"}.fa-linkedin-in:before{content:"\f0e1"}.fa-linode:before{content:"\f2b8"}.fa-linux:before{content:"\f17c"}.fa-lira-sign:before{content:"\f195"}.fa-list:before{content:"\f03a"}.fa-list-alt:before{content:"\f022"}.fa-list-ol:before{content:"\f0cb"}.fa-list-ul:before{content:"\f0ca"}.fa-location-arrow:before{content:"\f124"}.fa-lock:before{content:"\f023"}.fa-lock-open:before{content:"\f3c1"}.fa-long-arrow-alt-down:before{content:"\f309"}.fa-long-arrow-alt-left:before{content:"\f30a"}.fa-long-arrow-alt-right:before{content:"\f30b"}.fa-long-arrow-alt-up:before{content:"\f30c"}.fa-low-vision:before{content:"\f2a8"}.fa-luggage-cart:before{content:"\f59d"}.fa-lyft:before{content:"\f3c3"}.fa-magento:before{content:"\f3c4"}.fa-magic:before{content:"\f0d0"}.fa-magnet:before{content:"\f076"}.fa-mail-bulk:before{content:"\f674"}.fa-mailchimp:before{content:"\f59e"}.fa-male:before{content:"\f183"}.fa-mandalorian:before{content:"\f50f"}.fa-map:before{content:"\f279"}.fa-map-marked:before{content:"\f59f"}.fa-map-marked-alt:before{content:"\f5a0"}.fa-map-marker:before{content:"\f041"}.fa-map-marker-alt:before{content:"\f3c5"}.fa-map-pin:before{content:"\f276"}.fa-map-signs:before{content:"\f277"}.fa-markdown:before{content:"\f60f"}.fa-marker:before{content:"\f5a1"}.fa-mars:before{content:"\f222"}.fa-mars-double:before{content:"\f227"}.fa-mars-stroke:before{content:"\f229"}.fa-mars-stroke-h:before{content:"\f22b"}.fa-mars-stroke-v:before{content:"\f22a"}.fa-mask:before{content:"\f6fa"}.fa-mastodon:before{content:"\f4f6"}.fa-maxcdn:before{content:"\f136"}.fa-medal:before{content:"\f5a2"}.fa-medapps:before{content:"\f3c6"}.fa-medium:before{content:"\f23a"}.fa-medium-m:before{content:"\f3c7"}.fa-medkit:before{content:"\f0fa"}.fa-medrt:before{content:"\f3c8"}.fa-meetup:before{content:"\f2e0"}.fa-megaport:before{content:"\f5a3"}.fa-meh:before{content:"\f11a"}.fa-meh-blank:before{content:"\f5a4"}.fa-meh-rolling-eyes:before{content:"\f5a5"}.fa-memory:before{content:"\f538"}.fa-mendeley:before{content:"\f7b3"}.fa-menorah:before{content:"\f676"}.fa-mercury:before{content:"\f223"}.fa-meteor:before{content:"\f753"}.fa-microchip:before{content:"\f2db"}.fa-microphone:before{content:"\f130"}.fa-microphone-alt:before{content:"\f3c9"}.fa-microphone-alt-slash:before{content:"\f539"}.fa-microphone-slash:before{content:"\f131"}.fa-microscope:before{content:"\f610"}.fa-microsoft:before{content:"\f3ca"}.fa-minus:before{content:"\f068"}.fa-minus-circle:before{content:"\f056"}.fa-minus-square:before{content:"\f146"}.fa-mitten:before{content:"\f7b5"}.fa-mix:before{content:"\f3cb"}.fa-mixcloud:before{content:"\f289"}.fa-mizuni:before{content:"\f3cc"}.fa-mobile:before{content:"\f10b"}.fa-mobile-alt:before{content:"\f3cd"}.fa-modx:before{content:"\f285"}.fa-monero:before{content:"\f3d0"}.fa-money-bill:before{content:"\f0d6"}.fa-money-bill-alt:before{content:"\f3d1"}.fa-money-bill-wave:before{content:"\f53a"}.fa-money-bill-wave-alt:before{content:"\f53b"}.fa-money-check:before{content:"\f53c"}.fa-money-check-alt:before{content:"\f53d"}.fa-monument:before{content:"\f5a6"}.fa-moon:before{content:"\f186"}.fa-mortar-pestle:before{content:"\f5a7"}.fa-mosque:before{content:"\f678"}.fa-motorcycle:before{content:"\f21c"}.fa-mountain:before{content:"\f6fc"}.fa-mouse-pointer:before{content:"\f245"}.fa-mug-hot:before{content:"\f7b6"}.fa-music:before{content:"\f001"}.fa-napster:before{content:"\f3d2"}.fa-neos:before{content:"\f612"}.fa-network-wired:before{content:"\f6ff"}.fa-neuter:before{content:"\f22c"}.fa-newspaper:before{content:"\f1ea"}.fa-nimblr:before{content:"\f5a8"}.fa-node:before{content:"\f419"}.fa-node-js:before{content:"\f3d3"}.fa-not-equal:before{content:"\f53e"}.fa-notes-medical:before{content:"\f481"}.fa-npm:before{content:"\f3d4"}.fa-ns8:before{content:"\f3d5"}.fa-nutritionix:before{content:"\f3d6"}.fa-object-group:before{content:"\f247"}.fa-object-ungroup:before{content:"\f248"}.fa-odnoklassniki:before{content:"\f263"}.fa-odnoklassniki-square:before{content:"\f264"}.fa-oil-can:before{content:"\f613"}.fa-old-republic:before{content:"\f510"}.fa-om:before{content:"\f679"}.fa-opencart:before{content:"\f23d"}.fa-openid:before{content:"\f19b"}.fa-opera:before{content:"\f26a"}.fa-optin-monster:before{content:"\f23c"}.fa-osi:before{content:"\f41a"}.fa-otter:before{content:"\f700"}.fa-outdent:before{content:"\f03b"}.fa-page4:before{content:"\f3d7"}.fa-pagelines:before{content:"\f18c"}.fa-pager:before{content:"\f815"}.fa-paint-brush:before{content:"\f1fc"}.fa-paint-roller:before{content:"\f5aa"}.fa-palette:before{content:"\f53f"}.fa-palfed:before{content:"\f3d8"}.fa-pallet:before{content:"\f482"}.fa-paper-plane:before{content:"\f1d8"}.fa-paperclip:before{content:"\f0c6"}.fa-parachute-box:before{content:"\f4cd"}.fa-paragraph:before{content:"\f1dd"}.fa-parking:before{content:"\f540"}.fa-passport:before{content:"\f5ab"}.fa-pastafarianism:before{content:"\f67b"}.fa-paste:before{content:"\f0ea"}.fa-patreon:before{content:"\f3d9"}.fa-pause:before{content:"\f04c"}.fa-pause-circle:before{content:"\f28b"}.fa-paw:before{content:"\f1b0"}.fa-paypal:before{content:"\f1ed"}.fa-peace:before{content:"\f67c"}.fa-pen:before{content:"\f304"}.fa-pen-alt:before{content:"\f305"}.fa-pen-fancy:before{content:"\f5ac"}.fa-pen-nib:before{content:"\f5ad"}.fa-pen-square:before{content:"\f14b"}.fa-pencil-alt:before{content:"\f303"}.fa-pencil-ruler:before{content:"\f5ae"}.fa-penny-arcade:before{content:"\f704"}.fa-people-carry:before{content:"\f4ce"}.fa-pepper-hot:before{content:"\f816"}.fa-percent:before{content:"\f295"}.fa-percentage:before{content:"\f541"}.fa-periscope:before{content:"\f3da"}.fa-person-booth:before{content:"\f756"}.fa-phabricator:before{content:"\f3db"}.fa-phoenix-framework:before{content:"\f3dc"}.fa-phoenix-squadron:before{content:"\f511"}.fa-phone:before{content:"\f095"}.fa-phone-alt:before{content:"\f879"}.fa-phone-slash:before{content:"\f3dd"}.fa-phone-square:before{content:"\f098"}.fa-phone-square-alt:before{content:"\f87b"}.fa-phone-volume:before{content:"\f2a0"}.fa-photo-video:before{content:"\f87c"}.fa-php:before{content:"\f457"}.fa-pied-piper:before{content:"\f2ae"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-pied-piper-hat:before{content:"\f4e5"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-piggy-bank:before{content:"\f4d3"}.fa-pills:before{content:"\f484"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-p:before{content:"\f231"}.fa-pinterest-square:before{content:"\f0d3"}.fa-pizza-slice:before{content:"\f818"}.fa-place-of-worship:before{content:"\f67f"}.fa-plane:before{content:"\f072"}.fa-plane-arrival:before{content:"\f5af"}.fa-plane-departure:before{content:"\f5b0"}.fa-play:before{content:"\f04b"}.fa-play-circle:before{content:"\f144"}.fa-playstation:before{content:"\f3df"}.fa-plug:before{content:"\f1e6"}.fa-plus:before{content:"\f067"}.fa-plus-circle:before{content:"\f055"}.fa-plus-square:before{content:"\f0fe"}.fa-podcast:before{content:"\f2ce"}.fa-poll:before{content:"\f681"}.fa-poll-h:before{content:"\f682"}.fa-poo:before{content:"\f2fe"}.fa-poo-storm:before{content:"\f75a"}.fa-poop:before{content:"\f619"}.fa-portrait:before{content:"\f3e0"}.fa-pound-sign:before{content:"\f154"}.fa-power-off:before{content:"\f011"}.fa-pray:before{content:"\f683"}.fa-praying-hands:before{content:"\f684"}.fa-prescription:before{content:"\f5b1"}.fa-prescription-bottle:before{content:"\f485"}.fa-prescription-bottle-alt:before{content:"\f486"}.fa-print:before{content:"\f02f"}.fa-procedures:before{content:"\f487"}.fa-product-hunt:before{content:"\f288"}.fa-project-diagram:before{content:"\f542"}.fa-pushed:before{content:"\f3e1"}.fa-puzzle-piece:before{content:"\f12e"}.fa-python:before{content:"\f3e2"}.fa-qq:before{content:"\f1d6"}.fa-qrcode:before{content:"\f029"}.fa-question:before{content:"\f128"}.fa-question-circle:before{content:"\f059"}.fa-quidditch:before{content:"\f458"}.fa-quinscape:before{content:"\f459"}.fa-quora:before{content:"\f2c4"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-quran:before{content:"\f687"}.fa-r-project:before{content:"\f4f7"}.fa-radiation:before{content:"\f7b9"}.fa-radiation-alt:before{content:"\f7ba"}.fa-rainbow:before{content:"\f75b"}.fa-random:before{content:"\f074"}.fa-raspberry-pi:before{content:"\f7bb"}.fa-ravelry:before{content:"\f2d9"}.fa-react:before{content:"\f41b"}.fa-reacteurope:before{content:"\f75d"}.fa-readme:before{content:"\f4d5"}.fa-rebel:before{content:"\f1d0"}.fa-receipt:before{content:"\f543"}.fa-recycle:before{content:"\f1b8"}.fa-red-river:before{content:"\f3e3"}.fa-reddit:before{content:"\f1a1"}.fa-reddit-alien:before{content:"\f281"}.fa-reddit-square:before{content:"\f1a2"}.fa-redhat:before{content:"\f7bc"}.fa-redo:before{content:"\f01e"}.fa-redo-alt:before{content:"\f2f9"}.fa-registered:before{content:"\f25d"}.fa-remove-format:before{content:"\f87d"}.fa-renren:before{content:"\f18b"}.fa-reply:before{content:"\f3e5"}.fa-reply-all:before{content:"\f122"}.fa-replyd:before{content:"\f3e6"}.fa-republican:before{content:"\f75e"}.fa-researchgate:before{content:"\f4f8"}.fa-resolving:before{content:"\f3e7"}.fa-restroom:before{content:"\f7bd"}.fa-retweet:before{content:"\f079"}.fa-rev:before{content:"\f5b2"}.fa-ribbon:before{content:"\f4d6"}.fa-ring:before{content:"\f70b"}.fa-road:before{content:"\f018"}.fa-robot:before{content:"\f544"}.fa-rocket:before{content:"\f135"}.fa-rocketchat:before{content:"\f3e8"}.fa-rockrms:before{content:"\f3e9"}.fa-route:before{content:"\f4d7"}.fa-rss:before{content:"\f09e"}.fa-rss-square:before{content:"\f143"}.fa-ruble-sign:before{content:"\f158"}.fa-ruler:before{content:"\f545"}.fa-ruler-combined:before{content:"\f546"}.fa-ruler-horizontal:before{content:"\f547"}.fa-ruler-vertical:before{content:"\f548"}.fa-running:before{content:"\f70c"}.fa-rupee-sign:before{content:"\f156"}.fa-sad-cry:before{content:"\f5b3"}.fa-sad-tear:before{content:"\f5b4"}.fa-safari:before{content:"\f267"}.fa-salesforce:before{content:"\f83b"}.fa-sass:before{content:"\f41e"}.fa-satellite:before{content:"\f7bf"}.fa-satellite-dish:before{content:"\f7c0"}.fa-save:before{content:"\f0c7"}.fa-schlix:before{content:"\f3ea"}.fa-school:before{content:"\f549"}.fa-screwdriver:before{content:"\f54a"}.fa-scribd:before{content:"\f28a"}.fa-scroll:before{content:"\f70e"}.fa-sd-card:before{content:"\f7c2"}.fa-search:before{content:"\f002"}.fa-search-dollar:before{content:"\f688"}.fa-search-location:before{content:"\f689"}.fa-search-minus:before{content:"\f010"}.fa-search-plus:before{content:"\f00e"}.fa-searchengin:before{content:"\f3eb"}.fa-seedling:before{content:"\f4d8"}.fa-sellcast:before{content:"\f2da"}.fa-sellsy:before{content:"\f213"}.fa-server:before{content:"\f233"}.fa-servicestack:before{content:"\f3ec"}.fa-shapes:before{content:"\f61f"}.fa-share:before{content:"\f064"}.fa-share-alt:before{content:"\f1e0"}.fa-share-alt-square:before{content:"\f1e1"}.fa-share-square:before{content:"\f14d"}.fa-shekel-sign:before{content:"\f20b"}.fa-shield-alt:before{content:"\f3ed"}.fa-ship:before{content:"\f21a"}.fa-shipping-fast:before{content:"\f48b"}.fa-shirtsinbulk:before{content:"\f214"}.fa-shoe-prints:before{content:"\f54b"}.fa-shopping-bag:before{content:"\f290"}.fa-shopping-basket:before{content:"\f291"}.fa-shopping-cart:before{content:"\f07a"}.fa-shopware:before{content:"\f5b5"}.fa-shower:before{content:"\f2cc"}.fa-shuttle-van:before{content:"\f5b6"}.fa-sign:before{content:"\f4d9"}.fa-sign-in-alt:before{content:"\f2f6"}.fa-sign-language:before{content:"\f2a7"}.fa-sign-out-alt:before{content:"\f2f5"}.fa-signal:before{content:"\f012"}.fa-signature:before{content:"\f5b7"}.fa-sim-card:before{content:"\f7c4"}.fa-simplybuilt:before{content:"\f215"}.fa-sistrix:before{content:"\f3ee"}.fa-sitemap:before{content:"\f0e8"}.fa-sith:before{content:"\f512"}.fa-skating:before{content:"\f7c5"}.fa-sketch:before{content:"\f7c6"}.fa-skiing:before{content:"\f7c9"}.fa-skiing-nordic:before{content:"\f7ca"}.fa-skull:before{content:"\f54c"}.fa-skull-crossbones:before{content:"\f714"}.fa-skyatlas:before{content:"\f216"}.fa-skype:before{content:"\f17e"}.fa-slack:before{content:"\f198"}.fa-slack-hash:before{content:"\f3ef"}.fa-slash:before{content:"\f715"}.fa-sleigh:before{content:"\f7cc"}.fa-sliders-h:before{content:"\f1de"}.fa-slideshare:before{content:"\f1e7"}.fa-smile:before{content:"\f118"}.fa-smile-beam:before{content:"\f5b8"}.fa-smile-wink:before{content:"\f4da"}.fa-smog:before{content:"\f75f"}.fa-smoking:before{content:"\f48d"}.fa-smoking-ban:before{content:"\f54d"}.fa-sms:before{content:"\f7cd"}.fa-snapchat:before{content:"\f2ab"}.fa-snapchat-ghost:before{content:"\f2ac"}.fa-snapchat-square:before{content:"\f2ad"}.fa-snowboarding:before{content:"\f7ce"}.fa-snowflake:before{content:"\f2dc"}.fa-snowman:before{content:"\f7d0"}.fa-snowplow:before{content:"\f7d2"}.fa-socks:before{content:"\f696"}.fa-solar-panel:before{content:"\f5ba"}.fa-sort:before{content:"\f0dc"}.fa-sort-alpha-down:before{content:"\f15d"}.fa-sort-alpha-down-alt:before{content:"\f881"}.fa-sort-alpha-up:before{content:"\f15e"}.fa-sort-alpha-up-alt:before{content:"\f882"}.fa-sort-amount-down:before{content:"\f160"}.fa-sort-amount-down-alt:before{content:"\f884"}.fa-sort-amount-up:before{content:"\f161"}.fa-sort-amount-up-alt:before{content:"\f885"}.fa-sort-down:before{content:"\f0dd"}.fa-sort-numeric-down:before{content:"\f162"}.fa-sort-numeric-down-alt:before{content:"\f886"}.fa-sort-numeric-up:before{content:"\f163"}.fa-sort-numeric-up-alt:before{content:"\f887"}.fa-sort-up:before{content:"\f0de"}.fa-soundcloud:before{content:"\f1be"}.fa-sourcetree:before{content:"\f7d3"}.fa-spa:before{content:"\f5bb"}.fa-space-shuttle:before{content:"\f197"}.fa-speakap:before{content:"\f3f3"}.fa-speaker-deck:before{content:"\f83c"}.fa-spell-check:before{content:"\f891"}.fa-spider:before{content:"\f717"}.fa-spinner:before{content:"\f110"}.fa-splotch:before{content:"\f5bc"}.fa-spotify:before{content:"\f1bc"}.fa-spray-can:before{content:"\f5bd"}.fa-square:before{content:"\f0c8"}.fa-square-full:before{content:"\f45c"}.fa-square-root-alt:before{content:"\f698"}.fa-squarespace:before{content:"\f5be"}.fa-stack-exchange:before{content:"\f18d"}.fa-stack-overflow:before{content:"\f16c"}.fa-stackpath:before{content:"\f842"}.fa-stamp:before{content:"\f5bf"}.fa-star:before{content:"\f005"}.fa-star-and-crescent:before{content:"\f699"}.fa-star-half:before{content:"\f089"}.fa-star-half-alt:before{content:"\f5c0"}.fa-star-of-david:before{content:"\f69a"}.fa-star-of-life:before{content:"\f621"}.fa-staylinked:before{content:"\f3f5"}.fa-steam:before{content:"\f1b6"}.fa-steam-square:before{content:"\f1b7"}.fa-steam-symbol:before{content:"\f3f6"}.fa-step-backward:before{content:"\f048"}.fa-step-forward:before{content:"\f051"}.fa-stethoscope:before{content:"\f0f1"}.fa-sticker-mule:before{content:"\f3f7"}.fa-sticky-note:before{content:"\f249"}.fa-stop:before{content:"\f04d"}.fa-stop-circle:before{content:"\f28d"}.fa-stopwatch:before{content:"\f2f2"}.fa-store:before{content:"\f54e"}.fa-store-alt:before{content:"\f54f"}.fa-strava:before{content:"\f428"}.fa-stream:before{content:"\f550"}.fa-street-view:before{content:"\f21d"}.fa-strikethrough:before{content:"\f0cc"}.fa-stripe:before{content:"\f429"}.fa-stripe-s:before{content:"\f42a"}.fa-stroopwafel:before{content:"\f551"}.fa-studiovinari:before{content:"\f3f8"}.fa-stumbleupon:before{content:"\f1a4"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-subscript:before{content:"\f12c"}.fa-subway:before{content:"\f239"}.fa-suitcase:before{content:"\f0f2"}.fa-suitcase-rolling:before{content:"\f5c1"}.fa-sun:before{content:"\f185"}.fa-superpowers:before{content:"\f2dd"}.fa-superscript:before{content:"\f12b"}.fa-supple:before{content:"\f3f9"}.fa-surprise:before{content:"\f5c2"}.fa-suse:before{content:"\f7d6"}.fa-swatchbook:before{content:"\f5c3"}.fa-swimmer:before{content:"\f5c4"}.fa-swimming-pool:before{content:"\f5c5"}.fa-symfony:before{content:"\f83d"}.fa-synagogue:before{content:"\f69b"}.fa-sync:before{content:"\f021"}.fa-sync-alt:before{content:"\f2f1"}.fa-syringe:before{content:"\f48e"}.fa-table:before{content:"\f0ce"}.fa-table-tennis:before{content:"\f45d"}.fa-tablet:before{content:"\f10a"}.fa-tablet-alt:before{content:"\f3fa"}.fa-tablets:before{content:"\f490"}.fa-tachometer-alt:before{content:"\f3fd"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-tape:before{content:"\f4db"}.fa-tasks:before{content:"\f0ae"}.fa-taxi:before{content:"\f1ba"}.fa-teamspeak:before{content:"\f4f9"}.fa-teeth:before{content:"\f62e"}.fa-teeth-open:before{content:"\f62f"}.fa-telegram:before{content:"\f2c6"}.fa-telegram-plane:before{content:"\f3fe"}.fa-temperature-high:before{content:"\f769"}.fa-temperature-low:before{content:"\f76b"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-tenge:before{content:"\f7d7"}.fa-terminal:before{content:"\f120"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-th:before{content:"\f00a"}.fa-th-large:before{content:"\f009"}.fa-th-list:before{content:"\f00b"}.fa-the-red-yeti:before{content:"\f69d"}.fa-theater-masks:before{content:"\f630"}.fa-themeco:before{content:"\f5c6"}.fa-themeisle:before{content:"\f2b2"}.fa-thermometer:before{content:"\f491"}.fa-thermometer-empty:before{content:"\f2cb"}.fa-thermometer-full:before{content:"\f2c7"}.fa-thermometer-half:before{content:"\f2c9"}.fa-thermometer-quarter:before{content:"\f2ca"}.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-think-peaks:before{content:"\f731"}.fa-thumbs-down:before{content:"\f165"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbtack:before{content:"\f08d"}.fa-ticket-alt:before{content:"\f3ff"}.fa-times:before{content:"\f00d"}.fa-times-circle:before{content:"\f057"}.fa-tint:before{content:"\f043"}.fa-tint-slash:before{content:"\f5c7"}.fa-tired:before{content:"\f5c8"}.fa-toggle-off:before{content:"\f204"}.fa-toggle-on:before{content:"\f205"}.fa-toilet:before{content:"\f7d8"}.fa-toilet-paper:before{content:"\f71e"}.fa-toolbox:before{content:"\f552"}.fa-tools:before{content:"\f7d9"}.fa-tooth:before{content:"\f5c9"}.fa-torah:before{content:"\f6a0"}.fa-torii-gate:before{content:"\f6a1"}.fa-tractor:before{content:"\f722"}.fa-trade-federation:before{content:"\f513"}.fa-trademark:before{content:"\f25c"}.fa-traffic-light:before{content:"\f637"}.fa-train:before{content:"\f238"}.fa-tram:before{content:"\f7da"}.fa-transgender:before{content:"\f224"}.fa-transgender-alt:before{content:"\f225"}.fa-trash:before{content:"\f1f8"}.fa-trash-alt:before{content:"\f2ed"}.fa-trash-restore:before{content:"\f829"}.fa-trash-restore-alt:before{content:"\f82a"}.fa-tree:before{content:"\f1bb"}.fa-trello:before{content:"\f181"}.fa-tripadvisor:before{content:"\f262"}.fa-trophy:before{content:"\f091"}.fa-truck:before{content:"\f0d1"}.fa-truck-loading:before{content:"\f4de"}.fa-truck-monster:before{content:"\f63b"}.fa-truck-moving:before{content:"\f4df"}.fa-truck-pickup:before{content:"\f63c"}.fa-tshirt:before{content:"\f553"}.fa-tty:before{content:"\f1e4"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-tv:before{content:"\f26c"}.fa-twitch:before{content:"\f1e8"}.fa-twitter:before{content:"\f099"}.fa-twitter-square:before{content:"\f081"}.fa-typo3:before{content:"\f42b"}.fa-uber:before{content:"\f402"}.fa-ubuntu:before{content:"\f7df"}.fa-uikit:before{content:"\f403"}.fa-umbrella:before{content:"\f0e9"}.fa-umbrella-beach:before{content:"\f5ca"}.fa-underline:before{content:"\f0cd"}.fa-undo:before{content:"\f0e2"}.fa-undo-alt:before{content:"\f2ea"}.fa-uniregistry:before{content:"\f404"}.fa-universal-access:before{content:"\f29a"}.fa-university:before{content:"\f19c"}.fa-unlink:before{content:"\f127"}.fa-unlock:before{content:"\f09c"}.fa-unlock-alt:before{content:"\f13e"}.fa-untappd:before{content:"\f405"}.fa-upload:before{content:"\f093"}.fa-ups:before{content:"\f7e0"}.fa-usb:before{content:"\f287"}.fa-user:before{content:"\f007"}.fa-user-alt:before{content:"\f406"}.fa-user-alt-slash:before{content:"\f4fa"}.fa-user-astronaut:before{content:"\f4fb"}.fa-user-check:before{content:"\f4fc"}.fa-user-circle:before{content:"\f2bd"}.fa-user-clock:before{content:"\f4fd"}.fa-user-cog:before{content:"\f4fe"}.fa-user-edit:before{content:"\f4ff"}.fa-user-friends:before{content:"\f500"}.fa-user-graduate:before{content:"\f501"}.fa-user-injured:before{content:"\f728"}.fa-user-lock:before{content:"\f502"}.fa-user-md:before{content:"\f0f0"}.fa-user-minus:before{content:"\f503"}.fa-user-ninja:before{content:"\f504"}.fa-user-nurse:before{content:"\f82f"}.fa-user-plus:before{content:"\f234"}.fa-user-secret:before{content:"\f21b"}.fa-user-shield:before{content:"\f505"}.fa-user-slash:before{content:"\f506"}.fa-user-tag:before{content:"\f507"}.fa-user-tie:before{content:"\f508"}.fa-user-times:before{content:"\f235"}.fa-users:before{content:"\f0c0"}.fa-users-cog:before{content:"\f509"}.fa-usps:before{content:"\f7e1"}.fa-ussunnah:before{content:"\f407"}.fa-utensil-spoon:before{content:"\f2e5"}.fa-utensils:before{content:"\f2e7"}.fa-vaadin:before{content:"\f408"}.fa-vector-square:before{content:"\f5cb"}.fa-venus:before{content:"\f221"}.fa-venus-double:before{content:"\f226"}.fa-venus-mars:before{content:"\f228"}.fa-viacoin:before{content:"\f237"}.fa-viadeo:before{content:"\f2a9"}.fa-viadeo-square:before{content:"\f2aa"}.fa-vial:before{content:"\f492"}.fa-vials:before{content:"\f493"}.fa-viber:before{content:"\f409"}.fa-video:before{content:"\f03d"}.fa-video-slash:before{content:"\f4e2"}.fa-vihara:before{content:"\f6a7"}.fa-vimeo:before{content:"\f40a"}.fa-vimeo-square:before{content:"\f194"}.fa-vimeo-v:before{content:"\f27d"}.fa-vine:before{content:"\f1ca"}.fa-vk:before{content:"\f189"}.fa-vnv:before{content:"\f40b"}.fa-voicemail:before{content:"\f897"}.fa-volleyball-ball:before{content:"\f45f"}.fa-volume-down:before{content:"\f027"}.fa-volume-mute:before{content:"\f6a9"}.fa-volume-off:before{content:"\f026"}.fa-volume-up:before{content:"\f028"}.fa-vote-yea:before{content:"\f772"}.fa-vr-cardboard:before{content:"\f729"}.fa-vuejs:before{content:"\f41f"}.fa-walking:before{content:"\f554"}.fa-wallet:before{content:"\f555"}.fa-warehouse:before{content:"\f494"}.fa-water:before{content:"\f773"}.fa-wave-square:before{content:"\f83e"}.fa-waze:before{content:"\f83f"}.fa-weebly:before{content:"\f5cc"}.fa-weibo:before{content:"\f18a"}.fa-weight:before{content:"\f496"}.fa-weight-hanging:before{content:"\f5cd"}.fa-weixin:before{content:"\f1d7"}.fa-whatsapp:before{content:"\f232"}.fa-whatsapp-square:before{content:"\f40c"}.fa-wheelchair:before{content:"\f193"}.fa-whmcs:before{content:"\f40d"}.fa-wifi:before{content:"\f1eb"}.fa-wikipedia-w:before{content:"\f266"}.fa-wind:before{content:"\f72e"}.fa-window-close:before{content:"\f410"}.fa-window-maximize:before{content:"\f2d0"}.fa-window-minimize:before{content:"\f2d1"}.fa-window-restore:before{content:"\f2d2"}.fa-windows:before{content:"\f17a"}.fa-wine-bottle:before{content:"\f72f"}.fa-wine-glass:before{content:"\f4e3"}.fa-wine-glass-alt:before{content:"\f5ce"}.fa-wix:before{content:"\f5cf"}.fa-wizards-of-the-coast:before{content:"\f730"}.fa-wolf-pack-battalion:before{content:"\f514"}.fa-won-sign:before{content:"\f159"}.fa-wordpress:before{content:"\f19a"}.fa-wordpress-simple:before{content:"\f411"}.fa-wpbeginner:before{content:"\f297"}.fa-wpexplorer:before{content:"\f2de"}.fa-wpforms:before{content:"\f298"}.fa-wpressr:before{content:"\f3e4"}.fa-wrench:before{content:"\f0ad"}.fa-x-ray:before{content:"\f497"}.fa-xbox:before{content:"\f412"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-y-combinator:before{content:"\f23b"}.fa-yahoo:before{content:"\f19e"}.fa-yammer:before{content:"\f840"}.fa-yandex:before{content:"\f413"}.fa-yandex-international:before{content:"\f414"}.fa-yarn:before{content:"\f7e3"}.fa-yelp:before{content:"\f1e9"}.fa-yen-sign:before{content:"\f157"}.fa-yin-yang:before{content:"\f6ad"}.fa-yoast:before{content:"\f2b1"}.fa-youtube:before{content:"\f167"}.fa-youtube-square:before{content:"\f431"}.fa-zhihu:before{content:"\f63f"}.sr-only{border:0;clip:rect(0,0,0,0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.sr-only-focusable:active,.sr-only-focusable:focus{clip:auto;height:auto;margin:0;overflow:visible;position:static;width:auto}@font-face{font-family:"Font Awesome 5 Brands";font-style:normal;font-weight:normal;font-display:auto;src:url(../webfonts/fa-brands-400.eot);src:url(../webfonts/fa-brands-400.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-brands-400.woff2) format("woff2"),url(../webfonts/fa-brands-400.woff) format("woff"),url(../webfonts/fa-brands-400.ttf) format("truetype"),url(../webfonts/fa-brands-400.svg#fontawesome) format("svg")}.fab{font-family:"Font Awesome 5 Brands"}@font-face{font-family:"Font Awesome 5 Free";font-style:normal;font-weight:400;font-display:auto;src:url(../webfonts/fa-regular-400.eot);src:url(../webfonts/fa-regular-400.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-regular-400.woff2) format("woff2"),url(../webfonts/fa-regular-400.woff) format("woff"),url(../webfonts/fa-regular-400.ttf) format("truetype"),url(../webfonts/fa-regular-400.svg#fontawesome) format("svg")}.far{font-weight:400}@font-face{font-family:"Font Awesome 5 Free";font-style:normal;font-weight:900;font-display:auto;src:url(../webfonts/fa-solid-900.eot);src:url(../webfonts/fa-solid-900.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-solid-900.woff2) format("woff2"),url(../webfonts/fa-solid-900.woff) format("woff"),url(../webfonts/fa-solid-900.ttf) format("truetype"),url(../webfonts/fa-solid-900.svg#fontawesome) format("svg")}.fa,.far,.fas{font-family:"Font Awesome 5 Free"}.fa,.fas{font-weight:900} \ No newline at end of file diff --git a/assets/css/main-20210906.scss b/assets/css/main-20210906.scss new file mode 100644 index 0000000..a4f6df3 --- /dev/null +++ b/assets/css/main-20210906.scss @@ -0,0 +1,20 @@ +--- +--- + +@import 'libs/vars'; + +@import 'libs/reset'; + +// sethy stuff +@import 'libs/animations'; +@import 'layout'; +@import 'elements'; +@import 'forms'; +@import 'navigation'; +@import 'videos'; +@import 'player'; +@import 'trackplayer'; +@import 'cookies'; +@import 'set'; +@import 'svg'; +@import 'staff'; diff --git a/assets/css/noscripts-20210906.scss b/assets/css/noscripts-20210906.scss new file mode 100644 index 0000000..a907e9a --- /dev/null +++ b/assets/css/noscripts-20210906.scss @@ -0,0 +1,22 @@ +--- +--- + +@import 'libs/vars'; + +@import 'libs/reset'; + +// sethy stuff +@import 'libs/animations'; +@import 'layout'; +@import 'elements'; +@import 'forms'; +@import 'navigation'; +@import 'videos'; +@import 'player'; +@import 'trackplayer'; +@import 'cookies'; +@import 'set'; +@import 'svg'; +@import 'staff'; +@import 'noscripts'; + diff --git a/assets/fonts/Astloch-Bold.ttf b/assets/fonts/Astloch-Bold.ttf new file mode 100644 index 0000000..73328fa Binary files /dev/null and b/assets/fonts/Astloch-Bold.ttf differ diff --git a/assets/fonts/Bungee/Bungee-Regular.ttf b/assets/fonts/Bungee/Bungee-Regular.ttf new file mode 100644 index 0000000..3229ee2 Binary files /dev/null and b/assets/fonts/Bungee/Bungee-Regular.ttf differ diff --git a/assets/fonts/Bungee/BungeeHairline-Regular.ttf b/assets/fonts/Bungee/BungeeHairline-Regular.ttf new file mode 100644 index 0000000..604d41c Binary files /dev/null and b/assets/fonts/Bungee/BungeeHairline-Regular.ttf differ diff --git a/assets/fonts/Bungee/OFL.txt b/assets/fonts/Bungee/OFL.txt new file mode 100644 index 0000000..a431ae9 --- /dev/null +++ b/assets/fonts/Bungee/OFL.txt @@ -0,0 +1,92 @@ +Copyright 2008 The Bungee Project Authors (david@djr.com) +This Font Software is licensed under the SIL Open Font License, Version 1.1. +This license is copied below, and is also available with a FAQ at: +http://scripts.sil.org/OFL + + +----------------------------------------------------------- +SIL OPEN FONT LICENSE Version 1.1 - 26 February 2007 +----------------------------------------------------------- + +PREAMBLE +The goals of the Open Font License (OFL) are to stimulate worldwide +development of collaborative font projects, to support the font creation +efforts of academic and linguistic communities, and to provide a free and +open framework in which fonts may be shared and improved in partnership +with others. + +The OFL allows the licensed fonts to be used, studied, modified and +redistributed freely as long as they are not sold by themselves. The +fonts, including any derivative works, can be bundled, embedded, +redistributed and/or sold with any software provided that any reserved +names are not used by derivative works. The fonts and derivatives, +however, cannot be released under any other type of license. The +requirement for fonts to remain under this license does not apply +to any document created using the fonts or their derivatives. + +DEFINITIONS +"Font Software" refers to the set of files released by the Copyright +Holder(s) under this license and clearly marked as such. This may +include source files, build scripts and documentation. + +"Reserved Font Name" refers to any names specified as such after the +copyright statement(s). + +"Original Version" refers to the collection of Font Software components as +distributed by the Copyright Holder(s). + +"Modified Version" refers to any derivative made by adding to, deleting, +or substituting -- in part or in whole -- any of the components of the +Original Version, by changing formats or by porting the Font Software to a +new environment. + +"Author" refers to any designer, engineer, programmer, technical +writer or other person who contributed to the Font Software. + +PERMISSION & CONDITIONS +Permission is hereby granted, free of charge, to any person obtaining +a copy of the Font Software, to use, study, copy, merge, embed, modify, +redistribute, and sell modified and unmodified copies of the Font +Software, subject to the following conditions: + +1) Neither the Font Software nor any of its individual components, +in Original or Modified Versions, may be sold by itself. + +2) Original or Modified Versions of the Font Software may be bundled, +redistributed and/or sold with any software, provided that each copy +contains the above copyright notice and this license. These can be +included either as stand-alone text files, human-readable headers or +in the appropriate machine-readable metadata fields within text or +binary files as long as those fields can be easily viewed by the user. + +3) No Modified Version of the Font Software may use the Reserved Font +Name(s) unless explicit written permission is granted by the corresponding +Copyright Holder. This restriction only applies to the primary font name as +presented to the users. + +4) The name(s) of the Copyright Holder(s) or the Author(s) of the Font +Software shall not be used to promote, endorse or advertise any +Modified Version, except to acknowledge the contribution(s) of the +Copyright Holder(s) and the Author(s) or with their explicit written +permission. + +5) The Font Software, modified or unmodified, in part or in whole, +must be distributed entirely under this license, and must not be +distributed under any other license. The requirement for fonts to +remain under this license does not apply to any document created +using the Font Software. + +TERMINATION +This license becomes null and void if any of the above conditions are +not met. + +DISCLAIMER +THE FONT SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO ANY WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT +OF COPYRIGHT, PATENT, TRADEMARK, OR OTHER RIGHT. IN NO EVENT SHALL THE +COPYRIGHT HOLDER BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +INCLUDING ANY GENERAL, SPECIAL, INDIRECT, INCIDENTAL, OR CONSEQUENTIAL +DAMAGES, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF THE USE OR INABILITY TO USE THE FONT SOFTWARE OR FROM +OTHER DEALINGS IN THE FONT SOFTWARE. diff --git a/assets/fonts/FontAwesome.otf b/assets/fonts/FontAwesome.otf new file mode 100644 index 0000000..401ec0f Binary files /dev/null and b/assets/fonts/FontAwesome.otf differ diff --git a/assets/fonts/GN_KillGothic_U_KanaO.ttf b/assets/fonts/GN_KillGothic_U_KanaO.ttf new file mode 100644 index 0000000..7e69cdd Binary files /dev/null and b/assets/fonts/GN_KillGothic_U_KanaO.ttf differ diff --git a/assets/fonts/IBMPlexSansCondensed-Bold.ttf b/assets/fonts/IBMPlexSansCondensed-Bold.ttf new file mode 100644 index 0000000..40e023c Binary files /dev/null and b/assets/fonts/IBMPlexSansCondensed-Bold.ttf differ diff --git a/assets/fonts/JetBrainsMono_Bold.ttf b/assets/fonts/JetBrainsMono_Bold.ttf new file mode 100644 index 0000000..5dc6ec2 Binary files /dev/null and b/assets/fonts/JetBrainsMono_Bold.ttf differ diff --git a/assets/fonts/JetBrainsMono_Bold_Italic.ttf b/assets/fonts/JetBrainsMono_Bold_Italic.ttf new file mode 100644 index 0000000..8a36bcc Binary files /dev/null and b/assets/fonts/JetBrainsMono_Bold_Italic.ttf differ diff --git a/assets/fonts/JetBrainsMono_ExtraBold.ttf b/assets/fonts/JetBrainsMono_ExtraBold.ttf new file mode 100644 index 0000000..bba598e Binary files /dev/null and b/assets/fonts/JetBrainsMono_ExtraBold.ttf differ diff --git a/assets/fonts/JetBrainsMono_ExtraBold_Italic.ttf b/assets/fonts/JetBrainsMono_ExtraBold_Italic.ttf new file mode 100644 index 0000000..ff89d25 Binary files /dev/null and b/assets/fonts/JetBrainsMono_ExtraBold_Italic.ttf differ diff --git a/assets/fonts/JetBrainsMono_Italic.ttf b/assets/fonts/JetBrainsMono_Italic.ttf new file mode 100644 index 0000000..44e1f4a Binary files /dev/null and b/assets/fonts/JetBrainsMono_Italic.ttf differ diff --git a/assets/fonts/JetBrainsMono_Regular.ttf b/assets/fonts/JetBrainsMono_Regular.ttf new file mode 100644 index 0000000..7db854f Binary files /dev/null and b/assets/fonts/JetBrainsMono_Regular.ttf differ diff --git a/assets/fonts/Kaiso_Next_B.otf b/assets/fonts/Kaiso_Next_B.otf new file mode 100644 index 0000000..d280087 Binary files /dev/null and b/assets/fonts/Kaiso_Next_B.otf differ diff --git a/assets/fonts/MajorMonoDisplay-Regular.ttf b/assets/fonts/MajorMonoDisplay-Regular.ttf new file mode 100644 index 0000000..3dd534c Binary files /dev/null and b/assets/fonts/MajorMonoDisplay-Regular.ttf differ diff --git a/assets/fonts/NikkyouSans_B6aV.ttf b/assets/fonts/NikkyouSans_B6aV.ttf new file mode 100644 index 0000000..c255443 Binary files /dev/null and b/assets/fonts/NikkyouSans_B6aV.ttf differ diff --git a/assets/fonts/PressStart2P-Regular.ttf b/assets/fonts/PressStart2P-Regular.ttf new file mode 100644 index 0000000..39adf42 Binary files /dev/null and b/assets/fonts/PressStart2P-Regular.ttf differ diff --git a/assets/fonts/Rubik/Rubik-Light.ttf b/assets/fonts/Rubik/Rubik-Light.ttf new file mode 100644 index 0000000..5ffda61 Binary files /dev/null and b/assets/fonts/Rubik/Rubik-Light.ttf differ diff --git a/assets/fonts/Rubik/Rubik-LightItalic.ttf b/assets/fonts/Rubik/Rubik-LightItalic.ttf new file mode 100644 index 0000000..747fc6f Binary files /dev/null and b/assets/fonts/Rubik/Rubik-LightItalic.ttf differ diff --git a/assets/fonts/Rubik/Rubik-Medium.ttf b/assets/fonts/Rubik/Rubik-Medium.ttf new file mode 100644 index 0000000..c0b7965 Binary files /dev/null and b/assets/fonts/Rubik/Rubik-Medium.ttf differ diff --git a/assets/fonts/Rubik/Rubik-MediumItalic.ttf b/assets/fonts/Rubik/Rubik-MediumItalic.ttf new file mode 100644 index 0000000..7738506 Binary files /dev/null and b/assets/fonts/Rubik/Rubik-MediumItalic.ttf differ diff --git a/assets/fonts/SedgwickAveDisplay-Regular.ttf b/assets/fonts/SedgwickAveDisplay-Regular.ttf new file mode 100644 index 0000000..b809963 Binary files /dev/null and b/assets/fonts/SedgwickAveDisplay-Regular.ttf differ diff --git a/assets/fonts/Staatliches-Regular.ttf b/assets/fonts/Staatliches-Regular.ttf new file mode 100644 index 0000000..6305e22 Binary files /dev/null and b/assets/fonts/Staatliches-Regular.ttf differ diff --git a/assets/fonts/Staatliches/OFL.txt b/assets/fonts/Staatliches/OFL.txt new file mode 100644 index 0000000..d7339cb --- /dev/null +++ b/assets/fonts/Staatliches/OFL.txt @@ -0,0 +1,93 @@ +Copyright 2018 The Staatliches Authors (https://github.com/googlefonts/staatliches) + +This Font Software is licensed under the SIL Open Font License, Version 1.1. +This license is copied below, and is also available with a FAQ at: +http://scripts.sil.org/OFL + + +----------------------------------------------------------- +SIL OPEN FONT LICENSE Version 1.1 - 26 February 2007 +----------------------------------------------------------- + +PREAMBLE +The goals of the Open Font License (OFL) are to stimulate worldwide +development of collaborative font projects, to support the font creation +efforts of academic and linguistic communities, and to provide a free and +open framework in which fonts may be shared and improved in partnership +with others. + +The OFL allows the licensed fonts to be used, studied, modified and +redistributed freely as long as they are not sold by themselves. The +fonts, including any derivative works, can be bundled, embedded, +redistributed and/or sold with any software provided that any reserved +names are not used by derivative works. The fonts and derivatives, +however, cannot be released under any other type of license. The +requirement for fonts to remain under this license does not apply +to any document created using the fonts or their derivatives. + +DEFINITIONS +"Font Software" refers to the set of files released by the Copyright +Holder(s) under this license and clearly marked as such. This may +include source files, build scripts and documentation. + +"Reserved Font Name" refers to any names specified as such after the +copyright statement(s). + +"Original Version" refers to the collection of Font Software components as +distributed by the Copyright Holder(s). + +"Modified Version" refers to any derivative made by adding to, deleting, +or substituting -- in part or in whole -- any of the components of the +Original Version, by changing formats or by porting the Font Software to a +new environment. + +"Author" refers to any designer, engineer, programmer, technical +writer or other person who contributed to the Font Software. + +PERMISSION & CONDITIONS +Permission is hereby granted, free of charge, to any person obtaining +a copy of the Font Software, to use, study, copy, merge, embed, modify, +redistribute, and sell modified and unmodified copies of the Font +Software, subject to the following conditions: + +1) Neither the Font Software nor any of its individual components, +in Original or Modified Versions, may be sold by itself. + +2) Original or Modified Versions of the Font Software may be bundled, +redistributed and/or sold with any software, provided that each copy +contains the above copyright notice and this license. These can be +included either as stand-alone text files, human-readable headers or +in the appropriate machine-readable metadata fields within text or +binary files as long as those fields can be easily viewed by the user. + +3) No Modified Version of the Font Software may use the Reserved Font +Name(s) unless explicit written permission is granted by the corresponding +Copyright Holder. This restriction only applies to the primary font name as +presented to the users. + +4) The name(s) of the Copyright Holder(s) or the Author(s) of the Font +Software shall not be used to promote, endorse or advertise any +Modified Version, except to acknowledge the contribution(s) of the +Copyright Holder(s) and the Author(s) or with their explicit written +permission. + +5) The Font Software, modified or unmodified, in part or in whole, +must be distributed entirely under this license, and must not be +distributed under any other license. The requirement for fonts to +remain under this license does not apply to any document created +using the Font Software. + +TERMINATION +This license becomes null and void if any of the above conditions are +not met. + +DISCLAIMER +THE FONT SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO ANY WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT +OF COPYRIGHT, PATENT, TRADEMARK, OR OTHER RIGHT. IN NO EVENT SHALL THE +COPYRIGHT HOLDER BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +INCLUDING ANY GENERAL, SPECIAL, INDIRECT, INCIDENTAL, OR CONSEQUENTIAL +DAMAGES, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF THE USE OR INABILITY TO USE THE FONT SOFTWARE OR FROM +OTHER DEALINGS IN THE FONT SOFTWARE. diff --git a/assets/fonts/Staatliches/Staatliches-Regular.ttf b/assets/fonts/Staatliches/Staatliches-Regular.ttf new file mode 100644 index 0000000..5d8ae49 Binary files /dev/null and b/assets/fonts/Staatliches/Staatliches-Regular.ttf differ diff --git a/assets/fonts/collects.ttf b/assets/fonts/collects.ttf new file mode 100644 index 0000000..dfbc0a4 Binary files /dev/null and b/assets/fonts/collects.ttf differ diff --git a/assets/fonts/fontawesome-webfont.eot b/assets/fonts/fontawesome-webfont.eot new file mode 100644 index 0000000..e9f60ca Binary files /dev/null and b/assets/fonts/fontawesome-webfont.eot differ diff --git a/assets/fonts/fontawesome-webfont.svg b/assets/fonts/fontawesome-webfont.svg new file mode 100644 index 0000000..855c845 --- /dev/null +++ b/assets/fonts/fontawesome-webfont.svg @@ -0,0 +1,2671 @@ + + + + +Created by FontForge 20120731 at Mon Oct 24 17:37:40 2016 + By ,,, +Copyright Dave Gandy 2016. All rights reserved. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/assets/fonts/fontawesome-webfont.ttf b/assets/fonts/fontawesome-webfont.ttf new file mode 100644 index 0000000..35acda2 Binary files /dev/null and b/assets/fonts/fontawesome-webfont.ttf differ diff --git a/assets/fonts/fontawesome-webfont.woff b/assets/fonts/fontawesome-webfont.woff new file mode 100644 index 0000000..400014a Binary files /dev/null and b/assets/fonts/fontawesome-webfont.woff differ diff --git a/assets/fonts/fontawesome-webfont.woff2 b/assets/fonts/fontawesome-webfont.woff2 new file mode 100644 index 0000000..4d13fc6 Binary files /dev/null and b/assets/fonts/fontawesome-webfont.woff2 differ diff --git a/assets/fonts/fz.otf b/assets/fonts/fz.otf new file mode 100644 index 0000000..6eb0649 Binary files /dev/null and b/assets/fonts/fz.otf differ diff --git a/assets/fonts/icofont.eot b/assets/fonts/icofont.eot new file mode 100644 index 0000000..2850a6e Binary files /dev/null and b/assets/fonts/icofont.eot differ diff --git a/assets/fonts/icofont.ttf b/assets/fonts/icofont.ttf new file mode 100644 index 0000000..d194bff Binary files /dev/null and b/assets/fonts/icofont.ttf differ diff --git a/assets/fonts/icofont.woff b/assets/fonts/icofont.woff new file mode 100644 index 0000000..d24bb0f Binary files /dev/null and b/assets/fonts/icofont.woff differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff new file mode 100644 index 0000000..ce95a1a Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff2 b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff2 new file mode 100644 index 0000000..280eee5 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold-Italic.woff2 differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff new file mode 100644 index 0000000..2060cd1 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff2 b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff2 new file mode 100644 index 0000000..f81bf39 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-ExtraBold.woff2 differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff b/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff new file mode 100644 index 0000000..9c292e3 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff2 b/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff2 new file mode 100644 index 0000000..514fc7b Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-Italic.woff2 differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff b/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff new file mode 100644 index 0000000..20b54f1 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff2 b/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff2 new file mode 100644 index 0000000..e57de0b Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono-Regular.woff2 differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold.ttf b/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold.ttf new file mode 100644 index 0000000..bba598e Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold.ttf differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold_Italic.ttf b/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold_Italic.ttf new file mode 100644 index 0000000..ff89d25 Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono_ExtraBold_Italic.ttf differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono_Italic.ttf b/assets/fonts/jetBrainsMono/JetBrainsMono_Italic.ttf new file mode 100644 index 0000000..44e1f4a Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono_Italic.ttf differ diff --git a/assets/fonts/jetBrainsMono/JetBrainsMono_Regular.ttf b/assets/fonts/jetBrainsMono/JetBrainsMono_Regular.ttf new file mode 100644 index 0000000..7db854f Binary files /dev/null and b/assets/fonts/jetBrainsMono/JetBrainsMono_Regular.ttf differ diff --git a/assets/fonts/poppins/Poppins-Light.ttf b/assets/fonts/poppins/Poppins-Light.ttf new file mode 100644 index 0000000..2ab0221 Binary files /dev/null and b/assets/fonts/poppins/Poppins-Light.ttf differ diff --git a/assets/fonts/poppins/Poppins-LightItalic.ttf b/assets/fonts/poppins/Poppins-LightItalic.ttf new file mode 100644 index 0000000..6f9279d Binary files /dev/null and b/assets/fonts/poppins/Poppins-LightItalic.ttf differ diff --git a/assets/fonts/poppins/Poppins-Medium.ttf b/assets/fonts/poppins/Poppins-Medium.ttf new file mode 100644 index 0000000..e90e87e Binary files /dev/null and b/assets/fonts/poppins/Poppins-Medium.ttf differ diff --git a/assets/fonts/poppins/Poppins-MediumItalic.ttf b/assets/fonts/poppins/Poppins-MediumItalic.ttf new file mode 100644 index 0000000..d8a251c Binary files /dev/null and b/assets/fonts/poppins/Poppins-MediumItalic.ttf differ diff --git a/assets/fonts/poppins/popin-light-italic.woff2 b/assets/fonts/poppins/popin-light-italic.woff2 new file mode 100644 index 0000000..80dea78 Binary files /dev/null and b/assets/fonts/poppins/popin-light-italic.woff2 differ diff --git a/assets/fonts/poppins/popin-light.woff2 b/assets/fonts/poppins/popin-light.woff2 new file mode 100644 index 0000000..025dca3 Binary files /dev/null and b/assets/fonts/poppins/popin-light.woff2 differ diff --git a/assets/fonts/poppins/popin-medium-italic.woff2 b/assets/fonts/poppins/popin-medium-italic.woff2 new file mode 100644 index 0000000..3e307b4 Binary files /dev/null and b/assets/fonts/poppins/popin-medium-italic.woff2 differ diff --git a/assets/fonts/poppins/popin-medium.woff2 b/assets/fonts/poppins/popin-medium.woff2 new file mode 100644 index 0000000..bb0923b Binary files /dev/null and b/assets/fonts/poppins/popin-medium.woff2 differ diff --git a/assets/fonts/terminus/TerminusTTF-Bold.ttf b/assets/fonts/terminus/TerminusTTF-Bold.ttf new file mode 100644 index 0000000..3eeb0ad Binary files /dev/null and b/assets/fonts/terminus/TerminusTTF-Bold.ttf differ diff --git a/assets/fonts/terminus/TerminusTTF.ttf b/assets/fonts/terminus/TerminusTTF.ttf new file mode 100644 index 0000000..d302264 Binary files /dev/null and b/assets/fonts/terminus/TerminusTTF.ttf differ diff --git a/assets/fonts/togalite_black.otf b/assets/fonts/togalite_black.otf new file mode 100644 index 0000000..c1c786f Binary files /dev/null and b/assets/fonts/togalite_black.otf differ diff --git a/assets/img/vignette-footer.svg b/assets/img/vignette-footer.svg new file mode 100644 index 0000000..d82d6b7 --- /dev/null +++ b/assets/img/vignette-footer.svg @@ -0,0 +1,13 @@ +--- +layout: nil +--- + + + + + + + + + + diff --git a/assets/img/vignette.svg b/assets/img/vignette.svg new file mode 100644 index 0000000..4c0cfd1 --- /dev/null +++ b/assets/img/vignette.svg @@ -0,0 +1,15 @@ +--- +layout: nil +--- + + + + + + + + + + + + diff --git a/assets/js/jquery-3.5.1.min.js b/assets/js/jquery-3.5.1.min.js new file mode 100644 index 0000000..b061403 --- /dev/null +++ b/assets/js/jquery-3.5.1.min.js @@ -0,0 +1,2 @@ +/*! jQuery v3.5.1 | (c) JS Foundation and other contributors | jquery.org/license */ +!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(C,e){"use strict";var t=[],r=Object.getPrototypeOf,s=t.slice,g=t.flat?function(e){return t.flat.call(e)}:function(e){return t.concat.apply([],e)},u=t.push,i=t.indexOf,n={},o=n.toString,v=n.hasOwnProperty,a=v.toString,l=a.call(Object),y={},m=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType},x=function(e){return null!=e&&e===e.window},E=C.document,c={type:!0,src:!0,nonce:!0,noModule:!0};function b(e,t,n){var r,i,o=(n=n||E).createElement("script");if(o.text=e,t)for(r in c)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function w(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[o.call(e)]||"object":typeof e}var f="3.5.1",S=function(e,t){return new S.fn.init(e,t)};function p(e){var t=!!e&&"length"in e&&e.length,n=w(e);return!m(e)&&!x(e)&&("array"===n||0===t||"number"==typeof t&&0+~]|"+M+")"+M+"*"),U=new RegExp(M+"|>"),X=new RegExp(F),V=new RegExp("^"+I+"$"),G={ID:new RegExp("^#("+I+")"),CLASS:new RegExp("^\\.("+I+")"),TAG:new RegExp("^("+I+"|[*])"),ATTR:new RegExp("^"+W),PSEUDO:new RegExp("^"+F),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Y=/HTML$/i,Q=/^(?:input|select|textarea|button)$/i,J=/^h\d$/i,K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ee=/[+~]/,te=new RegExp("\\\\[\\da-fA-F]{1,6}"+M+"?|\\\\([^\\r\\n\\f])","g"),ne=function(e,t){var n="0x"+e.slice(1)-65536;return t||(n<0?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320))},re=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ie=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},oe=function(){T()},ae=be(function(e){return!0===e.disabled&&"fieldset"===e.nodeName.toLowerCase()},{dir:"parentNode",next:"legend"});try{H.apply(t=O.call(p.childNodes),p.childNodes),t[p.childNodes.length].nodeType}catch(e){H={apply:t.length?function(e,t){L.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function se(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&(T(e),e=e||C,E)){if(11!==p&&(u=Z.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return n.push(a),n}else if(f&&(a=f.getElementById(i))&&y(e,a)&&a.id===i)return n.push(a),n}else{if(u[2])return H.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&d.getElementsByClassName&&e.getElementsByClassName)return H.apply(n,e.getElementsByClassName(i)),n}if(d.qsa&&!N[t+" "]&&(!v||!v.test(t))&&(1!==p||"object"!==e.nodeName.toLowerCase())){if(c=t,f=e,1===p&&(U.test(t)||z.test(t))){(f=ee.test(t)&&ye(e.parentNode)||e)===e&&d.scope||((s=e.getAttribute("id"))?s=s.replace(re,ie):e.setAttribute("id",s=S)),o=(l=h(t)).length;while(o--)l[o]=(s?"#"+s:":scope")+" "+xe(l[o]);c=l.join(",")}try{return H.apply(n,f.querySelectorAll(c)),n}catch(e){N(t,!0)}finally{s===S&&e.removeAttribute("id")}}}return g(t.replace($,"$1"),e,n,r)}function ue(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function le(e){return e[S]=!0,e}function ce(e){var t=C.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function fe(e,t){var n=e.split("|"),r=n.length;while(r--)b.attrHandle[n[r]]=t}function pe(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function de(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}}function he(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}}function ge(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&ae(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function ve(a){return le(function(o){return o=+o,le(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function ye(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}for(e in d=se.support={},i=se.isXML=function(e){var t=e.namespaceURI,n=(e.ownerDocument||e).documentElement;return!Y.test(t||n&&n.nodeName||"HTML")},T=se.setDocument=function(e){var t,n,r=e?e.ownerDocument||e:p;return r!=C&&9===r.nodeType&&r.documentElement&&(a=(C=r).documentElement,E=!i(C),p!=C&&(n=C.defaultView)&&n.top!==n&&(n.addEventListener?n.addEventListener("unload",oe,!1):n.attachEvent&&n.attachEvent("onunload",oe)),d.scope=ce(function(e){return a.appendChild(e).appendChild(C.createElement("div")),"undefined"!=typeof e.querySelectorAll&&!e.querySelectorAll(":scope fieldset div").length}),d.attributes=ce(function(e){return e.className="i",!e.getAttribute("className")}),d.getElementsByTagName=ce(function(e){return e.appendChild(C.createComment("")),!e.getElementsByTagName("*").length}),d.getElementsByClassName=K.test(C.getElementsByClassName),d.getById=ce(function(e){return a.appendChild(e).id=S,!C.getElementsByName||!C.getElementsByName(S).length}),d.getById?(b.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(te,ne);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=d.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):d.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},b.find.CLASS=d.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&E)return t.getElementsByClassName(e)},s=[],v=[],(d.qsa=K.test(C.querySelectorAll))&&(ce(function(e){var t;a.appendChild(e).innerHTML="",e.querySelectorAll("[msallowcapture^='']").length&&v.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||v.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+S+"-]").length||v.push("~="),(t=C.createElement("input")).setAttribute("name",""),e.appendChild(t),e.querySelectorAll("[name='']").length||v.push("\\["+M+"*name"+M+"*="+M+"*(?:''|\"\")"),e.querySelectorAll(":checked").length||v.push(":checked"),e.querySelectorAll("a#"+S+"+*").length||v.push(".#.+[+~]"),e.querySelectorAll("\\\f"),v.push("[\\r\\n\\f]")}),ce(function(e){e.innerHTML="";var t=C.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&v.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&v.push(":enabled",":disabled"),a.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&v.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),v.push(",.*:")})),(d.matchesSelector=K.test(c=a.matches||a.webkitMatchesSelector||a.mozMatchesSelector||a.oMatchesSelector||a.msMatchesSelector))&&ce(function(e){d.disconnectedMatch=c.call(e,"*"),c.call(e,"[s!='']:x"),s.push("!=",F)}),v=v.length&&new RegExp(v.join("|")),s=s.length&&new RegExp(s.join("|")),t=K.test(a.compareDocumentPosition),y=t||K.test(a.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},D=t?function(e,t){if(e===t)return l=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)==(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!d.sortDetached&&t.compareDocumentPosition(e)===n?e==C||e.ownerDocument==p&&y(p,e)?-1:t==C||t.ownerDocument==p&&y(p,t)?1:u?P(u,e)-P(u,t):0:4&n?-1:1)}:function(e,t){if(e===t)return l=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e==C?-1:t==C?1:i?-1:o?1:u?P(u,e)-P(u,t):0;if(i===o)return pe(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?pe(a[r],s[r]):a[r]==p?-1:s[r]==p?1:0}),C},se.matches=function(e,t){return se(e,null,null,t)},se.matchesSelector=function(e,t){if(T(e),d.matchesSelector&&E&&!N[t+" "]&&(!s||!s.test(t))&&(!v||!v.test(t)))try{var n=c.call(e,t);if(n||d.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){N(t,!0)}return 0":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||se.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&se.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=h(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=m[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&m(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=se.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function D(e,n,r){return m(n)?S.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?S.grep(e,function(e){return e===n!==r}):"string"!=typeof n?S.grep(e,function(e){return-1)[^>]*|#([\w-]+))$/;(S.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||j,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:q.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof S?t[0]:t,S.merge(this,S.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:E,!0)),N.test(r[1])&&S.isPlainObject(t))for(r in t)m(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=E.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):m(e)?void 0!==n.ready?n.ready(e):e(S):S.makeArray(e,this)}).prototype=S.fn,j=S(E);var L=/^(?:parents|prev(?:Until|All))/,H={children:!0,contents:!0,next:!0,prev:!0};function O(e,t){while((e=e[t])&&1!==e.nodeType);return e}S.fn.extend({has:function(e){var t=S(e,this),n=t.length;return this.filter(function(){for(var e=0;e\x20\t\r\n\f]*)/i,he=/^$|^module$|\/(?:java|ecma)script/i;ce=E.createDocumentFragment().appendChild(E.createElement("div")),(fe=E.createElement("input")).setAttribute("type","radio"),fe.setAttribute("checked","checked"),fe.setAttribute("name","t"),ce.appendChild(fe),y.checkClone=ce.cloneNode(!0).cloneNode(!0).lastChild.checked,ce.innerHTML="",y.noCloneChecked=!!ce.cloneNode(!0).lastChild.defaultValue,ce.innerHTML="",y.option=!!ce.lastChild;var ge={thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};function ve(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&A(e,t)?S.merge([e],n):n}function ye(e,t){for(var n=0,r=e.length;n",""]);var me=/<|&#?\w+;/;function xe(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d\s*$/g;function qe(e,t){return A(e,"table")&&A(11!==t.nodeType?t:t.firstChild,"tr")&&S(e).children("tbody")[0]||e}function Le(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function He(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Oe(e,t){var n,r,i,o,a,s;if(1===t.nodeType){if(Y.hasData(e)&&(s=Y.get(e).events))for(i in Y.remove(t,"handle events"),s)for(n=0,r=s[i].length;n").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),E.head.appendChild(r[0])},abort:function(){i&&i()}}});var Ut,Xt=[],Vt=/(=)\?(?=&|$)|\?\?/;S.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Xt.pop()||S.expando+"_"+Ct.guid++;return this[e]=!0,e}}),S.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Vt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Vt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=m(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Vt,"$1"+r):!1!==e.jsonp&&(e.url+=(Et.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||S.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=C[r],C[r]=function(){o=arguments},n.always(function(){void 0===i?S(C).removeProp(r):C[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Xt.push(r)),o&&m(i)&&i(o[0]),o=i=void 0}),"script"}),y.createHTMLDocument=((Ut=E.implementation.createHTMLDocument("").body).innerHTML="
",2===Ut.childNodes.length),S.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(y.createHTMLDocument?((r=(t=E.implementation.createHTMLDocument("")).createElement("base")).href=E.location.href,t.head.appendChild(r)):t=E),o=!n&&[],(i=N.exec(e))?[t.createElement(i[1])]:(i=xe([e],t,o),o&&o.length&&S(o).remove(),S.merge([],i.childNodes)));var r,i,o},S.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1").append(S.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},S.expr.pseudos.animated=function(t){return S.grep(S.timers,function(e){return t===e.elem}).length},S.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=S.css(e,"position"),c=S(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=S.css(e,"top"),u=S.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),m(t)&&(t=t.call(e,n,S.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):("number"==typeof f.top&&(f.top+="px"),"number"==typeof f.left&&(f.left+="px"),c.css(f))}},S.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){S.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===S.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===S.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=S(e).offset()).top+=S.css(e,"borderTopWidth",!0),i.left+=S.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-S.css(r,"marginTop",!0),left:t.left-i.left-S.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===S.css(e,"position"))e=e.offsetParent;return e||re})}}),S.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;S.fn[t]=function(e){return $(this,function(e,t,n){var r;if(x(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),S.each(["top","left"],function(e,n){S.cssHooks[n]=$e(y.pixelPosition,function(e,t){if(t)return t=Be(e,n),Me.test(t)?S(e).position()[n]+"px":t})}),S.each({Height:"height",Width:"width"},function(a,s){S.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){S.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return $(this,function(e,t,n){var r;return x(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?S.css(e,t,i):S.style(e,t,n,i)},s,n?e:void 0,n)}})}),S.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){S.fn[t]=function(e){return this.on(t,e)}}),S.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),S.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){S.fn[n]=function(e,t){return 0= sticky) { + hider.classList.add("sticky") + } else { + hider.classList.remove("sticky") + + } +} + +// Make a pretty background when menu is open +var bodyBluring = document.getElementById("main-wrapper") + +function blurBody() { + bodyBluring.classList.toggle("blurredout"); +} +function removeBlur() { + bodyBluring.classList.remove("blurredout") +} + +/// request permission to autoplay \ No newline at end of file diff --git a/assets/js/zafari.js b/assets/js/zafari.js new file mode 100644 index 0000000..8cd7878 --- /dev/null +++ b/assets/js/zafari.js @@ -0,0 +1,13 @@ +var zafari = document.getElementById("zafari"); +var is_chrome = navigator.userAgent.indexOf('Chrome') > -1; +var is_explorer = navigator.userAgent.indexOf('MSIE') > -1; +var is_firefox = navigator.userAgent.indexOf('Firefox') > -1; +var is_safari = navigator.userAgent.indexOf("Safari") > -1; +var is_opera = navigator.userAgent.toLowerCase().indexOf("op") > -1; +if (navigator.userAgent.indexOf('Safari') != -1 && navigator.userAgent.indexOf('Chrome') == -1) { + zafari.classList.add("zafariClass"); +} + +function youMadBro() { + zafari.classList.remove("zafariClass"); +} \ No newline at end of file diff --git a/assets/webfonts/fa-brands-400.eot b/assets/webfonts/fa-brands-400.eot new file mode 100644 index 0000000..54ad8d7 Binary files /dev/null and b/assets/webfonts/fa-brands-400.eot differ diff --git a/assets/webfonts/fa-brands-400.svg b/assets/webfonts/fa-brands-400.svg new file mode 100644 index 0000000..2c8659c --- /dev/null +++ b/assets/webfonts/fa-brands-400.svg @@ -0,0 +1,3637 @@ + + + + + +Created by FontForge 20200314 at Wed Jul 15 11:59:41 2020 + By Robert Madole +Copyright (c) Font Awesome + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/assets/webfonts/fa-brands-400.ttf b/assets/webfonts/fa-brands-400.ttf new file mode 100644 index 0000000..16852bf Binary files /dev/null and b/assets/webfonts/fa-brands-400.ttf differ diff --git a/assets/webfonts/fa-brands-400.woff b/assets/webfonts/fa-brands-400.woff new file mode 100644 index 0000000..6cf6fb3 Binary files /dev/null and b/assets/webfonts/fa-brands-400.woff differ diff --git a/assets/webfonts/fa-brands-400.woff2 b/assets/webfonts/fa-brands-400.woff2 new file mode 100644 index 0000000..f2a4e36 Binary files /dev/null and b/assets/webfonts/fa-brands-400.woff2 differ diff --git a/assets/webfonts/fa-regular-400.eot b/assets/webfonts/fa-regular-400.eot new file mode 100644 index 0000000..479b32c Binary files /dev/null and b/assets/webfonts/fa-regular-400.eot differ diff --git a/assets/webfonts/fa-regular-400.svg b/assets/webfonts/fa-regular-400.svg new file mode 100644 index 0000000..7947ca8 --- /dev/null +++ b/assets/webfonts/fa-regular-400.svg @@ -0,0 +1,805 @@ + + + + + +Created by FontForge 20200314 at Wed Jul 15 11:59:40 2020 + By Robert Madole +Copyright (c) Font Awesome + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/assets/webfonts/fa-regular-400.ttf b/assets/webfonts/fa-regular-400.ttf new file mode 100644 index 0000000..42a04fd Binary files /dev/null and b/assets/webfonts/fa-regular-400.ttf differ diff --git a/assets/webfonts/fa-regular-400.woff b/assets/webfonts/fa-regular-400.woff new file mode 100644 index 0000000..c390c60 Binary files /dev/null and b/assets/webfonts/fa-regular-400.woff differ diff --git a/assets/webfonts/fa-regular-400.woff2 b/assets/webfonts/fa-regular-400.woff2 new file mode 100644 index 0000000..11c71d2 Binary files /dev/null and b/assets/webfonts/fa-regular-400.woff2 differ diff --git a/assets/webfonts/fa-solid-900.eot b/assets/webfonts/fa-solid-900.eot new file mode 100644 index 0000000..52883b9 Binary files /dev/null and b/assets/webfonts/fa-solid-900.eot differ diff --git a/assets/webfonts/fa-solid-900.svg b/assets/webfonts/fa-solid-900.svg new file mode 100644 index 0000000..d5e4d52 --- /dev/null +++ b/assets/webfonts/fa-solid-900.svg @@ -0,0 +1,5015 @@ + + + + + +Created by FontForge 20200314 at Wed Jul 15 11:59:41 2020 + By Robert Madole +Copyright (c) Font Awesome + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/assets/webfonts/fa-solid-900.ttf b/assets/webfonts/fa-solid-900.ttf new file mode 100644 index 0000000..7c59512 Binary files /dev/null and b/assets/webfonts/fa-solid-900.ttf differ diff --git a/assets/webfonts/fa-solid-900.woff b/assets/webfonts/fa-solid-900.woff new file mode 100644 index 0000000..aff125d Binary files /dev/null and b/assets/webfonts/fa-solid-900.woff differ diff --git a/assets/webfonts/fa-solid-900.woff2 b/assets/webfonts/fa-solid-900.woff2 new file mode 100644 index 0000000..aa2b791 Binary files /dev/null and b/assets/webfonts/fa-solid-900.woff2 differ diff --git a/atom.xml b/atom.xml new file mode 100644 index 0000000..393ab02 --- /dev/null +++ b/atom.xml @@ -0,0 +1,38 @@ +--- +layout: nil +--- + + + {{ site.title }} + {{ site.description | xml_escape }} + + + {{ site.time | date_to_xmlschema }} + {{ site.url }}/atom.xml + + {{ site.publisher.name }} + {{ site.publisher.mail }} + + Copyleft {{ site.time | date: '%Y' }} {{ site.publisher.name }} + {{ site.url }}{{ site.icon }} + {{ site.url }}{{ site.icon }} + + {% for post in site.posts limit:10 %} + + {{ post.title }} + + {{ post.date | date_to_xmlschema }} + {{ post.last_modified_at | date_to_xmlschema }} + {{ site.url }}{{ post.url }} + {{ post.content | strip_html | truncate: 220 | xml_escape }} + {{ post.description }} + +{% assign author_id = post.author | prepend: "/authors/" | append: "/" %} +{% assign author = site.authors | where: "url", author_id | first %} + {{ author.name }} + {{ author.email }} + {{ author.url_staff }} + + + {% endfor %} + \ No newline at end of file diff --git a/chat.html b/chat.html new file mode 100644 index 0000000..68bd88f --- /dev/null +++ b/chat.html @@ -0,0 +1,9 @@ +--- +title: Chat with me fam! +description: >- + On this page you'll find a bridge to my IRC channel. This channel is also availbe via matrix +image: /images/kaur-kristjan-cppf4w5pb1c-unsplash.jpg +layout: page +--- +

You do not need to register to participate. This chat is public. We never ask you to submit credit-card (any other payment information) nor personal information. It is provided by kiwi via Libera.Chat. Read the privacy policy of Kiwi and Libera.Chat
Matrix user? Click here

+ diff --git a/cookies.md b/cookies.md new file mode 100644 index 0000000..72c548a --- /dev/null +++ b/cookies.md @@ -0,0 +1,9 @@ +--- +title: Cookies & Privacy policy +image: /images/pages/arget-zvhhkivur9m-unsplash.jpg +description: 'Privacy is important, therefor 徒 setto セット respects it!' +sitemap: false +layout: page +--- + +## This site doesn't use cookies or analytics. \ No newline at end of file diff --git a/discography.html b/discography.html new file mode 100644 index 0000000..a7eb1aa --- /dev/null +++ b/discography.html @@ -0,0 +1,41 @@ +--- +title: Discography +subtitle: Discog +description: Collection of music releases published by 徒 setto セット over the years. +tags: + - discography + - releases + - music + - full-length + - albums + - EP +video_path: +image: /images/pages/jack-hamilton-CMnNiQBkwBI-unsplash.jpg +--- + +{% include relBase.html %} +{% include header.html %} + +{% assign sorted = site.posts | sort: 'date' | reverse %} +{% for post in sorted %} +{% if post.category == 'releases' %} +
+ + +
+
+

{{ post.title }}

+ +

{% for tag in post.tags %}{{ tag }}{% endfor %} released {% include forloop-dates.html %}

+

{{ post.description }}

+

🔊 Listen

+ +
+
+ +
+{% endif %} +{% endfor %} diff --git a/feed.xml b/feed.xml new file mode 100644 index 0000000..6a3833c --- /dev/null +++ b/feed.xml @@ -0,0 +1,43 @@ +--- +layout: nil +title : To Setto Setto RSS Feed +--- + + + + + {{ site.title | xml_escape }} + + {{ site.url }} + {{ site.description | xml_escape }} + {{ site.time | date_to_rfc822 }} + en-US + https://jekyllrb.com/ + + {{ site.icon }} + {{ site.title | xml_escape }} + {{ site.url }} + {% imagesize {{ site.icon }}:width %} + {% imagesize {{ site.icon }}:height %} + + {{ site.publisher.mail }} ({{ site.publisher.name }}) + Anti-Copyright 2018 {{ site.title }} + + + {% for post in site.posts limit: 7 %} + + {{ post.title | xml_escape }} + {{ site.url }}{{ post.url }}?pk_campaign=rss + {{ site.url }}{{ post.url }} + {{ post.description | truncate: 200 | xml_escape }} + Hi-Lights + {% assign author_id = post.author | prepend: "/authors/" | append: "/" %} + {% assign author = site.authors | where: "url", author_id | first %} + {{ author.email }} ({{ author.name }}) + {{ post.date | date_to_rfc822 }} + + {{ post.title | xml_escape }} + + {% endfor %} + + diff --git a/images/arget-zvhhkivur9m-unsplash.jpg b/images/arget-zvhhkivur9m-unsplash.jpg new file mode 100644 index 0000000..5b3f903 Binary files /dev/null and b/images/arget-zvhhkivur9m-unsplash.jpg differ diff --git a/images/creds.jpg b/images/creds.jpg new file mode 100644 index 0000000..5a8055d Binary files /dev/null and b/images/creds.jpg differ diff --git a/images/darkweb.jpg b/images/darkweb.jpg new file mode 100644 index 0000000..6f41c08 Binary files /dev/null and b/images/darkweb.jpg differ diff --git a/images/darkweb480x480.png b/images/darkweb480x480.png new file mode 100644 index 0000000..03aa7de Binary files /dev/null and b/images/darkweb480x480.png differ diff --git a/images/emptypixel.png b/images/emptypixel.png new file mode 100644 index 0000000..f3f8517 Binary files /dev/null and b/images/emptypixel.png differ diff --git a/images/kaur-kristjan-cppf4w5pb1c-unsplash.jpg b/images/kaur-kristjan-cppf4w5pb1c-unsplash.jpg new file mode 100644 index 0000000..a8b4f81 Binary files /dev/null and b/images/kaur-kristjan-cppf4w5pb1c-unsplash.jpg differ diff --git a/images/links/31754598_1544769695645302_5533343342533804032_o.jpg b/images/links/31754598_1544769695645302_5533343342533804032_o.jpg new file mode 100644 index 0000000..09fd424 Binary files /dev/null and b/images/links/31754598_1544769695645302_5533343342533804032_o.jpg differ diff --git a/images/links/5022924.png b/images/links/5022924.png new file mode 100644 index 0000000..f3a1bec Binary files /dev/null and b/images/links/5022924.png differ diff --git a/images/links/Screenshot_20200908_202010.jpg b/images/links/Screenshot_20200908_202010.jpg new file mode 100644 index 0000000..8b5d741 Binary files /dev/null and b/images/links/Screenshot_20200908_202010.jpg differ diff --git a/images/links/Screenshot_20200908_202215.jpg b/images/links/Screenshot_20200908_202215.jpg new file mode 100644 index 0000000..0c00a27 Binary files /dev/null and b/images/links/Screenshot_20200908_202215.jpg differ diff --git a/images/links/Screenshot_20200908_202311.jpg b/images/links/Screenshot_20200908_202311.jpg new file mode 100644 index 0000000..77292df Binary files /dev/null and b/images/links/Screenshot_20200908_202311.jpg differ diff --git a/images/links/Screenshot_20200908_202404.jpg b/images/links/Screenshot_20200908_202404.jpg new file mode 100644 index 0000000..282ab69 Binary files /dev/null and b/images/links/Screenshot_20200908_202404.jpg differ diff --git a/images/links/Screenshot_20200908_202439.jpg b/images/links/Screenshot_20200908_202439.jpg new file mode 100644 index 0000000..8f63f4d Binary files /dev/null and b/images/links/Screenshot_20200908_202439.jpg differ diff --git a/images/links/Screenshot_20200908_202921.jpg b/images/links/Screenshot_20200908_202921.jpg new file mode 100644 index 0000000..03ced48 Binary files /dev/null and b/images/links/Screenshot_20200908_202921.jpg differ diff --git a/images/links/Screenshot_20200908_202955.jpg b/images/links/Screenshot_20200908_202955.jpg new file mode 100644 index 0000000..a4adc9a Binary files /dev/null and b/images/links/Screenshot_20200908_202955.jpg differ diff --git a/images/links/alsenet.jpg b/images/links/alsenet.jpg new file mode 100644 index 0000000..b57ce8b Binary files /dev/null and b/images/links/alsenet.jpg differ diff --git a/images/links/basspistol.png b/images/links/basspistol.png new file mode 100644 index 0000000..78ce9fc Binary files /dev/null and b/images/links/basspistol.png differ diff --git a/images/links/cropped-logo_alsenet_pv-1-e1466347695561.png b/images/links/cropped-logo_alsenet_pv-1-e1466347695561.png new file mode 100644 index 0000000..f8dd333 Binary files /dev/null and b/images/links/cropped-logo_alsenet_pv-1-e1466347695561.png differ diff --git a/images/links/ritarn.jpg b/images/links/ritarn.jpg new file mode 100644 index 0000000..2bfe8a8 Binary files /dev/null and b/images/links/ritarn.jpg differ diff --git a/images/nebula-bw.jpg b/images/nebula-bw.jpg new file mode 100644 index 0000000..2d2e53c Binary files /dev/null and b/images/nebula-bw.jpg differ diff --git a/images/nebula.jpg b/images/nebula.jpg new file mode 100644 index 0000000..e6a34cf Binary files /dev/null and b/images/nebula.jpg differ diff --git a/images/nebula___.jpg b/images/nebula___.jpg new file mode 100644 index 0000000..bf459d9 Binary files /dev/null and b/images/nebula___.jpg differ diff --git a/images/pages/4-darkweb-instrumental-.jpeg b/images/pages/4-darkweb-instrumental-.jpeg new file mode 100644 index 0000000..55fd3ef Binary files /dev/null and b/images/pages/4-darkweb-instrumental-.jpeg differ diff --git a/images/pages/arget-zvhhkivur9m-unsplash.jpg b/images/pages/arget-zvhhkivur9m-unsplash.jpg new file mode 100644 index 0000000..5b3f903 Binary files /dev/null and b/images/pages/arget-zvhhkivur9m-unsplash.jpg differ diff --git a/images/pages/background-setto-v2-blus.svg b/images/pages/background-setto-v2-blus.svg new file mode 100644 index 0000000..47edd86 --- /dev/null +++ b/images/pages/background-setto-v2-blus.svg @@ -0,0 +1,140 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/pages/creds.jpg b/images/pages/creds.jpg new file mode 100644 index 0000000..5a8055d Binary files /dev/null and b/images/pages/creds.jpg differ diff --git a/images/pages/default-live-background.jpg b/images/pages/default-live-background.jpg new file mode 100644 index 0000000..608cf55 Binary files /dev/null and b/images/pages/default-live-background.jpg differ diff --git a/images/pages/jack-hamilton-CMnNiQBkwBI-unsplash.jpg b/images/pages/jack-hamilton-CMnNiQBkwBI-unsplash.jpg new file mode 100644 index 0000000..5449104 Binary files /dev/null and b/images/pages/jack-hamilton-CMnNiQBkwBI-unsplash.jpg differ diff --git a/images/pages/kaur-kristjan-cppf4w5pb1c-unsplash.jpg b/images/pages/kaur-kristjan-cppf4w5pb1c-unsplash.jpg new file mode 100644 index 0000000..a8b4f81 Binary files /dev/null and b/images/pages/kaur-kristjan-cppf4w5pb1c-unsplash.jpg differ diff --git a/images/pages/phone.jpg b/images/pages/phone.jpg new file mode 100644 index 0000000..402b5d3 Binary files /dev/null and b/images/pages/phone.jpg differ diff --git a/images/pages/pingu.jpg b/images/pages/pingu.jpg new file mode 100644 index 0000000..6ae920f Binary files /dev/null and b/images/pages/pingu.jpg differ diff --git a/images/posts/1-ep-life-of-a-dudelini.jpeg b/images/posts/1-ep-life-of-a-dudelini.jpeg new file mode 100644 index 0000000..c3da8f5 Binary files /dev/null and b/images/posts/1-ep-life-of-a-dudelini.jpeg differ diff --git a/images/posts/1-grandma-got-the-ssh-keys.jpeg b/images/posts/1-grandma-got-the-ssh-keys.jpeg new file mode 100644 index 0000000..f2f5dd4 Binary files /dev/null and b/images/posts/1-grandma-got-the-ssh-keys.jpeg differ diff --git a/images/posts/1-k-as-tu-fait-de-nous-.jpeg b/images/posts/1-k-as-tu-fait-de-nous-.jpeg new file mode 100644 index 0000000..0e3dff8 Binary files /dev/null and b/images/posts/1-k-as-tu-fait-de-nous-.jpeg differ diff --git a/images/posts/2-darkweb-instrumental-.jpeg b/images/posts/2-darkweb-instrumental-.jpeg new file mode 100644 index 0000000..55fd3ef Binary files /dev/null and b/images/posts/2-darkweb-instrumental-.jpeg differ diff --git a/images/posts/333mix.jpg b/images/posts/333mix.jpg new file mode 100644 index 0000000..73c074e Binary files /dev/null and b/images/posts/333mix.jpg differ diff --git a/images/posts/Screenshot_20200918_112312.jpg b/images/posts/Screenshot_20200918_112312.jpg new file mode 100644 index 0000000..b0d8a42 Binary files /dev/null and b/images/posts/Screenshot_20200918_112312.jpg differ diff --git a/images/posts/digital-detox.jpg b/images/posts/digital-detox.jpg new file mode 100644 index 0000000..b84d5a5 Binary files /dev/null and b/images/posts/digital-detox.jpg differ diff --git a/images/posts/final-pingnucover1220x1200.jpg b/images/posts/final-pingnucover1220x1200.jpg new file mode 100644 index 0000000..16bd533 Binary files /dev/null and b/images/posts/final-pingnucover1220x1200.jpg differ diff --git a/images/posts/fuckit.jpg b/images/posts/fuckit.jpg new file mode 100644 index 0000000..fa8f59a Binary files /dev/null and b/images/posts/fuckit.jpg differ diff --git a/images/posts/littlebug1400x1400.png b/images/posts/littlebug1400x1400.png new file mode 100644 index 0000000..1dd1f71 Binary files /dev/null and b/images/posts/littlebug1400x1400.png differ diff --git a/images/satoshimonami.jpg b/images/satoshimonami.jpg new file mode 100644 index 0000000..3851faa Binary files /dev/null and b/images/satoshimonami.jpg differ diff --git a/images/setto-logo-dark.svg b/images/setto-logo-dark.svg new file mode 100644 index 0000000..42cff12 --- /dev/null +++ b/images/setto-logo-dark.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/setto-logo.svg b/images/setto-logo.svg new file mode 100644 index 0000000..8442881 --- /dev/null +++ b/images/setto-logo.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/images/setto-logoicon-footer.svg b/images/setto-logoicon-footer.svg new file mode 100644 index 0000000..c920b8e --- /dev/null +++ b/images/setto-logoicon-footer.svg @@ -0,0 +1,2 @@ + + diff --git a/images/setto-logoicon.svg b/images/setto-logoicon.svg new file mode 100644 index 0000000..69b8528 --- /dev/null +++ b/images/setto-logoicon.svg @@ -0,0 +1,2 @@ + + diff --git a/images/setto_banner.jpg b/images/setto_banner.jpg new file mode 100644 index 0000000..12d9b4e Binary files /dev/null and b/images/setto_banner.jpg differ diff --git a/images/setto_icon.png b/images/setto_icon.png new file mode 100644 index 0000000..bfef833 Binary files /dev/null and b/images/setto_icon.png differ diff --git a/images/setto_logo.png b/images/setto_logo.png new file mode 100644 index 0000000..99e1fae Binary files /dev/null and b/images/setto_logo.png differ diff --git a/images/setto_logo.svg b/images/setto_logo.svg new file mode 100644 index 0000000..3a34c49 --- /dev/null +++ b/images/setto_logo.svg @@ -0,0 +1,2 @@ + + diff --git a/images/untitled.jpg b/images/untitled.jpg new file mode 100644 index 0000000..d7eb528 Binary files /dev/null and b/images/untitled.jpg differ diff --git a/index.html b/index.html index 1c5c530..2665a27 100644 --- a/index.html +++ b/index.html @@ -1,675 +1,145 @@ - - - - - - - - - - - - - - - - - -
- - - -/* new */ +{% include relBase.html %} +
+
+

{{ page.title }}

+
-.ztr-comment-new .ztr-reply-form { - margin: 0.5em 0; - padding: 0; -} +
+ +
+ + -.ztr-comment-new .ztr-comment-body { - padding: 0; -} + +
-.ztr-comment-new .ztr-comment-actions { - font-size: 1.1em; - padding: 0; -} +
-/* Dark mode defaults */ -@media (prefers-color-scheme: dark) { - .ztr-spinner .path { - stroke: var(--ztr-text-color, #DEDEDE); - } +
+
+
+

{{ site.title }}

+

{{ page.description }}

+

Releases

+
+ {% assign sorted = site.posts | sort: 'date' | reverse %} + {% for post in sorted %} + {% for album in site.albums %} + + {% if album.slug == post.album %} - .ztr-comment, - .ztr-reply-button { - background-color: var(--ztr-background-color, rgba(255, 255, 255, 0.06)); - } +
+
+ + Cover art for {{ post.title }} +
+

{{ album.name }}

- .ztr-reply-login-button { - color: #2B2B2B; - background-color: var(--ztr-login-button-color, #DEDEDE); - } + {% assign total = 0 %} + {% for track in album.tracks %} + {% assign total = total | plus: track.format.duration %} + {% endfor %} + - svg { - fill: var(--ztr-icon-color, #DEDEDE); - } +

Duration: {% assign round_seconds = total | round %}{% assign minutes = round_seconds | divided_by: 60 %}{% assign leftover_seconds = minutes | times: 60 %}{{ minutes }}:{% assign seconds_without_zero = round_seconds | minus: leftover_seconds %}{% if seconds_without_zero < 10 %}0{% endif %}{{ seconds_without_zero }}

- ul.ztr-comment-actions li span { - color: var(--ztr-icon-color); - } +

{% for tag in post.tags %}{{ tag }}{% endfor %} released

+
+
+
- .ztr-comment-action-reply:hover svg { - fill: #96609c; - } + {% endif %} + {% endfor %} + {% endfor %} +
+
+
- .ztr-comment-action-reply:hover span { - color: #96609c; - } -}`;function K0(e){if(!Number.isSafeInteger(e)||e<0)throw new Error(`Wrong positive integer: ${e}`)}function Pb(e,...t){if(!(e instanceof Uint8Array))throw new Error("Expected Uint8Array");if(t.length>0&&!t.includes(e.length))throw new Error(`Expected Uint8Array of length ${t}, not of length=${e.length}`)}function dx(e){if(typeof e!="function"||typeof e.create!="function")throw new Error("Hash should be wrapped by utils.wrapConstructor");K0(e.outputLen),K0(e.blockLen)}function Gc(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function fx(e,t){Pb(e);let n=t.outputLen;if(e.lengthe instanceof Uint8Array,pf=e=>new DataView(e.buffer,e.byteOffset,e.byteLength),Zn=(e,t)=>e<<32-t|e>>>t,hx=new Uint8Array(new Uint32Array([287454020]).buffer)[0]===68;if(!hx)throw new Error("Non little-endian hardware is not supported");function px(e){if(typeof e!="string")throw new Error(`utf8ToBytes expected string, got ${typeof e}`);return new Uint8Array(new TextEncoder().encode(e))}function Gf(e){if(typeof e=="string"&&(e=px(e)),!Ib(e))throw new Error(`expected Uint8Array, got ${typeof e}`);return e}function gx(...e){let t=new Uint8Array(e.reduce((r,o)=>r+o.length,0)),n=0;return e.forEach(r=>{if(!Ib(r))throw new Error("Uint8Array expected");t.set(r,n),n+=r.length}),t}var Nb=class{clone(){return this._cloneInto()}};function mx(e){let t=r=>e().update(Gf(r)).digest(),n=e();return t.outputLen=n.outputLen,t.blockLen=n.blockLen,t.create=()=>e(),t}function Ob(e=32){if(hf&&typeof hf.getRandomValues=="function")return hf.getRandomValues(new Uint8Array(e));throw new Error("crypto.getRandomValues must be defined")}function bx(e,t,n,r){if(typeof e.setBigUint64=="function")return e.setBigUint64(t,n,r);let o=BigInt(32),i=BigInt(4294967295),a=Number(n>>o&i),u=Number(n&i),d=r?4:0,h=r?0:4;e.setUint32(t+d,a,r),e.setUint32(t+h,u,r)}var wx=class extends Nb{constructor(t,n,r,o){super(),this.blockLen=t,this.outputLen=n,this.padOffset=r,this.isLE=o,this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.buffer=new Uint8Array(t),this.view=pf(this.buffer)}update(t){Gc(this);let{view:n,buffer:r,blockLen:o}=this;t=Gf(t);let i=t.length;for(let a=0;ao-a&&(this.process(r,0),a=0);for(let b=a;bm.length)throw new Error("_sha2: outputLen bigger than state");for(let b=0;be&t^~e&n,vx=(e,t,n)=>e&t^e&n^t&n,_x=new Uint32Array([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),io=new Uint32Array([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),so=new Uint32Array(64),Ex=class extends wx{constructor(){super(64,32,8,!1),this.A=io[0]|0,this.B=io[1]|0,this.C=io[2]|0,this.D=io[3]|0,this.E=io[4]|0,this.F=io[5]|0,this.G=io[6]|0,this.H=io[7]|0}get(){let{A:t,B:n,C:r,D:o,E:i,F:a,G:u,H:d}=this;return[t,n,r,o,i,a,u,d]}set(t,n,r,o,i,a,u,d){this.A=t|0,this.B=n|0,this.C=r|0,this.D=o|0,this.E=i|0,this.F=a|0,this.G=u|0,this.H=d|0}process(t,n){for(let b=0;b<16;b++,n+=4)so[b]=t.getUint32(n,!1);for(let b=16;b<64;b++){let _=so[b-15],T=so[b-2],A=Zn(_,7)^Zn(_,18)^_>>>3,k=Zn(T,17)^Zn(T,19)^T>>>10;so[b]=k+so[b-7]+A+so[b-16]|0}let{A:r,B:o,C:i,D:a,E:u,F:d,G:h,H:m}=this;for(let b=0;b<64;b++){let _=Zn(u,6)^Zn(u,11)^Zn(u,25),T=m+_+yx(u,d,h)+_x[b]+so[b]|0,k=(Zn(r,2)^Zn(r,13)^Zn(r,22))+vx(r,o,i)|0;m=h,h=d,d=u,u=a+T|0,a=i,i=o,o=r,r=T+k|0}r=r+this.A|0,o=o+this.B|0,i=i+this.C|0,a=a+this.D|0,u=u+this.E|0,d=d+this.F|0,h=h+this.G|0,m=m+this.H|0,this.set(r,o,i,a,u,d,h,m)}roundClean(){so.fill(0)}destroy(){this.set(0,0,0,0,0,0,0,0),this.buffer.fill(0)}},Cf=mx(()=>new Ex);var Rb=BigInt(0),au=BigInt(1),xx=BigInt(2),cu=e=>e instanceof Uint8Array,kx=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function Ri(e){if(!cu(e))throw new Error("Uint8Array expected");let t="";for(let n=0;nr+o.length,0)),n=0;return e.forEach(r=>{if(!cu(r))throw new Error("Uint8Array expected");t.set(r,n),n+=r.length}),t}function Ax(e,t){if(e.length!==t.length)return!1;for(let n=0;nRb;e>>=au,t+=1);return t}function Bx(e,t){return e>>BigInt(t)&au}var Lx=(e,t,n)=>e|(n?au:Rb)<(xx<new Uint8Array(e),G0=e=>Uint8Array.from(e);function zb(e,t,n){if(typeof e!="number"||e<2)throw new Error("hashLen must be a number");if(typeof t!="number"||t<2)throw new Error("qByteLen must be a number");if(typeof n!="function")throw new Error("hmacFn must be a function");let r=gf(e),o=gf(e),i=0,a=()=>{r.fill(1),o.fill(0),i=0},u=(...b)=>n(o,r,...b),d=(b=gf())=>{o=u(G0([0]),b),r=u(),b.length!==0&&(o=u(G0([1]),b),r=u())},h=()=>{if(i++>=1e3)throw new Error("drbg: tried 1000 values");let b=0,_=[];for(;b{a(),d(b);let T;for(;!(T=_(h()));)d();return a(),T}}var Cx={bigint:e=>typeof e=="bigint",function:e=>typeof e=="function",boolean:e=>typeof e=="boolean",string:e=>typeof e=="string",stringOrUint8Array:e=>typeof e=="string"||e instanceof Uint8Array,isSafeInteger:e=>Number.isSafeInteger(e),array:e=>Array.isArray(e),field:(e,t)=>t.Fp.isValid(e),hash:e=>typeof e=="function"&&Number.isSafeInteger(e.outputLen)};function Zs(e,t,n={}){let r=(o,i,a)=>{let u=Cx[i];if(typeof u!="function")throw new Error(`Invalid validator "${i}", expected function`);let d=e[o];if(!(a&&d===void 0)&&!u(d,e))throw new Error(`Invalid param ${String(o)}=${d} (${typeof d}), expected ${i}`)};for(let[o,i]of Object.entries(t))r(o,i,!1);for(let[o,i]of Object.entries(n))r(o,i,!0);return e}var Px=Object.freeze(Object.defineProperty({__proto__:null,bitGet:Bx,bitLen:$x,bitMask:Xf,bitSet:Lx,bytesToHex:Ri,bytesToNumberBE:rn,bytesToNumberLE:Yf,concatBytes:Go,createHmacDrbg:zb,ensureBytes:jt,equalBytes:Ax,hexToBytes:Ui,hexToNumber:Zf,numberToBytesBE:po,numberToBytesLE:Jf,numberToHexUnpadded:Ub,numberToVarBytesBE:Sx,utf8ToBytes:Tx,validateObject:Zs},Symbol.toStringTag,{value:"Module"}));var Lt=BigInt(0),pt=BigInt(1),Wo=BigInt(2),Ix=BigInt(3),Pf=BigInt(4),Z0=BigInt(5),Y0=BigInt(8);BigInt(9);BigInt(16);function zt(e,t){let n=e%t;return n>=Lt?n:t+n}function Nx(e,t,n){if(n<=Lt||t 0");if(n===pt)return Lt;let r=pt;for(;t>Lt;)t&pt&&(r=r*e%n),e=e*e%n,t>>=pt;return r}function yn(e,t,n){let r=e;for(;t-- >Lt;)r*=r,r%=n;return r}function If(e,t){if(e===Lt||t<=Lt)throw new Error(`invert: expected positive integers, got n=${e} mod=${t}`);let n=zt(e,t),r=t,o=Lt,i=pt;for(;n!==Lt;){let u=r/n,d=r%n,h=o-i*u;r=n,n=d,o=i,i=h}if(r!==pt)throw new Error("invert: does not exist");return zt(o,t)}function Ox(e){let t=(e-pt)/Wo,n,r,o;for(n=e-pt,r=0;n%Wo===Lt;n/=Wo,r++);for(o=Wo;o(r[o]="function",r),t);return Zs(e,n)}function Mx(e,t,n){if(n 0");if(n===Lt)return e.ONE;if(n===pt)return t;let r=e.ONE,o=t;for(;n>Lt;)n&pt&&(r=e.mul(r,o)),o=e.sqr(o),n>>=pt;return r}function Dx(e,t){let n=new Array(t.length),r=t.reduce((i,a,u)=>e.is0(a)?i:(n[u]=i,e.mul(i,a)),e.ONE),o=e.inv(r);return t.reduceRight((i,a,u)=>e.is0(a)?i:(n[u]=e.mul(i,n[u]),e.mul(i,a)),o),n}function Mb(e,t){let n=t!==void 0?t:e.toString(2).length,r=Math.ceil(n/8);return{nBitLength:n,nByteLength:r}}function Fx(e,t,n=!1,r={}){if(e<=Lt)throw new Error(`Expected Field ORDER > 0, got ${e}`);let{nBitLength:o,nByteLength:i}=Mb(e,t);if(i>2048)throw new Error("Field lengths over 2048 bytes are not supported");let a=Rx(e),u=Object.freeze({ORDER:e,BITS:o,BYTES:i,MASK:Xf(o),ZERO:Lt,ONE:pt,create:d=>zt(d,e),isValid:d=>{if(typeof d!="bigint")throw new Error(`Invalid field element: expected bigint, got ${typeof d}`);return Lt<=d&&dd===Lt,isOdd:d=>(d&pt)===pt,neg:d=>zt(-d,e),eql:(d,h)=>d===h,sqr:d=>zt(d*d,e),add:(d,h)=>zt(d+h,e),sub:(d,h)=>zt(d-h,e),mul:(d,h)=>zt(d*h,e),pow:(d,h)=>Mx(u,d,h),div:(d,h)=>zt(d*If(h,e),e),sqrN:d=>d*d,addN:(d,h)=>d+h,subN:(d,h)=>d-h,mulN:(d,h)=>d*h,inv:d=>If(d,e),sqrt:r.sqrt||(d=>a(u,d)),invertBatch:d=>Dx(u,d),cmov:(d,h,m)=>m?h:d,toBytes:d=>n?Jf(d,i):po(d,i),fromBytes:d=>{if(d.length!==i)throw new Error(`Fp.fromBytes: expected ${i}, got ${d.length}`);return n?Yf(d):rn(d)}});return Object.freeze(u)}function Db(e){if(typeof e!="bigint")throw new Error("field order must be bigint");let t=e.toString(2).length;return Math.ceil(t/8)}function Fb(e){let t=Db(e);return t+Math.ceil(t/2)}function jx(e,t,n=!1){let r=e.length,o=Db(t),i=Fb(t);if(r<16||r1024)throw new Error(`expected ${i}-1024 bytes of input, got ${r}`);let a=n?rn(e):Yf(e),u=zt(a,t-pt)+pt;return n?Jf(u,o):po(u,o)}var Hx=BigInt(0),mf=BigInt(1);function Vx(e,t){let n=(o,i)=>{let a=i.negate();return o?a:i},r=o=>{let i=Math.ceil(t/o)+1,a=2**(o-1);return{windows:i,windowSize:a}};return{constTimeNegate:n,unsafeLadder(o,i){let a=e.ZERO,u=o;for(;i>Hx;)i&mf&&(a=a.add(u)),u=u.double(),i>>=mf;return a},precomputeWindow(o,i){let{windows:a,windowSize:u}=r(i),d=[],h=o,m=h;for(let b=0;b>=T,I>d&&(I-=_,a+=mf);let O=k,L=k+Math.abs(I)-1,f=A%2!==0,p=I<0;I===0?m=m.add(n(f,i[O])):h=h.add(n(p,i[L]))}return{p:h,f:m}},wNAFCached(o,i,a,u){let d=o._WINDOW_SIZE||1,h=i.get(o);return h||(h=this.precomputeWindow(o,d),d!==1&&i.set(o,u(h))),this.wNAF(d,h,a)}}}function jb(e){return zx(e.Fp),Zs(e,{n:"bigint",h:"bigint",Gx:"field",Gy:"field"},{nBitLength:"isSafeInteger",nByteLength:"isSafeInteger"}),Object.freeze({...Mb(e.n,e.nBitLength),...e,p:e.Fp.ORDER})}function qx(e){let t=jb(e);Zs(t,{a:"field",b:"field"},{allowedPrivateKeyLengths:"array",wrapPrivateKey:"boolean",isTorsionFree:"function",clearCofactor:"function",allowInfinityPoint:"boolean",fromBytes:"function",toBytes:"function"});let{endo:n,Fp:r,a:o}=t;if(n){if(!r.eql(o,r.ZERO))throw new Error("Endomorphism can only be defined for Koblitz curves that have a=0");if(typeof n!="object"||typeof n.beta!="bigint"||typeof n.splitScalar!="function")throw new Error("Expected endomorphism with beta: bigint and splitScalar: function")}return Object.freeze({...t})}var{bytesToNumberBE:Wx,hexToBytes:Qx}=Px,Ko={Err:class extends Error{constructor(t=""){super(t)}},_parseInt(e){let{Err:t}=Ko;if(e.length<2||e[0]!==2)throw new t("Invalid signature integer tag");let n=e[1],r=e.subarray(2,n+2);if(!n||r.length!==n)throw new t("Invalid signature integer: wrong length");if(r[0]&128)throw new t("Invalid signature integer: negative");if(r[0]===0&&!(r[1]&128))throw new t("Invalid signature integer: unnecessary leading zero");return{d:Wx(r),l:e.subarray(n+2)}},toSig(e){let{Err:t}=Ko,n=typeof e=="string"?Qx(e):e;if(!(n instanceof Uint8Array))throw new Error("ui8a expected");let r=n.length;if(r<2||n[0]!=48)throw new t("Invalid signature tag");if(n[1]!==r-2)throw new t("Invalid signature: incorrect length");let{d:o,l:i}=Ko._parseInt(n.subarray(2)),{d:a,l:u}=Ko._parseInt(i);if(u.length)throw new t("Invalid signature: left bytes after parsing");return{r:o,s:a}},hexFromSig(e){let t=h=>Number.parseInt(h[0],16)&8?"00"+h:h,n=h=>{let m=h.toString(16);return m.length&1?`0${m}`:m},r=t(n(e.s)),o=t(n(e.r)),i=r.length/2,a=o.length/2,u=n(i),d=n(a);return`30${n(a+i+4)}02${d}${o}02${u}${r}`}},xr=BigInt(0),vn=BigInt(1);BigInt(2);var J0=BigInt(3);BigInt(4);function Kx(e){let t=qx(e),{Fp:n}=t,r=t.toBytes||((A,k,I)=>{let O=k.toAffine();return Go(Uint8Array.from([4]),n.toBytes(O.x),n.toBytes(O.y))}),o=t.fromBytes||(A=>{let k=A.subarray(1),I=n.fromBytes(k.subarray(0,n.BYTES)),O=n.fromBytes(k.subarray(n.BYTES,2*n.BYTES));return{x:I,y:O}});function i(A){let{a:k,b:I}=t,O=n.sqr(A),L=n.mul(O,A);return n.add(n.add(L,n.mul(A,k)),I)}if(!n.eql(n.sqr(t.Gy),i(t.Gx)))throw new Error("bad generator point: equation left != right");function a(A){return typeof A=="bigint"&&xrn.eql(f,n.ZERO);return L(I)&&L(O)?b.ZERO:new b(I,O,n.ONE)}get x(){return this.toAffine().x}get y(){return this.toAffine().y}static normalizeZ(k){let I=n.invertBatch(k.map(O=>O.pz));return k.map((O,L)=>O.toAffine(I[L])).map(b.fromAffine)}static fromHex(k){let I=b.fromAffine(o(jt("pointHex",k)));return I.assertValidity(),I}static fromPrivateKey(k){return b.BASE.multiply(d(k))}_setWindowSize(k){this._WINDOW_SIZE=k,h.delete(this)}assertValidity(){if(this.is0()){if(t.allowInfinityPoint&&!n.is0(this.py))return;throw new Error("bad point: ZERO")}let{x:k,y:I}=this.toAffine();if(!n.isValid(k)||!n.isValid(I))throw new Error("bad point: x or y not FE");let O=n.sqr(I),L=i(k);if(!n.eql(O,L))throw new Error("bad point: equation left != right");if(!this.isTorsionFree())throw new Error("bad point: not in prime-order subgroup")}hasEvenY(){let{y:k}=this.toAffine();if(n.isOdd)return!n.isOdd(k);throw new Error("Field doesn't support isOdd")}equals(k){m(k);let{px:I,py:O,pz:L}=this,{px:f,py:p,pz:w}=k,v=n.eql(n.mul(I,w),n.mul(f,L)),S=n.eql(n.mul(O,w),n.mul(p,L));return v&&S}negate(){return new b(this.px,n.neg(this.py),this.pz)}double(){let{a:k,b:I}=t,O=n.mul(I,J0),{px:L,py:f,pz:p}=this,w=n.ZERO,v=n.ZERO,S=n.ZERO,$=n.mul(L,L),P=n.mul(f,f),M=n.mul(p,p),N=n.mul(L,f);return N=n.add(N,N),S=n.mul(L,p),S=n.add(S,S),w=n.mul(k,S),v=n.mul(O,M),v=n.add(w,v),w=n.sub(P,v),v=n.add(P,v),v=n.mul(w,v),w=n.mul(N,w),S=n.mul(O,S),M=n.mul(k,M),N=n.sub($,M),N=n.mul(k,N),N=n.add(N,S),S=n.add($,$),$=n.add(S,$),$=n.add($,M),$=n.mul($,N),v=n.add(v,$),M=n.mul(f,p),M=n.add(M,M),$=n.mul(M,N),w=n.sub(w,$),S=n.mul(M,P),S=n.add(S,S),S=n.add(S,S),new b(w,v,S)}add(k){m(k);let{px:I,py:O,pz:L}=this,{px:f,py:p,pz:w}=k,v=n.ZERO,S=n.ZERO,$=n.ZERO,P=t.a,M=n.mul(t.b,J0),N=n.mul(I,f),B=n.mul(O,p),F=n.mul(L,w),q=n.add(I,O),x=n.add(f,p);q=n.mul(q,x),x=n.add(N,B),q=n.sub(q,x),x=n.add(I,L);let z=n.add(f,w);return x=n.mul(x,z),z=n.add(N,F),x=n.sub(x,z),z=n.add(O,L),v=n.add(p,w),z=n.mul(z,v),v=n.add(B,F),z=n.sub(z,v),$=n.mul(P,x),v=n.mul(M,F),$=n.add(v,$),v=n.sub(B,$),$=n.add(B,$),S=n.mul(v,$),B=n.add(N,N),B=n.add(B,N),F=n.mul(P,F),x=n.mul(M,x),B=n.add(B,F),F=n.sub(N,F),F=n.mul(P,F),x=n.add(x,F),N=n.mul(B,x),S=n.add(S,N),N=n.mul(z,x),v=n.mul(q,v),v=n.sub(v,N),N=n.mul(q,B),$=n.mul(z,$),$=n.add($,N),new b(v,S,$)}subtract(k){return this.add(k.negate())}is0(){return this.equals(b.ZERO)}wNAF(k){return T.wNAFCached(this,h,k,I=>{let O=n.invertBatch(I.map(L=>L.pz));return I.map((L,f)=>L.toAffine(O[f])).map(b.fromAffine)})}multiplyUnsafe(k){let I=b.ZERO;if(k===xr)return I;if(u(k),k===vn)return this;let{endo:O}=t;if(!O)return T.unsafeLadder(this,k);let{k1neg:L,k1:f,k2neg:p,k2:w}=O.splitScalar(k),v=I,S=I,$=this;for(;f>xr||w>xr;)f&vn&&(v=v.add($)),w&vn&&(S=S.add($)),$=$.double(),f>>=vn,w>>=vn;return L&&(v=v.negate()),p&&(S=S.negate()),S=new b(n.mul(S.px,O.beta),S.py,S.pz),v.add(S)}multiply(k){u(k);let I=k,O,L,{endo:f}=t;if(f){let{k1neg:p,k1:w,k2neg:v,k2:S}=f.splitScalar(I),{p:$,f:P}=this.wNAF(w),{p:M,f:N}=this.wNAF(S);$=T.constTimeNegate(p,$),M=T.constTimeNegate(v,M),M=new b(n.mul(M.px,f.beta),M.py,M.pz),O=$.add(M),L=P.add(N)}else{let{p,f:w}=this.wNAF(I);O=p,L=w}return b.normalizeZ([O,L])[0]}multiplyAndAddUnsafe(k,I,O){let L=b.BASE,f=(w,v)=>v===xr||v===vn||!w.equals(L)?w.multiplyUnsafe(v):w.multiply(v),p=f(this,I).add(f(k,O));return p.is0()?void 0:p}toAffine(k){let{px:I,py:O,pz:L}=this,f=this.is0();k==null&&(k=f?n.ONE:n.inv(L));let p=n.mul(I,k),w=n.mul(O,k),v=n.mul(L,k);if(f)return{x:n.ZERO,y:n.ZERO};if(!n.eql(v,n.ONE))throw new Error("invZ was invalid");return{x:p,y:w}}isTorsionFree(){let{h:k,isTorsionFree:I}=t;if(k===vn)return!0;if(I)return I(b,this);throw new Error("isTorsionFree() has not been declared for the elliptic curve")}clearCofactor(){let{h:k,clearCofactor:I}=t;return k===vn?this:I?I(b,this):this.multiplyUnsafe(t.h)}toRawBytes(k=!0){return this.assertValidity(),r(b,this,k)}toHex(k=!0){return Ri(this.toRawBytes(k))}}b.BASE=new b(t.Gx,t.Gy,n.ONE),b.ZERO=new b(n.ZERO,n.ONE,n.ZERO);let _=t.nBitLength,T=Vx(b,t.endo?Math.ceil(_/2):_);return{CURVE:t,ProjectivePoint:b,normPrivateKeyToScalar:d,weierstrassEquation:i,isWithinCurveOrder:a}}function Gx(e){let t=jb(e);return Zs(t,{hash:"hash",hmac:"function",randomBytes:"function"},{bits2int:"function",bits2int_modN:"function",lowS:"boolean"}),Object.freeze({lowS:!0,...t})}function Zx(e){let t=Gx(e),{Fp:n,n:r}=t,o=n.BYTES+1,i=2*n.BYTES+1;function a(x){return xrRi(po(x,t.nByteLength));function A(x){let z=r>>vn;return x>z}function k(x){return A(x)?u(-x):x}let I=(x,z,V)=>rn(x.slice(z,V));class O{constructor(z,V,K){this.r=z,this.s=V,this.recovery=K,this.assertValidity()}static fromCompact(z){let V=t.nByteLength;return z=jt("compactSignature",z,V*2),new O(I(z,0,V),I(z,V,2*V))}static fromDER(z){let{r:V,s:K}=Ko.toSig(jt("DER",z));return new O(V,K)}assertValidity(){if(!_(this.r))throw new Error("r must be 0 < r < CURVE.n");if(!_(this.s))throw new Error("s must be 0 < s < CURVE.n")}addRecoveryBit(z){return new O(this.r,this.s,z)}recoverPublicKey(z){let{r:V,s:K,recovery:Z}=this,W=S(jt("msgHash",z));if(Z==null||![0,1,2,3].includes(Z))throw new Error("recovery id invalid");let J=Z===2||Z===3?V+t.n:V;if(J>=n.ORDER)throw new Error("recovery id 2 or 3 invalid");let de=(Z&1)===0?"02":"03",_e=h.fromHex(de+T(J)),ve=d(J),Pe=u(-W*ve),ie=u(K*ve),Se=h.BASE.multiplyAndAddUnsafe(_e,Pe,ie);if(!Se)throw new Error("point at infinify");return Se.assertValidity(),Se}hasHighS(){return A(this.s)}normalizeS(){return this.hasHighS()?new O(this.r,u(-this.s),this.recovery):this}toDERRawBytes(){return Ui(this.toDERHex())}toDERHex(){return Ko.hexFromSig({r:this.r,s:this.s})}toCompactRawBytes(){return Ui(this.toCompactHex())}toCompactHex(){return T(this.r)+T(this.s)}}let L={isValidPrivateKey(x){try{return m(x),!0}catch{return!1}},normPrivateKeyToScalar:m,randomPrivateKey:()=>{let x=Fb(t.n);return jx(t.randomBytes(x),t.n)},precompute(x=8,z=h.BASE){return z._setWindowSize(x),z.multiply(BigInt(3)),z}};function f(x,z=!0){return h.fromPrivateKey(x).toRawBytes(z)}function p(x){let z=x instanceof Uint8Array,V=typeof x=="string",K=(z||V)&&x.length;return z?K===o||K===i:V?K===2*o||K===2*i:x instanceof h}function w(x,z,V=!0){if(p(x))throw new Error("first arg must be private key");if(!p(z))throw new Error("second arg must be public key");return h.fromHex(z).multiply(m(x)).toRawBytes(V)}let v=t.bits2int||function(x){let z=rn(x),V=x.length*8-t.nBitLength;return V>0?z>>BigInt(V):z},S=t.bits2int_modN||function(x){return u(v(x))},$=Xf(t.nBitLength);function P(x){if(typeof x!="bigint")throw new Error("bigint expected");if(!(xr<=x&&x<$))throw new Error(`bigint expected < 2^${t.nBitLength}`);return po(x,t.nByteLength)}function M(x,z,V=N){if(["recovered","canonical"].some(Re=>Re in V))throw new Error("sign() legacy options not supported");let{hash:K,randomBytes:Z}=t,{lowS:W,prehash:J,extraEntropy:de}=V;W==null&&(W=!0),x=jt("msgHash",x),J&&(x=jt("prehashed msgHash",K(x)));let _e=S(x),ve=m(z),Pe=[P(ve),P(_e)];if(de!=null){let Re=de===!0?Z(n.BYTES):de;Pe.push(jt("extraEntropy",Re))}let ie=Go(...Pe),Se=_e;function Ve(Re){let je=v(Re);if(!_(je))return;let Et=d(je),Qe=h.BASE.multiply(je).toAffine(),he=u(Qe.x);if(he===xr)return;let Me=u(Et*u(Se+he*ve));if(Me===xr)return;let Ce=(Qe.x===he?0:2)|Number(Qe.y&vn),Ie=Me;return W&&A(Me)&&(Ie=k(Me),Ce^=1),new O(he,Ie,Ce)}return{seed:ie,k2sig:Ve}}let N={lowS:t.lowS,prehash:!1},B={lowS:t.lowS,prehash:!1};function F(x,z,V=N){let{seed:K,k2sig:Z}=M(x,z,V),W=t;return zb(W.hash.outputLen,W.nByteLength,W.hmac)(K,Z)}h.BASE._setWindowSize(8);function q(x,z,V,K=B){var Z;let W=x;if(z=jt("msgHash",z),V=jt("publicKey",V),"strict"in K)throw new Error("options.strict was renamed to lowS");let{lowS:J,prehash:de}=K,_e,ve;try{if(typeof W=="string"||W instanceof Uint8Array)try{_e=O.fromDER(W)}catch(he){if(!(he instanceof Ko.Err))throw he;_e=O.fromCompact(W)}else if(typeof W=="object"&&typeof W.r=="bigint"&&typeof W.s=="bigint"){let{r:he,s:Me}=W;_e=new O(he,Me)}else throw new Error("PARSE");ve=h.fromHex(V)}catch(he){if(he.message==="PARSE")throw new Error("signature must be Signature instance, Uint8Array or hex string");return!1}if(J&&_e.hasHighS())return!1;de&&(z=t.hash(z));let{r:Pe,s:ie}=_e,Se=S(z),Ve=d(ie),Re=u(Se*Ve),je=u(Pe*Ve),Et=(Z=h.BASE.multiplyAndAddUnsafe(ve,Re,je))==null?void 0:Z.toAffine();return Et?u(Et.x)===Pe:!1}return{CURVE:t,getPublicKey:f,getSharedSecret:w,sign:F,verify:q,ProjectivePoint:h,Signature:O,utils:L}}var Zc=class extends Nb{constructor(t,n){super(),this.finished=!1,this.destroyed=!1,dx(t);let r=Gf(n);if(this.iHash=t.create(),typeof this.iHash.update!="function")throw new Error("Expected instance of class which extends utils.Hash");this.blockLen=this.iHash.blockLen,this.outputLen=this.iHash.outputLen;let o=this.blockLen,i=new Uint8Array(o);i.set(r.length>o?t.create().update(r).digest():r);for(let a=0;anew Zc(e,t).update(n).digest();Hb.create=(e,t)=>new Zc(e,t);function Yx(e){return{hash:e,hmac:(t,...n)=>Hb(e,t,gx(...n)),randomBytes:Ob}}function Jx(e,t){let n=r=>Zx({...e,...Yx(r)});return Object.freeze({...n(t),create:n})}var uu=BigInt("0xfffffffffffffffffffffffffffffffffffffffffffffffffffffffefffffc2f"),Yc=BigInt("0xfffffffffffffffffffffffffffffffebaaedce6af48a03bbfd25e8cd0364141"),Vb=BigInt(1),Jc=BigInt(2),X0=(e,t)=>(e+t/Jc)/t;function qb(e){let t=uu,n=BigInt(3),r=BigInt(6),o=BigInt(11),i=BigInt(22),a=BigInt(23),u=BigInt(44),d=BigInt(88),h=e*e*e%t,m=h*h*e%t,b=yn(m,n,t)*m%t,_=yn(b,n,t)*m%t,T=yn(_,Jc,t)*h%t,A=yn(T,o,t)*T%t,k=yn(A,i,t)*A%t,I=yn(k,u,t)*k%t,O=yn(I,d,t)*I%t,L=yn(O,u,t)*k%t,f=yn(L,n,t)*m%t,p=yn(f,a,t)*A%t,w=yn(p,r,t)*h%t,v=yn(w,Jc,t);if(!Nf.eql(Nf.sqr(v),e))throw new Error("Cannot find square root");return v}var Nf=Fx(uu,void 0,void 0,{sqrt:qb}),eh=Jx({a:BigInt(0),b:BigInt(7),Fp:Nf,n:Yc,Gx:BigInt("55066263022277343669578718895168534326250603453777594175500187360389116729240"),Gy:BigInt("32670510020758816978083085130507043184471273380659243275938904335757337482424"),h:BigInt(1),lowS:!0,endo:{beta:BigInt("0x7ae96a2b657c07106e64479eac3434e99cf0497512f58995c1396c28719501ee"),splitScalar:e=>{let t=Yc,n=BigInt("0x3086d221a7d46bcde86c90e49284eb15"),r=-Vb*BigInt("0xe4437ed6010e88286f547fa90abfe4c3"),o=BigInt("0x114ca50f7a8e2f3f657c1108d9d44cfd8"),i=n,a=BigInt("0x100000000000000000000000000000000"),u=X0(i*e,t),d=X0(-r*e,t),h=zt(e-u*n-d*o,t),m=zt(-u*r-d*i,t),b=h>a,_=m>a;if(b&&(h=t-h),_&&(m=t-m),h>a||m>a)throw new Error("splitScalar: Endomorphism failed, k="+e);return{k1neg:b,k1:h,k2neg:_,k2:m}}}},Cf),lu=BigInt(0),Wb=e=>typeof e=="bigint"&&lutypeof e=="bigint"&&luo.charCodeAt(0)));n=Go(r,r),eb[e]=n}return Cf(Go(n,...t))}var th=e=>e.toRawBytes(!0).slice(1),Of=e=>po(e,32),bf=e=>zt(e,uu),Ks=e=>zt(e,Yc),nh=eh.ProjectivePoint,e4=(e,t,n)=>nh.BASE.multiplyAndAddUnsafe(e,t,n);function Rf(e){let t=eh.utils.normPrivateKeyToScalar(e),n=nh.fromPrivateKey(t);return{scalar:n.hasEvenY()?t:Ks(-t),bytes:th(n)}}function Qb(e){if(!Wb(e))throw new Error("bad x: need 0 < x < p");let t=bf(e*e),n=bf(t*e+BigInt(7)),r=qb(n);r%Jc!==lu&&(r=bf(-r));let o=new nh(e,r,Vb);return o.assertValidity(),o}function Kb(...e){return Ks(rn(Xc("BIP0340/challenge",...e)))}function t4(e){return Rf(e).bytes}function n4(e,t,n=Ob(32)){let r=jt("message",e),{bytes:o,scalar:i}=Rf(t),a=jt("auxRand",n,32),u=Of(i^rn(Xc("BIP0340/aux",a))),d=Xc("BIP0340/nonce",u,o,r),h=Ks(rn(d));if(h===lu)throw new Error("sign failed: k is zero");let{bytes:m,scalar:b}=Rf(h),_=Kb(m,o,r),T=new Uint8Array(64);if(T.set(m,0),T.set(Of(Ks(b+_*i)),32),!Gb(T,r,o))throw new Error("sign: Invalid signature produced");return T}function Gb(e,t,n){let r=jt("signature",e,64),o=jt("message",t),i=jt("publicKey",n,32);try{let a=Qb(rn(i)),u=rn(r.subarray(0,32));if(!Wb(u))return!1;let d=rn(r.subarray(32,64));if(!Xx(d))return!1;let h=Kb(Of(u),th(a),o),m=e4(a,d,Ks(-h));return!(!m||!m.hasEvenY()||m.toAffine().x!==u)}catch{return!1}}var Gt={getPublicKey:t4,sign:n4,verify:Gb,utils:{randomPrivateKey:eh.utils.randomPrivateKey,lift_x:Qb,pointToBytes:th,numberToBytesBE:po,bytesToNumberBE:rn,taggedHash:Xc,mod:zt}};var Zb=e=>e instanceof Uint8Array,wf=e=>new DataView(e.buffer,e.byteOffset,e.byteLength),Yn=(e,t)=>e<<32-t|e>>>t,r4=new Uint8Array(new Uint32Array([287454020]).buffer)[0]===68;if(!r4)throw new Error("Non little-endian hardware is not supported");var o4=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function et(e){if(!Zb(e))throw new Error("Uint8Array expected");let t="";for(let n=0;ne().update(Jb(r)).digest(),n=e();return t.outputLen=n.outputLen,t.blockLen=n.blockLen,t.create=()=>e(),t}function zf(e){if(!Number.isSafeInteger(e)||e<0)throw new Error(`Wrong positive integer: ${e}`)}function s4(e){if(typeof e!="boolean")throw new Error(`Expected boolean, not ${e}`)}function ew(e,...t){if(!(e instanceof Uint8Array))throw new Error("Expected Uint8Array");if(t.length>0&&!t.includes(e.length))throw new Error(`Expected Uint8Array of length ${t}, not of length=${e.length}`)}function a4(e){if(typeof e!="function"||typeof e.create!="function")throw new Error("Hash should be wrapped by utils.wrapConstructor");zf(e.outputLen),zf(e.blockLen)}function c4(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function u4(e,t){ew(e);let n=t.outputLen;if(e.length>o&i),u=Number(n&i),d=r?4:0,h=r?0:4;e.setUint32(t+d,a,r),e.setUint32(t+h,u,r)}var Mf=class extends Uf{constructor(t,n,r,o){super(),this.blockLen=t,this.outputLen=n,this.padOffset=r,this.isLE=o,this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.buffer=new Uint8Array(t),this.view=wf(this.buffer)}update(t){yf.exists(this);let{view:n,buffer:r,blockLen:o}=this;t=Jb(t);let i=t.length;for(let a=0;ao-a&&(this.process(r,0),a=0);for(let b=a;bm.length)throw new Error("_sha2: outputLen bigger than state");for(let b=0;be&t^~e&n,f4=(e,t,n)=>e&t^e&n^t&n,h4=new Uint32Array([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),ao=new Uint32Array([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),co=new Uint32Array(64),eu=class extends Mf{constructor(){super(64,32,8,!1),this.A=ao[0]|0,this.B=ao[1]|0,this.C=ao[2]|0,this.D=ao[3]|0,this.E=ao[4]|0,this.F=ao[5]|0,this.G=ao[6]|0,this.H=ao[7]|0}get(){let{A:t,B:n,C:r,D:o,E:i,F:a,G:u,H:d}=this;return[t,n,r,o,i,a,u,d]}set(t,n,r,o,i,a,u,d){this.A=t|0,this.B=n|0,this.C=r|0,this.D=o|0,this.E=i|0,this.F=a|0,this.G=u|0,this.H=d|0}process(t,n){for(let b=0;b<16;b++,n+=4)co[b]=t.getUint32(n,!1);for(let b=16;b<64;b++){let _=co[b-15],T=co[b-2],A=Yn(_,7)^Yn(_,18)^_>>>3,k=Yn(T,17)^Yn(T,19)^T>>>10;co[b]=k+co[b-7]+A+co[b-16]|0}let{A:r,B:o,C:i,D:a,E:u,F:d,G:h,H:m}=this;for(let b=0;b<64;b++){let _=Yn(u,6)^Yn(u,11)^Yn(u,25),T=m+_+d4(u,d,h)+h4[b]+co[b]|0,k=(Yn(r,2)^Yn(r,13)^Yn(r,22))+f4(r,o,i)|0;m=h,h=d,d=u,u=a+T|0,a=i,i=o,o=r,r=T+k|0}r=r+this.A|0,o=o+this.B|0,i=i+this.C|0,a=a+this.D|0,u=u+this.E|0,d=d+this.F|0,h=h+this.G|0,m=m+this.H|0,this.set(r,o,i,a,u,d,h,m)}roundClean(){co.fill(0)}destroy(){this.set(0,0,0,0,0,0,0,0),this.buffer.fill(0)}},Df=class extends eu{constructor(){super(),this.A=-1056596264,this.B=914150663,this.C=812702999,this.D=-150054599,this.E=-4191439,this.F=1750603025,this.G=1694076839,this.H=-1090891868,this.outputLen=28}},rh=Xb(()=>new eu);Xb(()=>new Df);var qo=Symbol("verified"),p4=e=>e instanceof Object;function g4(e){if(!p4(e)||typeof e.kind!="number"||typeof e.content!="string"||typeof e.created_at!="number"||typeof e.pubkey!="string"||!e.pubkey.match(/^[a-f0-9]{64}$/)||!Array.isArray(e.tags))return!1;for(let t=0;tt.id.startsWith(n))||e.kinds&&e.kinds.indexOf(t.kind)===-1||e.authors&&e.authors.indexOf(t.pubkey)===-1&&!e.authors.some(n=>t.pubkey.startsWith(n)))return!1;for(let n in e)if(n[0]==="#"){let r=n.slice(1),o=e[`#${r}`];if(o&&!t.tags.find(([i,a])=>i===n.slice(1)&&o.indexOf(a)!==-1))return!1}return!(e.since&&t.created_ate.until)}function k4(e,t){for(let n=0;n{let t=new MessageChannel,n=()=>{t.port1.removeEventListener("message",n),e()};t.port1.addEventListener("message",n),t.port2.postMessage(0),t.port1.start()})}var B4=e=>(e[qo]=!0,!0),tw;try{tw=WebSocket}catch{}var nw=class{constructor(t,n){we(this,"url"),we(this,"_connected",!1),we(this,"onclose",null),we(this,"onnotice",r=>console.debug(`NOTICE from ${this.url}: ${r}`)),we(this,"_onauth",null),we(this,"baseEoseTimeout",4400),we(this,"connectionTimeout",4400),we(this,"openSubs",new Map),we(this,"connectionTimeoutHandle"),we(this,"connectionPromise"),we(this,"openCountRequests",new Map),we(this,"openEventPublishes",new Map),we(this,"ws"),we(this,"incomingMessageQueue",new w4),we(this,"queueRunning",!1),we(this,"challenge"),we(this,"serial",0),we(this,"verifyEvent"),this.url=js(t),this.verifyEvent=n.verifyEvent}static async connect(t,n){let r=new nw(t,n);return await r.connect(),r}closeAllSubscriptions(t){for(let[n,r]of this.openSubs)r.close(t);this.openSubs.clear();for(let[n,r]of this.openEventPublishes)r.reject(new Error(t));this.openEventPublishes.clear();for(let[n,r]of this.openCountRequests)r.reject(new Error(t));this.openCountRequests.clear()}get connected(){return this._connected}async connect(){return this.connectionPromise?this.connectionPromise:(this.challenge=void 0,this.connectionPromise=new Promise((t,n)=>{this.connectionTimeoutHandle=setTimeout(()=>{var r;n("connection timed out"),this.connectionPromise=void 0,(r=this.onclose)==null||r.call(this),this.closeAllSubscriptions("relay connection timed out")},this.connectionTimeout);try{this.ws=new tw(this.url)}catch(r){n(r);return}this.ws.onopen=()=>{clearTimeout(this.connectionTimeoutHandle),this._connected=!0,t()},this.ws.onerror=r=>{var o;n(r.message),this._connected&&(this._connected=!1,this.connectionPromise=void 0,(o=this.onclose)==null||o.call(this),this.closeAllSubscriptions("relay connection errored"))},this.ws.onclose=async()=>{var r;this._connected&&(this._connected=!1,this.connectionPromise=void 0,(r=this.onclose)==null||r.call(this),this.closeAllSubscriptions("relay connection closed"))},this.ws.onmessage=this._onmessage.bind(this)}),this.connectionPromise)}async runQueue(){for(this.queueRunning=!0;this.handleNext()!==!1;)await $4();this.queueRunning=!1}handleNext(){var t,n,r;let o=this.incomingMessageQueue.dequeue();if(!o)return!1;let i=A4(o);if(i){let a=this.openSubs.get(i);if(!a)return;let u=S4(o,"id"),d=(t=a.alreadyHaveEvent)==null?void 0:t.call(a,u);if((n=a.receivedEvent)==null||n.call(a,this,u),d)return}try{let a=JSON.parse(o);switch(a[0]){case"EVENT":{let u=this.openSubs.get(a[1]),d=a[2];this.verifyEvent(d)&&k4(u.filters,d)&&u.onevent(d);return}case"COUNT":{let u=a[1],d=a[2],h=this.openCountRequests.get(u);h&&(h.resolve(d.count),this.openCountRequests.delete(u));return}case"EOSE":{let u=this.openSubs.get(a[1]);if(!u)return;u.receivedEose();return}case"OK":{let u=a[1],d=a[2],h=a[3],m=this.openEventPublishes.get(u);d?m.resolve(h):m.reject(new Error(h)),this.openEventPublishes.delete(u);return}case"CLOSED":{let u=a[1],d=this.openSubs.get(u);if(!d)return;d.closed=!0,d.close(a[2]);return}case"NOTICE":this.onnotice(a[1]);return;case"AUTH":{this.challenge=a[1],(r=this._onauth)==null||r.call(this,a[1]);return}}}catch{return}}async send(t){if(!this.connectionPromise)throw new Error("sending on closed connection");this.connectionPromise.then(()=>{var n;(n=this.ws)==null||n.send(t)})}async auth(t){if(!this.challenge)throw new Error("can't perform auth, no challenge was received");let n=await t(T4(this.url,this.challenge)),r=new Promise((o,i)=>{this.openEventPublishes.set(n.id,{resolve:o,reject:i})});return this.send('["AUTH",'+JSON.stringify(n)+"]"),r}async publish(t){let n=new Promise((r,o)=>{this.openEventPublishes.set(t.id,{resolve:r,reject:o})});return this.send('["EVENT",'+JSON.stringify(t)+"]"),n}async count(t,n){this.serial++;let r=n?.id||"count:"+this.serial,o=new Promise((i,a)=>{this.openCountRequests.set(r,{resolve:i,reject:a})});return this.send('["COUNT","'+r+'",'+JSON.stringify(t)+"]"),o}subscribe(t,n){let r=this.prepareSubscription(t,n);return r.fire(),r}prepareSubscription(t,n){this.serial++;let r=n.id||"sub:"+this.serial,o=new L4(this,r,t,n);return this.openSubs.set(r,o),o}close(){var t;this.closeAllSubscriptions("relay connection closed by us"),this._connected=!1,(t=this.ws)==null||t.close()}_onmessage(t){this.incomingMessageQueue.enqueue(t.data),this.queueRunning||this.runQueue()}},L4=class{constructor(t,n,r,o){we(this,"relay"),we(this,"id"),we(this,"closed",!1),we(this,"eosed",!1),we(this,"filters"),we(this,"alreadyHaveEvent"),we(this,"receivedEvent"),we(this,"onevent"),we(this,"oneose"),we(this,"onclose"),we(this,"eoseTimeout"),we(this,"eoseTimeoutHandle"),this.relay=t,this.filters=r,this.id=n,this.alreadyHaveEvent=o.alreadyHaveEvent,this.receivedEvent=o.receivedEvent,this.eoseTimeout=o.eoseTimeout||t.baseEoseTimeout,this.oneose=o.oneose,this.onclose=o.onclose,this.onevent=o.onevent||(i=>{console.warn(`onevent() callback not defined for subscription '${this.id}' in relay ${this.relay.url}. event received:`,i)})}fire(){this.relay.send('["REQ","'+this.id+'",'+JSON.stringify(this.filters).substring(1)),this.eoseTimeoutHandle=setTimeout(this.receivedEose.bind(this),this.eoseTimeout)}receivedEose(){var t;this.eosed||(clearTimeout(this.eoseTimeoutHandle),this.eosed=!0,(t=this.oneose)==null||t.call(this))}close(t="closed by caller"){var n;!this.closed&&this.relay.connected&&(this.relay.send('["CLOSE",'+JSON.stringify(this.id)+"]"),this.closed=!0),this.relay.openSubs.delete(this.id),(n=this.onclose)==null||n.call(this,t)}},C4=class{constructor(e){we(this,"relays",new Map),we(this,"seenOn",new Map),we(this,"trackRelays",!1),we(this,"verifyEvent"),we(this,"trustedRelayURLs",new Set),this.verifyEvent=e.verifyEvent}async ensureRelay(e,t){e=js(e);let n=this.relays.get(e);return n||(n=new nw(e,{verifyEvent:this.trustedRelayURLs.has(e)?B4:this.verifyEvent}),t?.connectionTimeout&&(n.connectionTimeout=t.connectionTimeout),this.relays.set(e,n)),await n.connect(),n}close(e){e.map(js).forEach(t=>{var n;(n=this.relays.get(t))==null||n.close()})}subscribeMany(e,t,n){this.trackRelays&&(n.receivedEvent=(b,_)=>{let T=this.seenOn.get(_);T||(T=new Set,this.seenOn.set(_,T)),T.add(b)});let r=new Set,o=[],i=[],a=b=>{var _;i[b]=!0,i.filter(T=>T).length===e.length&&((_=n.oneose)==null||_.call(n),a=()=>{})},u=[],d=(b,_)=>{var T;a(b),u[b]=_,u.filter(A=>A).length===e.length&&((T=n.onclose)==null||T.call(n,u),d=()=>{})},h=b=>{var _;if((_=n.alreadyHaveEvent)!=null&&_.call(n,b))return!0;let T=r.has(b);return r.add(b),T},m=Promise.all(e.map(js).map(async(b,_,T)=>{if(T.indexOf(b)!==_){d(_,"duplicate url");return}let A;try{A=await this.ensureRelay(b,{connectionTimeout:n.maxWait?Math.max(n.maxWait*.8,n.maxWait-1e3):void 0})}catch(I){d(_,I?.message||String(I));return}let k=A.subscribe(t,{...n,oneose:()=>a(_),onclose:I=>d(_,I),alreadyHaveEvent:h,eoseTimeout:n.maxWait});o.push(k)}));return{async close(){await m,o.forEach(b=>{b.close()})}}}subscribeManyEose(e,t,n){let r=this.subscribeMany(e,t,{...n,oneose(){r.close()}});return r}async querySync(e,t,n){return new Promise(async r=>{let o=[];this.subscribeManyEose(e,[t],{...n,onevent(i){o.push(i)},onclose(i){r(o)}})})}async get(e,t,n){t.limit=1;let r=await this.querySync(e,t,n);return r.sort((o,i)=>i.created_at-o.created_at),r[0]||null}publish(e,t){return e.map(js).map(async(n,r,o)=>o.indexOf(n)!==r?Promise.reject("duplicate url"):(await this.ensureRelay(n)).publish(t))}},P4=class extends C4{constructor(){super({verifyEvent:_4})}},Gs=Symbol("store-raw"),Xn=Symbol("store-node"),_n=Symbol("store-has"),rw=Symbol("store-self");function ow(e){let t=e[nn];if(!t&&(Object.defineProperty(e,nn,{value:t=new Proxy(e,N4)}),!Array.isArray(e))){let n=Object.keys(e),r=Object.getOwnPropertyDescriptors(e);for(let o=0,i=n.length;oe[nn][t]),n}function oh(e){Oi()&&Zo(zi(e,Xn),rw)()}function iw(e){return oh(e),Reflect.ownKeys(e)}var N4={get(e,t,n){if(t===Gs)return e;if(t===nn)return n;if(t===Qs)return oh(e),n;let r=zi(e,Xn),o=r[t],i=o?o():e[t];if(t===Xn||t===_n||t==="__proto__")return i;if(!o){let a=Object.getOwnPropertyDescriptor(e,t);Oi()&&(typeof i!="function"||e.hasOwnProperty(t))&&!(a&&a.get)&&(i=Zo(r,t,i)())}return Sr(i)?ow(i):i},has(e,t){return t===Gs||t===nn||t===Qs||t===Xn||t===_n||t==="__proto__"?!0:(Oi()&&Zo(zi(e,_n),t)(),t in e)},set(){return!0},deleteProperty(){return!0},ownKeys:iw,getOwnPropertyDescriptor:I4};function tn(e,t,n,r=!1){if(!r&&e[t]===n)return;let o=e[t],i=e.length;n===void 0?(delete e[t],e[_n]&&e[_n][t]&&o!==void 0&&e[_n][t].$()):(e[t]=n,e[_n]&&e[_n][t]&&o===void 0&&e[_n][t].$());let a=zi(e,Xn),u;if((u=Zo(a,t,o))&&u.$(()=>n),Array.isArray(e)&&e.length!==i){for(let d=e.length;d1){r=t.shift();let a=typeof r,u=Array.isArray(e);if(Array.isArray(r)){for(let d=0;d1){Hs(e[r],t,[r].concat(n));return}o=e[r],n=[r].concat(n)}let i=t[0];typeof i=="function"&&(i=i(o,n),i===o)||r===void 0&&i==null||(i=Ar(i),r===void 0||Sr(o)&&Sr(i)&&!Array.isArray(i)?sw(o,i):tn(e,r,i))}function R4(...[e,t]){let n=Ar(e||{}),r=Array.isArray(n),o=ow(n);function i(...a){Bi(()=>{r&&a.length===1?O4(n,a[0]):Hs(n,a)})}return[o,i]}function U4(e,t){let n=Reflect.getOwnPropertyDescriptor(e,t);return!n||n.get||n.set||!n.configurable||t===nn||t===Xn||(delete n.value,delete n.writable,n.get=()=>e[nn][t],n.set=r=>e[nn][t]=r),n}var z4={get(e,t,n){if(t===Gs)return e;if(t===nn)return n;if(t===Qs)return oh(e),n;let r=zi(e,Xn),o=r[t],i=o?o():e[t];if(t===Xn||t===_n||t==="__proto__")return i;if(!o){let a=Object.getOwnPropertyDescriptor(e,t),u=typeof i=="function";if(Oi()&&(!u||e.hasOwnProperty(t))&&!(a&&a.get))i=Zo(r,t,i)();else if(i!=null&&u&&i===Array.prototype[t])return(...d)=>Bi(()=>Array.prototype[t].apply(n,d))}return Sr(i)?aw(i):i},has(e,t){return t===Gs||t===nn||t===Qs||t===Xn||t===_n||t==="__proto__"?!0:(Oi()&&Zo(zi(e,_n),t)(),t in e)},set(e,t,n){return Bi(()=>tn(e,t,Ar(n))),!0},deleteProperty(e,t){return Bi(()=>tn(e,t,void 0,!0)),!0},ownKeys:iw,getOwnPropertyDescriptor:U4};function aw(e){let t=e[nn];if(!t){Object.defineProperty(e,nn,{value:t=new Proxy(e,z4)});let n=Object.keys(e),r=Object.getOwnPropertyDescriptors(e);for(let o=0,i=n.length;oBi(()=>u.call(t,h))})}}}return t}function ih(e,t){let n=Ar(e||{});return aw(n)}var Ff=Symbol("store-root");function $i(e,t,n,r,o){let i=t[n];if(e===i)return;if(n!==Ff&&(!Sr(e)||!Sr(i)||o&&e[o]!==i[o])){tn(t,n,e);return}if(Array.isArray(e)){if(e.length&&i.length&&(!r||o&&e[0]&&e[0][o]!=null)){let d,h,m,b,_,T,A,k;for(m=0,b=Math.min(i.length,e.length);m=m&&_>=m&&(i[b]===e[_]||o&&i[m]&&e[m]&&i[b][o]===e[_][o]);b--,_--)I[_]=i[b];if(m>_||m>b){for(h=m;h<=_;h++)tn(i,h,e[h]);for(;he.length&&tn(i,"length",e.length);return}for(A=new Array(_+1),h=_;h>=m;h--)T=e[h],k=o&&T?T[o]:T,d=O.get(k),A[h]=d===void 0?-1:d,O.set(k,h);for(d=m;d<=b;d++)T=i[d],k=o&&T?T[o]:T,h=O.get(k),h!==void 0&&h!==-1&&(I[h]=i[d],h=A[h],O.set(k,h));for(h=m;he.length&&tn(i,"length",e.length);return}let a=Object.keys(e);for(let d=0,h=a.length;d{if(!Sr(i)||!Sr(o))return o;let a=$i(o,{[Ff]:i},Ff,n,r);return a===void 0?i:a}}var Ci=new P4,xe=ih({rootEventIds:[],filter:{},profiles:()=>[]}),Kt=ih({}),D4=["reply","likes","zaps","publish","watch","replyAnonymously","hideContent"],F4=e=>D4.includes(e);function ji(e){if(!Number.isSafeInteger(e))throw new Error(`Wrong integer: ${e}`)}function $r(...e){let t=(o,i)=>a=>o(i(a)),n=Array.from(e).reverse().reduce((o,i)=>o?t(o,i.encode):i.encode,void 0),r=e.reduce((o,i)=>o?t(o,i.decode):i.decode,void 0);return{encode:n,decode:r}}function Br(e){return{encode:t=>{if(!Array.isArray(t)||t.length&&typeof t[0]!="number")throw new Error("alphabet.encode input should be an array of numbers");return t.map(n=>{if(ji(n),n<0||n>=e.length)throw new Error(`Digit index outside alphabet: ${n} (alphabet: ${e.length})`);return e[n]})},decode:t=>{if(!Array.isArray(t)||t.length&&typeof t[0]!="string")throw new Error("alphabet.decode input should be array of strings");return t.map(n=>{if(typeof n!="string")throw new Error(`alphabet.decode: not string element=${n}`);let r=e.indexOf(n);if(r===-1)throw new Error(`Unknown letter: "${n}". Allowed: ${e}`);return r})}}}function Lr(e=""){if(typeof e!="string")throw new Error("join separator should be string");return{encode:t=>{if(!Array.isArray(t)||t.length&&typeof t[0]!="string")throw new Error("join.encode input should be array of strings");for(let n of t)if(typeof n!="string")throw new Error(`join.encode: non-string input=${n}`);return t.join(e)},decode:t=>{if(typeof t!="string")throw new Error("join.decode input should be string");return t.split(e)}}}function fu(e,t="="){if(ji(e),typeof t!="string")throw new Error("padding chr should be string");return{encode(n){if(!Array.isArray(n)||n.length&&typeof n[0]!="string")throw new Error("padding.encode input should be array of strings");for(let r of n)if(typeof r!="string")throw new Error(`padding.encode: non-string input=${r}`);for(;n.length*e%8;)n.push(t);return n},decode(n){if(!Array.isArray(n)||n.length&&typeof n[0]!="string")throw new Error("padding.encode input should be array of strings");for(let o of n)if(typeof o!="string")throw new Error(`padding.decode: non-string input=${o}`);let r=n.length;if(r*e%8)throw new Error("Invalid padding: string should have whole number of bytes");for(;r>0&&n[r-1]===t;r--)if(!((r-1)*e%8))throw new Error("Invalid padding: string has too much padding");return n.slice(0,r)}}}function cw(e){if(typeof e!="function")throw new Error("normalize fn should be function");return{encode:t=>t,decode:t=>e(t)}}function tb(e,t,n){if(t<2)throw new Error(`convertRadix: wrong from=${t}, base cannot be less than 2`);if(n<2)throw new Error(`convertRadix: wrong to=${n}, base cannot be less than 2`);if(!Array.isArray(e))throw new Error("convertRadix: data should be array");if(!e.length)return[];let r=0,o=[],i=Array.from(e);for(i.forEach(a=>{if(ji(a),a<0||a>=t)throw new Error(`Wrong integer: ${a}`)});;){let a=0,u=!0;for(let d=r;dt?uw(t,e%t):e,tu=(e,t)=>e+(t-uw(e,t));function jf(e,t,n,r){if(!Array.isArray(e))throw new Error("convertRadix2: data should be array");if(t<=0||t>32)throw new Error(`convertRadix2: wrong from=${t}`);if(n<=0||n>32)throw new Error(`convertRadix2: wrong to=${n}`);if(tu(t,n)>32)throw new Error(`convertRadix2: carry overflow from=${t} to=${n} carryBits=${tu(t,n)}`);let o=0,i=0,a=2**n-1,u=[];for(let d of e){if(ji(d),d>=2**t)throw new Error(`convertRadix2: invalid data word=${d} from=${t}`);if(o=o<32)throw new Error(`convertRadix2: carry overflow pos=${i} from=${t}`);for(i+=t;i>=n;i-=n)u.push((o>>i-n&a)>>>0);o&=2**i-1}if(o=o<=t)throw new Error("Excess padding");if(!r&&o)throw new Error(`Non-zero padding: ${o}`);return r&&i>0&&u.push(o>>>0),u}function j4(e){return ji(e),{encode:t=>{if(!(t instanceof Uint8Array))throw new Error("radix.encode input should be Uint8Array");return tb(Array.from(t),2**8,e)},decode:t=>{if(!Array.isArray(t)||t.length&&typeof t[0]!="number")throw new Error("radix.decode input should be array of strings");return Uint8Array.from(tb(t,e,2**8))}}}function go(e,t=!1){if(ji(e),e<=0||e>32)throw new Error("radix2: bits should be in (0..32]");if(tu(8,e)>32||tu(e,8)>32)throw new Error("radix2: carry overflow");return{encode:n=>{if(!(n instanceof Uint8Array))throw new Error("radix2.encode input should be Uint8Array");return jf(Array.from(n),8,e,!t)},decode:n=>{if(!Array.isArray(n)||n.length&&typeof n[0]!="number")throw new Error("radix2.decode input should be array of strings");return Uint8Array.from(jf(n,e,8,t))}}}function nb(e){if(typeof e!="function")throw new Error("unsafeWrapper fn should be function");return function(...t){try{return e.apply(null,t)}catch{}}}var H4=$r(go(4),Br("0123456789ABCDEF"),Lr("")),V4=$r(go(5),Br("ABCDEFGHIJKLMNOPQRSTUVWXYZ234567"),fu(5),Lr(""));$r(go(5),Br("0123456789ABCDEFGHIJKLMNOPQRSTUV"),fu(5),Lr(""));$r(go(5),Br("0123456789ABCDEFGHJKMNPQRSTVWXYZ"),Lr(""),cw(e=>e.toUpperCase().replace(/O/g,"0").replace(/[IL]/g,"1")));var q4=$r(go(6),Br("ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"),fu(6),Lr("")),W4=$r(go(6),Br("ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_"),fu(6),Lr("")),sh=e=>$r(j4(58),Br(e),Lr("")),Hf=sh("123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz");sh("123456789abcdefghijkmnopqrstuvwxyzABCDEFGHJKLMNPQRSTUVWXYZ");sh("rpshnaf39wBUDNEGHJKLM4PQRST7VWXYZ2bcdeCg65jkm8oFqi1tuvAxyz");var rb=[0,2,3,5,6,7,9,10,11],Q4={encode(e){let t="";for(let n=0;n>25,n=(e&33554431)<<5;for(let r=0;r>r&1)===1&&(n^=ob[r]);return n}function ib(e,t,n=1){let r=e.length,o=1;for(let i=0;i126)throw new Error(`Invalid prefix (${e})`);o=Ms(o)^a>>5}o=Ms(o);for(let i=0;i_)throw new TypeError(`Length ${T} exceeds limit ${_}`);return m=m.toLowerCase(),`${m}1${Vf.encode(b)}${ib(m,b,t)}`}function u(m,b=90){if(typeof m!="string")throw new Error(`bech32.decode input should be string, not ${typeof m}`);if(m.length<8||b!==!1&&m.length>b)throw new TypeError(`Wrong string length: ${m.length} (${m}). Expected (8..${b})`);let _=m.toLowerCase();if(m!==_&&m!==m.toUpperCase())throw new Error("String must be lowercase or uppercase");m=_;let T=m.lastIndexOf("1");if(T===0||T===-1)throw new Error('Letter "1" must be present between prefix and data only');let A=m.slice(0,T),k=m.slice(T+1);if(k.length<6)throw new Error("Data must be at least 6 characters long");let I=Vf.decode(k).slice(0,-6),O=ib(A,I,t);if(!k.endsWith(O))throw new Error(`Invalid checksum in ${m}: expected "${O}"`);return{prefix:A,words:I}}let d=nb(u);function h(m){let{prefix:b,words:_}=u(m,!1);return{prefix:b,words:_,bytes:r(_)}}return{encode:a,decode:u,decodeToBytes:h,decodeUnsafe:d,fromWords:r,fromWordsUnsafe:i,toWords:o}}var Mi=lw("bech32");lw("bech32m");var K4={encode:e=>new TextDecoder().decode(e),decode:e=>new TextEncoder().encode(e)},G4=$r(go(4),Br("0123456789abcdef"),Lr(""),cw(e=>{if(typeof e!="string"||e.length%2)throw new TypeError(`hex.decode: expected string, got ${typeof e} with length ${e.length}`);return e.toLowerCase()})),Z4={utf8:K4,hex:G4,base16:H4,base32:V4,base64:q4,base64url:W4,base58:Hf,base58xmr:Q4};`${Object.keys(Z4).join(", ")}`;var Ds=new TextDecoder("utf-8");new TextEncoder;var dw=5e3;function Dc(e){var t,n,r,o,i,a,u,d;let{prefix:h,words:m}=Mi.decode(e,dw),b=new Uint8Array(Mi.fromWords(m));switch(h){case"nprofile":{let _=Rc(b);if(!((t=_[0])!=null&&t[0]))throw new Error("missing TLV 0 for nprofile");if(_[0][0].length!==32)throw new Error("TLV 0 should be 32 bytes");return{type:"nprofile",data:{pubkey:et(_[0][0]),relays:_[1]?_[1].map(T=>Ds.decode(T)):[]}}}case"nevent":{let _=Rc(b);if(!((n=_[0])!=null&&n[0]))throw new Error("missing TLV 0 for nevent");if(_[0][0].length!==32)throw new Error("TLV 0 should be 32 bytes");if(_[2]&&_[2][0].length!==32)throw new Error("TLV 2 should be 32 bytes");if(_[3]&&_[3][0].length!==4)throw new Error("TLV 3 should be 4 bytes");return{type:"nevent",data:{id:et(_[0][0]),relays:_[1]?_[1].map(T=>Ds.decode(T)):[],author:(r=_[2])!=null&&r[0]?et(_[2][0]):void 0,kind:(o=_[3])!=null&&o[0]?parseInt(et(_[3][0]),16):void 0}}}case"naddr":{let _=Rc(b);if(!((i=_[0])!=null&&i[0]))throw new Error("missing TLV 0 for naddr");if(!((a=_[2])!=null&&a[0]))throw new Error("missing TLV 2 for naddr");if(_[2][0].length!==32)throw new Error("TLV 2 should be 32 bytes");if(!((u=_[3])!=null&&u[0]))throw new Error("missing TLV 3 for naddr");if(_[3][0].length!==4)throw new Error("TLV 3 should be 4 bytes");return{type:"naddr",data:{identifier:Ds.decode(_[0][0]),pubkey:et(_[2][0]),kind:parseInt(et(_[3][0]),16),relays:_[1]?_[1].map(T=>Ds.decode(T)):[]}}}case"nrelay":{let _=Rc(b);if(!((d=_[0])!=null&&d[0]))throw new Error("missing TLV 0 for nrelay");return{type:"nrelay",data:Ds.decode(_[0][0])}}case"nsec":return{type:h,data:b};case"npub":case"note":return{type:h,data:et(b)};default:throw new Error(`unknown prefix ${h}`)}}function Rc(e){let t={},n=e;for(;n.length>0;){let r=n[0],o=n[1],i=n.slice(2,2+o);if(n=n.slice(2+o),i.lengthFs.decode(T)):[]}}}case"nevent":{let _=Uc(b);if(!((n=_[0])!=null&&n[0]))throw new Error("missing TLV 0 for nevent");if(_[0][0].length!==32)throw new Error("TLV 0 should be 32 bytes");if(_[2]&&_[2][0].length!==32)throw new Error("TLV 2 should be 32 bytes");if(_[3]&&_[3][0].length!==4)throw new Error("TLV 3 should be 4 bytes");return{type:"nevent",data:{id:et(_[0][0]),relays:_[1]?_[1].map(T=>Fs.decode(T)):[],author:(r=_[2])!=null&&r[0]?et(_[2][0]):void 0,kind:(o=_[3])!=null&&o[0]?parseInt(et(_[3][0]),16):void 0}}}case"naddr":{let _=Uc(b);if(!((i=_[0])!=null&&i[0]))throw new Error("missing TLV 0 for naddr");if(!((a=_[2])!=null&&a[0]))throw new Error("missing TLV 2 for naddr");if(_[2][0].length!==32)throw new Error("TLV 2 should be 32 bytes");if(!((u=_[3])!=null&&u[0]))throw new Error("missing TLV 3 for naddr");if(_[3][0].length!==4)throw new Error("TLV 3 should be 4 bytes");return{type:"naddr",data:{identifier:Fs.decode(_[0][0]),pubkey:et(_[2][0]),kind:parseInt(et(_[3][0]),16),relays:_[1]?_[1].map(T=>Fs.decode(T)):[]}}}case"nrelay":{let _=Uc(b);if(!((d=_[0])!=null&&d[0]))throw new Error("missing TLV 0 for nrelay");return{type:"nrelay",data:Fs.decode(_[0][0])}}case"nsec":return{type:h,data:b};case"npub":case"note":return{type:h,data:et(b)};default:throw new Error(`unknown prefix ${h}`)}}function Uc(e){let t={},n=e;for(;n.length>0;){let r=n[0],o=n[1],i=n.slice(2,2+o);if(n=n.slice(2+o),i.lengthnew RegExp(`\\b${ek.source}\\b`,"g");function*tk(e){let t=e.matchAll(gw());for(let n of t)try{let[r,o]=n;yield{uri:r,value:o,decoded:pw(o),start:n.index,end:n.index+r.length}}catch{}}function nk(e,t){return e.replaceAll(gw(),(n,r)=>t({uri:n,value:r,decoded:pw(r)}))}var rk=typeof globalThis<"u"?globalThis:typeof window<"u"?window:typeof global<"u"?global:typeof self<"u"?self:{};function ok(e){return e&&e.__esModule&&Object.prototype.hasOwnProperty.call(e,"default")?e.default:e}var mw={exports:{}};(function(e,t){(function(n,r){e.exports=r()})(rk,function(){function n(u){return u.replace(/\\([(){}[\]#*+\-.!_\\])/g,function(d,h){return String.fromCharCode(1,o.indexOf(h)+i)}).replace(/(\*\*|__|~~)(\S(?:[\s\S]*?\S)?)\1/g,function(d,h,m){return h==="~~"?""+m+"":""+m+""}).replace(/(\n|^|\W)([_\*])(\S(?:[\s\S]*?\S)?)\2(\W|$|\n)/g,function(d,h,m,b,_){return h+""+b+""+_}).replace(/(!?)\[([^\]<>]+)\]\((\+?)([^ \)<>]+)(?: "([^\(\)\"]+)")?\)/g,function(d,h,m,b,_,T){var A=T?' title="'+T+'"':"";return h?''+m+'":(b&&(A+=' target="_blank"'),'"+m+"")})}function r(u){return u.replace(/\x01([\x0f-\x1c])/g,function(d,h){return o.charAt(h.charCodeAt(0)-i)})}var o="\\[!]#{()}*+-._",i=16,a=function(u){return u.replace(/.+(?:\n.+)*/g,function(d){var h=/^\s{4}([^]*)$/.exec(d);if(h)return"
"+h[1].replace(/\n    /g,`
-`)+"
";for(var m,b=[],_=n(d).split(` -`),T=0,A=_.length;A>T;++T){var k=_[T],I=/^\s{0,3}(\#{1,6})\s+(.*?)\s*#*\s*$/.exec(k);if(I)b.push(m=[I[2],"h",I[1].length]);else{var O=/^(\s*)(?:[-*]|(\d[.)])) (.+)$/.exec(k);O?b.push(m=[O[3],O[2]?"ol":"ul",O[1].length]):/^\s{0,3}([-])(\s*\1){2,}\s*$/.test(k)?b.push(m=["","hr"]):m&&m[1]!=="hr"&&m[1]!=="h"?m[0]+=` -`+k:b.push(m=[k,"p",""])}}var L="",f=[];for(T=0,A=b.length;A>T;++T){m=b[T];var p=m[0],w=m[1],v=m[2];if(w==="ul"||w==="ol")!f.length||v>f[0][1]?(f.unshift([w,v]),L+="<"+f[0][0]+">
  • "+p):f.length>1&&v<=f[1][1]?(L+="
  • ",--T):L+="
  • "+p;else{for(;f.length;)L+="
  • ";L+=w==="hr"?"
    ":"<"+w+v+a.headAttrs(v,p)+">"+p+""}}for(;f.length;)L+="";return r(L)})};return a.href=function(u){return u},a.headAttrs=function(u,d){return""},a})})(mw);var ik=mw.exports,sk=ok(ik);function ak(e){return async()=>new Promise(t=>{setTimeout(t,e)})}function ck(e,{delay:t=void 0}={}){if(typeof t!="number"&&t!==void 0)throw new TypeError(`Expected \`interval\` to be of type \`number\` but received type \`${typeof t}\``);let n=t===void 0?async()=>{}:ak(t),r=[];return o=>{r.push(o),r.length===1&&(async()=>(await n(),e(r),r=[]))()}}var uk=(e,t)=>t.some(n=>e instanceof n),ab,cb;function lk(){return ab||(ab=[IDBDatabase,IDBObjectStore,IDBIndex,IDBCursor,IDBTransaction])}function dk(){return cb||(cb=[IDBCursor.prototype.advance,IDBCursor.prototype.continue,IDBCursor.prototype.continuePrimaryKey])}var bw=new WeakMap,qf=new WeakMap,ww=new WeakMap,_f=new WeakMap,ah=new WeakMap;function fk(e){let t=new Promise((n,r)=>{let o=()=>{e.removeEventListener("success",i),e.removeEventListener("error",a)},i=()=>{n(fo(e.result)),o()},a=()=>{r(e.error),o()};e.addEventListener("success",i),e.addEventListener("error",a)});return t.then(n=>{n instanceof IDBCursor&&bw.set(n,e)}).catch(()=>{}),ah.set(t,e),t}function hk(e){if(qf.has(e))return;let t=new Promise((n,r)=>{let o=()=>{e.removeEventListener("complete",i),e.removeEventListener("error",a),e.removeEventListener("abort",a)},i=()=>{n(),o()},a=()=>{r(e.error||new DOMException("AbortError","AbortError")),o()};e.addEventListener("complete",i),e.addEventListener("error",a),e.addEventListener("abort",a)});qf.set(e,t)}var Wf={get(e,t,n){if(e instanceof IDBTransaction){if(t==="done")return qf.get(e);if(t==="objectStoreNames")return e.objectStoreNames||ww.get(e);if(t==="store")return n.objectStoreNames[1]?void 0:n.objectStore(n.objectStoreNames[0])}return fo(e[t])},set(e,t,n){return e[t]=n,!0},has(e,t){return e instanceof IDBTransaction&&(t==="done"||t==="store")?!0:t in e}};function pk(e){Wf=e(Wf)}function gk(e){return e===IDBDatabase.prototype.transaction&&!("objectStoreNames"in IDBTransaction.prototype)?function(t,...n){let r=e.call(Ef(this),t,...n);return ww.set(r,t.sort?t.sort():[t]),fo(r)}:dk().includes(e)?function(...t){return e.apply(Ef(this),t),fo(bw.get(this))}:function(...t){return fo(e.apply(Ef(this),t))}}function mk(e){return typeof e=="function"?gk(e):(e instanceof IDBTransaction&&hk(e),uk(e,lk())?new Proxy(e,Wf):e)}function fo(e){if(e instanceof IDBRequest)return fk(e);if(_f.has(e))return _f.get(e);let t=mk(e);return t!==e&&(_f.set(e,t),ah.set(t,e)),t}var Ef=e=>ah.get(e);function bk(e,t,{blocked:n,upgrade:r,blocking:o,terminated:i}={}){let a=indexedDB.open(e,t),u=fo(a);return r&&a.addEventListener("upgradeneeded",d=>{r(fo(a.result),d.oldVersion,d.newVersion,fo(a.transaction),d)}),n&&a.addEventListener("blocked",d=>n(d.oldVersion,d.newVersion,d)),u.then(d=>{i&&d.addEventListener("close",()=>i()),o&&d.addEventListener("versionchange",h=>o(h.oldVersion,h.newVersion,h))}).catch(()=>{}),u}var wk=["get","getKey","getAll","getAllKeys","count"],yk=["put","add","delete","clear"],xf=new Map;function ub(e,t){if(!(e instanceof IDBDatabase&&!(t in e)&&typeof t=="string"))return;if(xf.get(t))return xf.get(t);let n=t.replace(/FromIndex$/,""),r=t!==n,o=yk.includes(n);if(!(n in(r?IDBIndex:IDBObjectStore).prototype)||!(o||wk.includes(n)))return;let i=async function(a,...u){let d=this.transaction(a,o?"readwrite":"readonly"),h=d.store;return r&&(h=h.index(u.shift())),(await Promise.all([h[n](...u),o&&d.done]))[0]};return xf.set(t,i),i}pk(e=>({...e,get:(t,n,r)=>ub(t,n)||e.get(t,n,r),has:(t,n)=>!!ub(t,n)||e.has(t,n)}));function vk(e){let t={reply:void 0,root:void 0,mentions:[],profiles:[]},n=[];for(let r of e.tags)r[0]==="e"&&r[1]&&n.push(r),r[0]==="p"&&r[1]&&t.profiles.push({pubkey:r[1],relays:r[2]?[r[2]]:[]});for(let r=0;r{if(t<=1){let i=[...e.objectStoreNames];await Promise.all(i.map(a=>e.deleteObjectStore(a)))}let n=e.createObjectStore("events",{keyPath:Vs.events});n.createIndex("a","a"),n.createIndex("ro","ro"),n.createIndex("r","r"),n.createIndex("d","d"),n.createIndex("k","k"),e.createObjectStore("aggregates",{keyPath:Vs.aggregates}),e.createObjectStore("profiles",{keyPath:Vs.profiles}).createIndex("l","l"),e.createObjectStore("relays",{keyPath:Vs.relays}).createIndex("a","a")},nu=e=>{var t,n;let r=vk(e),o=e.tags.find(k=>k[0]==="a"),i=o&&o[1],a=o&&o[3]==="mention",u=e.tags.find(k=>k[0]==="r"),d=u&&u[1],h=e.tags.filter(k=>k[0]==="t"),m=[...new Set(h.map(k=>k[1]))],b=e.tags.find(k=>k[0]==="d"),_=b&&b[1],T=e.tags.find(k=>k[0]==="title"),A=T&&T[1];return{id:e.id??"",k:e.kind,c:e.content,ts:e.created_at,pk:e.pubkey,ro:(t=r.root)==null?void 0:t.id,re:(n=r.reply)==null?void 0:n.id,me:r.mentions.map(k=>k.id),p:r.profiles.map(k=>k.pubkey),a:i,am:a,r:d,t:m,d:_,tl:A}},Ek=()=>({}),Pi=Ek(),lb=!0,db,hu=async()=>{if(lb!==!1)try{return db||(db=await bk("zapthreads",2,{upgrade:_k}))}catch{lb=!1}},zc=e=>{let t=We(lo(e,()=>{let[n,r,o]=e(),i=()=>Di(n,r,o),[a,{mutate:u}]=Eb(()=>qs[n],i,{initialValue:[],storage:yw});return Di(n,r,o).then(u),a}));return()=>t()()},fb=e=>{let t=We(lo(e,()=>{let[n,r,o]=e(),i=()=>Ii(n,r,o),[a,{mutate:u}]=Eb(()=>qs[n],i,{initialValue:void 0,storage:yw});return Ii(n,r,o).then(u),a}));return()=>t()()},Di=async(e,t,n)=>{let r=await hu();if(!r){let o=Pi[e];if(o){if(n){let i=Array.isArray(t)?t:[t];return Object.values(o).filter(a=>i.includes(a[n.index]))}return Object.values(o)}return[]}if(t&&n){if(Array.isArray(t)){let o=t.map(a=>r.getAllFromIndex(e,n.index,a));return(await Promise.all(o)).flat()}return r.getAllFromIndex(e,n.index,t)}return r.getAll(e)},Ii=async(e,t,n)=>{let r=await hu();if(!r){let o=Pi[e];if(o){if(n)return Object.values(o).find(a=>a[n.index]===t);let i=(t.lower?t.lower:t).toString();return o[i]}return}return n?r.getFromIndex(e,n.index,t):r.get(e,t)},kf={},hb=(e,t)=>{Pi[e]??(Pi[e]={});for(let n of t){let r=Vs[e];r=Array.isArray(r)?r:[r];let o=r.map(i=>n[i]).join(",");Pi[e][o]=n}},xn=async(e,t,n={immediate:!1})=>{let r=await hu();if(n.immediate){r?r.put(e,t):hb(e,[t]),qs[e]=+new Date;return}kf[e]||(kf[e]=ck(async o=>{if(!r){hb(e,o),qs[e]=+new Date;return}let i=r.transaction(e,"readwrite");await Promise.all([...o.map(u=>i.store.put(u)),i.done])&&(qs[e]=+new Date)},{delay:96})),kf[e](t)},xk=async()=>{let e=await hu();if(!e){Pi={};return}let t=[...e.objectStoreNames];await Promise.all(t.map(n=>e.clear(n)))},qs=ih({});function yw(e){let[t,n]=R4({value:e});return[()=>t.value,r=>{let o=Ar(t.value);return typeof r=="function"&&(r=r(o)),n("value",M4(r)),t.value}]}var vw=async(e,t,n)=>{let r=+new Date,o=216e5,i=[...new Set(e)].filter(u=>{let d=n.find(h=>h.pk===u);return!(d?.l&&d.l>r-o)}).filter(u=>!!u);if(i.length===0)return;let a=await Ci.querySync(t,{kinds:[0],authors:i});for(let u of i){let d=a.find(h=>h.pubkey===u);if(d){let h=JSON.parse(d.content),m=d.pubkey,b={pk:m,ts:d.created_at,i:h.image||h.picture,n:h.displayName||h.display_name||h.name},_=n.find(T=>T.pk===m);!_||!_?.n||_.ts{let r=(await Di("relays",e.value,{index:"a"})).filter(o=>t.includes(o.n)).map(o=>o.l);return r.length>0?Math.min(...r)+1:0},Sk=async(e,t)=>{let n={};for(let o of t){let i=Ci.seenOn.get(o.id);if(i)for(let a of i)o.ts>(n[a.url]||0)&&(n[a.url]=o.ts)}let r=await Di("relays",e.value,{index:"a"});for(let o in n){let i=r.find(a=>a.n===o);i?n[o]>i.l&&(i.l=n[o],xn("relays",i)):xn("relays",{n:o,a:e.value,l:n[o]})}},Ak=new RegExp("(?<=^|\\s)https?:\\/\\/[-a-zA-Z0-9@:%._\\+~#=]{1,256}\\.[a-zA-Z0-9()]{1,6}\\b([-a-zA-Z0-9()@:%_\\+.~#?&\\/\\/=]*)","gi"),Tk=/(\S*(?:png|jpg|jpeg|gif|webp))/gi,$k=new RegExp("(?<=^|\\s)@?((naddr|npub|nevent|note)[a-z0-9]{20,})","g"),Bk=/\`(.*?)\`/g,Lk=/\B\#([a-zA-Z0-9]+\b)(?!;)/g,_w=(e,t,n=[])=>{let r=e.c,o=t.urlPrefixes,i=t.profiles;r=r.replace(Ak,u=>u.match(Tk)?`![image](${u})`:`[${u}](${u})`);let a=[...new Set(e.t)];if(a.length>0){let u=new RegExp(`(^|\\s)\\#(${a.join("|")})`,"gi");r=r.replaceAll(u,`$1[#$2](${o.tag}$2)`)}return r=r.replaceAll($k,"nostr:$1"),r=nk(r,({decoded:u,value:d})=>{switch(u.type){case"nprofile":let h=i().find(k=>k.pk===u.data.pubkey);return`[@${h?.n||Qo(d)}](${o.nprofile}${d})`;case"npub":let b=i().find(k=>k.pk===u.data);return`[@${b?.n||Qo(d)}](${o.npub}${d})`;case"note":return`[@${Qo(d)}](${o.note}${d})`;case"naddr":let T=u.data,A=n.find(k=>k.pk===T.pubkey&&k.d===T.identifier);return A&&A.tl?`[${A.tl}](${o.naddr}${d})`:`[@${Qo(d)}](${o.naddr}${d})`;case"nevent":return`[@${Qo(d)}](${o.nevent}${d})`;default:return d}}),r=r.replaceAll(Bk,"$1"),sk(r.trim())},Ck=e=>{let t=[],n=tk(e);for(let i of n){if(i.decoded.type==="npub"&&t.push(["p",i.decoded.data]),i.decoded.type==="naddr"){let a=i.decoded.data;t.push(["a",`${a.kind}:${a.pubkey}:${a.identifier}`,"","mention"])}i.decoded.type==="nevent"&&t.push(["e",i.decoded.data.id]),i.decoded.type==="note"&&t.push(["e",i.decoded.data])}let r=e.matchAll(Lk),o=new Set([...r].map(i=>i[1].toLowerCase()));for(let i of o)t.push(["t",i]);return t},Pk=(e="")=>{let t={naddr:"https://nostr.com/",npub:"https://nostr.com/",nprofile:"https://nostr.com/",nevent:"https://nostr.com/",note:"https://nostr.com/",tag:"https://snort.social/t/"};for(let n of e.split(",")){let[r,o]=n.split(":");o&&(t[r]=`https://${o}`)}return t},Qo=e=>e.substring(0,8)+"..."+e.substring(e.length-4),Fc=e=>e.sort((t,n)=>(t.ts||0)>=(n.ts||0)?-1:1),Un=20,jc='data:image/svg+xml;utf-8,',Ik=e=>{let t=new Date,n=Math.floor((t.getTime()-e)/1e3);if(n<60)return"now";if(n<3600){let r=Math.floor(n/60);return`${r} minute${r===1?"":"s"} ago`}if(n<=86400){let r=Math.floor(n/3600);return`${r} hour${r===1?"":"s"} ago`}if(n<=604800){let r=Math.floor(n/86400);return`${r} day${r===1?"":"s"} ago`}if(n>604800){let r=new Date(e),o=r.toLocaleDateString("en-us",{day:"numeric",month:"long"}),i=r.getFullYear()===t.getFullYear()?"":" "+r.getFullYear();return"on "+o+i}return""},Nk=e=>e<1e4?e.toString():e<1e6?Math.round(e/1e3)+"k":Math.round(e/1e6)+"M",ch=e=>e.children.reduce((t,n)=>t+ch(n),e.children.length),Ok=/\/+$/,Rk=(e,t=!0)=>{let n=new URL(e);return n.hash="",t&&(n.pathname=n.pathname.replace(Ok,"")),n.toString()},Ew=(e,t)=>{let n=e.map(o=>({...o,children:[]})),r=new Set(n.filter(o=>{if(t){let i=t.id===(o.re||o.ro);return i&&(o.parent=t),i}return!n.find(i=>i.id===(o.re||o.ro))}));n=n.filter(o=>!r.has(o));for(let o of r)o.children.push(...Ew(n,o));return[...r]},Ai=Symbol("verified"),Uk=e=>e instanceof Object;function zk(e){if(!Uk(e)||typeof e.kind!="number"||typeof e.content!="string"||typeof e.created_at!="number"||typeof e.pubkey!="string"||!e.pubkey.match(/^[a-f0-9]{64}$/)||!Array.isArray(e.tags))return!1;for(let t=0;t{Ni(()=>{let t=e();t&&setTimeout(()=>t.focus())})},Ti=Symbol("verified"),Vk=e=>e instanceof Object;function qk(e){if(!Vk(e)||typeof e.kind!="number"||typeof e.content!="string"||typeof e.created_at!="number"||typeof e.pubkey!="string"||!e.pubkey.match(/^[a-f0-9]{64}$/)||!Array.isArray(e.tags))return!1;for(let t=0;tt.id.startsWith(n))||e.kinds&&e.kinds.indexOf(t.kind)===-1||e.authors&&e.authors.indexOf(t.pubkey)===-1&&!e.authors.some(n=>t.pubkey.startsWith(n)))return!1;for(let n in e)if(n[0]==="#"){let r=n.slice(1),o=e[`#${r}`];if(o&&!t.tags.find(([i,a])=>i===n.slice(1)&&o.indexOf(a)!==-1))return!1}return!(e.since&&t.created_ate.until)}function t6(e,t){for(let n=0;n{let t=new MessageChannel,n=()=>{t.port1.removeEventListener("message",n),e()};t.port1.addEventListener("message",n),t.port2.postMessage(0),t.port1.start()})}var Sw;try{Sw=WebSocket}catch{}var Aw=class{constructor(e,t){we(this,"url"),we(this,"_connected",!1),we(this,"onclose",null),we(this,"onnotice",n=>console.debug(`NOTICE from ${this.url}: ${n}`)),we(this,"_onauth",null),we(this,"baseEoseTimeout",4400),we(this,"connectionTimeout",4400),we(this,"openSubs",new Map),we(this,"connectionTimeoutHandle"),we(this,"connectionPromise"),we(this,"openCountRequests",new Map),we(this,"openEventPublishes",new Map),we(this,"ws"),we(this,"incomingMessageQueue",new Gk),we(this,"queueRunning",!1),we(this,"challenge"),we(this,"serial",0),we(this,"verifyEvent"),this.url=Qk(e),this.verifyEvent=t.verifyEvent}static async connect(e,t){let n=new Aw(e,t);return await n.connect(),n}closeAllSubscriptions(e){for(let[t,n]of this.openSubs)n.close(e);this.openSubs.clear();for(let[t,n]of this.openEventPublishes)n.reject(new Error(e));this.openEventPublishes.clear();for(let[t,n]of this.openCountRequests)n.reject(new Error(e));this.openCountRequests.clear()}get connected(){return this._connected}async connect(){return this.connectionPromise?this.connectionPromise:(this.challenge=void 0,this.connectionPromise=new Promise((e,t)=>{this.connectionTimeoutHandle=setTimeout(()=>{var n;t("connection timed out"),this.connectionPromise=void 0,(n=this.onclose)==null||n.call(this),this.closeAllSubscriptions("relay connection timed out")},this.connectionTimeout);try{this.ws=new Sw(this.url)}catch(n){t(n);return}this.ws.onopen=()=>{clearTimeout(this.connectionTimeoutHandle),this._connected=!0,e()},this.ws.onerror=n=>{var r;t(n.message),this._connected&&(this._connected=!1,this.connectionPromise=void 0,(r=this.onclose)==null||r.call(this),this.closeAllSubscriptions("relay connection errored"))},this.ws.onclose=async()=>{var n;this._connected&&(this._connected=!1,this.connectionPromise=void 0,(n=this.onclose)==null||n.call(this),this.closeAllSubscriptions("relay connection closed"))},this.ws.onmessage=this._onmessage.bind(this)}),this.connectionPromise)}async runQueue(){for(this.queueRunning=!0;this.handleNext()!==!1;)await i6();this.queueRunning=!1}handleNext(){var e,t,n;let r=this.incomingMessageQueue.dequeue();if(!r)return!1;let o=r6(r);if(o){let i=this.openSubs.get(o);if(!i)return;let a=n6(r,"id"),u=(e=i.alreadyHaveEvent)==null?void 0:e.call(i,a);if((t=i.receivedEvent)==null||t.call(i,this,a),u)return}try{let i=JSON.parse(r);switch(i[0]){case"EVENT":{let a=this.openSubs.get(i[1]),u=i[2];this.verifyEvent(u)&&t6(a.filters,u)&&a.onevent(u);return}case"COUNT":{let a=i[1],u=i[2],d=this.openCountRequests.get(a);d&&(d.resolve(u.count),this.openCountRequests.delete(a));return}case"EOSE":{let a=this.openSubs.get(i[1]);if(!a)return;a.receivedEose();return}case"OK":{let a=i[1],u=i[2],d=i[3],h=this.openEventPublishes.get(a);u?h.resolve(d):h.reject(new Error(d)),this.openEventPublishes.delete(a);return}case"CLOSED":{let a=i[1],u=this.openSubs.get(a);if(!u)return;u.closed=!0,u.close(i[2]);return}case"NOTICE":this.onnotice(i[1]);return;case"AUTH":{this.challenge=i[1],(n=this._onauth)==null||n.call(this,i[1]);return}}}catch{return}}async send(e){if(!this.connectionPromise)throw new Error("sending on closed connection");this.connectionPromise.then(()=>{var t;(t=this.ws)==null||t.send(e)})}async auth(e){if(!this.challenge)throw new Error("can't perform auth, no challenge was received");let t=await e(o6(this.url,this.challenge)),n=new Promise((r,o)=>{this.openEventPublishes.set(t.id,{resolve:r,reject:o})});return this.send('["AUTH",'+JSON.stringify(t)+"]"),n}async publish(e){let t=new Promise((n,r)=>{this.openEventPublishes.set(e.id,{resolve:n,reject:r})});return this.send('["EVENT",'+JSON.stringify(e)+"]"),t}async count(e,t){this.serial++;let n=t?.id||"count:"+this.serial,r=new Promise((o,i)=>{this.openCountRequests.set(n,{resolve:o,reject:i})});return this.send('["COUNT","'+n+'",'+JSON.stringify(e)+"]"),r}subscribe(e,t){let n=this.prepareSubscription(e,t);return n.fire(),n}prepareSubscription(e,t){this.serial++;let n=t.id||"sub:"+this.serial,r=new s6(this,n,e,t);return this.openSubs.set(n,r),r}close(){var e;this.closeAllSubscriptions("relay connection closed by us"),this._connected=!1,(e=this.ws)==null||e.close()}_onmessage(e){this.incomingMessageQueue.enqueue(e.data),this.queueRunning||this.runQueue()}},s6=class{constructor(e,t,n,r){we(this,"relay"),we(this,"id"),we(this,"closed",!1),we(this,"eosed",!1),we(this,"filters"),we(this,"alreadyHaveEvent"),we(this,"receivedEvent"),we(this,"onevent"),we(this,"oneose"),we(this,"onclose"),we(this,"eoseTimeout"),we(this,"eoseTimeoutHandle"),this.relay=e,this.filters=n,this.id=t,this.alreadyHaveEvent=r.alreadyHaveEvent,this.receivedEvent=r.receivedEvent,this.eoseTimeout=r.eoseTimeout||e.baseEoseTimeout,this.oneose=r.oneose,this.onclose=r.onclose,this.onevent=r.onevent||(o=>{console.warn(`onevent() callback not defined for subscription '${this.id}' in relay ${this.relay.url}. event received:`,o)})}fire(){this.relay.send('["REQ","'+this.id+'",'+JSON.stringify(this.filters).substring(1)),this.eoseTimeoutHandle=setTimeout(this.receivedEose.bind(this),this.eoseTimeout)}receivedEose(){var e;this.eosed||(clearTimeout(this.eoseTimeoutHandle),this.eosed=!0,(e=this.oneose)==null||e.call(this))}close(e="closed by caller"){var t;!this.closed&&this.relay.connected&&(this.relay.send('["CLOSE",'+JSON.stringify(this.id)+"]"),this.closed=!0),this.relay.openSubs.delete(this.id),(t=this.onclose)==null||t.call(this,e)}},Tw=class extends Aw{constructor(e){super(e,{verifyEvent:Jk})}static async connect(e){let t=new Tw(e);return await t.connect(),t}};new TextDecoder("utf-8");new TextEncoder;function a6(e){e.indexOf("://")===-1&&(e="wss://"+e);let t=new URL(e);return t.pathname=t.pathname.replace(/\/+/g,"/"),t.pathname.endsWith("/")&&(t.pathname=t.pathname.slice(0,-1)),(t.port==="80"&&t.protocol==="ws:"||t.port==="443"&&t.protocol==="wss:")&&(t.port=""),t.searchParams.sort(),t.hash="",t.toString()}var c6=He("
    "),u6=He("
    "),l6=He("Publishing is disabled"),d6=He("Error: "),f6=He(''),h6=He("
  • likes"),b6=He("
  • sats"),w6=He("
      "),$w=e=>{let[t,n]=_t(""),[r,o]=_t(!1),[i,a]=_t(),[u,d]=_t(""),h=()=>xe.anchor,m=xe.profiles,b=()=>xe.relays,_=async()=>{if(!window.nostr){A("Error: No NIP-07 extension!");return}let L=await window.nostr.getPublicKey();Kt.internal={pk:L,signEvent:async f=>window.nostr.signEvent(f)},d(""),Kt.active=Kt.internal};Ni(async()=>{if(Kt.active){let L=Kt.active.pk,f=m().find(p=>p.pk===L);f||(f={pk:L,l:0,ts:0},await xn("profiles",f)),a(f),vw([L],b(),m())}else a()});let T=async(L,f)=>{var p;o(!1),n(""),d(f??""),await xn("events",nu(L),{immediate:!0}),(p=e.onDone)==null||p.call(globalThis)},A=L=>{o(!1),d(`Error: ${L}`)},k=async L=>{let f;if(L)f=Kt.active;else{if(!Kt.anonymous){let P=jk();Kt.anonymous={pk:xw(P),signEvent:async M=>({sig:kw(M,P).sig})}}f=Kt.anonymous}if(!f?.signEvent){A("Error: User has no signer!");return}let p=t().trim();if(!p)return;let w={kind:1,created_at:Math.round(Date.now()/1e3),content:p,pubkey:f.pk,tags:Ck(p)};if(xe.anchorAuthor!==w.pubkey&&w.tags.push(["p",xe.anchorAuthor]),xe.externalAuthor)try{let P=Dc(xe.externalAuthor).data;w.tags.push(["p",P])}catch{}if(e.replyTo){let P=await Ii("events",IDBKeyRange.only(e.replyTo));P&&(w.tags.push(["e",P.ro,"","root"]),P.pk!==w.pubkey&&w.tags.push(["p",P.pk])),w.tags.push(["e",e.replyTo,"","reply"])}else{let P=xe.version||xe.rootEventIds[0];if(P)w.tags.push(["e",P,"","root"]);else if(h().type==="http"){let M=a6(h().value),N={pubkey:f.pk,created_at:Math.round(Date.now()/1e3),kind:8812,tags:[["r",M]],content:`Comments on ${M} \u21B4`},B={id:Ws(N),...N,...await f.signEvent(N)};xn("events",nu(B)),xe.disableFeatures.includes("publish")?console.log("Publishing root event disabled",B):Ci.publish(b(),B),xe.filter={"#e":[B.id]},w.tags.push(["e",B.id,"","root"])}}h().type==="naddr"&&w.tags.push(["a",h().value,"","root"]);let v=Ws(w),S=await f.signEvent(w),$={id:v,...w,...S};if(o(!0),console.log(JSON.stringify($,null,2)),xe.disableFeatures.includes("publish"))setTimeout(()=>T($),1e3);else{let P=[];for(let M of b())try{await(await Tw.connect(M)).publish($)}catch(N){console.error(N),P.push(M)}if(P.length===b().length)A("Error: Your comment was not published to any relay");else{let M=`Published to ${P.length}/${b().length} relays (see console for more info)`,N=P.length>0?M:void 0;T($,N)}P.length=0}},I=e.replyTo!==void 0,O;return Hk(()=>I&&O),(()=>{let L=u6(),f=L.firstChild,p=f.nextSibling;f.addEventListener("change",v=>n(v.target.value));let w=O;return typeof w=="function"?Bb(w,f):O=f,f.autofocus=I,Le(p,(()=>{let v=We(()=>!!xe.disableFeatures.includes("publish"));return()=>v()&&l6()})(),null),Le(p,(()=>{let v=We(()=>!!u());return()=>v()&&(()=>{let S=d6();return S.firstChild,Le(S,u,null),S})()})(),null),Le(p,Rn(Qc,{get when(){return!r()},get fallback(){return f6()},get children(){let v=c6(),S=v.firstChild;return En(()=>{var $;return Ht(S,"src",(($=i())==null?void 0:$.i)||jc)}),v}}),null),Le(p,(()=>{let v=We(()=>!!i());return()=>v()&&(()=>{let S=h6();return S.firstChild,S.$$click=()=>k(i()),Le(S,()=>i().n||Qo(fw(i().pk)),null),En(()=>S.disabled=r()),S})()})(),null),Le(p,(()=>{let v=We(()=>!i()&&!xe.disableFeatures.includes("replyAnonymously"));return()=>v()&&(()=>{let S=p6();return S.$$click=()=>k(),En(()=>S.disabled=r()),S})()})(),null),Le(p,(()=>{let v=We(()=>!i());return()=>v()&&(()=>{let S=g6();return S.$$click=()=>_(),S})()})(),null),En(v=>{let S=r(),$=xe.replyPlaceholder||"Add your comment...";return S!==v._v$&&(f.disabled=v._v$=S),$!==v._v$2&&Ht(f,"placeholder",v._v$2=$),v},{_v$:void 0,_v$2:void 0}),En(()=>f.value=t()),L})()},y6=()=>{let e=()=>xe.anchor,t=fb(()=>["aggregates",IDBKeyRange.only([e().value,9735])]),n=fb(()=>["aggregates",IDBKeyRange.only([e().value,7])]),r=()=>{var i;return((i=t())==null?void 0:i.sum)??0},o=()=>{var i;return((i=n())==null?void 0:i.ids.length)??0};return(()=>{let i=w6(),a=i.firstChild,u=a.firstChild;return Le(u,Rn(Qc,{get when(){return!xe.disableFeatures.includes("likes")},get children(){let d=m6(),h=d.firstChild,m=h.firstChild;return Le(d,q6,h),Le(h,o,m),d}}),null),Le(u,Rn(Qc,{get when(){return!xe.disableFeatures.includes("zaps")},get children(){let d=b6(),h=d.firstChild,m=h.firstChild;return Le(d,V6,h),Le(h,()=>Nk(r()),m),d}}),null),Le(a,Rn($w,{}),null),i})()};Kf(["click"]);function v6(e){return e!==null&&(typeof e=="object"||typeof e=="function")}function pb(e,...t){return typeof e=="function"?e(...t):e}function _6(e){let t={...e},n={...e},r={},o=a=>{let u=r[a];if(!u){if(!Oi())return t[a];r[a]=u=_t(t[a],{internal:!0}),delete t[a]}return u[0]()};for(let a in e)Object.defineProperty(n,a,{get:()=>o(a),enumerable:!0});let i=(a,u)=>{let d=r[a];if(d)return d[1](u);a in t&&(t[a]=pb(u,[t[a]]))};return[n,(a,u)=>{if(v6(a)){let d=kn(()=>Object.entries(pb(a,n)));Bi(()=>{for(let[h,m]of d)i(h,()=>m)})}else i(a,u);return n}]}var Bw={width:null,height:null};function Af(e){if(!e)return{...Bw};let{width:t,height:n}=e.getBoundingClientRect();return{width:t,height:n}}function E6(e){let t=typeof e=="function",[n,r]=_6(t?Bw:Af(e)),o=new ResizeObserver(([i])=>r(Af(i.target)));return Li(()=>o.disconnect()),t?Ni(()=>{let i=e();i&&(r(Af(i)),o.observe(i),Li(()=>o.unobserve(i)))}):(o.observe(e),Li(()=>o.unobserve(e))),n}var x6=He("
      "),k6=He("
    • "),S6=He("
      • ed